Events related to the load are dispatched by the LoaderInfo object\r\n * referenced by the contentLoaderInfo property of the Loader\r\n * object. The contentLoaderInfo property is set to a valid\r\n * LoaderInfo object, even before the content is loaded, so that you can add\r\n * event listeners to the object prior to the load.
To detect uncaught errors that happen in a loaded SWF, use the\r\n * Loader.uncaughtErrorEvents property, not the\r\n * Loader.contentLoaderInfo.uncaughtErrorEvents property.
ParserEvent.PARSE_ERROR\r\n * @param event\r\n */\r\n Loader.prototype.onParseError = function (event) {\r\n var handled;\r\n var isDependency = (this._currentDependency != this._baseDependency);\r\n var loader = event.target;\r\n this.removeEventListeners(loader);\r\n if (this.hasEventListener(ParserEvent.PARSE_ERROR)) {\r\n this.dispatchEvent(event);\r\n handled = true;\r\n }\r\n else {\r\n // TODO: Consider not doing this even when Loader does\r\n // have it's own LOAD_ERROR listener\r\n var i, len = this._parseErrorHandlers.length;\r\n for (i = 0; i < len; i++)\r\n if (!handled)\r\n handled = this._parseErrorHandlers[i](event);\r\n }\r\n if (handled) {\r\n this.retrieveNext();\r\n }\r\n else {\r\n // Error event was not handled by listeners directly on Loader or\r\n // on any of the subscribed loaders (in the list of error handlers.)\r\n throw new Error(event.message);\r\n }\r\n };\r\n Loader.prototype.onAssetComplete = function (event) {\r\n // Add loaded asset to list of assets retrieved as part\r\n // of the current dependency. This list will be inspected\r\n // by the parent parser when dependency is resolved\r\n if (this._currentDependency)\r\n this._currentDependency.assets.push(event.asset);\r\n event.asset.resetAssetPath(event.asset.name, this._namespace);\r\n if (!this._currentDependency.suppresAssetEvents)\r\n this.dispatchEvent(event);\r\n };\r\n Loader.prototype.onReadyForDependencies = function (event) {\r\n var parser = event.target;\r\n if (this._context && !this._context.includeDependencies)\r\n parser._iResumeParsing();\r\n else\r\n this.retrieveParserDependencies();\r\n };\r\n Loader.prototype.onLoadProgress = function (event) {\r\n this.dispatchEvent(event);\r\n };\r\n /**\r\n * Called when a single dependency was parsed, and pushes further dependencies onto the stack.\r\n * @param event\r\n */\r\n Loader.prototype.onLoadComplete = function (event) {\r\n var loader = event.urlLoader;\r\n this.removeEventListeners(loader);\r\n // Resolve this dependency\r\n this._currentDependency._iSetData(loader.data);\r\n if (this._currentDependency.retrieveAsRawData) {\r\n // No need to parse this data, which should be returned as is\r\n this.resolveParserDependencies();\r\n }\r\n else {\r\n this.parseDependency(this._currentDependency);\r\n }\r\n };\r\n /**\r\n * Called when parsing is complete.\r\n */\r\n Loader.prototype.onParseComplete = function (event) {\r\n var parser = event.target;\r\n parser.removeEventListener(ParserEvent.READY_FOR_DEPENDENCIES, this._onReadyForDependenciesDelegate);\r\n parser.removeEventListener(ParserEvent.PARSE_COMPLETE, this._onParseCompleteDelegate);\r\n parser.removeEventListener(ParserEvent.PARSE_ERROR, this._onParseErrorDelegate);\r\n parser.removeEventListener(AssetEvent.TEXTURE_SIZE_ERROR, this._onTextureSizeErrorDelegate);\r\n parser.removeEventListener(AssetEvent.ASSET_COMPLETE, this._onAssetCompleteDelegate);\r\n this.resolveParserDependencies();\r\n };\r\n /**\r\n * Called when an image is too large or it's dimensions are not a power of 2\r\n * @param event\r\n */\r\n Loader.prototype.onTextureSizeError = function (event) {\r\n event.asset.name = this._currentDependency.resolveName(event.asset);\r\n this.dispatchEvent(event);\r\n };\r\n Loader.prototype.addEventListeners = function (loader) {\r\n loader.addEventListener(URLLoaderEvent.LOAD_PROGRESS, this._onLoadProgressDelegate);\r\n loader.addEventListener(URLLoaderEvent.LOAD_COMPLETE, this._onLoadCompleteDelegate);\r\n loader.addEventListener(URLLoaderEvent.LOAD_ERROR, this._onLoadErrorDelegate);\r\n };\r\n Loader.prototype.removeEventListeners = function (loader) {\r\n loader.removeEventListener(URLLoaderEvent.LOAD_PROGRESS, this._onLoadProgressDelegate);\r\n loader.removeEventListener(URLLoaderEvent.LOAD_COMPLETE, this._onLoadCompleteDelegate);\r\n loader.removeEventListener(URLLoaderEvent.LOAD_ERROR, this._onLoadErrorDelegate);\r\n };\r\n Loader.prototype.stop = function () {\r\n this.dispose();\r\n };\r\n Loader.prototype.dispose = function () {\r\n this._errorHandlers = null;\r\n this._parseErrorHandlers = null;\r\n this._context = null;\r\n this._stack = null;\r\n if (this._currentDependency && this._currentDependency._iLoader)\r\n this.removeEventListeners(this._currentDependency._iLoader);\r\n this._currentDependency = null;\r\n };\r\n /**\r\n * @private\r\n * This method is used by other loader classes (e.g. Loader3D and AssetLibraryBundle) to\r\n * add error event listeners to the Loader instance. This system is used instead of\r\n * the regular EventDispatcher system so that the AssetLibrary error handler can be sure\r\n * that if hasEventListener() returns true, it's client code that's listening for the\r\n * event. Secondly, functions added as error handler through this custom method are\r\n * expected to return a boolean value indicating whether the event was handled (i.e.\r\n * whether they in turn had any client code listening for the event.) If no handlers\r\n * return true, the Loader knows that the event wasn't handled and will throw an RTE.\r\n */\r\n Loader.prototype._iAddParseErrorHandler = function (handler) {\r\n if (this._parseErrorHandlers.indexOf(handler) < 0)\r\n this._parseErrorHandlers.push(handler);\r\n };\r\n Loader.prototype._iAddErrorHandler = function (handler) {\r\n if (this._errorHandlers.indexOf(handler) < 0)\r\n this._errorHandlers.push(handler);\r\n };\r\n /**\r\n * Guesses the parser to be used based on the file contents.\r\n * @param data The data to be parsed.\r\n * @param uri The url or id of the object to be parsed.\r\n * @return An instance of the guessed parser.\r\n */\r\n Loader.prototype.getParserFromData = function (data) {\r\n var len = Loader._parsers.length;\r\n // go in reverse order to allow application override of default parser added in away.proper\r\n for (var i = len - 1; i >= 0; i--)\r\n if (Loader._parsers[i].supportsData(data))\r\n return new Loader._parsers[i]();\r\n return null;\r\n };\r\n /**\r\n * Initiates parsing of the loaded dependency.\r\n *\r\n * @param The dependency to be parsed.\r\n */\r\n Loader.prototype.parseDependency = function (dependency) {\r\n var parser = dependency.parser;\r\n // If no parser has been defined, try to find one by letting\r\n // all plugged in parsers inspect the actual data.\r\n if (!parser)\r\n dependency._iSetParser(parser = this.getParserFromData(dependency.data));\r\n if (parser) {\r\n parser.addEventListener(ParserEvent.READY_FOR_DEPENDENCIES, this._onReadyForDependenciesDelegate);\r\n parser.addEventListener(ParserEvent.PARSE_COMPLETE, this._onParseCompleteDelegate);\r\n parser.addEventListener(ParserEvent.PARSE_ERROR, this._onParseErrorDelegate);\r\n parser.addEventListener(AssetEvent.TEXTURE_SIZE_ERROR, this._onTextureSizeErrorDelegate);\r\n parser.addEventListener(AssetEvent.ASSET_COMPLETE, this._onAssetCompleteDelegate);\r\n if (dependency.request && dependency.request.url)\r\n parser._iFileName = dependency.request.url;\r\n parser.materialMode = this._materialMode;\r\n parser.parseAsync(dependency.data);\r\n }\r\n else {\r\n var handled;\r\n var message = \"No parser defined. To enable all parsers for auto-detection, use Parsers.enableAllBundled()\";\r\n var event = new ParserEvent(ParserEvent.PARSE_ERROR, message);\r\n if (this.hasEventListener(ParserEvent.PARSE_ERROR)) {\r\n this.dispatchEvent(event);\r\n handled = true;\r\n }\r\n else {\r\n // TODO: Consider not doing this even when Loader does\r\n // have it's own LOAD_ERROR listener\r\n var i, len = this._parseErrorHandlers.length;\r\n for (i = 0; i < len; i++)\r\n if (!handled)\r\n handled = this._parseErrorHandlers[i](event);\r\n }\r\n if (handled) {\r\n this.retrieveNext();\r\n }\r\n else {\r\n // Error event was not handled by listeners directly on Loader or\r\n // on any of the subscribed loaders (in the list of error handlers.)\r\n throw new Error(message);\r\n }\r\n }\r\n };\r\n /**\r\n * Guesses the parser to be used based on the file extension.\r\n * @return An instance of the guessed parser.\r\n */\r\n Loader.prototype.getParserFromSuffix = function (url) {\r\n var fileExtension = this.getSuffix(url);\r\n var len = Loader._parsers.length;\r\n // go in reverse order to allow application override of default parser added in away.proper\r\n for (var i = len - 1; i >= 0; i--) {\r\n var parserClass = Loader._parsers[i];\r\n if (parserClass.supportsType(fileExtension))\r\n return new parserClass();\r\n }\r\n return null;\r\n };\r\n Loader.prototype.getSuffix = function (url) {\r\n // Get rid of query string if any and extract extension\r\n var base = (url.indexOf('?') > 0) ? url.split('?')[0] : url;\r\n return base.substr(base.lastIndexOf('.') + 1).toLowerCase();\r\n };\r\n return Loader;\r\n}(EventDispatcher));\r\nexport { Loader };\r\n// Image parser only parser that is added by default, to save file size.\r\nLoader._parsers = new Array();\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/library/Loader.js","/**\r\n * Enumaration export class for precedence when resolving naming conflicts in the library.\r\n *\r\n * @see away.library.AssetLibrary.conflictPrecedence\r\n * @see away.library.AssetLibrary.conflictStrategy\r\n * @see away.library.naming.ConflictStrategy\r\n */\r\nvar ConflictPrecedence = (function () {\r\n function ConflictPrecedence() {\r\n }\r\n return ConflictPrecedence;\r\n}());\r\nexport { ConflictPrecedence };\r\n/**\r\n * Signals that in a conflict, the previous owner of the conflicting name\r\n * should be favored (and keep it's name) and that the newly renamed asset\r\n * is reverted to a non-conflicting name.\r\n */\r\nConflictPrecedence.FAVOR_OLD = 'favorOld';\r\n/**\r\n * Signales that in a conflict, the newly renamed asset is favored (and keeps\r\n * it's newly defined name) and that the previous owner of that name gets\r\n * renamed to a non-conflicting name.\r\n */\r\nConflictPrecedence.FAVOR_NEW = 'favorNew';\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/library/ConflictPrecedence.js","import { ConflictPrecedence } from \"../library/ConflictPrecedence\";\r\nimport { AbstractMethodError } from \"../errors/AbstractMethodError\";\r\nimport { AssetEvent } from \"../events/AssetEvent\";\r\n/**\r\n * Abstract base export class for naming conflict resolution classes. Extend this to create a\r\n * strategy export class which the asset library can use to resolve asset naming conflicts, or\r\n * use one of the bundled concrete strategy classes:\r\n *\r\n * - \r\n *
- IgnoreConflictStrategy (ConflictStrategy.IGNORE) \r\n *
- ErrorConflictStrategy (ConflictStrategy.THROW_ERROR) \r\n *
- NumSuffixConflictStrategy (ConflictStrategy.APPEND_NUM_SUFFIX) \r\n *
AssetLibrary.conflictPrecedence property defines which\r\n * of the conflicting assets will get to keep it's name, and which is renamed (if any.)\r\n *\r\n * @see away.library.AssetLibrary.conflictStrategy\r\n * @see away.library.naming.ConflictStrategyBase\r\n */\r\nvar ConflictStrategy = (function () {\r\n function ConflictStrategy(include) {\r\n //TODO: find out why typescript d.ts files do not include this class\r\n }\r\n return ConflictStrategy;\r\n}());\r\nexport { ConflictStrategy };\r\n/**\r\n * Specifies that in case of a naming conflict, one of the assets will be renamed and\r\n * a numeric suffix appended to the base name.\r\n */\r\nConflictStrategy.APPEND_NUM_SUFFIX = new NumSuffixConflictStrategy();\r\n/**\r\n * Specifies that naming conflicts should be ignored. This is not recommended in most\r\n * cases, unless it can be 100% guaranteed that the application does not cause naming\r\n * conflicts in the library (i.e. when an app-level system is in place to prevent this.)\r\n */\r\nConflictStrategy.IGNORE = new IgnoreConflictStrategy();\r\n/**\r\n * Specifies that an error should be thrown if a naming conflict is discovered. Use this\r\n * to be 100% sure that naming conflicts never occur unnoticed, and when it's undesirable\r\n * to have the library automatically rename assets to avoid such conflicts.\r\n */\r\nConflictStrategy.THROW_ERROR = new ErrorConflictStrategy();\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/library/ConflictStrategy.js","import * as tslib_1 from \"tslib\";\r\nimport { AssetLibraryIterator } from \"../library/AssetLibraryIterator\";\r\nimport { Loader } from \"../library/Loader\";\r\nimport { ConflictPrecedence } from \"../library/ConflictPrecedence\";\r\nimport { ConflictStrategy } from \"../library/ConflictStrategy\";\r\nimport { AssetBase } from \"../library/AssetBase\";\r\nimport { ErrorBase } from \"../errors/ErrorBase\";\r\nimport { AssetEvent } from \"../events/AssetEvent\";\r\nimport { URLLoaderEvent } from \"../events/URLLoaderEvent\";\r\nimport { LoaderEvent } from \"../events/LoaderEvent\";\r\nimport { EventDispatcher } from \"../events/EventDispatcher\";\r\nimport { ParserEvent } from \"../events/ParserEvent\";\r\n/**\r\n * AssetLibraryBundle enforces a multiton pattern and is not intended to be instanced directly.\r\n * Its purpose is to create a container for 3D data management, both before and after parsing.\r\n * If you are interested in creating multiple library bundles, please use the getInstance() method.\r\n */\r\nvar AssetLibraryBundle = (function (_super) {\r\n tslib_1.__extends(AssetLibraryBundle, _super);\r\n /**\r\n * Creates a new AssetLibraryBundle object.\r\n *\r\n * @param me A multiton enforcer for the AssetLibraryBundle ensuring it cannnot be instanced.\r\n */\r\n function AssetLibraryBundle() {\r\n var _this = _super.call(this) || this;\r\n _this._loaderSessionsGarbage = new Array();\r\n _this._assets = new Array(); //new Vector.ConflictStrategy.APPEND_NUM_SUFFIX\r\n * is used which means that a numeric suffix is appended to one of the assets. The\r\n * conflictPrecedence property defines which of the two conflicting assets will\r\n * be renamed.\r\n *\r\n * @see naming.ConflictStrategy\r\n * @see AssetLibrary.conflictPrecedence\r\n */\r\n get: function () {\r\n return this._strategy;\r\n },\r\n set: function (val) {\r\n if (!val)\r\n throw new ErrorBase('namingStrategy must not be null. To ignore naming, use AssetLibrary.IGNORE');\r\n this._strategy = val.create();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(AssetLibraryBundle.prototype, \"conflictPrecedence\", {\r\n /**\r\n * Defines which asset should have precedence when resolving a naming conflict between\r\n * two assets of which one has just been renamed by the user or by a parser. By default\r\n * ConflictPrecedence.FAVOR_NEW is used, meaning that the newly renamed\r\n * asset will keep it's new name while the older asset gets renamed to not conflict.\r\n *\r\n * This property is ignored for conflict strategies that do not actually rename an\r\n * asset automatically, such as ConflictStrategy.IGNORE and ConflictStrategy.THROW_ERROR.\r\n *\r\n * @see away.library.ConflictPrecedence\r\n * @see away.library.ConflictStrategy\r\n */\r\n get: function () {\r\n return this._strategyPreference;\r\n },\r\n set: function (val) {\r\n this._strategyPreference = val;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * Create an AssetLibraryIterator instance that can be used to iterate over the assets\r\n * in this asset library instance. The iterator can filter assets on asset type and/or\r\n * namespace. A \"null\" filter value means no filter of that type is used.\r\n *\r\n * @param assetTypeFilter Asset type to filter on (from the AssetType enum class.) Use\r\n * null to not filter on asset type.\r\n * @param namespaceFilter Namespace to filter on. Use null to not filter on namespace.\r\n * @param filterFunc Callback function to use when deciding whether an asset should be\r\n * included in the iteration or not. This needs to be a function that takes a single\r\n * parameter of type IAsset and returns a boolean where true means it should be included.\r\n *\r\n * @see away.library.AssetType\r\n */\r\n AssetLibraryBundle.prototype.createIterator = function (assetTypeFilter, namespaceFilter, filterFunc) {\r\n if (assetTypeFilter === void 0) { assetTypeFilter = null; }\r\n if (namespaceFilter === void 0) { namespaceFilter = null; }\r\n if (filterFunc === void 0) { filterFunc = null; }\r\n return new AssetLibraryIterator(this._assets, assetTypeFilter, namespaceFilter, filterFunc);\r\n };\r\n /**\r\n * Loads a file and (optionally) all of its dependencies.\r\n *\r\n * @param req The URLRequest object containing the URL of the file to be loaded.\r\n * @param context An optional context object providing additional parameters for loading\r\n * @param ns An optional namespace string under which the file is to be loaded, allowing the differentiation of two resources with identical assets\r\n * @param parser An optional parser object for translating the loaded data into a usable resource. If not provided, Loader will attempt to auto-detect the file type.\r\n * @return A handle to the retrieved resource.\r\n */\r\n AssetLibraryBundle.prototype.load = function (req, context, ns, parser) {\r\n if (context === void 0) { context = null; }\r\n if (ns === void 0) { ns = null; }\r\n if (parser === void 0) { parser = null; }\r\n this.getLoader().load(req, context, ns, parser);\r\n };\r\n /**\r\n * Loads a resource from existing data in memory.\r\n *\r\n * @param data The data object containing all resource information.\r\n * @param context An optional context object providing additional parameters for loading\r\n * @param ns An optional namespace string under which the file is to be loaded, allowing the differentiation of two resources with identical assets\r\n * @param parser An optional parser object for translating the loaded data into a usable resource. If not provided, Loader will attempt to auto-detect the file type.\r\n * @return A handle to the retrieved resource.\r\n */\r\n AssetLibraryBundle.prototype.loadData = function (data, context, ns, parser) {\r\n if (context === void 0) { context = null; }\r\n if (ns === void 0) { ns = null; }\r\n if (parser === void 0) { parser = null; }\r\n this.getLoader().loadData(data, '', context, ns, parser);\r\n };\r\n AssetLibraryBundle.prototype.getLoader = function () {\r\n var loader = new Loader();\r\n this._loaderSessions.push(loader);\r\n loader.addEventListener(LoaderEvent.LOAD_COMPLETE, this._onLoadCompleteDelegate);\r\n loader.addEventListener(AssetEvent.TEXTURE_SIZE_ERROR, this._onTextureSizeErrorDelegate);\r\n loader.addEventListener(AssetEvent.ASSET_COMPLETE, this._onAssetCompleteDelegate);\r\n // Error are handled separately (see documentation for addErrorHandler)\r\n loader._iAddErrorHandler(this._onLoadErrorDelegate);\r\n loader._iAddParseErrorHandler(this._onParseErrorDelegate);\r\n return loader;\r\n };\r\n AssetLibraryBundle.prototype.disposeLoader = function (loader) {\r\n var index = this._loaderSessions.indexOf(loader);\r\n this._loaderSessions.splice(index, 1);\r\n this.killloaderSession(loader);\r\n };\r\n /**\r\n *\r\n */\r\n AssetLibraryBundle.prototype.getAsset = function (name, ns) {\r\n if (ns === void 0) { ns = null; }\r\n if (this._assetDictDirty)\r\n this.rehashAssetDict();\r\n if (ns == null)\r\n ns = AssetBase.DEFAULT_NAMESPACE;\r\n if (!this._assetDictionary.hasOwnProperty(ns))\r\n return null;\r\n return this._assetDictionary[ns][name];\r\n };\r\n AssetLibraryBundle.prototype.getAllAssets = function () {\r\n return this._assets;\r\n };\r\n /**\r\n * Adds an asset to the asset library, first making sure that it's name is unique\r\n * using the method defined by the conflictStrategy and\r\n * conflictPrecedence properties.\r\n */\r\n AssetLibraryBundle.prototype.addAsset = function (asset) {\r\n var ns;\r\n var old;\r\n // Bail if asset has already been added.\r\n if (this._assets.indexOf(asset) >= 0)\r\n return;\r\n old = this.getAsset(asset.adaptee.name, asset.adaptee.assetNamespace);\r\n ns = asset.adaptee.assetNamespace || AssetBase.DEFAULT_NAMESPACE;\r\n if (old != null)\r\n this._strategy.resolveConflict(asset, old, this._assetDictionary[ns], this._strategyPreference);\r\n //create unique-id (for now this is used in AwayBuilder only\r\n //asset.id = IDUtil.createUID();\r\n // Add it\r\n this._assets.push(asset);\r\n if (!this._assetDictionary.hasOwnProperty(ns))\r\n this._assetDictionary[ns] = new Object();\r\n this._assetDictionary[ns][asset.adaptee.name] = asset;\r\n asset.adaptee.addEventListener(AssetEvent.RENAME, this._onAssetRenameDelegate);\r\n asset.adaptee.addEventListener(AssetEvent.ASSET_CONFLICT_RESOLVED, this._onAssetConflictResolvedDelegate);\r\n };\r\n /**\r\n * Removes an asset from the library, and optionally disposes that asset by calling\r\n * it's disposeAsset() method (which for most assets is implemented as a default\r\n * version of that type's dispose() method.\r\n *\r\n * @param asset The asset which should be removed from this library.\r\n * @param dispose Defines whether the assets should also be disposed.\r\n */\r\n AssetLibraryBundle.prototype.removeAsset = function (asset, dispose) {\r\n if (dispose === void 0) { dispose = true; }\r\n var idx;\r\n this.removeAssetFromDict(asset);\r\n asset.adaptee.removeEventListener(AssetEvent.RENAME, this._onAssetRenameDelegate);\r\n asset.adaptee.removeEventListener(AssetEvent.ASSET_CONFLICT_RESOLVED, this._onAssetConflictResolvedDelegate);\r\n idx = this._assets.indexOf(asset);\r\n if (idx >= 0)\r\n this._assets.splice(idx, 1);\r\n if (dispose)\r\n asset.dispose();\r\n };\r\n /**\r\n * Removes an asset which is specified using name and namespace.\r\n *\r\n * @param name The name of the asset to be removed.\r\n * @param ns The namespace to which the desired asset belongs.\r\n * @param dispose Defines whether the assets should also be disposed.\r\n *\r\n * @see away.library.AssetLibrary.removeAsset()\r\n */\r\n AssetLibraryBundle.prototype.removeAssetByName = function (name, ns, dispose) {\r\n if (ns === void 0) { ns = null; }\r\n if (dispose === void 0) { dispose = true; }\r\n var asset = this.getAsset(name, ns);\r\n if (asset)\r\n this.removeAsset(asset, dispose);\r\n return asset;\r\n };\r\n /**\r\n * Removes all assets from the asset library, optionally disposing them as they\r\n * are removed.\r\n *\r\n * @param dispose Defines whether the assets should also be disposed.\r\n */\r\n AssetLibraryBundle.prototype.removeAllAssets = function (dispose) {\r\n if (dispose === void 0) { dispose = true; }\r\n if (dispose) {\r\n var asset;\r\n var len = this._assets.length;\r\n for (var c = 0; c < len; c++) {\r\n asset = this._assets[c];\r\n asset.dispose();\r\n }\r\n }\r\n this._assets.length = 0;\r\n this.rehashAssetDict();\r\n };\r\n /**\r\n * Removes all assets belonging to a particular namespace (null for default)\r\n * from the asset library, and optionall disposes them by calling their\r\n * disposeAsset() method.\r\n *\r\n * @param ns The namespace from which all assets should be removed.\r\n * @param dispose Defines whether the assets should also be disposed.\r\n *\r\n * @see away.library.AssetLibrary.removeAsset()\r\n */\r\n AssetLibraryBundle.prototype.removeNamespaceAssets = function (ns, dispose) {\r\n if (ns === void 0) { ns = null; }\r\n if (dispose === void 0) { dispose = true; }\r\n var idx = 0;\r\n var asset;\r\n var old_assets;\r\n // Empty the assets vector after having stored a copy of it.\r\n // The copy will be filled with all assets which weren't removed.\r\n old_assets = this._assets.concat();\r\n this._assets.length = 0;\r\n if (ns == null)\r\n ns = AssetBase.DEFAULT_NAMESPACE;\r\n var len = old_assets.length;\r\n for (var d = 0; d < len; d++) {\r\n asset = old_assets[d];\r\n // Remove from dict if in the supplied namespace. If not,\r\n // transfer over to the new vector.\r\n if (asset.adaptee.assetNamespace == ns) {\r\n if (dispose)\r\n asset.dispose();\r\n // Remove asset from dictionary, but don't try to auto-remove\r\n // the namespace, which will trigger an unnecessarily expensive\r\n // test that is not needed since we know that the namespace\r\n // will be empty when loop finishes.\r\n this.removeAssetFromDict(asset, false);\r\n }\r\n else {\r\n this._assets[idx++] = asset;\r\n }\r\n }\r\n /*\r\n for each (asset in old_assets) {\r\n // Remove from dict if in the supplied namespace. If not,\r\n // transfer over to the new vector.\r\n if (asset.assetNamespace == ns) {\r\n if (dispose)\r\n asset.dispose();\r\n\r\n // Remove asset from dictionary, but don't try to auto-remove\r\n // the namespace, which will trigger an unnecessarily expensive\r\n // test that is not needed since we know that the namespace\r\n // will be empty when loop finishes.\r\n removeAssetFromDict(asset, false);\r\n } else\r\n _assets[idx++] = asset;\r\n\r\n }\r\n */\r\n // Remove empty namespace\r\n if (this._assetDictionary.hasOwnProperty(ns))\r\n delete this._assetDictionary[ns];\r\n };\r\n AssetLibraryBundle.prototype.removeAssetFromDict = function (asset, autoRemoveEmptyNamespace) {\r\n if (autoRemoveEmptyNamespace === void 0) { autoRemoveEmptyNamespace = true; }\r\n if (this._assetDictDirty)\r\n this.rehashAssetDict();\r\n if (this._assetDictionary.hasOwnProperty(asset.adaptee.assetNamespace)) {\r\n if (this._assetDictionary[asset.adaptee.assetNamespace].hasOwnProperty(asset.adaptee.name))\r\n delete this._assetDictionary[asset.adaptee.assetNamespace][asset.adaptee.name];\r\n if (autoRemoveEmptyNamespace) {\r\n var key;\r\n var empty = true;\r\n for (key in this._assetDictionary[asset.adaptee.assetNamespace]) {\r\n empty = false;\r\n break;\r\n }\r\n if (empty)\r\n delete this._assetDictionary[asset.adaptee.assetNamespace];\r\n }\r\n }\r\n };\r\n AssetLibraryBundle.prototype.stopAllLoaders = function () {\r\n var len = this._loaderSessions.length;\r\n for (var i = 0; i < len; i++)\r\n this.killloaderSession(this._loaderSessions[i]);\r\n this._loaderSessions = new Array();\r\n };\r\n AssetLibraryBundle.prototype.rehashAssetDict = function () {\r\n var asset;\r\n this._assetDictionary = {};\r\n var len = this._assets.length;\r\n for (var c = 0; c < len; c++) {\r\n asset = this._assets[c];\r\n if (!this._assetDictionary.hasOwnProperty(asset.adaptee.assetNamespace))\r\n this._assetDictionary[asset.adaptee.assetNamespace] = {};\r\n this._assetDictionary[asset.adaptee.assetNamespace][asset.adaptee.name] = asset;\r\n }\r\n this._assetDictDirty = false;\r\n };\r\n /**\r\n * Called when a an error occurs during loading.\r\n */\r\n AssetLibraryBundle.prototype.onLoadError = function (event) {\r\n if (this.hasEventListener(URLLoaderEvent.LOAD_ERROR)) {\r\n this.dispatchEvent(event);\r\n return true;\r\n }\r\n else {\r\n return false;\r\n }\r\n };\r\n /**\r\n * Called when a an error occurs during parsing.\r\n */\r\n AssetLibraryBundle.prototype.onParseError = function (event) {\r\n if (this.hasEventListener(ParserEvent.PARSE_ERROR)) {\r\n this.dispatchEvent(event);\r\n return true;\r\n }\r\n else {\r\n return false;\r\n }\r\n };\r\n AssetLibraryBundle.prototype.onAssetComplete = function (event) {\r\n // Only add asset to library the first time.\r\n if (event.type == AssetEvent.ASSET_COMPLETE)\r\n this.addAsset(event.asset.adapter);\r\n this.dispatchEvent(event);\r\n };\r\n AssetLibraryBundle.prototype.onTextureSizeError = function (event) {\r\n this.dispatchEvent(event);\r\n };\r\n /**\r\n * Called when the resource and all of its dependencies was retrieved.\r\n */\r\n AssetLibraryBundle.prototype.onLoadComplete = function (event) {\r\n var loader = event.target;\r\n this.dispatchEvent(event);\r\n this.disposeLoader(loader);\r\n };\r\n AssetLibraryBundle.prototype.killloaderSession = function (loader) {\r\n loader.removeEventListener(LoaderEvent.LOAD_COMPLETE, this._onLoadCompleteDelegate);\r\n loader.removeEventListener(AssetEvent.TEXTURE_SIZE_ERROR, this._onTextureSizeErrorDelegate);\r\n loader.removeEventListener(AssetEvent.ASSET_COMPLETE, this._onAssetCompleteDelegate);\r\n loader.stop();\r\n };\r\n AssetLibraryBundle.prototype.onAssetRename = function (event) {\r\n var asset = event.target.adapter; // TODO: was ev.currentTarget - watch this var\r\n var old = this.getAsset(asset.adaptee.assetNamespace, asset.adaptee.name);\r\n if (old != null) {\r\n this._strategy.resolveConflict(asset, old, this._assetDictionary[asset.adaptee.assetNamespace], this._strategyPreference);\r\n }\r\n else {\r\n var dict = this._assetDictionary[event.asset.assetNamespace];\r\n if (dict == null)\r\n return;\r\n dict[event.prevName] = null;\r\n dict[event.asset.name] = event.asset;\r\n }\r\n };\r\n AssetLibraryBundle.prototype.onAssetConflictResolved = function (event) {\r\n this.dispatchEvent(event.clone());\r\n };\r\n return AssetLibraryBundle;\r\n}(EventDispatcher));\r\nexport { AssetLibraryBundle };\r\nAssetLibraryBundle._iInstances = new Object();\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/library/AssetLibraryBundle.js","import { AssetLibraryBundle } from \"../library/AssetLibraryBundle\";\r\nimport { Loader } from \"../library/Loader\";\r\n/**\r\n * AssetLibrary enforces a singleton pattern and is not intended to be instanced.\r\n * It's purpose is to allow access to the default library bundle through a set of static shortcut methods.\r\n * If you are interested in creating multiple library bundles, please use the getBundle() method.\r\n */\r\nvar AssetLibrary = (function () {\r\n /**\r\n * Creates a new AssetLibrary object.\r\n *\r\n */\r\n function AssetLibrary() {\r\n }\r\n //*/\r\n /**\r\n * Returns an AssetLibrary bundle instance. If no key is given, returns the default bundle (which is\r\n * similar to using the AssetLibraryBundle as a singleton). To keep several separated library bundles,\r\n * pass a string key to this method to define which bundle should be returned. This is\r\n * referred to as using the AssetLibraryBundle as a multiton.\r\n *\r\n * @param key Defines which multiton instance should be returned.\r\n * @return An instance of the asset library\r\n */\r\n AssetLibrary.getBundle = function (key) {\r\n if (key === void 0) { key = 'default'; }\r\n return AssetLibraryBundle.getInstance(key);\r\n };\r\n /**\r\n *\r\n */\r\n AssetLibrary.enableParser = function (parserClass) {\r\n Loader.enableParser(parserClass);\r\n };\r\n /**\r\n *\r\n */\r\n AssetLibrary.enableParsers = function (parserClasses) {\r\n Loader.enableParsers(parserClasses);\r\n };\r\n Object.defineProperty(AssetLibrary, \"conflictStrategy\", {\r\n /**\r\n * Short-hand for conflictStrategy property on default asset library bundle.\r\n *\r\n * @see AssetLibraryBundle.conflictStrategy\r\n */\r\n get: function () {\r\n return AssetLibrary.getBundle().conflictStrategy;\r\n },\r\n set: function (val) {\r\n AssetLibrary.getBundle().conflictStrategy = val;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(AssetLibrary, \"conflictPrecedence\", {\r\n /**\r\n * Short-hand for conflictPrecedence property on default asset library bundle.\r\n *\r\n * @see AssetLibraryBundle.conflictPrecedence\r\n */\r\n get: function () {\r\n return AssetLibrary.getBundle().conflictPrecedence;\r\n },\r\n set: function (val) {\r\n AssetLibrary.getBundle().conflictPrecedence = val;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * Short-hand for createIterator() method on default asset library bundle.\r\n *\r\n * @see AssetLibraryBundle.createIterator()\r\n */\r\n AssetLibrary.createIterator = function (assetTypeFilter, namespaceFilter, filterFunc) {\r\n if (assetTypeFilter === void 0) { assetTypeFilter = null; }\r\n if (namespaceFilter === void 0) { namespaceFilter = null; }\r\n if (filterFunc === void 0) { filterFunc = null; }\r\n return AssetLibrary.getBundle().createIterator(assetTypeFilter, namespaceFilter, filterFunc);\r\n };\r\n /**\r\n * Short-hand for load() method on default asset library bundle.\r\n *\r\n * @see AssetLibraryBundle.load()\r\n */\r\n AssetLibrary.load = function (req, context, ns, parser) {\r\n if (context === void 0) { context = null; }\r\n if (ns === void 0) { ns = null; }\r\n if (parser === void 0) { parser = null; }\r\n AssetLibrary.getBundle().load(req, context, ns, parser);\r\n };\r\n /**\r\n * Short-hand for loadData() method on default asset library bundle.\r\n *\r\n * @see AssetLibraryBundle.loadData()\r\n */\r\n AssetLibrary.loadData = function (data, context, ns, parser) {\r\n if (context === void 0) { context = null; }\r\n if (ns === void 0) { ns = null; }\r\n if (parser === void 0) { parser = null; }\r\n AssetLibrary.getBundle().loadData(data, context, ns, parser);\r\n };\r\n AssetLibrary.stopLoad = function () {\r\n AssetLibrary.getBundle().stopAllLoaders();\r\n };\r\n AssetLibrary.getLoader = function () {\r\n return AssetLibrary.getBundle().getLoader();\r\n };\r\n /**\r\n * Short-hand for getAsset() method on default asset library bundle.\r\n *\r\n * @see AssetLibraryBundle.getAsset()\r\n */\r\n AssetLibrary.getAsset = function (name, ns) {\r\n if (ns === void 0) { ns = null; }\r\n return AssetLibrary.getBundle().getAsset(name, ns);\r\n };\r\n /**\r\n * Short-hand for getAsset() method on default asset library bundle.\r\n *\r\n * @see AssetLibraryBundle.getAsset()\r\n */\r\n AssetLibrary.getAllAssets = function () {\r\n return AssetLibrary.getBundle().getAllAssets();\r\n };\r\n /**\r\n * Short-hand for addEventListener() method on default asset library bundle.\r\n */\r\n AssetLibrary.addEventListener = function (type, listener) {\r\n AssetLibrary.getBundle().addEventListener(type, listener);\r\n };\r\n /**\r\n * Short-hand for removeEventListener() method on default asset library bundle.\r\n */\r\n AssetLibrary.removeEventListener = function (type, listener) {\r\n AssetLibrary.getBundle().removeEventListener(type, listener);\r\n };\r\n /**\r\n * Short-hand for hasEventListener() method on default asset library bundle.\r\n\r\n public static hasEventListener(type:string):boolean\r\n {\r\n return AssetLibrary.getBundle().hasEventListener(type);\r\n }\r\n\r\n public static willTrigger(type:string):boolean\r\n {\r\n return getBundle().willTrigger(type);\r\n }\r\n */\r\n /**\r\n * Short-hand for addAsset() method on default asset library bundle.\r\n *\r\n * @see AssetLibraryBundle.addAsset()\r\n */\r\n AssetLibrary.addAsset = function (asset) {\r\n AssetLibrary.getBundle().addAsset(asset);\r\n };\r\n /**\r\n * Short-hand for removeAsset() method on default asset library bundle.\r\n *\r\n * @param asset The asset which should be removed from the library.\r\n * @param dispose Defines whether the assets should also be disposed.\r\n *\r\n * @see AssetLibraryBundle.removeAsset()\r\n */\r\n AssetLibrary.removeAsset = function (asset, dispose) {\r\n if (dispose === void 0) { dispose = true; }\r\n AssetLibrary.getBundle().removeAsset(asset, dispose);\r\n };\r\n /**\r\n * Short-hand for removeAssetByName() method on default asset library bundle.\r\n *\r\n * @param name The name of the asset to be removed.\r\n * @param ns The namespace to which the desired asset belongs.\r\n * @param dispose Defines whether the assets should also be disposed.\r\n *\r\n * @see AssetLibraryBundle.removeAssetByName()\r\n */\r\n AssetLibrary.removeAssetByName = function (name, ns, dispose) {\r\n if (ns === void 0) { ns = null; }\r\n if (dispose === void 0) { dispose = true; }\r\n return AssetLibrary.getBundle().removeAssetByName(name, ns, dispose);\r\n };\r\n /**\r\n * Short-hand for removeAllAssets() method on default asset library bundle.\r\n *\r\n * @param dispose Defines whether the assets should also be disposed.\r\n *\r\n * @see AssetLibraryBundle.removeAllAssets()\r\n */\r\n AssetLibrary.removeAllAssets = function (dispose) {\r\n if (dispose === void 0) { dispose = true; }\r\n AssetLibrary.getBundle().removeAllAssets(dispose);\r\n };\r\n /**\r\n * Short-hand for removeNamespaceAssets() method on default asset library bundle.\r\n *\r\n * @see AssetLibraryBundle.removeNamespaceAssets()\r\n */\r\n AssetLibrary.removeNamespaceAssets = function (ns, dispose) {\r\n if (ns === void 0) { ns = null; }\r\n if (dispose === void 0) { dispose = true; }\r\n AssetLibrary.getBundle().removeNamespaceAssets(ns, dispose);\r\n };\r\n return AssetLibrary;\r\n}());\r\nexport { AssetLibrary };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/library/AssetLibrary.js","var IDUtil = (function () {\r\n function IDUtil() {\r\n }\r\n /**\r\n * Generates a UID (unique identifier) based on ActionScript's\r\n * pseudo-random number generator and the current time.\r\n *\r\n * The UID has the form\r\n * \"XXXXXXXX-XXXX-XXXX-XXXX-XXXXXXXXXXXX\"\r\n * where X is a hexadecimal digit (0-9, A-F).
This UID will not be truly globally unique; but it is the best\r\n * we can do without player support for UID generation.
\r\n *\r\n * @return The newly-generated UID.\r\n *\r\n * @langversion 3.0\r\n * @playerversion Flash 9\r\n * @playerversion AIR 1.1\r\n * @productversion Flex 3\r\n */\r\n IDUtil.createUID = function () {\r\n var uid = new Array(36);\r\n var index = 0;\r\n var i;\r\n var j;\r\n for (i = 0; i < 8; i++)\r\n uid[index++] = IDUtil.ALPHA_CHAR_CODES[Math.floor(Math.random() * 16)];\r\n for (i = 0; i < 3; i++) {\r\n uid[index++] = 45; // charCode for \"-\"\r\n for (j = 0; j < 4; j++)\r\n uid[index++] = IDUtil.ALPHA_CHAR_CODES[Math.floor(Math.random() * 16)];\r\n }\r\n uid[index++] = 45; // charCode for \"-\"\r\n var time = new Date().getTime();\r\n // Note: time is the number of milliseconds since 1970,\r\n // which is currently more than one trillion.\r\n // We use the low 8 hex digits of this number in the UID.\r\n // Just in case the system clock has been reset to\r\n // Jan 1-4, 1970 (in which case this number could have only\r\n // 1-7 hex digits), we pad on the left with 7 zeros\r\n // before taking the low digits.\r\n var timeString = (\"0000000\" + time.toString(16).toUpperCase()).substr(-8);\r\n for (i = 0; i < 8; i++)\r\n uid[index++] = timeString.charCodeAt(i);\r\n for (i = 0; i < 4; i++)\r\n uid[index++] = IDUtil.ALPHA_CHAR_CODES[Math.floor(Math.random() * 16)];\r\n return String.fromCharCode.apply(null, uid);\r\n };\r\n return IDUtil;\r\n}());\r\nexport { IDUtil };\r\n/**\r\n * @private\r\n * Char codes for 0123456789ABCDEF\r\n */\r\nIDUtil.ALPHA_CHAR_CODES = [48, 49, 50, 51, 52, 53, 54, 55, 56, 57, 65, 66, 67, 68, 69, 70];\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/library/IDUtil.js","import * as tslib_1 from \"tslib\";\r\nimport { EventDispatcher } from \"../events/EventDispatcher\";\r\n/**\r\n * The LoaderInfo export class provides information about a loaded SWF file or a\r\n * loaded image file(JPEG, GIF, or PNG). LoaderInfo objects are available for\r\n * any display object. The information provided includes load progress, the\r\n * URLs of the loader and loaded content, the number of bytes total for the\r\n * media, and the nominal height and width of the media.\r\n *\r\n *You can access LoaderInfo objects in two ways:
\r\n *\r\n *- \r\n *
- The
contentLoaderInfoproperty of a flash.display.Loader\r\n * object - ThecontentLoaderInfoproperty is always available\r\n * for any Loader object. For a Loader object that has not called the\r\n *load()orloadBytes()method, or that has not\r\n * sufficiently loaded, attempting to access many of the properties of the\r\n *contentLoaderInfoproperty throws an error. \r\n * - The
loaderInfoproperty of a display object. \r\n *
The contentLoaderInfo property of a Loader object provides\r\n * information about the content that the Loader object is loading, whereas\r\n * the loaderInfo property of a DisplayObject provides\r\n * information about the root SWF file for that display object.
When you use a Loader object to load a display object(such as a SWF\r\n * file or a bitmap), the loaderInfo property of the display\r\n * object is the same as the contentLoaderInfo property of the\r\n * Loader object(DisplayObject.loaderInfo =\r\n * Loader.contentLoaderInfo). Because the instance of the main export class of\r\n * the SWF file has no Loader object, the loaderInfo property is\r\n * the only way to access the LoaderInfo for the instance of the main export class of\r\n * the SWF file.
The following diagram shows the different uses of the LoaderInfo\r\n * object - for the instance of the main export class of the SWF file, for the\r\n * contentLoaderInfo property of a Loader object, and for the\r\n * loaderInfo property of a loaded object:
When a loading operation is not complete, some properties of the\r\n * contentLoaderInfo property of a Loader object are not\r\n * available. You can obtain some properties, such as\r\n * bytesLoaded, bytesTotal, url,\r\n * loaderURL, and applicationDomain. When the\r\n * loaderInfo object dispatches the init event, you\r\n * can access all properties of the loaderInfo object and the\r\n * loaded image or SWF file.
Note: All properties of LoaderInfo objects are read-only.
\r\n *\r\n *The EventDispatcher.dispatchEvent() method is not\r\n * applicable to LoaderInfo objects. If you call dispatchEvent()\r\n * on a LoaderInfo object, an IllegalOperationError exception is thrown.
complete event is always dispatched after\r\n * the init event. The init event\r\n * is dispatched when the object is ready to access, though\r\n * the content may still be downloading.\r\n * @event httpStatus Dispatched when a network request is made over HTTP and\r\n * an HTTP status code can be detected.\r\n * @event init Dispatched when the properties and methods of a loaded\r\n * SWF file are accessible and ready for use. The content,\r\n * however, can still be downloading. A LoaderInfo object\r\n * dispatches the init event when the following\r\n * conditions exist:\r\n * - \r\n *
- All properties and methods associated with the\r\n * loaded object and those associated with the LoaderInfo\r\n * object are accessible. \r\n *
- The constructors for all child objects have\r\n * completed. \r\n *
- All ActionScript code in the first frame of the\r\n * loaded SWF's main timeline has been executed. \r\n *
For example, an Event.INIT is dispatched\r\n * when the first frame of a movie or animation is loaded.\r\n * The movie is then accessible and can be added to the\r\n * display list. The complete movie, however, can take\r\n * longer to download. The Event.COMPLETE is\r\n * only dispatched once the full movie is loaded.
The init event always precedes the\r\n * complete event.
unload()\r\n * method of the Loader object, or when a second load is\r\n * performed by the same Loader object and the original\r\n * content is removed prior to the load beginning.\r\n */\r\nvar LoaderInfo = (function (_super) {\r\n tslib_1.__extends(LoaderInfo, _super);\r\n function LoaderInfo() {\r\n return _super.apply(this, arguments) || this;\r\n }\r\n Object.defineProperty(LoaderInfo.prototype, \"bytes\", {\r\n /**\r\n * The bytes associated with a LoaderInfo object.\r\n *\r\n * @throws SecurityError If the object accessing this API is prevented from\r\n * accessing the loaded object due to security\r\n * restrictions. This situation can occur, for\r\n * instance, when a Loader object attempts to access\r\n * the contentLoaderInfo.content property\r\n * and it is not granted security permission to access\r\n * the loaded content.\r\n *\r\n * For more information related to security, see the\r\n * Flash Player Developer Center Topic:
bytesTotal, all of the bytes are loaded.\r\n */\r\n get: function () {\r\n return this._bytesLoaded;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(LoaderInfo.prototype, \"bytesTotal\", {\r\n /**\r\n * The number of compressed bytes in the entire media file.\r\n *\r\n * Before the first progress event is dispatched by this\r\n * LoaderInfo object's corresponding Loader object, bytesTotal\r\n * is 0. After the first progress event from the Loader object,\r\n * bytesTotal reflects the actual number of bytes to be\r\n * downloaded.
contentLoaderInfo.content property\r\n * and it is not granted security permission to access\r\n * the loaded content.\r\n *\r\n * For more information related to security, see the\r\n * Flash Player Developer Center Topic:
null if not\r\n * enough of the file has loaded in order to determine the type. The\r\n * following list gives the possible values:\r\n * - \r\n *
\"application/x-shockwave-flash\"\r\n * \"image/jpeg\"\r\n * \"image/gif\"\r\n * \"image/png\"\r\n *
loaderInfo property of the instance\r\n * of the main export class of the SWF file, no Loader object is associated.\r\n *\r\n * @throws SecurityError If the object accessing this API is prevented from\r\n * accessing the Loader object because of security\r\n * restrictions. This can occur, for instance, when a\r\n * loaded SWF file attempts to access its\r\n * loaderInfo.loader property and it is\r\n * not granted security permission to access the\r\n * loading SWF file.\r\n *\r\n * For more information related to security, see the\r\n * Flash Player Developer Center Topic:
Before the first progress event is dispatched by this\r\n * LoaderInfo object's corresponding Loader object, the value of the\r\n * url property might reflect only the initial URL specified in\r\n * the call to the load() method of the Loader object. After the\r\n * first progress event, the url property reflects\r\n * the media's final URL, after any redirects and relative URLs are\r\n * resolved.
In some cases, the value of the url property is truncated;\r\n * see the isURLInaccessible property for details.
ParserBase provides an abstract base export class for objects that convert blocks of data to data structures\r\n * supported by away.\r\n *\r\n * If used by Loader to automatically determine the parser type, two public static methods should\r\n * be implemented, with the following signatures:\r\n *\r\n * public static supportsType(extension : string) : boolean\r\n * Indicates whether or not a given file extension is supported by the parser.\r\n *\r\n * public static supportsData(data : *) : boolean\r\n * Tests whether a data block can be parsed by the parser.\r\n *\r\n * Furthermore, for any concrete subtype, the method initHandle should be overridden to immediately\r\n * create the object that will contain the parsed data. This allows ResourceManager to return an object\r\n * handle regardless of whether the object was loaded or not.\r\n *\r\n * @see Loader\r\n */\r\nvar ParserBase = (function (_super) {\r\n tslib_1.__extends(ParserBase, _super);\r\n /**\r\n * Creates a new ParserBase object\r\n * @param format The data format of the file data to be parsed. Can be either ParserDataFormat.BINARY or ParserDataFormat.PLAIN_TEXT, and should be provided by the concrete subtype.\r\n *\r\n * @see away.loading.parsers.ParserDataFormat\r\n */\r\n function ParserBase(format) {\r\n var _this = _super.call(this) || this;\r\n _this._materialMode = 0;\r\n _this._dataFormat = format;\r\n _this._dependencies = new Array();\r\n _this._pOnIntervalDelegate = function (event) { return _this._pOnInterval(event); };\r\n return _this;\r\n }\r\n //----------------------------------------------------------------------------------------------------------------------------------------------------------------\r\n // TODO: add error checking for the following ( could cause a problem if this function is not implemented )\r\n //----------------------------------------------------------------------------------------------------------------------------------------------------------------\r\n // Needs to be implemented in all Parsers (\r\n //public static supportsType(extension : string) : boolean\r\n //* Indicates whether or not a given file extension is supported by the parser.\r\n //----------------------------------------------------------------------------------------------------------------------------------------------------------------\r\n ParserBase.supportsType = function (extension) {\r\n throw new AbstractMethodError();\r\n };\r\n Object.defineProperty(ParserBase.prototype, \"content\", {\r\n /* Protected */\r\n get: function () {\r\n return this._pContent;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ParserBase.prototype, \"parsingFailure\", {\r\n get: function () {\r\n return this._parsingFailure;\r\n },\r\n set: function (b) {\r\n this._parsingFailure = b;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ParserBase.prototype, \"parsingPaused\", {\r\n get: function () {\r\n return this._parsingPaused;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ParserBase.prototype, \"parsingComplete\", {\r\n get: function () {\r\n return this._parsingComplete;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ParserBase.prototype, \"materialMode\", {\r\n get: function () {\r\n return this._materialMode;\r\n },\r\n set: function (newMaterialMode) {\r\n this._materialMode = newMaterialMode;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ParserBase.prototype, \"data\", {\r\n get: function () {\r\n return this._data;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ParserBase.prototype, \"dataFormat\", {\r\n /**\r\n * The data format of the file data to be parsed. Options are URLLoaderDataFormat.BINARY, URLLoaderDataFormat.ARRAY_BUFFER, URLLoaderDataFormat.BLOB, URLLoaderDataFormat.VARIABLES or URLLoaderDataFormat.TEXT.\r\n */\r\n get: function () {\r\n return this._dataFormat;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * Parse data (possibly containing bytearry, plain text or BitmapAsset) asynchronously, meaning that\r\n * the parser will periodically stop parsing so that the AVM may proceed to the\r\n * next frame.\r\n *\r\n * @param data The untyped data object in which the loaded data resides.\r\n * @param frameLimit number of milliseconds of parsing allowed per frame. The\r\n * actual time spent on a frame can exceed this number since time-checks can\r\n * only be performed between logical sections of the parsing procedure.\r\n */\r\n ParserBase.prototype.parseAsync = function (data, frameLimit) {\r\n if (frameLimit === void 0) { frameLimit = 30; }\r\n this._data = data;\r\n this._pStartParsing(frameLimit);\r\n };\r\n Object.defineProperty(ParserBase.prototype, \"dependencies\", {\r\n /**\r\n * A list of dependencies that need to be loaded and resolved for the object being parsed.\r\n */\r\n get: function () {\r\n return this._dependencies;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * Resolve a dependency when it's loaded. For example, a dependency containing an ImageResource would be assigned\r\n * to a Mesh instance as a BitmapMaterial, a scene graph object would be added to its intended parent. The\r\n * dependency should be a member of the dependencies property.\r\n *\r\n * @param resourceDependency The dependency to be resolved.\r\n */\r\n ParserBase.prototype._iResolveDependency = function (resourceDependency) {\r\n throw new AbstractMethodError();\r\n };\r\n /**\r\n * Resolve a dependency loading failure. Used by parser to eventually provide a default map\r\n *\r\n * @param resourceDependency The dependency to be resolved.\r\n */\r\n ParserBase.prototype._iResolveDependencyFailure = function (resourceDependency) {\r\n throw new AbstractMethodError();\r\n };\r\n /**\r\n * Resolve a dependency name\r\n *\r\n * @param resourceDependency The dependency to be resolved.\r\n */\r\n ParserBase.prototype._iResolveDependencyName = function (resourceDependency, asset) {\r\n return asset.name;\r\n };\r\n ParserBase.prototype._iResumeParsing = function () {\r\n this._parsingPaused = false;\r\n if (this._timer)\r\n this._timer.start();\r\n //get started!\r\n if (!this._isParsing)\r\n this._pOnInterval();\r\n };\r\n ParserBase.prototype._pFinalizeAsset = function (asset, name) {\r\n if (name === void 0) { name = null; }\r\n var type_event;\r\n var type_name;\r\n if (name != null)\r\n asset.name = name;\r\n // If the asset has no name, give it\r\n // a per-type default name.\r\n if (!asset.name)\r\n asset.name = asset.assetType;\r\n this.dispatchEvent(new AssetEvent(AssetEvent.ASSET_COMPLETE, asset));\r\n };\r\n /**\r\n * Parse the next block of data.\r\n * @return Whether or not more data needs to be parsed. Can be ParserBase.ParserBase.PARSING_DONE or\r\n * ParserBase.ParserBase.MORE_TO_PARSE.\r\n */\r\n ParserBase.prototype._pProceedParsing = function () {\r\n throw new AbstractMethodError();\r\n };\r\n ParserBase.prototype._pDieWithError = function (message) {\r\n if (message === void 0) { message = 'Unknown parsing error'; }\r\n if (this._timer) {\r\n this._timer.removeEventListener(TimerEvent.TIMER, this._pOnIntervalDelegate);\r\n this._timer.stop();\r\n this._timer = null;\r\n }\r\n this.dispatchEvent(new ParserEvent(ParserEvent.PARSE_ERROR, message));\r\n };\r\n ParserBase.prototype._pAddDependency = function (id, req, parser, data, retrieveAsRawData, suppressErrorEvents, sub_id) {\r\n if (parser === void 0) { parser = null; }\r\n if (data === void 0) { data = null; }\r\n if (retrieveAsRawData === void 0) { retrieveAsRawData = false; }\r\n if (suppressErrorEvents === void 0) { suppressErrorEvents = false; }\r\n if (sub_id === void 0) { sub_id = 0; }\r\n var dependency = new ResourceDependency(id, req, data, parser, this, retrieveAsRawData, suppressErrorEvents, sub_id);\r\n this._dependencies.push(dependency);\r\n return dependency;\r\n };\r\n ParserBase.prototype._pPauseAndRetrieveDependencies = function () {\r\n this._pPauseParsing();\r\n this.dispatchEvent(new ParserEvent(ParserEvent.READY_FOR_DEPENDENCIES));\r\n };\r\n ParserBase.prototype._pPauseParsing = function () {\r\n if (this._timer)\r\n this._timer.stop();\r\n this._parsingPaused = true;\r\n };\r\n /**\r\n * Tests whether or not there is still time left for parsing within the maximum allowed time frame per session.\r\n * @return True if there is still time left, false if the maximum allotted time was exceeded and parsing should be interrupted.\r\n */\r\n ParserBase.prototype._pHasTime = function () {\r\n return ((getTimer() - this._lastFrameTime) < this._frameLimit);\r\n };\r\n /**\r\n * Called when the parsing pause interval has passed and parsing can proceed.\r\n */\r\n ParserBase.prototype._pOnInterval = function (event) {\r\n if (event === void 0) { event = null; }\r\n this._lastFrameTime = getTimer();\r\n this._isParsing = true;\r\n if (this._pProceedParsing() && !this._parsingFailure)\r\n this._pFinishParsing();\r\n this._isParsing = false;\r\n };\r\n /**\r\n * Initializes the parsing of data.\r\n * @param frameLimit The maximum duration of a parsing session.\r\n */\r\n ParserBase.prototype._pStartParsing = function (frameLimit) {\r\n this._frameLimit = frameLimit;\r\n this._timer = new Timer(this._frameLimit, 0);\r\n this._timer.addEventListener(TimerEvent.TIMER, this._pOnIntervalDelegate);\r\n this._timer.start();\r\n //get started!\r\n this._pOnInterval();\r\n };\r\n /**\r\n * Finish parsing the data.\r\n */\r\n ParserBase.prototype._pFinishParsing = function () {\r\n if (this._timer) {\r\n this._timer.removeEventListener(TimerEvent.TIMER, this._pOnIntervalDelegate);\r\n this._timer.stop();\r\n }\r\n this._timer = null;\r\n this._parsingComplete = true;\r\n this._isParsing = false;\r\n this.dispatchEvent(new ParserEvent(ParserEvent.PARSE_COMPLETE));\r\n };\r\n /**\r\n *\r\n * @returns {string}\r\n * @private\r\n */\r\n ParserBase.prototype._pGetTextData = function () {\r\n return ParserUtils.toString(this._data);\r\n };\r\n /**\r\n *\r\n * @returns {ByteArray}\r\n * @private\r\n */\r\n ParserBase.prototype._pGetByteData = function () {\r\n return ParserUtils.toByteArray(this._data);\r\n };\r\n /**\r\n *\r\n * @returns {any}\r\n * @private\r\n */\r\n ParserBase.prototype._pGetData = function () {\r\n return this._data;\r\n };\r\n return ParserBase;\r\n}(EventDispatcher));\r\nexport { ParserBase };\r\n/**\r\n * Returned by proceedParsing to indicate no more parsing is needed.\r\n */\r\nParserBase.PARSING_DONE = true;\r\n/* Protected */\r\n/**\r\n * Returned by proceedParsing to indicate more parsing is needed, allowing asynchronous parsing.\r\n */\r\nParserBase.MORE_TO_PARSE = false;\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/parsers/ParserBase.js","/**\r\n * An enumeration providing values to describe the data format of parsed data.\r\n */\r\nvar ParserDataFormat = (function () {\r\n function ParserDataFormat() {\r\n }\r\n return ParserDataFormat;\r\n}());\r\nexport { ParserDataFormat };\r\n/**\r\n * Describes the format of a binary file.\r\n */\r\nParserDataFormat.BINARY = \"binary\";\r\n/**\r\n * Describes the format of a plain text file.\r\n */\r\nParserDataFormat.PLAIN_TEXT = \"plainText\";\r\n/**\r\n * Describes the format of an image file\r\n */\r\nParserDataFormat.IMAGE = \"image\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/parsers/ParserDataFormat.js","import * as tslib_1 from \"tslib\";\r\nimport { WaveAudio } from \"../audio/WaveAudio\";\r\nimport { URLLoaderDataFormat } from \"../net/URLLoaderDataFormat\";\r\nimport { ParserBase } from \"../parsers/ParserBase\";\r\nimport { ByteArray } from \"../utils/ByteArray\";\r\nvar WaveAudioParser = (function (_super) {\r\n tslib_1.__extends(WaveAudioParser, _super);\r\n function WaveAudioParser() {\r\n var _this = _super.call(this, URLLoaderDataFormat.BLOB) || this;\r\n _this._convertingBlobState = 0;\r\n return _this;\r\n }\r\n WaveAudioParser.supportsType = function (extension) {\r\n extension = extension.toLowerCase();\r\n return extension == \"wav\" || extension == \"mp3\" || extension == \"ogg\";\r\n };\r\n WaveAudioParser.supportsData = function (data) {\r\n if (!(data instanceof ByteArray))\r\n return false;\r\n var ba = data;\r\n var filetype = WaveAudioParser.parseFileType(ba);\r\n return filetype ? true : false;\r\n };\r\n WaveAudioParser.prototype._pStartParsing = function (frameLimit) {\r\n //clear content\r\n delete this._pContent;\r\n this._pContent = null;\r\n _super.prototype._pStartParsing.call(this, frameLimit);\r\n };\r\n WaveAudioParser.prototype._pProceedParsing = function () {\r\n var _this = this;\r\n if (this._convertingBlobState == 1) {\r\n return ParserBase.MORE_TO_PARSE;\r\n }\r\n else if (this._convertingBlobState == 2) {\r\n return ParserBase.PARSING_DONE;\r\n }\r\n else if (this._convertingBlobState == 3) {\r\n return ParserBase.PARSING_DONE; //todo\r\n }\r\n if (this.data instanceof ByteArray) {\r\n this._pContent = new WaveAudio(this.data.arraybytes);\r\n this._pFinalizeAsset(this._pContent, this._iFileName);\r\n }\r\n else if (this.data instanceof ArrayBuffer) {\r\n this._pContent = new WaveAudio(this.data);\r\n this._pFinalizeAsset(this._pContent, this._iFileName);\r\n }\r\n else if (this.data instanceof Blob) {\r\n this._convertingBlobState = 1;\r\n var fileReader = new FileReader();\r\n fileReader.onload = function (event) { return _this.blobConverted(event); };\r\n fileReader.readAsArrayBuffer(this.data);\r\n return ParserBase.MORE_TO_PARSE;\r\n }\r\n return ParserBase.PARSING_DONE;\r\n };\r\n WaveAudioParser.prototype.blobConverted = function (event) {\r\n this._pContent = new WaveAudio(event.target.result);\r\n this._pFinalizeAsset(this._pContent, WaveAudioParser.processFilename(this._iFileName));\r\n this._convertingBlobState = 2;\r\n };\r\n WaveAudioParser.parseFileType = function (ba) {\r\n //old mp3 detections\r\n // This does not seem to work for all my mp3 files (i tested different mp3 encoders)\r\n // I leave it in, because it might work for mp3 data that i do not have here to test\r\n ba.position = 0;\r\n if ((ba.readUnsignedShort() & 0xFFE0) == 0xFFE0) {\r\n return 'mp3'; // test for MP3 syncword\r\n }\r\n // new mp3 detection\r\n // this from is-mp3 npm module,\r\n // but still i have mp3 files that are not detected by this\r\n // i added the hack: (byte_1 === 255 && byte_2 === 243 && byte_3 === 130) \tto catch those mp3s\r\n // todo: find a more foolproof way to detect al mp3 (my hack might collide with detection for other filetypes)\r\n ba.position = 0;\r\n var byte_1 = ba.readUnsignedByte();\r\n var byte_2 = ba.readUnsignedByte();\r\n var byte_3 = ba.readUnsignedByte();\r\n if ((byte_1 === 73 && byte_2 === 68 && byte_3 === 51)\r\n || (byte_1 === 255 && byte_2 === 251)\r\n || (byte_1 === 255 && byte_2 === 243 && byte_3 === 130)) {\r\n return 'mp3';\r\n }\r\n ba.position = 0;\r\n if (ba.readUTFBytes(4) == 'RIFF')\r\n return 'wav';\r\n ba.position = 0;\r\n if (ba.readUTFBytes(4) == 'OggS')\r\n return 'ogg';\r\n ba.position = 0;\r\n return null;\r\n };\r\n return WaveAudioParser;\r\n}(ParserBase));\r\nexport { WaveAudioParser };\r\n/*\r\n this static property can be set with a function that that will be called on each filename before adding it to the library\r\n*/\r\nWaveAudioParser.processFilename = function (filename) {\r\n return filename;\r\n};\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/parsers/WaveAudioParser.js","/**\r\n * Provides constant values for camera lens projection options use the the coordinateSystem property\r\n *\r\n * @see away.projections.PerspectiveLens#coordinateSystem\r\n */\r\n/**\r\n * Provides constant values for camera lens projection options use the the coordinateSystem property\r\n *\r\n * @see away.projections.PerspectiveLens#coordinateSystem\r\n */ export var CoordinateSystem;\r\n(function (CoordinateSystem) {\r\n /**\r\n * Default option, projects to a left-handed coordinate system\r\n */\r\n CoordinateSystem[CoordinateSystem[\"LEFT_HANDED\"] = 0] = \"LEFT_HANDED\";\r\n /**\r\n * Projects to a right-handed coordinate system\r\n */\r\n CoordinateSystem[CoordinateSystem[\"RIGHT_HANDED\"] = 1] = \"RIGHT_HANDED\";\r\n})(CoordinateSystem || (CoordinateSystem = {}));\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/projections/CoordinateSystem.js","import * as tslib_1 from \"tslib\";\r\nimport { Matrix3D } from \"../geom/Matrix3D\";\r\nimport { Plane3D } from \"../geom/Plane3D\";\r\nimport { Rectangle } from \"../geom/Rectangle\";\r\nimport { EventDispatcher } from \"../events/EventDispatcher\";\r\nimport { ProjectionEvent } from \"../events/ProjectionEvent\";\r\nimport { TransformEvent } from \"../events/TransformEvent\";\r\nimport { AbstractMethodError } from \"../errors/AbstractMethodError\";\r\nimport { CoordinateSystem } from \"./CoordinateSystem\";\r\nvar ProjectionBase = (function (_super) {\r\n tslib_1.__extends(ProjectionBase, _super);\r\n function ProjectionBase(coordinateSystem) {\r\n if (coordinateSystem === void 0) { coordinateSystem = CoordinateSystem.LEFT_HANDED; }\r\n var _this = _super.call(this) || this;\r\n _this._viewMatrix3D = new Matrix3D();\r\n _this._inverseViewMatrix3D = new Matrix3D();\r\n _this._frustumMatrix3D = new Matrix3D();\r\n _this._viewRect = new Rectangle();\r\n _this._stageRect = new Rectangle();\r\n _this._near = 20;\r\n _this._far = 3000;\r\n _this._frustumCorners = [];\r\n _this._originX = 0.5;\r\n _this._originY = 0.5;\r\n _this._viewMatrix3DDirty = true;\r\n _this._inverseViewMatrix3DDirty = true;\r\n _this._frustumMatrix3DDirty = true;\r\n _this._frustumPlanesDirty = true;\r\n _this._coordinateSystem = coordinateSystem;\r\n _this._onInvalidateConcatenatedMatrix3DDelegate = function (event) { return _this._onInvalidateConcatenatedMatrix3D(event); };\r\n return _this;\r\n }\r\n Object.defineProperty(ProjectionBase.prototype, \"transform\", {\r\n get: function () {\r\n return this._transform;\r\n },\r\n set: function (value) {\r\n if (this._transform == value)\r\n return;\r\n if (this._transform)\r\n this._transform.removeEventListener(TransformEvent.INVALIDATE_CONCATENATED_MATRIX3D, this._onInvalidateConcatenatedMatrix3DDelegate);\r\n this._transform = value;\r\n if (this._transform)\r\n this._transform.addEventListener(TransformEvent.INVALIDATE_CONCATENATED_MATRIX3D, this._onInvalidateConcatenatedMatrix3DDelegate);\r\n this._invalidateViewMatrix3D();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ProjectionBase.prototype, \"coordinateSystem\", {\r\n /**\r\n * The handedness of the coordinate system projection. The default is LEFT_HANDED.\r\n */\r\n get: function () {\r\n return this._coordinateSystem;\r\n },\r\n set: function (value) {\r\n if (this._coordinateSystem == value)\r\n return;\r\n this._coordinateSystem = value;\r\n this._invalidateFrustumMatrix3D();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ProjectionBase.prototype, \"frustumCorners\", {\r\n /**\r\n *\r\n * @returns {number[]}\r\n */\r\n get: function () {\r\n return this._frustumCorners;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ProjectionBase.prototype, \"frustumMatrix3D\", {\r\n /**\r\n *\r\n * @returns {Matrix3D}\r\n */\r\n get: function () {\r\n if (this._frustumMatrix3DDirty)\r\n this._updateFrustumMatrix3D();\r\n return this._frustumMatrix3D;\r\n },\r\n set: function (value) {\r\n this._frustumMatrix3D = value;\r\n this._invalidateViewMatrix3D();\r\n this._invalidateProperties();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ProjectionBase.prototype, \"near\", {\r\n /**\r\n *\r\n * @returns {number}\r\n */\r\n get: function () {\r\n if (this._propertiesDirty)\r\n this._updateProperties();\r\n return this._near;\r\n },\r\n set: function (value) {\r\n if (value == this._near)\r\n return;\r\n this._near = value;\r\n this._invalidateFrustumMatrix3D();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ProjectionBase.prototype, \"originX\", {\r\n /**\r\n *\r\n * @returns {number}\r\n */\r\n get: function () {\r\n if (this._propertiesDirty)\r\n this._updateProperties();\r\n return this._originX;\r\n },\r\n set: function (value) {\r\n if (this._originX == value)\r\n return;\r\n this._originX = value;\r\n this._invalidateFrustumMatrix3D();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ProjectionBase.prototype, \"originY\", {\r\n /**\r\n *\r\n * @returns {number}\r\n */\r\n get: function () {\r\n if (this._propertiesDirty)\r\n this._updateProperties();\r\n return this._originY;\r\n },\r\n set: function (value) {\r\n if (this._originY == value)\r\n return;\r\n this._originY = value;\r\n this._invalidateFrustumMatrix3D();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ProjectionBase.prototype, \"far\", {\r\n /**\r\n *\r\n * @returns {number}\r\n */\r\n get: function () {\r\n if (this._propertiesDirty)\r\n this._updateProperties();\r\n return this._far;\r\n },\r\n set: function (value) {\r\n if (value == this._far)\r\n return;\r\n this._far = value;\r\n this._invalidateFrustumMatrix3D();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /*\r\n \r\n */\r\n ProjectionBase.prototype.project = function (vector3D) {\r\n var v = this.viewMatrix3D.transformVector(vector3D);\r\n v.x = v.x / v.w;\r\n v.y = -v.y / v.w;\r\n //z is remapped to w\r\n v.z = v.w;\r\n v.w = 1;\r\n return v;\r\n };\r\n Object.defineProperty(ProjectionBase.prototype, \"viewMatrix3D\", {\r\n get: function () {\r\n if (this._viewMatrix3DDirty) {\r\n this._viewMatrix3DDirty = false;\r\n if (this._transform) {\r\n this._viewMatrix3D.copyFrom(this._transform.inverseConcatenatedMatrix3D);\r\n this._viewMatrix3D.append(this.frustumMatrix3D);\r\n }\r\n else {\r\n this._viewMatrix3D.copyFrom(this.frustumMatrix3D);\r\n }\r\n }\r\n return this._viewMatrix3D;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ProjectionBase.prototype, \"inverseViewMatrix3D\", {\r\n get: function () {\r\n if (this._inverseViewMatrix3DDirty) {\r\n this._inverseViewMatrix3DDirty = false;\r\n this._inverseViewMatrix3D.copyFrom(this.viewMatrix3D);\r\n this._inverseViewMatrix3D.invert();\r\n }\r\n return this._inverseViewMatrix3D;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n ProjectionBase.prototype.unproject = function (nX, nY, sZ, target) {\r\n if (target === void 0) { target = null; }\r\n throw new AbstractMethodError();\r\n };\r\n ProjectionBase.prototype.clone = function () {\r\n throw new AbstractMethodError();\r\n };\r\n ProjectionBase.prototype._invalidateProperties = function () {\r\n this._propertiesDirty = true;\r\n };\r\n ProjectionBase.prototype._invalidateViewMatrix3D = function () {\r\n this._viewMatrix3DDirty = true;\r\n this._inverseViewMatrix3DDirty = true;\r\n this._frustumPlanesDirty = true;\r\n this.dispatchEvent(new ProjectionEvent(ProjectionEvent.MATRIX_CHANGED, this));\r\n };\r\n ProjectionBase.prototype._invalidateFrustumMatrix3D = function () {\r\n if (this._propertiesDirty)\r\n this._updateProperties();\r\n this._frustumMatrix3DDirty = true;\r\n this._invalidateViewMatrix3D();\r\n };\r\n ProjectionBase.prototype.setViewRect = function (x, y, width, height) {\r\n this._viewRect.x = x;\r\n this._viewRect.y = y;\r\n this._viewRect.width = width;\r\n this._viewRect.height = height;\r\n this._invalidateFrustumMatrix3D();\r\n };\r\n ProjectionBase.prototype.setStageRect = function (x, y, width, height) {\r\n this._stageRect.x = x;\r\n this._stageRect.y = y;\r\n this._stageRect.width = width;\r\n this._stageRect.height = height;\r\n this._invalidateFrustumMatrix3D();\r\n };\r\n ProjectionBase.prototype._updateFrustumMatrix3D = function () {\r\n this._frustumMatrix3DDirty = false;\r\n };\r\n ProjectionBase.prototype._updateProperties = function () {\r\n this._propertiesDirty = false;\r\n };\r\n Object.defineProperty(ProjectionBase.prototype, \"frustumPlanes\", {\r\n get: function () {\r\n if (this._frustumPlanesDirty)\r\n this._updateFrustumPlanes();\r\n return this._frustumPlanes;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n ProjectionBase.prototype._updateFrustumPlanes = function () {\r\n this._frustumPlanesDirty = false;\r\n if (!this._frustumPlanes) {\r\n this._frustumPlanes = [];\r\n for (var i = 0; i < 6; ++i)\r\n this._frustumPlanes[i] = new Plane3D();\r\n }\r\n var a, b, c;\r\n //var d : Number;\r\n var c11, c12, c13, c14;\r\n var c21, c22, c23, c24;\r\n var c31, c32, c33, c34;\r\n var c41, c42, c43, c44;\r\n var p;\r\n var raw = this.viewMatrix3D._rawData;\r\n var invLen;\r\n c11 = raw[0];\r\n c12 = raw[4];\r\n c13 = raw[8];\r\n c14 = raw[12];\r\n c21 = raw[1];\r\n c22 = raw[5];\r\n c23 = raw[9];\r\n c24 = raw[13];\r\n c31 = raw[2];\r\n c32 = raw[6];\r\n c33 = raw[10];\r\n c34 = raw[14];\r\n c41 = raw[3];\r\n c42 = raw[7];\r\n c43 = raw[11];\r\n c44 = raw[15];\r\n // left plane\r\n p = this._frustumPlanes[0];\r\n a = c41 + c11;\r\n b = c42 + c12;\r\n c = c43 + c13;\r\n invLen = 1 / Math.sqrt(a * a + b * b + c * c);\r\n p.a = a * invLen;\r\n p.b = b * invLen;\r\n p.c = c * invLen;\r\n p.d = -(c44 + c14) * invLen;\r\n // right plane\r\n p = this._frustumPlanes[1];\r\n a = c41 - c11;\r\n b = c42 - c12;\r\n c = c43 - c13;\r\n invLen = 1 / Math.sqrt(a * a + b * b + c * c);\r\n p.a = a * invLen;\r\n p.b = b * invLen;\r\n p.c = c * invLen;\r\n p.d = (c14 - c44) * invLen;\r\n // bottom\r\n p = this._frustumPlanes[2];\r\n a = c41 + c21;\r\n b = c42 + c22;\r\n c = c43 + c23;\r\n invLen = 1 / Math.sqrt(a * a + b * b + c * c);\r\n p.a = a * invLen;\r\n p.b = b * invLen;\r\n p.c = c * invLen;\r\n p.d = -(c44 + c24) * invLen;\r\n // top\r\n p = this._frustumPlanes[3];\r\n a = c41 - c21;\r\n b = c42 - c22;\r\n c = c43 - c23;\r\n invLen = 1 / Math.sqrt(a * a + b * b + c * c);\r\n p.a = a * invLen;\r\n p.b = b * invLen;\r\n p.c = c * invLen;\r\n p.d = (c24 - c44) * invLen;\r\n // near\r\n p = this._frustumPlanes[4];\r\n a = c31;\r\n b = c32;\r\n c = c33;\r\n invLen = 1 / Math.sqrt(a * a + b * b + c * c);\r\n p.a = a * invLen;\r\n p.b = b * invLen;\r\n p.c = c * invLen;\r\n p.d = -c34 * invLen;\r\n // far\r\n p = this._frustumPlanes[5];\r\n a = c41 - c31;\r\n b = c42 - c32;\r\n c = c43 - c33;\r\n invLen = 1 / Math.sqrt(a * a + b * b + c * c);\r\n p.a = a * invLen;\r\n p.b = b * invLen;\r\n p.c = c * invLen;\r\n p.d = (c34 - c44) * invLen;\r\n };\r\n ProjectionBase.prototype._onInvalidateConcatenatedMatrix3D = function (event) {\r\n this._invalidateViewMatrix3D();\r\n };\r\n return ProjectionBase;\r\n}(EventDispatcher));\r\nexport { ProjectionBase };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/projections/ProjectionBase.js","import * as tslib_1 from \"tslib\";\r\nimport { Vector3D } from \"../geom/Vector3D\";\r\nimport { ProjectionEvent } from \"../events/ProjectionEvent\";\r\nimport { ProjectionBase } from \"../projections/ProjectionBase\";\r\nvar ObliqueNearPlaneProjection = (function (_super) {\r\n tslib_1.__extends(ObliqueNearPlaneProjection, _super);\r\n function ObliqueNearPlaneProjection(baseProjection, plane) {\r\n var _this = _super.call(this) || this;\r\n _this.baseProjection = baseProjection;\r\n _this.plane = plane;\r\n _this._onProjectionMatrixChangedDelegate = function (event) { return _this.onProjectionMatrixChanged(event); };\r\n return _this;\r\n }\r\n Object.defineProperty(ObliqueNearPlaneProjection.prototype, \"frustumCorners\", {\r\n //@override\r\n get: function () {\r\n return this._baseProjection.frustumCorners;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ObliqueNearPlaneProjection.prototype, \"near\", {\r\n //@override\r\n get: function () {\r\n return this._baseProjection.near;\r\n },\r\n //@override\r\n set: function (value) {\r\n this._baseProjection.near = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ObliqueNearPlaneProjection.prototype, \"far\", {\r\n //@override\r\n get: function () {\r\n return this._baseProjection.far;\r\n },\r\n //@override\r\n set: function (value) {\r\n this._baseProjection.far = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ObliqueNearPlaneProjection.prototype, \"plane\", {\r\n get: function () {\r\n return this._plane;\r\n },\r\n set: function (value) {\r\n this._plane = value;\r\n this._invalidateFrustumMatrix3D();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ObliqueNearPlaneProjection.prototype, \"baseProjection\", {\r\n set: function (value) {\r\n if (this._baseProjection)\r\n this._baseProjection.removeEventListener(ProjectionEvent.MATRIX_CHANGED, this._onProjectionMatrixChangedDelegate);\r\n this._baseProjection = value;\r\n if (this._baseProjection)\r\n this._baseProjection.addEventListener(ProjectionEvent.MATRIX_CHANGED, this._onProjectionMatrixChangedDelegate);\r\n this._invalidateFrustumMatrix3D();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n ObliqueNearPlaneProjection.prototype.onProjectionMatrixChanged = function (event) {\r\n this._invalidateFrustumMatrix3D();\r\n };\r\n //@override\r\n ObliqueNearPlaneProjection.prototype._updateFrustumMatrix3D = function () {\r\n _super.prototype._updateFrustumMatrix3D.call(this);\r\n this._frustumMatrix3D.copyFrom(this._baseProjection.frustumMatrix3D);\r\n var cx = this._plane.a;\r\n var cy = this._plane.b;\r\n var cz = this._plane.c;\r\n var cw = -this._plane.d + .05;\r\n var signX = cx >= 0 ? 1 : -1;\r\n var signY = cy >= 0 ? 1 : -1;\r\n var p = new Vector3D(signX, signY, 1, 1);\r\n var inverse = this._frustumMatrix3D.clone();\r\n inverse.invert();\r\n var q = inverse.transformVector(p);\r\n this._frustumMatrix3D.copyRowTo(3, p);\r\n var a = (q.x * p.x + q.y * p.y + q.z * p.z + q.w * p.w) / (cx * q.x + cy * q.y + cz * q.z + cw * q.w);\r\n this._frustumMatrix3D.copyRowFrom(2, new Vector3D(cx * a, cy * a, cz * a, cw * a));\r\n };\r\n return ObliqueNearPlaneProjection;\r\n}(ProjectionBase));\r\nexport { ObliqueNearPlaneProjection };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/projections/ObliqueNearPlaneProjection.js","import * as tslib_1 from \"tslib\";\r\nimport { Matrix3D } from \"../geom/Matrix3D\";\r\nimport { Vector3D } from \"../geom/Vector3D\";\r\nimport { ProjectionBase } from \"./ProjectionBase\";\r\nvar OrthographicOffCenterProjection = (function (_super) {\r\n tslib_1.__extends(OrthographicOffCenterProjection, _super);\r\n function OrthographicOffCenterProjection(minX, maxX, minY, maxY) {\r\n var _this = _super.call(this) || this;\r\n _this._minX = minX;\r\n _this._maxX = maxX;\r\n _this._minY = minY;\r\n _this._maxY = maxY;\r\n return _this;\r\n }\r\n Object.defineProperty(OrthographicOffCenterProjection.prototype, \"minX\", {\r\n get: function () {\r\n return this._minX;\r\n },\r\n set: function (value) {\r\n this._minX = value;\r\n this._invalidateFrustumMatrix3D();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(OrthographicOffCenterProjection.prototype, \"maxX\", {\r\n get: function () {\r\n return this._maxX;\r\n },\r\n set: function (value) {\r\n this._maxX = value;\r\n this._invalidateFrustumMatrix3D();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(OrthographicOffCenterProjection.prototype, \"minY\", {\r\n get: function () {\r\n return this._minY;\r\n },\r\n set: function (value) {\r\n this._minY = value;\r\n this._invalidateFrustumMatrix3D();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(OrthographicOffCenterProjection.prototype, \"maxY\", {\r\n get: function () {\r\n return this._maxY;\r\n },\r\n set: function (value) {\r\n this._maxY = value;\r\n this._invalidateFrustumMatrix3D();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n //@override\r\n OrthographicOffCenterProjection.prototype.unproject = function (nX, nY, sZ) {\r\n var v = new Vector3D(nX, -nY, sZ, 1.0);\r\n v = this.inverseViewMatrix3D.transformVector(v);\r\n //z is unaffected by transform\r\n v.z = sZ;\r\n return v;\r\n };\r\n //@override\r\n OrthographicOffCenterProjection.prototype.clone = function () {\r\n var clone = new OrthographicOffCenterProjection(this._minX, this._maxX, this._minY, this._maxY);\r\n clone._near = this._near;\r\n clone._far = this._far;\r\n return clone;\r\n };\r\n //@override\r\n OrthographicOffCenterProjection.prototype._updateFrustumMatrix3D = function () {\r\n _super.prototype._updateFrustumMatrix3D.call(this);\r\n var raw = Matrix3D.CALCULATION_MATRIX._rawData;\r\n var w = 1 / (this._maxX - this._minX);\r\n var h = 1 / (this._maxY - this._minY);\r\n var d = 1 / (this._far - this._near);\r\n raw[0] = 2 * w;\r\n raw[5] = 2 * h;\r\n raw[10] = d;\r\n raw[12] = -(this._maxX + this._minX) * w;\r\n raw[13] = -(this._maxY + this._minY) * h;\r\n raw[14] = -this._near * d;\r\n raw[15] = 1;\r\n raw[1] = raw[2] = raw[3] = raw[4] = raw[6] = raw[7] = raw[8] = raw[9] = raw[11] = 0;\r\n this._frustumMatrix3D.copyRawDataFrom(raw);\r\n this._frustumCorners[0] = this._frustumCorners[9] = this._frustumCorners[12] = this._frustumCorners[21] = this._minX;\r\n this._frustumCorners[3] = this._frustumCorners[6] = this._frustumCorners[15] = this._frustumCorners[18] = this._maxX;\r\n this._frustumCorners[1] = this._frustumCorners[4] = this._frustumCorners[13] = this._frustumCorners[16] = this._minY;\r\n this._frustumCorners[7] = this._frustumCorners[10] = this._frustumCorners[19] = this._frustumCorners[22] = this._maxY;\r\n this._frustumCorners[2] = this._frustumCorners[5] = this._frustumCorners[8] = this._frustumCorners[11] = this._near;\r\n this._frustumCorners[14] = this._frustumCorners[17] = this._frustumCorners[20] = this._frustumCorners[23] = this._far;\r\n };\r\n return OrthographicOffCenterProjection;\r\n}(ProjectionBase));\r\nexport { OrthographicOffCenterProjection };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/projections/OrthographicOffCenterProjection.js","import * as tslib_1 from \"tslib\";\r\nimport { Matrix3D } from \"../geom/Matrix3D\";\r\nimport { Vector3D } from \"../geom/Vector3D\";\r\nimport { ProjectionBase } from \"./ProjectionBase\";\r\nvar OrthographicProjection = (function (_super) {\r\n tslib_1.__extends(OrthographicProjection, _super);\r\n function OrthographicProjection(projectionHeight) {\r\n if (projectionHeight === void 0) { projectionHeight = 500; }\r\n var _this = _super.call(this) || this;\r\n _this._projectionHeight = projectionHeight;\r\n return _this;\r\n }\r\n Object.defineProperty(OrthographicProjection.prototype, \"projectionHeight\", {\r\n get: function () {\r\n return this._projectionHeight;\r\n },\r\n set: function (value) {\r\n if (value == this._projectionHeight)\r\n return;\r\n this._projectionHeight = value;\r\n this._invalidateFrustumMatrix3D();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n //@override\r\n OrthographicProjection.prototype.unproject = function (nX, nY, sZ, target) {\r\n if (target === void 0) { target = null; }\r\n if (target == null)\r\n target = new Vector3D();\r\n target.x = nX + this.viewMatrix3D._rawData[12];\r\n target.y = -nY + this.viewMatrix3D._rawData[13];\r\n target.z = sZ;\r\n target.w = 1.0;\r\n this.inverseViewMatrix3D.transformVector(target, target);\r\n //z is unaffected by transform\r\n target.z = sZ;\r\n return target;\r\n };\r\n //@override\r\n OrthographicProjection.prototype.clone = function () {\r\n var clone = new OrthographicProjection();\r\n clone._near = this._near;\r\n clone._far = this._far;\r\n clone.projectionHeight = this._projectionHeight;\r\n return clone;\r\n };\r\n //@override\r\n OrthographicProjection.prototype._updateFrustumMatrix3D = function () {\r\n _super.prototype._updateFrustumMatrix3D.call(this);\r\n var raw = Matrix3D.CALCULATION_MATRIX._rawData;\r\n this._yMax = this._projectionHeight * .5;\r\n this._xMax = this._yMax * this._viewRect.width / this._viewRect.height;\r\n var left;\r\n var right;\r\n var top;\r\n var bottom;\r\n if (this._viewRect.x == 0 && this._viewRect.y == 0 && this._viewRect.width == this._stageRect.width && this._viewRect.height == this._stageRect.height) {\r\n // assume symmetric frustum\r\n left = -this._xMax;\r\n right = this._xMax;\r\n top = -this._yMax;\r\n bottom = this._yMax;\r\n raw[0] = 2 / (this._projectionHeight * this._viewRect.width / this._viewRect.height);\r\n raw[5] = 2 / this._projectionHeight;\r\n raw[10] = 1 / (this._far - this._near);\r\n raw[14] = this._near / (this._near - this._far);\r\n raw[1] = raw[2] = raw[3] = raw[4] = raw[6] = raw[7] = raw[8] = raw[9] = raw[11] = raw[12] = raw[13] = 0;\r\n raw[15] = 1;\r\n }\r\n else {\r\n var xWidth = this._xMax * (this._stageRect.width / this._viewRect.width);\r\n var yHgt = this._yMax * (this._stageRect.height / this._viewRect.height);\r\n var center = this._xMax * (this._viewRect.x * 2 - this._stageRect.width) / this._viewRect.width + this._xMax;\r\n var middle = -this._yMax * (this._viewRect.y * 2 - this._stageRect.height) / this._viewRect.height - this._yMax;\r\n left = center - xWidth;\r\n right = center + xWidth;\r\n top = middle - yHgt;\r\n bottom = middle + yHgt;\r\n raw[0] = 2 * 1 / (right - left);\r\n raw[5] = -2 * 1 / (top - bottom);\r\n raw[10] = 1 / (this._far - this._near);\r\n raw[12] = (right + left) / (right - left);\r\n raw[13] = (bottom + top) / (bottom - top);\r\n raw[14] = this._near / (this.near - this.far);\r\n raw[1] = raw[2] = raw[3] = raw[4] = raw[6] = raw[7] = raw[8] = raw[9] = raw[11] = 0;\r\n raw[15] = 1;\r\n }\r\n this._frustumCorners[0] = this._frustumCorners[9] = this._frustumCorners[12] = this._frustumCorners[21] = left;\r\n this._frustumCorners[3] = this._frustumCorners[6] = this._frustumCorners[15] = this._frustumCorners[18] = right;\r\n this._frustumCorners[1] = this._frustumCorners[4] = this._frustumCorners[13] = this._frustumCorners[16] = top;\r\n this._frustumCorners[7] = this._frustumCorners[10] = this._frustumCorners[19] = this._frustumCorners[22] = bottom;\r\n this._frustumCorners[2] = this._frustumCorners[5] = this._frustumCorners[8] = this._frustumCorners[11] = this._near;\r\n this._frustumCorners[14] = this._frustumCorners[17] = this._frustumCorners[20] = this._frustumCorners[23] = this._far;\r\n this._frustumMatrix3D.copyRawDataFrom(raw);\r\n };\r\n return OrthographicProjection;\r\n}(ProjectionBase));\r\nexport { OrthographicProjection };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/projections/OrthographicProjection.js","import * as tslib_1 from \"tslib\";\r\nimport { Matrix3D } from \"../geom/Matrix3D\";\r\nimport { Vector3D } from \"../geom/Vector3D\";\r\nimport { CoordinateSystem } from \"./CoordinateSystem\";\r\nimport { ProjectionBase } from \"./ProjectionBase\";\r\nvar PerspectiveProjection = (function (_super) {\r\n tslib_1.__extends(PerspectiveProjection, _super);\r\n function PerspectiveProjection(fieldOfView, coordinateSystem) {\r\n if (fieldOfView === void 0) { fieldOfView = 60; }\r\n if (coordinateSystem === void 0) { coordinateSystem = CoordinateSystem.LEFT_HANDED; }\r\n var _this = _super.call(this, coordinateSystem) || this;\r\n _this._fieldOfView = 60;\r\n _this._focalLength = 1000;\r\n _this._hFieldOfView = 60;\r\n _this._hFocalLength = 1000;\r\n _this._preserveAspectRatio = true;\r\n _this._preserveFocalLength = false;\r\n _this.fieldOfView = fieldOfView;\r\n return _this;\r\n }\r\n Object.defineProperty(PerspectiveProjection.prototype, \"preserveAspectRatio\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return this._preserveAspectRatio;\r\n },\r\n set: function (value) {\r\n if (this._preserveAspectRatio == value)\r\n return;\r\n this._preserveAspectRatio = value;\r\n if (this._preserveAspectRatio)\r\n this._invalidateFrustumMatrix3D();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(PerspectiveProjection.prototype, \"preserveFocalLength\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return this._preserveFocalLength;\r\n },\r\n set: function (value) {\r\n if (this._preserveFocalLength == value)\r\n return;\r\n this._preserveFocalLength = value;\r\n this._invalidateFrustumMatrix3D();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(PerspectiveProjection.prototype, \"fieldOfView\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n if (this._frustumMatrix3DDirty && this._preserveFocalLength)\r\n this._updateFrustumMatrix3D();\r\n return this._fieldOfView;\r\n },\r\n set: function (value) {\r\n if (this._fieldOfView == value)\r\n return;\r\n this._fieldOfView = value;\r\n this._invalidateFrustumMatrix3D();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(PerspectiveProjection.prototype, \"focalLength\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n if (this._frustumMatrix3DDirty && !this._preserveFocalLength)\r\n this._updateFrustumMatrix3D();\r\n return this._focalLength;\r\n },\r\n set: function (value) {\r\n if (this._focalLength == value)\r\n return;\r\n this._focalLength = value;\r\n this._invalidateFrustumMatrix3D();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(PerspectiveProjection.prototype, \"hFieldOfView\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n if (this._frustumMatrix3DDirty && this._preserveFocalLength)\r\n this._updateFrustumMatrix3D();\r\n return this._hFieldOfView;\r\n },\r\n set: function (value) {\r\n if (this._hFieldOfView == value)\r\n return;\r\n this._hFieldOfView = value;\r\n this._hFocalLength = 1 / Math.tan(this._hFieldOfView * Math.PI / 360);\r\n this._invalidateFrustumMatrix3D();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(PerspectiveProjection.prototype, \"hFocalLength\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n if (this._frustumMatrix3DDirty && !this._preserveFocalLength)\r\n this._updateFrustumMatrix3D();\r\n return this._hFocalLength;\r\n },\r\n set: function (value) {\r\n if (this._hFocalLength == value)\r\n return;\r\n this._hFocalLength = value;\r\n this._invalidateFrustumMatrix3D();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n //@override\r\n PerspectiveProjection.prototype.unproject = function (nX, nY, sZ, target) {\r\n if (target === void 0) { target = null; }\r\n if (target == null)\r\n target = new Vector3D();\r\n target.x = nX * sZ;\r\n target.y = -nY * sZ;\r\n target.z = (this._far + this._near) / (this._far - this._near) * sZ - 2 * this._far * this._near / (this._far - this._near);\r\n target.w = sZ;\r\n this.inverseViewMatrix3D.transformVector(target, target);\r\n target.w = 1;\r\n return target;\r\n };\r\n /**\r\n *\r\n * @returns {PerspectiveProjection}\r\n */\r\n PerspectiveProjection.prototype.clone = function () {\r\n var clone = new PerspectiveProjection(this._fieldOfView, this._coordinateSystem);\r\n clone._hFieldOfView = this.hFieldOfView;\r\n clone._preserveAspectRatio = this._preserveAspectRatio;\r\n clone._preserveFocalLength = this._preserveFocalLength;\r\n clone._near = this._near;\r\n clone._far = this._far;\r\n clone._coordinateSystem = this._coordinateSystem;\r\n return clone;\r\n };\r\n /**\r\n *\r\n * @private\r\n */\r\n PerspectiveProjection.prototype._updateFrustumMatrix3D = function () {\r\n _super.prototype._updateFrustumMatrix3D.call(this);\r\n var raw = Matrix3D.CALCULATION_MATRIX._rawData;\r\n if (this._preserveFocalLength) {\r\n if (this._preserveAspectRatio)\r\n this._hFocalLength = this._focalLength;\r\n this._fieldOfView = Math.atan(0.5 * this._viewRect.height / this._focalLength) * 360 / Math.PI;\r\n this._hFieldOfView = Math.atan(0.5 * this._viewRect.width / this._hFocalLength) * 360 / Math.PI;\r\n }\r\n else {\r\n this._focalLength = 0.5 * this._viewRect.height / Math.tan(this._fieldOfView * Math.PI / 360);\r\n if (this._preserveAspectRatio)\r\n this._hFocalLength = this._focalLength;\r\n else\r\n this._hFocalLength = 0.5 * this._viewRect.width / Math.tan(this._hFieldOfView * Math.PI / 360);\r\n }\r\n // assume scissored frustum\r\n var right = (this._viewRect.x + this._originX * this._viewRect.width) / this._hFocalLength;\r\n var top = -(this._viewRect.y + this._originY * this._viewRect.height) / this._focalLength;\r\n var left = right - this._stageRect.width / this._hFocalLength;\r\n var bottom = top + this._stageRect.height / this._focalLength;\r\n raw[0] = 2 / (right - left);\r\n raw[5] = 2 / (bottom - top);\r\n raw[8] = (right + left) / (right - left);\r\n raw[9] = (bottom + top) / (bottom - top);\r\n raw[10] = (this._far + this._near) / (this._far - this._near);\r\n raw[11] = 1;\r\n raw[1] = raw[2] = raw[3] = raw[4] = raw[6] = raw[7] = raw[12] = raw[13] = raw[15] = 0;\r\n raw[14] = -2 * this._far * this._near / (this._far - this._near);\r\n if (this._coordinateSystem == CoordinateSystem.RIGHT_HANDED)\r\n raw[5] = -raw[5];\r\n this._frustumMatrix3D.copyRawDataFrom(raw);\r\n this._frustumCorners[0] = this._frustumCorners[9] = this._near * left;\r\n this._frustumCorners[3] = this._frustumCorners[6] = this._near * right;\r\n this._frustumCorners[1] = this._frustumCorners[4] = this._near * top;\r\n this._frustumCorners[7] = this._frustumCorners[10] = this._near * bottom;\r\n this._frustumCorners[12] = this._frustumCorners[21] = this._far * left;\r\n this._frustumCorners[15] = this._frustumCorners[18] = this._far * right;\r\n this._frustumCorners[13] = this._frustumCorners[16] = this._far * top;\r\n this._frustumCorners[19] = this._frustumCorners[22] = this._far * bottom;\r\n this._frustumCorners[2] = this._frustumCorners[5] = this._frustumCorners[8] = this._frustumCorners[11] = this._near;\r\n this._frustumCorners[14] = this._frustumCorners[17] = this._frustumCorners[20] = this._frustumCorners[23] = this._far;\r\n };\r\n PerspectiveProjection.prototype._updateProperties = function () {\r\n _super.prototype._updateProperties.call(this);\r\n var rawData = this._frustumMatrix3D._rawData;\r\n this._near = rawData[14] / (-1 - rawData[10]);\r\n this._far = rawData[14] / (1 - rawData[10]);\r\n //rawData[8] = 2*(this._viewRect.x + this._originX*this._viewRect.width)/this._stageRect.width - 1;\r\n this._originX = ((rawData[8] + 1) * this._stageRect.width / 2 - this._viewRect.x) / this._viewRect.width;\r\n //rawData[9] = 1 - 2*(this._viewRect.y + this._originY*this._viewRect.height)/this._stageRect.height;\r\n this._originY = ((1 - rawData[9]) * this._stageRect.height / 2 - this._viewRect.y) / this._viewRect.height;\r\n };\r\n return PerspectiveProjection;\r\n}(ProjectionBase));\r\nexport { PerspectiveProjection };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/projections/PerspectiveProjection.js","var Keyboard = (function () {\r\n function Keyboard() {\r\n }\r\n return Keyboard;\r\n}());\r\nexport { Keyboard };\r\n/**\r\n * Constant associated with the key code value for the A key (65).\r\n */\r\nKeyboard.A = 65;\r\n/**\r\n * Constant associated with the key code value for the Alternate (Option) key (18).\r\n */\r\nKeyboard.ALTERNATE = 18;\r\n/**\r\n * Select the audio mode\r\n */\r\nKeyboard.AUDIO = 0x01000017;\r\n/**\r\n * Constant associated with the key code value for the B key (66).\r\n */\r\nKeyboard.B = 66;\r\n/**\r\n * Return to previous page in application\r\n */\r\nKeyboard.BACK = 0x01000016;\r\n/**\r\n * Constant associated with the key code value for the ` key (192).\r\n */\r\nKeyboard.BACKQUOTE = 192;\r\n/**\r\n * Constant associated with the key code value for the \\ key (220).\r\n */\r\nKeyboard.BACKSLASH = 220;\r\n/**\r\n * Constant associated with the key code value for the Backspace key (8).\r\n */\r\nKeyboard.BACKSPACE = 8;\r\n/**\r\n * Blue function key button\r\n */\r\nKeyboard.BLUE = 0x01000003;\r\n/**\r\n * Constant associated with the key code value for the C key (67).\r\n */\r\nKeyboard.C = 67;\r\n/**\r\n * Constant associated with the key code value for the Caps Lock key (20).\r\n */\r\nKeyboard.CAPS_LOCK = 20;\r\n/**\r\n * Channel down\r\n */\r\nKeyboard.CHANNEL_DOWN = 0x01000005;\r\n/**\r\n * Channel up\r\n */\r\nKeyboard.CHANNEL_UP = 0x01000005;\r\n/**\r\n * Constant associated with the key code value for the , key (188).\r\n */\r\nKeyboard.COMMA = 188;\r\n/**\r\n * Constant associated with the Mac command key (15). This constant is\r\n * currently only used for setting menu key equivalents.\r\n */\r\nKeyboard.COMMAND = 15;\r\n/**\r\n * Constant associated with the key code value for the Control key (17).\r\n */\r\nKeyboard.CONTROL = 17;\r\n/**\r\n * Constant associated with the key code value for the D key (68).\r\n */\r\nKeyboard.D = 68;\r\n/**\r\n * Constant associated with the key code value for the Delete key (46).\r\n */\r\nKeyboard.DELETE = 46;\r\n/**\r\n * Constant associated with the key code value for the Down Arrow key (40).\r\n */\r\nKeyboard.DOWN = 40;\r\n/**\r\n * Engage DVR application mode\r\n */\r\nKeyboard.DVR = 0x01000019;\r\n/**\r\n * Constant associated with the key code value for the E key (69).\r\n */\r\nKeyboard.E = 69;\r\n/**\r\n * Constant associated with the key code value for the End key (35).\r\n */\r\nKeyboard.END = 35;\r\n/**\r\n * Constant associated with the key code value for the Enter key (13).\r\n */\r\nKeyboard.ENTER = 13;\r\n/**\r\n * Constant associated with the key code value for the = key (187).\r\n */\r\nKeyboard.EQUAL = 187;\r\n/**\r\n * Constant associated with the key code value for the Escape key (27).\r\n */\r\nKeyboard.ESCAPE = 27;\r\n/**\r\n * Exits current application mode\r\n */\r\nKeyboard.EXIT = 0x01000015;\r\n/**\r\n * Constant associated with the key code value for the F key (70).\r\n */\r\nKeyboard.F = 70;\r\n/**\r\n * Constant associated with the key code value for the F1 key (112).\r\n */\r\nKeyboard.F1 = 112;\r\n/**\r\n * Constant associated with the key code value for the F10 key (121).\r\n */\r\nKeyboard.F10 = 121;\r\n/**\r\n * Constant associated with the key code value for the F11 key (122).\r\n */\r\nKeyboard.F11 = 122;\r\n/**\r\n * Constant associated with the key code value for the F12 key (123).\r\n */\r\nKeyboard.F12 = 123;\r\n/**\r\n * Constant associated with the key code value for the F13 key (124).\r\n */\r\nKeyboard.F13 = 124;\r\n/**\r\n * Constant associated with the key code value for the F14 key (125).\r\n */\r\nKeyboard.F14 = 125;\r\n/**\r\n * Constant associated with the key code value for the F15 key (126).\r\n */\r\nKeyboard.F15 = 126;\r\n/**\r\n * Constant associated with the key code value for the F2 key (113).\r\n */\r\nKeyboard.F2 = 113;\r\n/**\r\n * Constant associated with the key code value for the F3 key (114).\r\n */\r\nKeyboard.F3 = 114;\r\n/**\r\n * Constant associated with the key code value for the F4 key (115).\r\n */\r\nKeyboard.F4 = 115;\r\n/**\r\n * Constant associated with the key code value for the F5 key (116).\r\n */\r\nKeyboard.F5 = 116;\r\n/**\r\n * Constant associated with the key code value for the F6 key (117).\r\n */\r\nKeyboard.F6 = 117;\r\n/**\r\n * Constant associated with the key code value for the F7 key (118).\r\n */\r\nKeyboard.F7 = 118;\r\n/**\r\n * Constant associated with the key code value for the F8 key (119).\r\n */\r\nKeyboard.F8 = 119;\r\n/**\r\n * Constant associated with the key code value for the F9 key (120).\r\n */\r\nKeyboard.F9 = 120;\r\n/**\r\n * Engage fast-forward transport mode\r\n */\r\nKeyboard.FAST_FORWARD = 0x0100000A;\r\n/**\r\n * Constant associated with the key code value for the G key (71).\r\n */\r\nKeyboard.G = 71;\r\n/**\r\n * Green function key button\r\n */\r\nKeyboard.GREEN = 0x01000001;\r\n/**\r\n * Engage program guide\r\n */\r\nKeyboard.GUIDE = 0x01000014;\r\n/**\r\n * Constant associated with the key code value for the H key (72).\r\n */\r\nKeyboard.H = 72;\r\n/**\r\n * Engage help application or context-sensitive help\r\n */\r\nKeyboard.HELP = 0x0100001D;\r\n/**\r\n * Constant associated with the key code value for the Home key (36).\r\n */\r\nKeyboard.HOME = 36;\r\n/**\r\n * Constant associated with the key code value for the I key (73).\r\n */\r\nKeyboard.I = 73;\r\n/**\r\n * Info button\r\n */\r\nKeyboard.INFO = 0x01000013;\r\n/**\r\n * Cycle input\r\n */\r\nKeyboard.INPUT = 0x0100001B;\r\n/**\r\n * Constant associated with the key code value for the Insert key (45).\r\n */\r\nKeyboard.INSERT = 45;\r\n/**\r\n * Constant associated with the key code value for the J key (74).\r\n */\r\nKeyboard.J = 74;\r\n/**\r\n * Constant associated with the key code value for the K key (75).\r\n */\r\nKeyboard.K = 75;\r\n/**\r\n * The Begin key\r\n */\r\nKeyboard.KEYNAME_BEGIN = \"Begin\";\r\n/**\r\n * The Break key\r\n */\r\nKeyboard.KEYNAME_BREAK = \"Break\";\r\n/**\r\n * The Clear Display key\r\n */\r\nKeyboard.KEYNAME_CLEARDISPLAY = \"ClrDsp\";\r\n/**\r\n * The Clear Line key\r\n */\r\nKeyboard.KEYNAME_CLEARLINE = \"ClrLn\";\r\n/**\r\n * The Delete key\r\n */\r\nKeyboard.KEYNAME_DELETE = \"Delete\";\r\n/**\r\n * The Delete Character key\r\n */\r\nKeyboard.KEYNAME_DELETECHAR = \"DelChr\";\r\n/**\r\n * The Delete Line key\r\n */\r\nKeyboard.KEYNAME_DELETELINE = \"DelLn\";\r\n/**\r\n * The down arrow\r\n */\r\nKeyboard.KEYNAME_DOWNARROW = \"Down\";\r\n/**\r\n * The End key\r\n */\r\nKeyboard.KEYNAME_END = \"End\";\r\n/**\r\n * The Execute key\r\n */\r\nKeyboard.KEYNAME_EXECUTE = \"Exec\";\r\n/**\r\n * The F1 key\r\n */\r\nKeyboard.KEYNAME_F1 = \"F1\";\r\n/**\r\n * The F10 key\r\n */\r\nKeyboard.KEYNAME_F10 = \"F10\";\r\n/**\r\n * The F11 key\r\n */\r\nKeyboard.KEYNAME_F11 = \"F11\";\r\n/**\r\n * The F12 key\r\n */\r\nKeyboard.KEYNAME_F12 = \"F12\";\r\n/**\r\n * The F13 key\r\n */\r\nKeyboard.KEYNAME_F13 = \"F13\";\r\n/**\r\n * The F14 key\r\n */\r\nKeyboard.KEYNAME_F14 = \"F14\";\r\n/**\r\n * The F15 key\r\n */\r\nKeyboard.KEYNAME_F15 = \"F15\";\r\n/**\r\n * The F16 key\r\n */\r\nKeyboard.KEYNAME_F16 = \"F16\";\r\n/**\r\n * The F17 key\r\n */\r\nKeyboard.KEYNAME_F17 = \"F17\";\r\n/**\r\n * The F18 key\r\n */\r\nKeyboard.KEYNAME_F18 = \"F18\";\r\n/**\r\n * The F19 key\r\n */\r\nKeyboard.KEYNAME_F19 = \"F19\";\r\n/**\r\n * The F2 key\r\n */\r\nKeyboard.KEYNAME_F2 = \"F2\";\r\n/**\r\n * The F20 key\r\n */\r\nKeyboard.KEYNAME_F20 = \"F20\";\r\n/**\r\n * The F21 key\r\n */\r\nKeyboard.KEYNAME_F21 = \"F21\";\r\n/**\r\n * The F22 key\r\n */\r\nKeyboard.KEYNAME_F22 = \"F22\";\r\n/**\r\n * The F23 key\r\n */\r\nKeyboard.KEYNAME_F23 = \"F23\";\r\n/**\r\n * The F24 key\r\n */\r\nKeyboard.KEYNAME_F24 = \"F24\";\r\n/**\r\n * The F25 key\r\n */\r\nKeyboard.KEYNAME_F25 = \"F25\";\r\n/**\r\n * The F26 key\r\n */\r\nKeyboard.KEYNAME_F26 = \"F26\";\r\n/**\r\n * The F27 key\r\n */\r\nKeyboard.KEYNAME_F27 = \"F27\";\r\n/**\r\n * The F28 key\r\n */\r\nKeyboard.KEYNAME_F28 = \"F28\";\r\n/**\r\n * The F29 key\r\n */\r\nKeyboard.KEYNAME_F29 = \"F29\";\r\n/**\r\n * The F3 key\r\n */\r\nKeyboard.KEYNAME_F3 = \"F3\";\r\n/**\r\n * The F30 key\r\n */\r\nKeyboard.KEYNAME_F30 = \"F30\";\r\n/**\r\n * The F31 key\r\n */\r\nKeyboard.KEYNAME_F31 = \"F31\";\r\n/**\r\n * The F32 key\r\n */\r\nKeyboard.KEYNAME_F32 = \"F32\";\r\n/**\r\n * The F33 key\r\n */\r\nKeyboard.KEYNAME_F33 = \"F33\";\r\n/**\r\n * The F34 key\r\n */\r\nKeyboard.KEYNAME_F34 = \"F34\";\r\n/**\r\n * The F35 key\r\n */\r\nKeyboard.KEYNAME_F35 = \"F35\";\r\n/**\r\n * The F4 key\r\n */\r\nKeyboard.KEYNAME_F4 = \"F4\";\r\n/**\r\n * The F5 key\r\n */\r\nKeyboard.KEYNAME_F5 = \"F5\";\r\n/**\r\n * The F6 key\r\n */\r\nKeyboard.KEYNAME_F6 = \"F6\";\r\n/**\r\n * The F7 key\r\n */\r\nKeyboard.KEYNAME_F7 = \"F7\";\r\n/**\r\n * The F8 key\r\n */\r\nKeyboard.KEYNAME_F8 = \"F8\";\r\n/**\r\n * The F9 key\r\n */\r\nKeyboard.KEYNAME_F9 = \"F9\";\r\n/**\r\n * The Find key\r\n */\r\nKeyboard.KEYNAME_FIND = \"Find\";\r\n/**\r\n * The Help key\r\n */\r\nKeyboard.KEYNAME_HELP = \"Help\";\r\n/**\r\n * The Home key\r\n */\r\nKeyboard.KEYNAME_HOME = \"Home\";\r\n/**\r\n * The Insert key\r\n */\r\nKeyboard.KEYNAME_INSERT = \"Insert\";\r\n/**\r\n * The Insert Character key\r\n */\r\nKeyboard.KEYNAME_INSERTCHAR = \"InsChr\";\r\n/**\r\n * The Insert Line key\r\n */\r\nKeyboard.KEYNAME_INSERTLINE = \"LnsLn\";\r\n/**\r\n * The left arrow\r\n */\r\nKeyboard.KEYNAME_LEFTARROW = \"Left\";\r\n/**\r\n * The Menu key\r\n */\r\nKeyboard.KEYNAME_MENU = \"Menu\";\r\n/**\r\n * The Mode Switch key\r\n */\r\nKeyboard.KEYNAME_MODESWITCH = \"ModeSw\";\r\n/**\r\n * The Next key\r\n */\r\nKeyboard.KEYNAME_NEXT = \"Next\";\r\n/**\r\n * The Page Down key\r\n */\r\nKeyboard.KEYNAME_PAGEDOWN = \"PgDn\";\r\n/**\r\n * The Page Up key\r\n */\r\nKeyboard.KEYNAME_PAGEUP = \"PgUp\";\r\n/**\r\n * The Pause key\r\n */\r\nKeyboard.KEYNAME_PAUSE = \"Pause\";\r\n/**\r\n * The Previous key\r\n */\r\nKeyboard.KEYNAME_PREV = \"Prev\";\r\n/**\r\n * The PRINT key\r\n */\r\nKeyboard.KEYNAME_PRINT = \"Print\";\r\n/**\r\n * The PRINT Screen\r\n */\r\nKeyboard.KEYNAME_PRINTSCREEN = \"PrntScrn\";\r\n/**\r\n * The Redo key\r\n */\r\nKeyboard.KEYNAME_REDO = \"Redo\";\r\n/**\r\n * The Reset key\r\n */\r\nKeyboard.KEYNAME_RESET = \"Reset\";\r\n/**\r\n * The right arrow\r\n */\r\nKeyboard.KEYNAME_RIGHTARROW = \"Right\";\r\n/**\r\n * The Scroll Lock key\r\n */\r\nKeyboard.KEYNAME_SCROLLLOCK = \"ScrlLck\";\r\n/**\r\n * The Select key\r\n */\r\nKeyboard.KEYNAME_SELECT = \"Select\";\r\n/**\r\n * The Stop key\r\n */\r\nKeyboard.KEYNAME_STOP = \"Stop\";\r\n/**\r\n * The System Request key\r\n */\r\nKeyboard.KEYNAME_SYSREQ = \"SysReq\";\r\n/**\r\n * The System key\r\n */\r\nKeyboard.KEYNAME_SYSTEM = \"Sys\";\r\n/**\r\n * The Undo key\r\n */\r\nKeyboard.KEYNAME_UNDO = \"Undo\";\r\n/**\r\n * The up arrow\r\n */\r\nKeyboard.KEYNAME_UPARROW = \"Up\";\r\n/**\r\n * The User key\r\n */\r\nKeyboard.KEYNAME_USER = \"User\";\r\n/**\r\n * Constant associated with the key code value for the L key (76).\r\n */\r\nKeyboard.L = 76;\r\n/**\r\n * Watch last channel or show watched\r\n */\r\nKeyboard.LAST = 0x01000011;\r\n/**\r\n * Constant associated with the key code value for the Left Arrow key (37).\r\n */\r\nKeyboard.LEFT = 37;\r\n/**\r\n * Constant associated with the key code value for the [ key (219).\r\n */\r\nKeyboard.LEFTBRACKET = 219;\r\n/**\r\n * Return to live [position in broadcast]\r\n */\r\nKeyboard.LIVE = 0x01000010;\r\n/**\r\n * Constant associated with the key code value for the M key (77).\r\n */\r\nKeyboard.M = 77;\r\n/**\r\n * Engage \"Master Shell\" e.g. TiVo or other vendor button\r\n */\r\nKeyboard.MASTER_SHELL = 0x0100001E;\r\n/**\r\n * Engage menu\r\n */\r\nKeyboard.MENU = 0x01000012;\r\n/**\r\n * Constant associated with the key code value for the - key (189).\r\n */\r\nKeyboard.MINUS = 189;\r\n/**\r\n * Constant associated with the key code value for the N key (78).\r\n */\r\nKeyboard.N = 78;\r\n/**\r\n * Skip to next track or chapter\r\n */\r\nKeyboard.NEXT = 0x0100000E;\r\n/**\r\n * Constant associated with the key code value for the 0 key (48).\r\n */\r\nKeyboard.NUMBER_0 = 48;\r\n/**\r\n * Constant associated with the key code value for the 1 key (49).\r\n */\r\nKeyboard.NUMBER_1 = 49;\r\n/**\r\n * Constant associated with the key code value for the 2 key (50).\r\n */\r\nKeyboard.NUMBER_2 = 50;\r\n/**\r\n * Constant associated with the key code value for the 3 key (51).\r\n */\r\nKeyboard.NUMBER_3 = 51;\r\n/**\r\n * Constant associated with the key code value for the 4 key (52).\r\n */\r\nKeyboard.NUMBER_4 = 52;\r\n/**\r\n * Constant associated with the key code value for the 5 key (53).\r\n */\r\nKeyboard.NUMBER_5 = 53;\r\n/**\r\n * Constant associated with the key code value for the 6 key (54).\r\n */\r\nKeyboard.NUMBER_6 = 54;\r\n/**\r\n * Constant associated with the key code value for the 7 key (55).\r\n */\r\nKeyboard.NUMBER_7 = 55;\r\n/**\r\n * Constant associated with the key code value for the 8 key (56).\r\n */\r\nKeyboard.NUMBER_8 = 56;\r\n/**\r\n * Constant associated with the key code value for the 9 key (57).\r\n */\r\nKeyboard.NUMBER_9 = 57;\r\n/**\r\n * Constant associated with the pseudo-key code for the the number pad (21). Use to set numpad modifier on key equivalents\r\n */\r\nKeyboard.NUMPAD = 21;\r\n/**\r\n * Constant associated with the key code value for the number 0 key on the number pad (96).\r\n */\r\nKeyboard.NUMPAD_0 = 96;\r\n/**\r\n * Constant associated with the key code value for the number 1 key on the number pad (97).\r\n */\r\nKeyboard.NUMPAD_1 = 97;\r\n/**\r\n * Constant associated with the key code value for the number 2 key on the number pad (98).\r\n */\r\nKeyboard.NUMPAD_2 = 98;\r\n/**\r\n * Constant associated with the key code value for the number 3 key on the number pad (99).\r\n */\r\nKeyboard.NUMPAD_3 = 99;\r\n/**\r\n * Constant associated with the key code value for the number 4 key on the number pad (100).\r\n */\r\nKeyboard.NUMPAD_4 = 100;\r\n/**\r\n * Constant associated with the key code value for the number 5 key on the number pad (101).\r\n */\r\nKeyboard.NUMPAD_5 = 101;\r\n/**\r\n * Constant associated with the key code value for the number 6 key on the number pad (102).\r\n */\r\nKeyboard.NUMPAD_6 = 102;\r\n/**\r\n * Constant associated with the key code value for the number 7 key on the number pad (103).\r\n */\r\nKeyboard.NUMPAD_7 = 103;\r\n/**\r\n * Constant associated with the key code value for the number 8 key on the number pad (104).\r\n */\r\nKeyboard.NUMPAD_8 = 104;\r\n/**\r\n * Constant associated with the key code value for the number 9 key on the number pad (105).\r\n */\r\nKeyboard.NUMPAD_9 = 105;\r\n/**\r\n * Constant associated with the key code value for the addition key on the number pad (107).\r\n */\r\nKeyboard.NUMPAD_ADD = 107;\r\n/**\r\n * Constant associated with the key code value for the decimal key on the number pad (110).\r\n */\r\nKeyboard.NUMPAD_DECIMAL = 110;\r\n/**\r\n * Constant associated with the key code value for the division key on the number pad (111).\r\n */\r\nKeyboard.NUMPAD_DIVIDE = 111;\r\n/**\r\n * Constant associated with the key code value for the Enter key on the number pad (108).\r\n */\r\nKeyboard.NUMPAD_ENTER = 108;\r\n/**\r\n * Constant associated with the key code value for the multiplication key on the number pad (106).\r\n */\r\nKeyboard.NUMPAD_MULTIPLY = 106;\r\n/**\r\n * Constant associated with the key code value for the subtraction key on the number pad (109).\r\n */\r\nKeyboard.NUMPAD_SUBTRACT = 109;\r\n/**\r\n * Constant associated with the key code value for the O key (79).\r\n */\r\nKeyboard.O = 79;\r\n/**\r\n * Constant associated with the key code value for the P key (80).\r\n */\r\nKeyboard.P = 80;\r\n/**\r\n * Constant associated with the key code value for the Page Down key (34).\r\n */\r\nKeyboard.PAGE_DOWN = 34;\r\n/**\r\n * Constant associated with the key code value for the Page Up key (33).\r\n */\r\nKeyboard.PAGE_UP = 33;\r\n/**\r\n * Engage pause transport mode\r\n */\r\nKeyboard.PAUSE = 0x01000008;\r\n/**\r\n * Constant associated with the key code value for the . key (190).\r\n */\r\nKeyboard.PERIOD = 190;\r\n/**\r\n * Engage play transport mode\r\n */\r\nKeyboard.PLAY = 0x01000007;\r\n/**\r\n * Skip to previous track or chapter\r\n */\r\nKeyboard.PREVIOUS = 0x0100000F;\r\n/**\r\n * Constant associated with the key code value for the Q key (81).\r\n */\r\nKeyboard.Q = 81;\r\n/**\r\n * Constant associated with the key code value for the ' key (222).\r\n */\r\nKeyboard.QUOTE = 222;\r\n/**\r\n * Constant associated with the key code value for the R key (82).\r\n */\r\nKeyboard.R = 82;\r\n/**\r\n * Record item or engage record transport mode\r\n */\r\nKeyboard.RECORD = 0x01000006;\r\n/**\r\n * Red function key button\r\n */\r\nKeyboard.RED = 0x01000000;\r\n/**\r\n * Engage rewind transport mode\r\n */\r\nKeyboard.REWIND = 0x0100000B;\r\n/**\r\n * Constant associated with the key code value for the Right Arrow key (39).\r\n */\r\nKeyboard.RIGHT = 39;\r\n/**\r\n * Constant associated with the key code value for the ] key (221).\r\n */\r\nKeyboard.RIGHTBRACKET = 221;\r\n/**\r\n * Constant associated with the key code value for the S key (83).\r\n */\r\nKeyboard.S = 83;\r\n/**\r\n * Search button\r\n */\r\nKeyboard.SEARCH = 0x0100001F;\r\n/**\r\n * Constant associated with the key code value for the ; key (186).\r\n */\r\nKeyboard.SEMICOLON = 186;\r\n/**\r\n * Engage setup application or menu\r\n */\r\nKeyboard.SETUP = 0x0100001C;\r\n/**\r\n * Constant associated with the key code value for the Shift key (16).\r\n */\r\nKeyboard.SHIFT = 16;\r\n/**\r\n * Quick skip backward (usually 7-10 seconds)\r\n */\r\nKeyboard.SKIP_BACKWARD = 0x0100000D;\r\n/**\r\n * Quick skip ahead (usually 30 seconds)\r\n */\r\nKeyboard.SKIP_FORWARD = 0x0100000C;\r\n/**\r\n * Constant associated with the key code value for the / key (191).\r\n */\r\nKeyboard.SLASH = 191;\r\n/**\r\n * Constant associated with the key code value for the Spacebar (32).\r\n */\r\nKeyboard.SPACE = 32;\r\n/**\r\n * Engage stop transport mode\r\n */\r\nKeyboard.STOP = 0x01000009;\r\n/**\r\n * Toggle subtitles\r\n */\r\nKeyboard.SUBTITLE = 0x01000018;\r\n/**\r\n * Constant associated with the key code value for the T key (84).\r\n */\r\nKeyboard.T = 84;\r\n/**\r\n * Constant associated with the key code value for the Tab key (9).\r\n */\r\nKeyboard.TAB = 9;\r\n/**\r\n * Constant associated with the key code value for the U key (85).\r\n */\r\nKeyboard.U = 85;\r\n/**\r\n * Constant associated with the key code value for the Up Arrow key (38).\r\n */\r\nKeyboard.UP = 38;\r\n/**\r\n * Constant associated with the key code value for the V key (86).\r\n */\r\nKeyboard.V = 86;\r\n/**\r\n * Engage video-on-demand\r\n */\r\nKeyboard.VOD = 0x0100001A;\r\n/**\r\n * Constant associated with the key code value for the W key (87).\r\n */\r\nKeyboard.W = 87;\r\n/**\r\n * Constant associated with the key code value for the X key (88).\r\n */\r\nKeyboard.X = 88;\r\n/**\r\n * Constant associated with the key code value for the Y key (89).\r\n */\r\nKeyboard.Y = 89;\r\n/**\r\n * Yellow function key button\r\n */\r\nKeyboard.YELLOW = 0x01000002;\r\n/**\r\n * Constant associated with the key code value for the Z key (90).\r\n */\r\nKeyboard.Z = 90;\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/ui/Keyboard.js","var Byte32Array = (function () {\r\n function Byte32Array(byteLength) {\r\n if (byteLength === void 0) { byteLength = 0; }\r\n this._maxLength = -1;\r\n this.bytePosition = 0;\r\n this.byteLength = -1;\r\n this._ensureSpace(byteLength);\r\n }\r\n Object.defineProperty(Byte32Array.prototype, \"arrayBuffer\", {\r\n get: function () {\r\n return this._arrayBuffer;\r\n },\r\n set: function (value) {\r\n //reset position\r\n this.bytePosition = 0;\r\n //clear length\r\n this.byteLength = -1;\r\n this._maxLength = -1;\r\n //calc new length\r\n this._ensureSpace(value.byteLength);\r\n //write new buffer\r\n this._int32Array.set(new Int32Array(value));\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Byte32Array.prototype.readByte32Array = function (byte32Array, byteLength) {\r\n if (byteLength === void 0) { byteLength = -1; }\r\n if (byteLength == -1)\r\n byteLength = byte32Array.byteLength - byte32Array.bytePosition;\r\n byte32Array.writeInt32Array(this._int32Array.subarray(this.bytePosition / 4, (this.bytePosition + byteLength) / 4));\r\n this.bytePosition += byteLength;\r\n };\r\n Byte32Array.prototype.writeByte32Array = function (byte32Array) {\r\n byte32Array.bytePosition = 0;\r\n byte32Array.readByte32Array(this, byte32Array.byteLength);\r\n };\r\n Byte32Array.prototype.writeFloat32Array = function (float32Array) {\r\n this._ensureSpace(this.bytePosition + float32Array.length * 4);\r\n this._float32Array.set(float32Array, this.bytePosition / 4);\r\n this.bytePosition += float32Array.length * 4;\r\n };\r\n Byte32Array.prototype.writeInt32Array = function (int32Array) {\r\n this._ensureSpace(this.bytePosition + int32Array.length * 4);\r\n this._uint32Array.set(int32Array, this.bytePosition / 4);\r\n this.bytePosition += int32Array.length * 4;\r\n };\r\n Byte32Array.prototype.writeUint32Array = function (uint32Array) {\r\n this._ensureSpace(this.bytePosition + uint32Array.length * 4);\r\n this._uint32Array.set(uint32Array, this.bytePosition / 4);\r\n this.bytePosition += uint32Array.length * 4;\r\n };\r\n Byte32Array.prototype.readFloat32Array = function (float32Array) {\r\n float32Array.set(this._float32Array.subarray(this.bytePosition / 4, this.bytePosition / 4 + float32Array.length));\r\n };\r\n Byte32Array.prototype.readInt32Array = function (int32Array) {\r\n int32Array.set(this._int32Array.subarray(this.bytePosition / 4, this.bytePosition / 4 + int32Array.length));\r\n };\r\n Byte32Array.prototype.readUint32Array = function (uint32Array) {\r\n uint32Array.set(this._uint32Array.subarray(this.bytePosition / 4, this.bytePosition / 4 + uint32Array.length));\r\n };\r\n Byte32Array.prototype.getBytesAvailable = function () {\r\n return this.byteLength - this.bytePosition;\r\n };\r\n Byte32Array.prototype.readUTFBytes = function (len) {\r\n var value = \"\";\r\n var max = this.bytePosition + len;\r\n var data = new DataView(this._arrayBuffer);\r\n // utf8-encode\r\n while (this.bytePosition < max) {\r\n var c = data.getUint8(this.bytePosition++);\r\n if (c < 0x80) {\r\n if (c == 0)\r\n break;\r\n value += String.fromCharCode(c);\r\n }\r\n else if (c < 0xE0) {\r\n value += String.fromCharCode(((c & 0x3F) << 6) | (data.getUint8(this.bytePosition++) & 0x7F));\r\n }\r\n else if (c < 0xF0) {\r\n var c2 = data.getUint8(this.bytePosition++);\r\n value += String.fromCharCode(((c & 0x1F) << 12) | ((c2 & 0x7F) << 6) | (data.getUint8(this.bytePosition++) & 0x7F));\r\n }\r\n else {\r\n var c2 = data.getUint8(this.bytePosition++);\r\n var c3 = data.getUint8(this.bytePosition++);\r\n value += String.fromCharCode(((c & 0x0F) << 18) | ((c2 & 0x7F) << 12) | ((c3 << 6) & 0x7F) | (data.getUint8(this.bytePosition++) & 0x7F));\r\n }\r\n }\r\n return value;\r\n };\r\n Byte32Array.prototype.writeUTFBytes = function (s) {\r\n var escstr = encodeURIComponent(s);\r\n var binstr = escstr.replace(/%([0-9A-F]{2})/g, function (match, p1) {\r\n return String.fromCharCode(parseInt('0x' + p1));\r\n });\r\n if (binstr.length % 4) {\r\n var padding = 4 - (binstr.length % 4);\r\n for (var i = 0; i < padding; i++)\r\n binstr += \" \";\r\n }\r\n this._ensureSpace(this.bytePosition + 4 + binstr.length);\r\n this.writeInt(binstr.length);\r\n for (var i = 0; i < binstr.length; i += 4)\r\n this.writeUnsignedInt((binstr.charCodeAt(i + 3) << 24) | (binstr.charCodeAt(i + 2) << 16) | (binstr.charCodeAt(i + 1) << 8) | binstr.charCodeAt(i));\r\n return binstr.length;\r\n };\r\n Byte32Array.prototype.readInt = function () {\r\n if (this.bytePosition > this.byteLength + 4)\r\n throw \"ByteArray out of bounds read. Position=\" + this.bytePosition + \", Length=\" + this.byteLength;\r\n var pa = this.bytePosition >> 2;\r\n this.bytePosition += 4;\r\n return this._int32Array[pa];\r\n };\r\n Byte32Array.prototype.writeUnsignedInt = function (b) {\r\n this._ensureSpace(this.bytePosition + 4);\r\n this._uint32Array[this.bytePosition >> 2] = (~~b) & 0xffffffff; // ~~ is cast to int in js...\r\n this.bytePosition += 4;\r\n };\r\n Byte32Array.prototype.writeInt = function (b) {\r\n this._ensureSpace(this.bytePosition + 4);\r\n this._int32Array[this.bytePosition >> 2] = (~~b); // ~~ is cast to int in js...\r\n this.bytePosition += 4;\r\n };\r\n Byte32Array.prototype.readUnsignedInt = function () {\r\n if (this.bytePosition > this.byteLength + 4)\r\n throw \"ByteArray out of bounds read. Position=\" + this.bytePosition + \", Length=\" + this.byteLength;\r\n var pa = this.bytePosition >> 2;\r\n this.bytePosition += 4;\r\n return this._uint32Array[pa];\r\n };\r\n Byte32Array.prototype.writeFloat = function (b) {\r\n this._ensureSpace(this.bytePosition + 4);\r\n this._float32Array[this.bytePosition >> 2] = b;\r\n this.bytePosition += 4;\r\n };\r\n Byte32Array.prototype.readFloat = function () {\r\n if (this.bytePosition > this.byteLength + 4)\r\n throw \"ByteArray out of bounds read. Positon=\" + this.bytePosition + \", Length=\" + this.byteLength;\r\n var pa = this.bytePosition >> 2;\r\n this.bytePosition += 4;\r\n return this._float32Array[pa];\r\n };\r\n Byte32Array.prototype._ensureSpace = function (length) {\r\n if (this.byteLength < length) {\r\n this.byteLength = length;\r\n if (this._maxLength < length) {\r\n this._maxLength = Math.max((length + 255) & (~255), 4);\r\n var newArrayBuffer = new ArrayBuffer(this._maxLength);\r\n var newInt32Array = new Int32Array(newArrayBuffer);\r\n if (this._int32Array)\r\n newInt32Array.set(this._int32Array); // memcpy\r\n this._uint32Array = new Uint32Array(newArrayBuffer);\r\n this._float32Array = new Float32Array(newArrayBuffer);\r\n this._int32Array = newInt32Array;\r\n this._arrayBuffer = newArrayBuffer;\r\n }\r\n }\r\n };\r\n return Byte32Array;\r\n}());\r\nexport { Byte32Array };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/utils/Byte32Array.js","import * as tslib_1 from \"tslib\";\r\nimport { ByteArrayBase } from \"../utils/ByteArrayBase\";\r\nvar ByteArrayBuffer = (function (_super) {\r\n tslib_1.__extends(ByteArrayBuffer, _super);\r\n function ByteArrayBuffer() {\r\n var _this = _super.call(this) || this;\r\n _this._bytes = [];\r\n _this._mode = \"Array\";\r\n return _this;\r\n }\r\n ByteArrayBuffer.prototype.writeByte = function (b) {\r\n var bi = ~~b;\r\n this._bytes[this.position++] = bi;\r\n if (this.position > this.length) {\r\n this.length = this.position;\r\n }\r\n };\r\n ByteArrayBuffer.prototype.readByte = function () {\r\n if (this.position >= this.length) {\r\n throw \"ByteArray out of bounds read. Position=\" + this.position + \", Length=\" + this.length;\r\n }\r\n return this._bytes[this.position++];\r\n };\r\n ByteArrayBuffer.prototype.writeUnsignedByte = function (b) {\r\n var bi = ~~b;\r\n this._bytes[this.position++] = bi & 0xff;\r\n if (this.position > this.length) {\r\n this.length = this.position;\r\n }\r\n };\r\n ByteArrayBuffer.prototype.readUnsignedByte = function () {\r\n if (this.position >= this.length) {\r\n throw \"ByteArray out of bounds read. Position=\" + this.position + \", Length=\" + this.length;\r\n }\r\n return this._bytes[this.position++];\r\n };\r\n ByteArrayBuffer.prototype.writeUnsignedShort = function (b) {\r\n var bi = ~~b;\r\n this._bytes[this.position++] = bi & 0xff;\r\n this._bytes[this.position++] = (bi >> 8) & 0xff;\r\n if (this.position > this.length) {\r\n this.length = this.position;\r\n }\r\n };\r\n ByteArrayBuffer.prototype.readUnsignedShort = function () {\r\n if (this.position + 2 > this.length)\r\n throw \"ByteArray out of bounds read. Position=\" + this.position + \", Length=\" + this.length;\r\n var r = this._bytes[this.position] | (this._bytes[this.position + 1] << 8);\r\n this.position += 2;\r\n return r;\r\n };\r\n ByteArrayBuffer.prototype.writeUnsignedInt = function (b) {\r\n var bi = ~~b;\r\n this._bytes[this.position++] = bi & 0xff;\r\n this._bytes[this.position++] = (bi >>> 8) & 0xff;\r\n this._bytes[this.position++] = (bi >>> 16) & 0xff;\r\n this._bytes[this.position++] = (bi >>> 24) & 0xff;\r\n if (this.position > this.length) {\r\n this.length = this.position;\r\n }\r\n };\r\n ByteArrayBuffer.prototype.readUnsignedInt = function () {\r\n if (this.position + 4 > this.length) {\r\n throw \"ByteArray out of bounds read. Position=\" + this.position + \", Length=\" + this.length;\r\n }\r\n var r = this._bytes[this.position] | (this._bytes[this.position + 1] << 8) | (this._bytes[this.position + 2] << 16) | (this._bytes[this.position + 3] << 24);\r\n this.position += 4;\r\n return r >>> 0;\r\n };\r\n ByteArrayBuffer.prototype.writeFloat = function (b) {\r\n // this is crazy slow and silly, but as a fallback...\r\n this.writeUnsignedInt(this.toFloatBits(Number(b)));\r\n };\r\n ByteArrayBuffer.prototype.toFloatBits = function (x) {\r\n // don't handle inf/nan yet\r\n // special case zero\r\n if (x == 0) {\r\n return 0;\r\n }\r\n // remove the sign, after this we only deal with positive numbers\r\n var sign = 0;\r\n if (x < 0) {\r\n x = -x;\r\n sign = 1;\r\n }\r\n else {\r\n sign = 0;\r\n }\r\n // a float value is now defined as: x = (1+(mantissa*2^-23))*(2^(exponent-127))\r\n var exponent = Math.log(x) / Math.log(2); // rough exponent\r\n exponent = Math.floor(exponent);\r\n x = x * Math.pow(2, 23 - exponent); // normalize to 24 bits\r\n var mantissa = Math.floor(x) - 0x800000;\r\n exponent = exponent + 127;\r\n return ((sign << 31) >>> 0) | (exponent << 23) | mantissa;\r\n };\r\n ByteArrayBuffer.prototype.readFloat = function (b) {\r\n return this.fromFloatBits(this.readUnsignedInt());\r\n };\r\n ByteArrayBuffer.prototype.fromFloatBits = function (x) {\r\n if (x == 0) {\r\n return 0;\r\n }\r\n var exponent = (x >>> 23) & 0xff;\r\n var mantissa = (x & 0x7fffff) | 0x800000;\r\n var y = Math.pow(2, (exponent - 127) - 23) * mantissa;\r\n if (x >>> 31 != 0) {\r\n y = -y;\r\n }\r\n return y;\r\n };\r\n return ByteArrayBuffer;\r\n}(ByteArrayBase));\r\nexport { ByteArrayBuffer };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/utils/ByteArrayBuffer.js","var CSS = (function () {\r\n function CSS() {\r\n }\r\n CSS.setElementSize = function (element, width, height) {\r\n if (!element)\r\n return;\r\n element.style.width = width + \"px\";\r\n element.style.height = height + \"px\";\r\n element[\"width\"] = width;\r\n element[\"height\"] = height;\r\n };\r\n CSS.setElementWidth = function (element, width) {\r\n if (!element)\r\n return;\r\n element.style.width = width + \"px\";\r\n element[\"width\"] = width;\r\n };\r\n CSS.setElementHeight = function (element, height) {\r\n if (!element)\r\n return;\r\n element.style.height = height + \"px\";\r\n element[\"height\"] = height;\r\n };\r\n CSS.setElementX = function (element, x) {\r\n if (!element)\r\n return;\r\n element.style.position = 'absolute';\r\n element.style.left = x + \"px\";\r\n };\r\n CSS.setElementY = function (element, y) {\r\n if (!element)\r\n return;\r\n element.style.position = 'absolute';\r\n element.style.top = y + \"px\";\r\n };\r\n CSS.getElementVisibility = function (element) {\r\n if (!element)\r\n return false;\r\n return element.style.visibility == 'visible';\r\n };\r\n CSS.setElementVisibility = function (element, visible) {\r\n if (!element)\r\n return;\r\n if (visible) {\r\n element.style.visibility = 'visible';\r\n }\r\n else {\r\n element.style.visibility = 'hidden';\r\n }\r\n };\r\n CSS.setElementAlpha = function (element, alpha) {\r\n if (element instanceof HTMLCanvasElement) {\r\n var context = element.getContext(\"2d\");\r\n context.globalAlpha = alpha;\r\n }\r\n };\r\n CSS.setElementPosition = function (element, x, y, absolute) {\r\n if (absolute === void 0) { absolute = false; }\r\n if (!element)\r\n return;\r\n if (absolute) {\r\n element.style.position = \"absolute\";\r\n }\r\n else {\r\n element.style.position = \"relative\";\r\n }\r\n element.style.left = x + \"px\";\r\n element.style.top = y + \"px\";\r\n };\r\n return CSS;\r\n}());\r\nexport { CSS };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/utils/CSS.js","import { PartialImplementationError } from \"../errors/PartialImplementationError\";\r\n/**\r\n *\r\n */\r\nvar Debug = (function () {\r\n function Debug() {\r\n }\r\n Debug.breakpoint = function () {\r\n Debug['break']();\r\n };\r\n Debug.throwPIROnKeyWordOnly = function (str, enable) {\r\n if (enable === void 0) { enable = true; }\r\n if (!enable)\r\n Debug.keyword = null;\r\n else\r\n Debug.keyword = str;\r\n };\r\n Debug.throwPIR = function (clss, fnc, msg) {\r\n Debug.logPIR('PartialImplementationError ' + clss, fnc, msg);\r\n if (Debug.THROW_ERRORS) {\r\n if (Debug.keyword) {\r\n var e = clss + fnc + msg;\r\n if (e.indexOf(Debug.keyword) == -1)\r\n return;\r\n }\r\n throw new PartialImplementationError(clss + '.' + fnc + ': ' + msg);\r\n }\r\n };\r\n Debug.logPIR = function (clss, fnc, msg) {\r\n if (msg === void 0) { msg = ''; }\r\n if (Debug.LOG_PI_ERRORS)\r\n console.log(clss + '.' + fnc + ': ' + msg);\r\n };\r\n Debug.log = function () {\r\n var args = [];\r\n for (var _i = 0; _i < arguments.length; _i++) {\r\n args[_i] = arguments[_i];\r\n }\r\n if (Debug.ENABLE_LOG)\r\n console.log(args);\r\n };\r\n return Debug;\r\n}());\r\nexport { Debug };\r\nDebug.THROW_ERRORS = true;\r\nDebug.ENABLE_LOG = true;\r\nDebug.LOG_PI_ERRORS = true;\r\nDebug.keyword = null;\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/utils/Debug.js","/**\r\n *\r\n */\r\nvar Extensions = (function () {\r\n function Extensions() {\r\n }\r\n return Extensions;\r\n}());\r\nexport { Extensions };\r\nExtensions.SIMD = Boolean(typeof (SIMD) !== \"undefined\");\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/utils/Extensions.js","import { getTimer } from \"../utils/getTimer\";\r\nvar RequestAnimationFrame = (function () {\r\n function RequestAnimationFrame(callback, callbackContext) {\r\n var _this = this;\r\n this._active = false;\r\n this._argsArray = new Array();\r\n this._getTimer = getTimer;\r\n this.setCallback(callback, callbackContext);\r\n this._rafUpdateFunction = function () {\r\n if (_this._active)\r\n _this._tick();\r\n };\r\n this._argsArray.push(this._dt);\r\n }\r\n // Public\r\n /**\r\n *\r\n * @param callback\r\n * @param callbackContext\r\n */\r\n RequestAnimationFrame.prototype.setCallback = function (callback, callbackContext) {\r\n this._callback = callback;\r\n this._callbackContext = callbackContext;\r\n };\r\n /**\r\n *\r\n */\r\n RequestAnimationFrame.prototype.start = function () {\r\n this._prevTime = this._getTimer();\r\n this._active = true;\r\n if (window) {\r\n if (window.requestAnimationFrame) {\r\n window.requestAnimationFrame(this._rafUpdateFunction);\r\n }\r\n else {\r\n if (window['mozRequestAnimationFrame'])\r\n window.requestAnimationFrame = window['mozRequestAnimationFrame'];\r\n else if (window['webkitRequestAnimationFrame'])\r\n window.requestAnimationFrame = window['webkitRequestAnimationFrame'];\r\n else if (window['oRequestAnimationFrame'])\r\n window.requestAnimationFrame = window['oRequestAnimationFrame'];\r\n }\r\n }\r\n };\r\n /**\r\n *\r\n */\r\n RequestAnimationFrame.prototype.stop = function () {\r\n this._active = false;\r\n };\r\n Object.defineProperty(RequestAnimationFrame.prototype, \"active\", {\r\n // Get / Set\r\n /**\r\n *\r\n * @returns {boolean}\r\n */\r\n get: function () {\r\n return this._active;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n // Private\r\n /**\r\n *\r\n * @private\r\n */\r\n RequestAnimationFrame.prototype._tick = function () {\r\n this._currentTime = this._getTimer();\r\n this._dt = this._currentTime - this._prevTime;\r\n this._argsArray[0] = this._dt;\r\n this._callback.apply(this._callbackContext, this._argsArray);\r\n window.requestAnimationFrame(this._rafUpdateFunction);\r\n this._prevTime = this._currentTime;\r\n };\r\n return RequestAnimationFrame;\r\n}());\r\nexport { RequestAnimationFrame };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/utils/RequestAnimationFrame.js","var XmlUtils = (function () {\r\n function XmlUtils() {\r\n }\r\n XmlUtils.getChildrenWithTag = function (node, tag) {\r\n var fragment = document.createDocumentFragment();\r\n if (node) {\r\n var num = node.childNodes.length;\r\n for (var i = 0; i < num; i++) {\r\n var child = node.childNodes[i];\r\n if (child != null) {\r\n if (child.nodeName == tag) {\r\n fragment.appendChild(child);\r\n }\r\n }\r\n }\r\n }\r\n return fragment.childNodes;\r\n };\r\n XmlUtils.filterListByParam = function (nodes, paramName, paramValue) {\r\n var fragment = document.createDocumentFragment();\r\n if (nodes) {\r\n var num = nodes.length;\r\n for (var i = 0; i < num; i++) {\r\n var child = nodes[i];\r\n if (child != null) {\r\n if (child.attributes.getNamedItem(paramName).value == paramValue) {\r\n fragment.appendChild(child);\r\n }\r\n }\r\n }\r\n }\r\n return fragment.childNodes;\r\n };\r\n XmlUtils.strToXml = function (str) {\r\n var parser = new DOMParser();\r\n var node = parser.parseFromString(str, \"text/xml\");\r\n return node;\r\n };\r\n XmlUtils.nodeToString = function (node) {\r\n if (!node)\r\n return \"\";\r\n var str = (new XMLSerializer()).serializeToString(node);\r\n return str;\r\n };\r\n XmlUtils.readAttributeValue = function (node, attrName) {\r\n var attrs = node.attributes;\r\n if (attrs == undefined) {\r\n return \"\";\r\n }\r\n var attribute = attrs.getNamedItem(attrName);\r\n if (!attribute) {\r\n //console.log(\"XmlUltils - readAttributeValue() - name: \" + attrName + \", attribute does not exist.\";\r\n return \"\";\r\n }\r\n //console.log(\"XmlUltils - readAttributeValue() - name: \" + attrName + \", value: \" + attribute.value);\r\n return attribute.value;\r\n };\r\n XmlUtils.writeAttributeValue = function (node, attrName, attrValue) {\r\n var attribute = document.createAttribute(attrName);\r\n attribute.value = attrValue;\r\n attribute = node.attributes.setNamedItem(attribute);\r\n console.log(\"XmlUltils - writeAttributeValue() - name: \" + attribute.name + \", value: \" + attribute.value);\r\n };\r\n XmlUtils.hasAttribute = function (node, attrName) {\r\n var attrs = node.attributes;\r\n if (attrs == undefined) {\r\n return false;\r\n }\r\n var attribute = attrs.getNamedItem(attrName);\r\n return attribute != null;\r\n };\r\n return XmlUtils;\r\n}());\r\nexport { XmlUtils };\r\nexport default XmlUtils;\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/utils/XmlUtils.js","export * from \"@awayjs/scene\";\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./node_modules/awayjs-full/dist/lib/scene.js\n// module id = 2\n// module chunks = 9","export * from \"@awayjs/parsers\";\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./node_modules/awayjs-full/dist/lib/parsers.js\n// module id = 3\n// module chunks = 9","export * from \"@awayjs/view\";\nimport { Loader, WaveAudioParser, AttributesBuffer } from \"@awayjs/core\";\nimport { Image2DParser, ImageCubeParser, TextureAtlasParser, Shape, Image2D, ImageCube, BitmapImage2D, ExternalImage2D, BitmapImageCube, SpecularImage2D, Sampler2D, SamplerCube, LineElements, TriangleElements, Single2DTexture, SingleCubeTexture, BasicMaterial } from \"@awayjs/graphics\";\nimport { Stage, GL_AttributesBuffer, GL_RenderImage2D, GL_RenderImageCube, GL_BitmapImage2D, GL_ExternalImage2D, GL_BitmapImageCube, GL_Sampler2D, GL_SamplerCube, RenderablePool, ShaderBase, GL_ShapeRenderable, GL_TriangleElements, GL_Single2DTexture, GL_SingleCubeTexture, GL_BasicMaterial } from \"@awayjs/stage\";\nimport { Skybox, DisplayObjectContainer, Scene, Billboard, LineSegment, Camera, DirectionalLight, Sprite, MovieClip, TextField, LightProbe, PointLight } from \"@awayjs/scene\";\nimport { GL_SkyboxMaterial, GL_BillboardRenderable, GL_LineSegmentRenderable, GL_SkyboxRenderable, GL_LineElements, DefaultMaterialGroup } from \"@awayjs/renderer\";\nimport { MethodMaterial, GL_MethodMaterial } from \"@awayjs/materials\";\nimport { PartitionBase, CameraNode, EntityNode, SkyboxNode } from \"@awayjs/view\";\n//enable parsers\nLoader.enableParser(WaveAudioParser);\nLoader.enableParser(Image2DParser);\nLoader.enableParser(ImageCubeParser);\nLoader.enableParser(TextureAtlasParser);\n//register core attributes\nStage.registerAbstraction(GL_AttributesBuffer, AttributesBuffer);\n//register scene entities\nDefaultMaterialGroup.registerAbstraction(GL_SkyboxMaterial, Skybox);\nRenderablePool.registerAbstraction(GL_BillboardRenderable, Billboard);\nRenderablePool.registerAbstraction(GL_LineSegmentRenderable, LineSegment);\nRenderablePool.registerAbstraction(GL_ShapeRenderable, Shape);\nRenderablePool.registerAbstraction(GL_SkyboxRenderable, Skybox);\n//register graphics images\nStage.registerAbstraction(GL_RenderImage2D, Image2D);\nStage.registerAbstraction(GL_RenderImageCube, ImageCube);\nStage.registerAbstraction(GL_BitmapImage2D, BitmapImage2D);\nStage.registerAbstraction(GL_ExternalImage2D, ExternalImage2D);\nStage.registerAbstraction(GL_BitmapImageCube, BitmapImageCube);\nStage.registerAbstraction(GL_BitmapImage2D, SpecularImage2D);\nStage.registerAbstraction(GL_Sampler2D, Sampler2D);\nStage.registerAbstraction(GL_SamplerCube, SamplerCube);\n//register graphics elements\nStage.registerAbstraction(GL_LineElements, LineElements);\nStage.registerAbstraction(GL_TriangleElements, TriangleElements);\n//register graphics textures\nShaderBase.registerAbstraction(GL_Single2DTexture, Single2DTexture);\nShaderBase.registerAbstraction(GL_SingleCubeTexture, SingleCubeTexture);\n//register graphics materials\nDefaultMaterialGroup.registerAbstraction(GL_BasicMaterial, BasicMaterial);\n//regiater material materials\nDefaultMaterialGroup.registerAbstraction(GL_MethodMaterial, MethodMaterial);\n//register view nodes\nPartitionBase.registerAbstraction(CameraNode, Camera);\nPartitionBase.registerAbstraction(EntityNode, DirectionalLight);\nPartitionBase.registerAbstraction(EntityNode, Sprite);\nPartitionBase.registerAbstraction(EntityNode, DisplayObjectContainer);\nPartitionBase.registerAbstraction(EntityNode, Scene);\nPartitionBase.registerAbstraction(EntityNode, MovieClip);\nPartitionBase.registerAbstraction(EntityNode, Billboard);\nPartitionBase.registerAbstraction(EntityNode, LineSegment);\nPartitionBase.registerAbstraction(EntityNode, TextField);\nPartitionBase.registerAbstraction(EntityNode, LightProbe);\nPartitionBase.registerAbstraction(EntityNode, PointLight);\nPartitionBase.registerAbstraction(SkyboxNode, Skybox);\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./node_modules/awayjs-full/dist/lib/view.js\n// module id = 4\n// module chunks = 9","export * from \"@awayjs/graphics\";\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./node_modules/awayjs-full/dist/lib/graphics.js\n// module id = 5\n// module chunks = 9","var ParticleData = (function () {\r\n function ParticleData() {\r\n }\r\n return ParticleData;\r\n}());\r\nexport { ParticleData };\r\nexport default ParticleData;\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/data/ParticleData.js","import * as tslib_1 from \"tslib\";\r\nimport { AssetBase } from \"@awayjs/core\";\r\n/**\r\n * Provides an abstract base class for nodes in an animation blend tree.\r\n */\r\nvar AnimationNodeBase = (function (_super) {\r\n tslib_1.__extends(AnimationNodeBase, _super);\r\n /**\r\n * Creates a new AnimationNodeBase object.\r\n */\r\n function AnimationNodeBase() {\r\n return _super.call(this) || this;\r\n }\r\n Object.defineProperty(AnimationNodeBase.prototype, \"stateClass\", {\r\n get: function () {\r\n return this._pStateClass;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * @inheritDoc\r\n */\r\n AnimationNodeBase.prototype.dispose = function () {\r\n };\r\n Object.defineProperty(AnimationNodeBase.prototype, \"assetType\", {\r\n /**\r\n * @inheritDoc\r\n */\r\n get: function () {\r\n return AnimationNodeBase.assetType;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n return AnimationNodeBase;\r\n}(AssetBase));\r\nexport { AnimationNodeBase };\r\nAnimationNodeBase.assetType = \"[asset AnimationNodeBase]\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/AnimationNodeBase.js","import * as tslib_1 from \"tslib\";\r\nimport { EventBase } from \"@awayjs/core\";\r\n/**\r\n * Dispatched to notify changes in a sub geometry object's state.\r\n *\r\n * @class away.events.RenderableEvent\r\n * @see away.core.base.Graphics\r\n */\r\nvar RenderableEvent = (function (_super) {\r\n tslib_1.__extends(RenderableEvent, _super);\r\n /**\r\n * Create a new GraphicsEvent\r\n * @param type The event type.\r\n * @param dataType An optional data type of the vertex data being updated.\r\n */\r\n function RenderableEvent(type, renderable) {\r\n var _this = _super.call(this, type) || this;\r\n _this._renderable = renderable;\r\n return _this;\r\n }\r\n Object.defineProperty(RenderableEvent.prototype, \"renderable\", {\r\n /**\r\n * The renderobject owner of the renderable owner.\r\n */\r\n get: function () {\r\n return this._renderable;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * Clones the event.\r\n *\r\n * @return An exact duplicate of the current object.\r\n */\r\n RenderableEvent.prototype.clone = function () {\r\n return new RenderableEvent(this.type, this._renderable);\r\n };\r\n return RenderableEvent;\r\n}(EventBase));\r\nexport { RenderableEvent };\r\n/**\r\n * Dispatched when a Renderable has been updated.\r\n */\r\nRenderableEvent.INVALIDATE_MATERIAL = \"invalidateMaterial\";\r\n/**\r\n *\r\n */\r\nRenderableEvent.INVALIDATE_ELEMENTS = \"invalidateElements\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/events/RenderableEvent.js","import * as tslib_1 from \"tslib\";\r\nimport { EventBase } from \"@awayjs/core\";\r\nvar StyleEvent = (function (_super) {\r\n tslib_1.__extends(StyleEvent, _super);\r\n function StyleEvent(type, style) {\r\n var _this = _super.call(this, type) || this;\r\n _this._style = style;\r\n return _this;\r\n }\r\n Object.defineProperty(StyleEvent.prototype, \"style\", {\r\n get: function () {\r\n return this._style;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * Clones the event.\r\n * @return An exact duplicate of the current object.\r\n */\r\n StyleEvent.prototype.clone = function () {\r\n return new StyleEvent(this.type, this._style);\r\n };\r\n return StyleEvent;\r\n}(EventBase));\r\nexport { StyleEvent };\r\n/**\r\n *\r\n */\r\nStyleEvent.INVALIDATE_PROPERTIES = \"invalidateProperties\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/events/StyleEvent.js","import * as tslib_1 from \"tslib\";\r\nimport { EventBase } from \"@awayjs/core\";\r\n/**\r\n * Dispatched to notify changes in a sub geometry object's state.\r\n *\r\n * @class away.events.ShapeEvent\r\n * @see away.core.base.Graphics\r\n */\r\nvar ShapeEvent = (function (_super) {\r\n tslib_1.__extends(ShapeEvent, _super);\r\n /**\r\n * Create a new GraphicsEvent\r\n * @param type The event type.\r\n * @param dataType An optional data type of the vertex data being updated.\r\n */\r\n function ShapeEvent(type, shape) {\r\n var _this = _super.call(this, type) || this;\r\n _this._shape = shape;\r\n return _this;\r\n }\r\n Object.defineProperty(ShapeEvent.prototype, \"shape\", {\r\n /**\r\n * The renderobject owner of the renderable owner.\r\n */\r\n get: function () {\r\n return this._shape;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * Clones the event.\r\n *\r\n * @return An exact duplicate of the current object.\r\n */\r\n ShapeEvent.prototype.clone = function () {\r\n return new ShapeEvent(this.type, this._shape);\r\n };\r\n return ShapeEvent;\r\n}(EventBase));\r\nexport { ShapeEvent };\r\n/**\r\n * Dispatched when a Renderable has been updated.\r\n */\r\nShapeEvent.ADD_MATERIAL = \"addMaterial\";\r\n/**\r\n * Dispatched when a Renderable has been updated.\r\n */\r\nShapeEvent.REMOVE_MATERIAL = \"removeMaterial\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/events/ShapeEvent.js","import * as tslib_1 from \"tslib\";\r\nimport { Box, AssetBase } from \"@awayjs/core\";\r\nimport { RenderableEvent } from \"../events/RenderableEvent\";\r\nimport { StyleEvent } from \"../events/StyleEvent\";\r\nimport { ShapeEvent } from \"../events/ShapeEvent\";\r\n/**\r\n * Graphic wraps a Elements as a scene graph instantiation. A Graphic is owned by a Sprite object.\r\n *\r\n *\r\n * @see away.base.ElementsBase\r\n * @see away.entities.Sprite\r\n *\r\n * @class away.base.Graphic\r\n */\r\nvar Shape = (function (_super) {\r\n tslib_1.__extends(Shape, _super);\r\n /**\r\n * Creates a new Shape object\r\n */\r\n function Shape(elements, material, style, count, offset) {\r\n if (material === void 0) { material = null; }\r\n if (style === void 0) { style = null; }\r\n if (count === void 0) { count = 0; }\r\n if (offset === void 0) { offset = 0; }\r\n var _this = _super.call(this) || this;\r\n _this._boxBoundsInvalid = true;\r\n _this._sphereBoundsInvalid = true;\r\n _this._onInvalidatePropertiesDelegate = function (event) { return _this._onInvalidateProperties(event); };\r\n _this._onInvalidateVerticesDelegate = function (event) { return _this._onInvalidateVertices(event); };\r\n _this._elements = elements;\r\n _this._material = material;\r\n _this._style = style;\r\n if (_this._style)\r\n _this._style.addEventListener(StyleEvent.INVALIDATE_PROPERTIES, _this._onInvalidatePropertiesDelegate);\r\n _this.count = count;\r\n _this.offset = offset;\r\n return _this;\r\n }\r\n Shape.getShape = function (elements, material, style, count, offset) {\r\n if (material === void 0) { material = null; }\r\n if (style === void 0) { style = null; }\r\n if (count === void 0) { count = 0; }\r\n if (offset === void 0) { offset = 0; }\r\n if (Shape._pool.length) {\r\n var shape = Shape._pool.pop();\r\n shape.elements = elements;\r\n shape.material = material;\r\n shape.style = style;\r\n shape.count = count;\r\n shape.offset = offset;\r\n return shape;\r\n }\r\n return new Shape(elements, material, style, count, offset);\r\n };\r\n Shape.storeShape = function (shape) {\r\n shape.elements = null;\r\n shape.material = null;\r\n shape.style = null;\r\n shape.clear();\r\n Shape._pool.push(shape);\r\n };\r\n Object.defineProperty(Shape.prototype, \"strokePath\", {\r\n /*\r\n * _strokePath provides the original stroke-path that was used to create this shape\r\n * when the strokepath is set, it should already be prepared so that its faster to update stroke for new thickness\r\n */\r\n get: function () {\r\n return this._strokePath;\r\n },\r\n set: function (value) {\r\n this._strokePath = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Shape.prototype, \"isStroke\", {\r\n /*\r\n * true if this shape was created for a stroke\r\n */\r\n get: function () {\r\n return this._isStroke;\r\n },\r\n set: function (value) {\r\n this._isStroke = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Shape.prototype, \"elements\", {\r\n /**\r\n * The Elements object which provides the geometry data for this Shape.\r\n */\r\n get: function () {\r\n return this._elements;\r\n },\r\n set: function (value) {\r\n if (this._elements == value)\r\n return;\r\n this._elements = value;\r\n this.invalidateElements();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Shape.prototype, \"assetType\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return Shape.assetType;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Shape.prototype, \"material\", {\r\n /**\r\n * The material used to render the current Shape. If set to null, the containing Graphics's material will be used instead.\r\n */\r\n get: function () {\r\n return this._material;\r\n },\r\n set: function (value) {\r\n if (this._material == value)\r\n return;\r\n if (this._material)\r\n this.dispatchEvent(new ShapeEvent(ShapeEvent.REMOVE_MATERIAL, this));\r\n this._material = value;\r\n if (this._material)\r\n this.dispatchEvent(new ShapeEvent(ShapeEvent.ADD_MATERIAL, this));\r\n this.invalidateMaterial();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Shape.prototype, \"style\", {\r\n /**\r\n * The style used to render the current Shape. If set to null, its parent Sprite's style will be used instead.\r\n */\r\n get: function () {\r\n return this._style;\r\n },\r\n set: function (value) {\r\n if (this._style == value)\r\n return;\r\n if (this._style)\r\n this._style.removeEventListener(StyleEvent.INVALIDATE_PROPERTIES, this._onInvalidatePropertiesDelegate);\r\n this._style = value;\r\n if (this._style)\r\n this._style.addEventListener(StyleEvent.INVALIDATE_PROPERTIES, this._onInvalidatePropertiesDelegate);\r\n this.invalidateMaterial();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n *\r\n */\r\n Shape.prototype.dispose = function () {\r\n _super.prototype.dispose.call(this);\r\n };\r\n Shape.prototype.invalidate = function () {\r\n _super.prototype.invalidate.call(this);\r\n this._boxBoundsInvalid = true;\r\n this._sphereBoundsInvalid = true;\r\n };\r\n Shape.prototype.invalidateElements = function () {\r\n this.dispatchEvent(new RenderableEvent(RenderableEvent.INVALIDATE_ELEMENTS, this));\r\n this._boxBoundsInvalid = true;\r\n this._sphereBoundsInvalid = true;\r\n };\r\n Shape.prototype.invalidateMaterial = function () {\r\n this.dispatchEvent(new RenderableEvent(RenderableEvent.INVALIDATE_MATERIAL, this));\r\n };\r\n Shape.prototype._onInvalidateProperties = function (event) {\r\n this.invalidateMaterial();\r\n };\r\n Shape.prototype._onInvalidateVertices = function (event) {\r\n if (event.attributesView != event.target.positions)\r\n return;\r\n this.invalidate();\r\n this.dispatchEvent(event);\r\n };\r\n /**\r\n * //TODO\r\n *\r\n * @param shortestCollisionDistance\r\n * @param findClosest\r\n * @returns {boolean}\r\n *\r\n * @internal\r\n */\r\n // public _iTestCollision(pickingCollision:PickingCollision, pickingCollider:IPickingCollider):boolean\r\n // {\r\n // \treturn this._elements._iTestCollision(pickingCollider, this.material, pickingCollision, this.count, this.offset)\r\n // }\r\n Shape.prototype.applyTransformation = function (transform) {\r\n this._elements.applyTransformation(transform, this.count, this.offset);\r\n };\r\n Shape.prototype.hitTestPoint = function (x, y, z) {\r\n var box;\r\n //early out for box test\r\n if (!(box = this.getBoxBounds()).contains(x, y, z))\r\n return false;\r\n return this._elements.hitTestPoint(x, y, z, box, this.count, this.offset);\r\n };\r\n Shape.prototype.scale = function (scale) {\r\n this._elements.scale(scale, this.count, this.offset);\r\n };\r\n Shape.prototype.scaleUV = function (scaleU, scaleV) {\r\n if (scaleU === void 0) { scaleU = 1; }\r\n if (scaleV === void 0) { scaleV = 1; }\r\n this._elements.scaleUV(scaleU, scaleV, this.count, this.offset);\r\n };\r\n Shape.prototype.getBoxBounds = function () {\r\n if (this._boxBoundsInvalid) {\r\n this._boxBoundsInvalid = false;\r\n this._boxBounds = this._elements.getBoxBounds(this._boxBounds || (this._boxBounds = new Box()), this.count, this.offset);\r\n }\r\n return this._boxBounds;\r\n };\r\n Shape.prototype.getSphereBounds = function (center, target) {\r\n if (target === void 0) { target = null; }\r\n return this._elements.getSphereBounds(center, target, this.count, this.offset);\r\n };\r\n return Shape;\r\n}(AssetBase));\r\nexport { Shape };\r\nShape._pool = new Array();\r\nShape.assetType = \"[asset Shape]\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/base/Shape.js","import * as tslib_1 from \"tslib\";\r\nimport { EventDispatcher } from \"@awayjs/core\";\r\nimport { StyleEvent } from \"../events/StyleEvent\";\r\n/**\r\n *\r\n */\r\nvar Style = (function (_super) {\r\n tslib_1.__extends(Style, _super);\r\n function Style() {\r\n var _this = _super.call(this) || this;\r\n _this._samplers = new Object();\r\n _this._images = new Object();\r\n _this._color = 0xFFFFFF;\r\n return _this;\r\n }\r\n Object.defineProperty(Style.prototype, \"sampler\", {\r\n get: function () {\r\n return this._sampler;\r\n },\r\n set: function (value) {\r\n if (this._sampler == value)\r\n return;\r\n this._sampler = value;\r\n this._invalidateProperties();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Style.prototype, \"image\", {\r\n get: function () {\r\n return this._image;\r\n },\r\n set: function (value) {\r\n if (this._image == value)\r\n return;\r\n this._image = value;\r\n this._invalidateProperties();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Style.prototype, \"uvMatrix\", {\r\n get: function () {\r\n return this._uvMatrix;\r\n },\r\n set: function (value) {\r\n if (this._uvMatrix == value)\r\n return;\r\n this._uvMatrix = value;\r\n this._invalidateProperties();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Style.prototype, \"color\", {\r\n /**\r\n * The diffuse reflectivity color of the surface.\r\n */\r\n get: function () {\r\n return this._color;\r\n },\r\n set: function (value) {\r\n if (this._color == value)\r\n return;\r\n this._color = value;\r\n this._invalidateProperties();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Style.prototype.getImageAt = function (texture, index) {\r\n if (index === void 0) { index = 0; }\r\n return (this._images[texture.id] ? this._images[texture.id][index] : null) || this._image;\r\n };\r\n Style.prototype.getSamplerAt = function (texture, index) {\r\n if (index === void 0) { index = 0; }\r\n return (this._samplers[texture.id] ? this._samplers[texture.id][index] : null) || this._sampler;\r\n };\r\n Style.prototype.addImageAt = function (image, texture, index) {\r\n if (index === void 0) { index = 0; }\r\n if (!this._images[texture.id])\r\n this._images[texture.id] = new Array();\r\n this._images[texture.id][index] = image;\r\n };\r\n Style.prototype.addSamplerAt = function (sampler, texture, index) {\r\n if (index === void 0) { index = 0; }\r\n if (!this._samplers[texture.id])\r\n this._samplers[texture.id] = new Array();\r\n this._samplers[texture.id][index] = sampler;\r\n this._invalidateProperties();\r\n };\r\n Style.prototype.removeImageAt = function (texture, index) {\r\n if (index === void 0) { index = 0; }\r\n if (!this._images[texture.id])\r\n return;\r\n this._images[texture.id][index] = null;\r\n this._invalidateProperties();\r\n };\r\n Style.prototype.removeSamplerAt = function (texture, index) {\r\n if (index === void 0) { index = 0; }\r\n if (!this._samplers[texture.id])\r\n return;\r\n this._samplers[texture.id][index] = null;\r\n this._invalidateProperties();\r\n };\r\n Style.prototype._invalidateProperties = function () {\r\n this.dispatchEvent(new StyleEvent(StyleEvent.INVALIDATE_PROPERTIES, this));\r\n };\r\n return Style;\r\n}(EventDispatcher));\r\nexport { Style };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/base/Style.js","import * as tslib_1 from \"tslib\";\r\nimport { EventDispatcher } from \"@awayjs/core\";\r\n/**\r\n * Picks a 3d object from a view or scene by 3D raycast calculations.\r\n * Performs an initial coarse boundary calculation to return a subset of entities whose bounding volumes intersect with the specified ray,\r\n * then triggers an optional picking collider on individual renderable objects to further determine the precise values of the picking ray collision.\r\n *\r\n * @class away.pick.RaycastPicker\r\n */\r\nvar TraverserBase = (function (_super) {\r\n tslib_1.__extends(TraverserBase, _super);\r\n /**\r\n *\r\n */\r\n function TraverserBase() {\r\n var _this = _super.call(this) || this;\r\n var i;\r\n //setup defaults for all entity functions\r\n for (i = 0; i < TraverserBase.entityNames.length; i++)\r\n if (!_this[TraverserBase.entityNames[i]])\r\n _this[TraverserBase.entityNames[i]] = _this.applyEntity;\r\n //setup defaults for all renderable functions\r\n for (i = 0; i < TraverserBase.renderableNames.length; i++)\r\n if (!_this[TraverserBase.renderableNames[i]])\r\n _this[TraverserBase.renderableNames[i]] = _this.applyRenderable;\r\n return _this;\r\n }\r\n TraverserBase.addEntityName = function (name) {\r\n TraverserBase.entityNames.push(name);\r\n return name;\r\n };\r\n TraverserBase.addRenderableName = function (name) {\r\n TraverserBase.renderableNames.push(name);\r\n return name;\r\n };\r\n /**\r\n * Returns true if the current node is at least partly in the frustum. If so, the partition node knows to pass on the traverser to its children.\r\n *\r\n * @param node The Partition3DNode object to frustum-test.\r\n */\r\n TraverserBase.prototype.enterNode = function (node) {\r\n return true;\r\n };\r\n TraverserBase.prototype.dispose = function () {\r\n //TODO\r\n };\r\n /**\r\n *\r\n * @param entity\r\n */\r\n TraverserBase.prototype.applyEntity = function (entity) {\r\n //do nothing\r\n };\r\n /**\r\n *\r\n * @param entity\r\n */\r\n TraverserBase.prototype.applyRenderable = function (renderable) {\r\n //do nothing\r\n };\r\n return TraverserBase;\r\n}(EventDispatcher));\r\nexport { TraverserBase };\r\nTraverserBase.entityNames = new Array();\r\nTraverserBase.renderableNames = new Array();\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/base/TraverserBase.js","/**\r\n * The CapsStyle class is an enumeration of constant values that specify the\r\n * caps style to use in drawing lines. The constants are provided for use as\r\n * values in the caps parameter of the\r\n * flash.display.Graphics.lineStyle() method. You can specify the\r\n * following three types of caps:\r\n */\r\nvar CapsStyle = (function () {\r\n function CapsStyle() {\r\n }\r\n return CapsStyle;\r\n}());\r\nexport { CapsStyle };\r\n/**\r\n * Used to specify round caps in the caps parameter of the\r\n * flash.display.Graphics.lineStyle() method.\r\n */\r\nCapsStyle.ROUND = 1;\r\n/**\r\n * Used to specify no caps in the caps parameter of the\r\n * flash.display.Graphics.lineStyle() method.\r\n */\r\nCapsStyle.NONE = 0;\r\n/**\r\n * Used to specify square caps in the caps parameter of the\r\n * flash.display.Graphics.lineStyle() method.\r\n */\r\nCapsStyle.SQUARE = 2;\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/draw/CapsStyle.js","/**\r\n * DrawMode is an enumeration of constant values that specify the\r\n * DrawMode to use when drawing.\r\n */\r\nvar DrawMode = (function () {\r\n function DrawMode() {\r\n }\r\n return DrawMode;\r\n}());\r\nexport { DrawMode };\r\n/**\r\n * Used to specify to draw both strokes and fills\r\n */\r\nDrawMode.BOTH = 1;\r\n/**\r\n * Used to specify to draw strokes only\r\n */\r\nDrawMode.STROKE = 0;\r\n/**\r\n * Used to specify to draw fills only\r\n */\r\nDrawMode.FILL = 2;\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/draw/DrawMode.js","/**\r\n * The GradientType class provides values for the type parameter\r\n * in the beginGradientFill() and\r\n * lineGradientStyle() methods of the flash.display.Graphics\r\n * class.\r\n */\r\nvar GradientType = (function () {\r\n function GradientType() {\r\n }\r\n return GradientType;\r\n}());\r\nexport { GradientType };\r\n/**\r\n * Value used to specify a linear gradient fill.\r\n */\r\nGradientType.LINEAR = \"linear\";\r\n/**\r\n * Value used to specify a radial gradient fill.\r\n */\r\nGradientType.RADIAL = \"radial\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/draw/GradientType.js","var GraphicsFillStyle = (function () {\r\n function GraphicsFillStyle(color, alpha) {\r\n if (color === void 0) { color = 0xffffff; }\r\n if (alpha === void 0) { alpha = 1; }\r\n this.color = color;\r\n this.alpha = alpha;\r\n }\r\n Object.defineProperty(GraphicsFillStyle.prototype, \"data_type\", {\r\n get: function () {\r\n return GraphicsFillStyle.data_type;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n return GraphicsFillStyle;\r\n}());\r\nexport { GraphicsFillStyle };\r\nGraphicsFillStyle.data_type = \"[graphicsdata FillStyle]\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/draw/GraphicsFillStyle.js","import * as tslib_1 from \"tslib\";\r\nimport { GraphicsFillStyle } from \"../draw/GraphicsFillStyle\";\r\nimport { GradientType } from \"../draw/GradientType\";\r\nimport { ColorUtils, Matrix, Rectangle } from \"@awayjs/core\";\r\nvar GradientFillStyle = (function (_super) {\r\n tslib_1.__extends(GradientFillStyle, _super);\r\n function GradientFillStyle(type, colors, alphas, ratios, matrix, spreadMethod, interpolationMethod, focalPointRatio) {\r\n var _this = _super.call(this) || this;\r\n if (colors.length != alphas.length || colors.length != ratios.length) {\r\n throw (\"GradientFillStyle: Error - colors, alphas and ratios must be of same length\");\r\n }\r\n _this.colors = colors;\r\n _this.colors_r = [];\r\n _this.colors_g = [];\r\n _this.colors_b = [];\r\n _this.colors_r.length = _this.colors_g.length = _this.colors_g.length = _this.colors.length;\r\n _this.alphas = alphas;\r\n _this.ratios = ratios;\r\n _this.matrix = matrix;\r\n _this.type = type;\r\n _this.uvRectangle = new Rectangle();\r\n _this.ratio_min = _this.ratios[0];\r\n _this.ratio_max = _this.ratios[_this.ratios.length - 1];\r\n var r = _this.ratios.length;\r\n while (r > 1) {\r\n r--;\r\n if (_this.ratios[r] < _this.ratios[r - 1]) {\r\n throw (\"GradientFillStyle: Error - ratios are not valid\");\r\n }\r\n }\r\n var c = colors.length;\r\n var argb;\r\n while (c > 0) {\r\n c--;\r\n argb = ColorUtils.float32ColorToARGB(colors[c]);\r\n _this.colors_r[c] = argb[1];\r\n _this.colors_g[c] = argb[2];\r\n _this.colors_b[c] = argb[3];\r\n }\r\n return _this;\r\n }\r\n GradientFillStyle.prototype.getUVMatrix = function () {\r\n if (!this.matrix) {\r\n this.matrix = new Matrix();\r\n }\r\n // console.log(this.uvRectangle);\r\n // console.log(this.matrix);\r\n // todo: this is ported from exporter-cpp code\r\n // probably a lot to optimize here\r\n var projection_width = 1638.4;\r\n var projection_height = 1638.4;\r\n var projection_width_half = projection_width * 0.5;\r\n var projection_height_half = projection_height * 0.5;\r\n //\tGet and invert the uv transform:\r\n var a = this.matrix.a;\r\n var b = this.matrix.b;\r\n var c = this.matrix.c;\r\n var d = this.matrix.d;\r\n var tx = this.matrix.tx;\r\n var ty = this.matrix.ty;\r\n var a_inv = d / (a * d - b * c);\r\n var b_inv = -b / (a * d - b * c);\r\n var c_inv = -c / (a * d - b * c);\r\n var d_inv = a / (a * d - b * c);\r\n var tx_inv = (c * ty - d * tx) / (a * d - b * c);\r\n var ty_inv = -(a * ty - b * tx) / (a * d - b * c);\r\n var a_out = (a_inv / projection_width) * (1 - (1 / 256));\r\n var b_out = 0; //(b_inv / projection_width)*(1-(1/256));\r\n var c_out = (c_inv / projection_width) * (1 - (1 / 256));\r\n var d_out = 0; //(d_inv / projection_width)*(1-(1/256));\r\n var tx_out = (this.uvRectangle.x) + ((tx_inv + projection_width_half) / projection_width) * (1 - (1 / 256));\r\n var ty_out = (this.uvRectangle.y); //+((ty_inv + projection_height_half)/projection_width)*(1-(1/256));\r\n this.matrix = new Matrix(a_out, c_out, 0, 0, tx_out, ty_out);\r\n if (this.type == GradientType.RADIAL) {\r\n this.matrix = new Matrix(a_inv / projection_width_half, c_inv / projection_width_half, b_inv / projection_width_half, d_inv / projection_width_half, ((tx_inv + projection_width_half) / projection_width_half) - 1, ((ty_inv + projection_height_half) / projection_width_half) - 1);\r\n }\r\n return this.matrix;\r\n };\r\n GradientFillStyle.prototype.getColorAtPosition = function (value) {\r\n var r1 = -1;\r\n var r2 = -1;\r\n if (value <= this.ratio_min) {\r\n r1 = 0;\r\n r2 = 0;\r\n }\r\n else if (value >= this.ratio_max) {\r\n r1 = this.ratios.length - 1;\r\n r2 = this.ratios.length - 1;\r\n }\r\n else {\r\n var r = 0;\r\n for (var r = 0; r < this.ratios.length - 1; r++) {\r\n if (value == this.ratios[r]) {\r\n r1 = r;\r\n r2 = r;\r\n break;\r\n }\r\n else if (value == this.ratios[r + 1]) {\r\n r1 = r + 1;\r\n r2 = r + 1;\r\n break;\r\n }\r\n else if (value >= this.ratios[r] && value <= this.ratios[r + 1]) {\r\n r1 = r;\r\n r2 = r + 1;\r\n break;\r\n }\r\n }\r\n }\r\n if (r1 == r2) {\r\n return [this.alphas[r1], this.colors_r[r1], this.colors_g[r1], this.colors_b[r1]];\r\n }\r\n var mix = (value - this.ratios[r1]) / (this.ratios[r2] - this.ratios[r1]);\r\n var mix_neg = 1 - mix;\r\n var color_a = this.alphas[r2] * mix + this.alphas[r1] * mix_neg;\r\n var color_r = this.colors_r[r2] * mix + this.colors_r[r1] * mix_neg;\r\n var color_g = this.colors_g[r2] * mix + this.colors_g[r1] * mix_neg;\r\n var color_b = this.colors_b[r2] * mix + this.colors_b[r1] * mix_neg;\r\n return [color_a, color_r, color_g, color_b];\r\n };\r\n GradientFillStyle.prototype.toString = function () {\r\n var str = \"\";\r\n var c = this.colors.length;\r\n var argb;\r\n while (c > 0) {\r\n c--;\r\n str += this.colors[c] + \"#\" + this.alphas[c] + \"#\" + this.ratios[c] + \"#\";\r\n }\r\n return str;\r\n };\r\n Object.defineProperty(GradientFillStyle.prototype, \"data_type\", {\r\n get: function () {\r\n return GradientFillStyle.data_type;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n return GradientFillStyle;\r\n}(GraphicsFillStyle));\r\nexport { GradientFillStyle };\r\nGradientFillStyle.data_type = \"[graphicsdata GradientFillStyle]\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/draw/GradientFillStyle.js","import { Point, MathConsts } from \"@awayjs/core\";\r\nimport { CapsStyle } from \"../draw/CapsStyle\";\r\nvar GraphicsFactoryHelper = (function () {\r\n function GraphicsFactoryHelper() {\r\n }\r\n GraphicsFactoryHelper.isClockWiseXY = function (point1x, point1y, point2x, point2y, point3x, point3y) {\r\n var num = (point1x - point2x) * (point3y - point2y) - (point1y - point2y) * (point3x - point2x);\r\n if (num < 0)\r\n return false;\r\n return true;\r\n };\r\n GraphicsFactoryHelper.getSign = function (ax, ay, cx, cy, bx, by) {\r\n return (ax - bx) * (cy - by) - (ay - by) * (cx - bx);\r\n };\r\n GraphicsFactoryHelper.pointInTri = function (ax, ay, bx, by, cx, cy, xx, xy) {\r\n var b1 = GraphicsFactoryHelper.getSign(ax, ay, xx, xy, bx, by) > 0;\r\n var b2 = GraphicsFactoryHelper.getSign(bx, by, xx, xy, cx, cy) > 0;\r\n var b3 = GraphicsFactoryHelper.getSign(cx, cy, xx, xy, ax, ay) > 0;\r\n return ((b1 == b2) && (b2 == b3));\r\n };\r\n GraphicsFactoryHelper.getControlXForCurveX = function (a, c, b) {\r\n return c;\r\n };\r\n GraphicsFactoryHelper.getControlYForCurveY = function (a, c, b) {\r\n return c;\r\n };\r\n GraphicsFactoryHelper.drawPoint = function (startX, startY, vertices, curves) {\r\n GraphicsFactoryHelper.addTriangle(startX - 2, startY - 2, startX + 2, startY - 2, startX + 2, startY + 2, 0, vertices, curves);\r\n GraphicsFactoryHelper.addTriangle(startX - 2, startY - 2, startX - 2, startY + 2, startX + 2, startY + 2, 0, vertices, curves);\r\n };\r\n GraphicsFactoryHelper.drawElipse = function (x, y, width, height, vertices, startAngle, endAngle, stepAngle, curves) {\r\n // todo: validate input / check edge cases\r\n var degreeTotal = endAngle - startAngle;\r\n var steps = degreeTotal / stepAngle;\r\n var x_last = x + width * Math.cos(startAngle * (Math.PI / 180));\r\n var y_last = y + height * Math.sin(startAngle * (Math.PI / 180));\r\n for (var i = 1; i <= steps; i++) {\r\n var x_tmp = x + width * Math.cos((startAngle + i * stepAngle) * (Math.PI / 180));\r\n var y_tmp = y + height * Math.sin((startAngle + i * stepAngle) * (Math.PI / 180));\r\n GraphicsFactoryHelper.addTriangle(x, y, x_tmp, y_tmp, x_last, y_last, 0, vertices, curves);\r\n x_last = x_tmp;\r\n y_last = y_tmp;\r\n }\r\n };\r\n GraphicsFactoryHelper.drawElipseStrokes = function (x, y, width, height, vertices, startAngle, endAngle, stepAngle, thickness, curves) {\r\n // todo: validate input / check edge cases\r\n var degreeTotal = endAngle - startAngle;\r\n var steps = degreeTotal / stepAngle;\r\n var x_last = x + (width + thickness) * Math.cos(startAngle * (Math.PI / 180));\r\n var y_last = y + (height + thickness) * Math.sin(startAngle * (Math.PI / 180));\r\n var x_last2 = x + (width - thickness) * Math.cos(startAngle * (Math.PI / 180));\r\n var y_last2 = y + (height - thickness) * Math.sin(startAngle * (Math.PI / 180));\r\n for (var i = 1; i <= steps; i++) {\r\n var x_tmp = x + (width + thickness) * Math.cos((startAngle + i * stepAngle) * (Math.PI / 180));\r\n var y_tmp = y + (height + thickness) * Math.sin((startAngle + i * stepAngle) * (Math.PI / 180));\r\n var x_tmp2 = x + (width - thickness) * Math.cos((startAngle + i * stepAngle) * (Math.PI / 180));\r\n var y_tmp2 = y + (height - thickness) * Math.sin((startAngle + i * stepAngle) * (Math.PI / 180));\r\n GraphicsFactoryHelper.addTriangle(x_tmp, y_tmp, x_tmp2, y_tmp2, x_last, y_last, 0, vertices, curves);\r\n GraphicsFactoryHelper.addTriangle(x_last2, y_last2, x_tmp2, y_tmp2, x_last, y_last, 0, vertices, curves);\r\n x_last = x_tmp;\r\n y_last = y_tmp;\r\n x_last2 = x_tmp2;\r\n y_last2 = y_tmp2;\r\n }\r\n };\r\n GraphicsFactoryHelper.addTriangle = function (startX, startY, controlX, controlY, endX, endY, tri_type, vertices, curves) {\r\n var x1 = startX;\r\n var y1 = startY;\r\n var x2 = controlX;\r\n var y2 = controlY;\r\n var x3 = endX;\r\n var y3 = endY;\r\n if (GraphicsFactoryHelper.isClockWiseXY(x1, y1, x2, y2, x3, y3)) {\r\n startX = x3;\r\n startY = y3;\r\n controlX = x2;\r\n controlY = y2;\r\n endX = x1;\r\n endY = y1;\r\n }\r\n var final_vert_cnt = vertices.length;\r\n if (tri_type == 0) {\r\n vertices[final_vert_cnt++] = startX;\r\n vertices[final_vert_cnt++] = startY;\r\n if (curves)\r\n vertices[final_vert_cnt++] = 4.5736980577097704e-41; // ((127<<24)+(127<<16)+0+0)\r\n vertices[final_vert_cnt++] = controlX;\r\n vertices[final_vert_cnt++] = controlY;\r\n if (curves)\r\n vertices[final_vert_cnt++] = 4.5736980577097704e-41; // ((127<<24)+(127<<16)+0+0)\r\n vertices[final_vert_cnt++] = endX;\r\n vertices[final_vert_cnt++] = endY;\r\n if (curves)\r\n vertices[final_vert_cnt++] = 4.5736980577097704e-41; // ((127<<24)+(127<<16)+0+0)\r\n }\r\n else if (tri_type < 0) {\r\n vertices[final_vert_cnt++] = startX;\r\n vertices[final_vert_cnt++] = startY;\r\n if (curves)\r\n vertices[final_vert_cnt++] = 1.1708844992641982e-38; // ((127<<24)+(127<<16)+0+0)\r\n vertices[final_vert_cnt++] = controlX;\r\n vertices[final_vert_cnt++] = controlY;\r\n if (curves)\r\n vertices[final_vert_cnt++] = 2.2778106537599901e-41; // ((127<<24)+(63<<16)+0+0)\r\n vertices[final_vert_cnt++] = endX;\r\n vertices[final_vert_cnt++] = endY;\r\n if (curves)\r\n vertices[final_vert_cnt++] = 1.7796490496925177e-43; // ((127<<24)+0+0+0)\r\n }\r\n else if (tri_type > 0) {\r\n vertices[final_vert_cnt++] = startX;\r\n vertices[final_vert_cnt++] = startY;\r\n if (curves)\r\n vertices[final_vert_cnt++] = 1.1708846393940446e-38; // ((-128<<24)+(127<<16)+0+0)\r\n vertices[final_vert_cnt++] = controlX;\r\n vertices[final_vert_cnt++] = controlY;\r\n if (curves)\r\n vertices[final_vert_cnt++] = 2.2779507836064226e-41; // ((-128<<24)+(63<<16)+0+0)\r\n vertices[final_vert_cnt++] = endX;\r\n vertices[final_vert_cnt++] = endY;\r\n if (curves)\r\n vertices[final_vert_cnt++] = 1.793662034335766e-43; // ((-128<<24)+0+0+0)\r\n }\r\n };\r\n GraphicsFactoryHelper.createCap = function (startX, startY, start_le, start_ri, dir_vec, capstyle, cap_position, thickness, vertices, curves) {\r\n if (capstyle == CapsStyle.ROUND) {\r\n //console.log(\"add round cap\");\r\n var tmp1_x = startX + (cap_position * (dir_vec.x * thickness));\r\n var tmp1_y = startY + (cap_position * (dir_vec.y * thickness));\r\n tmp1_x = tmp1_x * 2 - start_le.x / 2 - start_ri.x / 2;\r\n tmp1_y = tmp1_y * 2 - start_le.y / 2 - start_ri.y / 2;\r\n GraphicsFactoryHelper.addTriangle(start_le.x, start_le.y, tmp1_x, tmp1_y, start_ri.x, start_ri.y, -1, vertices, curves);\r\n }\r\n else if (capstyle == CapsStyle.SQUARE) {\r\n //console.log(\"add square cap\");\r\n var tmp1_x = start_le.x + (cap_position * (dir_vec.x * thickness));\r\n var tmp1_y = start_le.y + (cap_position * (dir_vec.y * thickness));\r\n var tmp2_x = start_ri.x + (cap_position * (dir_vec.x * thickness));\r\n var tmp2_y = start_ri.y + (cap_position * (dir_vec.y * thickness));\r\n GraphicsFactoryHelper.addTriangle(tmp2_x, tmp2_y, tmp1_x, tmp1_y, start_le.x, start_le.y, 0, vertices, curves);\r\n GraphicsFactoryHelper.addTriangle(tmp2_x, tmp2_y, start_le.x, start_le.y, start_ri.x, start_ri.y, 0, vertices, curves);\r\n }\r\n };\r\n GraphicsFactoryHelper.getLineFormularData = function (a, b) {\r\n var tmp_x = b.x - a.x;\r\n var tmp_y = b.y - a.y;\r\n var return_point = new Point();\r\n if ((tmp_x != 0) && (tmp_y != 0))\r\n return_point.x = tmp_y / tmp_x;\r\n return_point.y = -(return_point.x * a.x - a.y);\r\n return return_point;\r\n };\r\n GraphicsFactoryHelper.getQuadricBezierPosition = function (t, start, control, end) {\r\n var xt = 1 - t;\r\n return xt * xt * start + 2 * xt * t * control + t * t * end;\r\n };\r\n GraphicsFactoryHelper.subdivideCurve = function (startx, starty, cx, cy, endx, endy, startx2, starty2, cx2, cy2, endx2, endy2, array_out, array2_out) {\r\n var angle_1 = Math.atan2(cy - starty, cx - startx) * MathConsts.RADIANS_TO_DEGREES;\r\n var angle_2 = Math.atan2(endy - cy, endx - cx) * MathConsts.RADIANS_TO_DEGREES;\r\n var angle_delta = angle_2 - angle_1;\r\n //console.log(\"angle_delta \"+angle_delta);\r\n if (angle_delta > 180) {\r\n angle_delta -= 360;\r\n }\r\n if (angle_delta < -180) {\r\n angle_delta += 360;\r\n }\r\n if (Math.abs(angle_delta) >= 175) {\r\n array_out.push(startx, starty, cx, cy, endx, endy);\r\n array2_out.push(startx2, starty2, cx2, cy2, endx2, endy2);\r\n return;\r\n }\r\n var b1 = false;\r\n var b2 = false;\r\n if (angle_delta < 0) {\r\n // curve is curved to right side. right side is convex\r\n b1 = GraphicsFactoryHelper.getSign(startx, starty, cx2, cy2, endx, endy) > 0;\r\n b2 = GraphicsFactoryHelper.getSign(startx, starty, cx, cy, endx, endy) > 0;\r\n b1 = (((starty - endy) * (cx - startx) + (endx - startx) * (cy - starty)) * ((starty - endy) * (cx2 - startx) + (endx - startx) * (cy2 - starty))) < 0;\r\n }\r\n else {\r\n // curve is curved to left side. left side is convex\r\n b1 = GraphicsFactoryHelper.getSign(startx2, starty2, cx2, cy2, endx2, endy2) > 0;\r\n b2 = GraphicsFactoryHelper.getSign(startx2, starty2, cx, cy, endx2, endy2) > 0;\r\n b1 = (((starty2 - endy) * (cx - startx2) + (endx2 - startx2) * (cy - starty2)) * ((starty2 - endy2) * (cx2 - startx2) + (endx2 - startx2) * (cy2 - starty2))) < 0;\r\n }\r\n if (b1) {\r\n array_out.push(startx, starty, cx, cy, endx, endy);\r\n array2_out.push(startx2, starty2, cx2, cy2, endx2, endy2);\r\n return;\r\n }\r\n // triangles overlap. we must subdivide:\r\n var c1x = startx + (cx - startx) * 0.5; // new controlpoint 1.1\r\n var c1y = starty + (cy - starty) * 0.5;\r\n var c2x = cx + (endx - cx) * 0.5; // new controlpoint 1.2\r\n var c2y = cy + (endy - cy) * 0.5;\r\n var ax = c1x + (c2x - c1x) * 0.5; // new middlepoint 1\r\n var ay = c1y + (c2y - c1y) * 0.5;\r\n var c1x2 = startx2 + (cx2 - startx2) * 0.5; // new controlpoint 2.1\r\n var c1y2 = starty2 + (cy2 - starty2) * 0.5;\r\n var c2x2 = cx2 + (endx2 - cx2) * 0.5; // new controlpoint 2.2\r\n var c2y2 = cy2 + (endy2 - cy2) * 0.5;\r\n var ax2 = c1x2 + (c2x2 - c1x2) * 0.5; // new middlepoint 2\r\n var ay2 = c1y2 + (c2y2 - c1y2) * 0.5;\r\n GraphicsFactoryHelper.subdivideCurve(startx, starty, c1x, c1y, ax, ay, startx2, starty2, c1x2, c1y2, ax2, ay2, array_out, array2_out);\r\n GraphicsFactoryHelper.subdivideCurve(ax, ay, c2x, c2y, endx, endy, ax2, ay2, c2x2, c2y2, endx2, endy2, array_out, array2_out);\r\n };\r\n GraphicsFactoryHelper.tesselateCurve = function (startx, starty, cx, cy, endx, endy, array_out) {\r\n var angle_1 = Math.atan2(cy - starty, cx - startx) * MathConsts.RADIANS_TO_DEGREES;\r\n var angle_2 = Math.atan2(endy - cy, endx - cx) * MathConsts.RADIANS_TO_DEGREES;\r\n var angle_delta = angle_2 - angle_1;\r\n //console.log(\"angle_delta \"+angle_delta);\r\n while (angle_delta > 180) {\r\n angle_delta -= 360;\r\n }\r\n while (angle_delta < -180) {\r\n angle_delta += 360;\r\n }\r\n var diff_x = endx - startx;\r\n var diff_y = endy - starty;\r\n var len = Math.sqrt(diff_x * diff_x + diff_y * diff_y);\r\n //console.log(\"len\", len, \"angle_delta\", angle_delta);\r\n // if the curve angle is smaller than threshold_ang_2 and the len is smaller than threshold_len, we just early out. we will not use the ctr-point at all\r\n // todo: find best constants / checks to test if a curve need more subdividing\r\n /*if(Math.abs(angle_delta)>=150 && len <=3){\r\n array_out.push(endx, endy);\r\n return;\r\n }*/\r\n if (Math.abs(angle_delta) <= 2 || len <= 5) {\r\n array_out.push(endx, endy);\r\n return;\r\n }\r\n // curve needs to be subdivided:\r\n var c1x = startx + (cx - startx) * 0.5; // new controlpoint 1\r\n var c1y = starty + (cy - starty) * 0.5;\r\n var c2x = cx + (endx - cx) * 0.5; // new controlpoint 2\r\n var c2y = cy + (endy - cy) * 0.5;\r\n var ax = c1x + (c2x - c1x) * 0.5; // new middlepoint 1\r\n var ay = c1y + (c2y - c1y) * 0.5;\r\n GraphicsFactoryHelper.tesselateCurve(startx, starty, c1x, c1y, ax, ay, array_out);\r\n GraphicsFactoryHelper.tesselateCurve(ax, ay, c2x, c2y, endx, endy, array_out);\r\n };\r\n return GraphicsFactoryHelper;\r\n}());\r\nexport { GraphicsFactoryHelper };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/draw/GraphicsFactoryHelper.js","/**\r\n * @class away.base.HitTestCache\r\n */\r\nvar HitTestCache = (function () {\r\n function HitTestCache() {\r\n /**\r\n *\r\n */\r\n this.cells = new Array();\r\n /**\r\n *\r\n */\r\n this.lastCollisionIndex = -1;\r\n }\r\n return HitTestCache;\r\n}());\r\nexport { HitTestCache };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/utils/HitTestCache.js","import { AttributesBuffer, Float2Attributes, Float3Attributes, Float4Attributes, Byte4Attributes, Vector3D, Box, Sphere } from \"@awayjs/core\";\r\nimport { TriangleElements } from \"../elements/TriangleElements\";\r\nimport { HitTestCache } from \"./HitTestCache\";\r\nvar ElementsUtils = (function () {\r\n function ElementsUtils() {\r\n }\r\n ElementsUtils.generateFaceNormals = function (indexAttributes, positionAttributes, faceNormalAttributes, count, offset) {\r\n if (offset === void 0) { offset = 0; }\r\n var indices = indexAttributes.get(count, offset);\r\n var positions = positionAttributes.get(positionAttributes.count);\r\n if (faceNormalAttributes == null)\r\n faceNormalAttributes = new Float4Attributes(count + offset);\r\n else if (faceNormalAttributes.count < count + offset)\r\n faceNormalAttributes.count = count + offset;\r\n var indexDim = indexAttributes.stride;\r\n var posDim = positionAttributes.dimensions;\r\n var posStride = positionAttributes.stride;\r\n var faceNormals = faceNormalAttributes.get(count, offset);\r\n var len = count * indexDim;\r\n var i = 0;\r\n var j = 0;\r\n var index;\r\n var x1, x2, x3;\r\n var y1, y2, y3;\r\n var z1, z2, z3;\r\n var dx1, dy1, dz1;\r\n var dx2, dy2, dz2;\r\n var cx, cy, cz;\r\n var d;\r\n if (posDim == 3) {\r\n for (i = 0; i < len; i += indexDim) {\r\n index = indices[i] * posStride;\r\n x1 = positions[index];\r\n y1 = positions[index + 1];\r\n z1 = positions[index + 2];\r\n index = indices[i + 1] * posStride;\r\n x2 = positions[index];\r\n y2 = positions[index + 1];\r\n z2 = positions[index + 2];\r\n index = indices[i + 2] * posStride;\r\n x3 = positions[index];\r\n y3 = positions[index + 1];\r\n z3 = positions[index + 2];\r\n dx1 = x3 - x1;\r\n dy1 = y3 - y1;\r\n dz1 = z3 - z1;\r\n dx2 = x2 - x1;\r\n dy2 = y2 - y1;\r\n dz2 = z2 - z1;\r\n cx = dz1 * dy2 - dy1 * dz2;\r\n cy = dx1 * dz2 - dz1 * dx2;\r\n cz = dy1 * dx2 - dx1 * dy2;\r\n d = Math.sqrt(cx * cx + cy * cy + cz * cz);\r\n // length of cross product = 2*triangle area\r\n faceNormals[j++] = cx;\r\n faceNormals[j++] = cy;\r\n faceNormals[j++] = cz;\r\n faceNormals[j++] = d;\r\n }\r\n }\r\n else if (posDim == 2) {\r\n for (i = 0; i < len; i += indexDim) {\r\n faceNormals[j++] = 0;\r\n faceNormals[j++] = 0;\r\n faceNormals[j++] = 1;\r\n faceNormals[j++] = 1;\r\n }\r\n }\r\n return faceNormalAttributes;\r\n };\r\n ElementsUtils.generateNormals = function (indexAttributes, faceNormalAttributes, normalAttributes, concatenatedBuffer) {\r\n var indices = indexAttributes.get(indexAttributes.count);\r\n var faceNormals = faceNormalAttributes.get(faceNormalAttributes.count);\r\n if (normalAttributes == null)\r\n normalAttributes = new Float3Attributes(concatenatedBuffer);\r\n var indexDim = indexAttributes.dimensions;\r\n var normalStride = normalAttributes.stride;\r\n var normals = normalAttributes.get(normalAttributes.count);\r\n var i;\r\n var len = normalAttributes.count * normalStride;\r\n //clear normal values\r\n for (i = 0; i < len; i += normalStride) {\r\n normals[i] = 0;\r\n normals[i + 1] = 0;\r\n normals[i + 2] = 0;\r\n }\r\n len = indexAttributes.count * indexDim;\r\n var index;\r\n var f1 = 0;\r\n var f2 = 1;\r\n var f3 = 2;\r\n //collect face normals\r\n for (i = 0; i < len; i += indexDim) {\r\n index = indices[i] * normalStride;\r\n normals[index] += faceNormals[f1];\r\n normals[index + 1] += faceNormals[f2];\r\n normals[index + 2] += faceNormals[f3];\r\n index = indices[i + 1] * normalStride;\r\n normals[index] += faceNormals[f1];\r\n normals[index + 1] += faceNormals[f2];\r\n normals[index + 2] += faceNormals[f3];\r\n index = indices[i + 2] * normalStride;\r\n normals[index] += faceNormals[f1];\r\n normals[index + 1] += faceNormals[f2];\r\n normals[index + 2] += faceNormals[f3];\r\n f1 += 4;\r\n f2 += 4;\r\n f3 += 4;\r\n }\r\n len = normalAttributes.count * normalStride;\r\n var vx;\r\n var vy;\r\n var vz;\r\n var d;\r\n //normalise normals collections\r\n for (i = 0; i < len; i += normalStride) {\r\n vx = normals[i];\r\n vy = normals[i + 1];\r\n vz = normals[i + 2];\r\n d = 1.0 / Math.sqrt(vx * vx + vy * vy + vz * vz);\r\n normals[i] = vx * d;\r\n normals[i + 1] = vy * d;\r\n normals[i + 2] = vz * d;\r\n }\r\n return normalAttributes;\r\n };\r\n ElementsUtils.generateFaceTangents = function (indexAttributes, positionAttributes, uvAttributes, faceTangentAttributes, count, offset, useFaceWeights) {\r\n if (offset === void 0) { offset = 0; }\r\n if (useFaceWeights === void 0) { useFaceWeights = false; }\r\n var indices = indexAttributes.get(count, offset);\r\n var positions = positionAttributes.get(positionAttributes.count);\r\n var uvs = uvAttributes.get(uvAttributes.count);\r\n if (faceTangentAttributes == null)\r\n faceTangentAttributes = new Float4Attributes(count + offset);\r\n else if (faceTangentAttributes.count < count + offset)\r\n faceTangentAttributes.count = count + offset;\r\n var indexDim = indexAttributes.dimensions;\r\n var posDim = positionAttributes.dimensions;\r\n var posStride = positionAttributes.stride;\r\n var uvStride = uvAttributes.stride;\r\n var faceTangents = faceTangentAttributes.get(count, offset);\r\n var i = 0;\r\n var index1;\r\n var index2;\r\n var index3;\r\n var v0;\r\n var v1;\r\n var v2;\r\n var dv1;\r\n var dv2;\r\n var denom;\r\n var x0, y0, z0;\r\n var dx1, dy1, dz1;\r\n var dx2, dy2, dz2;\r\n var cx, cy, cz;\r\n //multiply by dimension to get index length\r\n var len = count * indexDim;\r\n for (i = 0; i < len; i += indexDim) {\r\n index1 = indices[i];\r\n index2 = indices[i + 1];\r\n index3 = indices[i + 2];\r\n v0 = uvs[index1 * uvStride + 1];\r\n dv1 = uvs[index2 * uvStride + 1] - v0;\r\n dv2 = uvs[index3 * uvStride + 1] - v0;\r\n v0 = index1 * posStride;\r\n v1 = index2 * posStride;\r\n v2 = index3 * posStride;\r\n x0 = positions[v0];\r\n dx1 = positions[v1] - x0;\r\n dx2 = positions[v2] - x0;\r\n cx = dv2 * dx1 - dv1 * dx2;\r\n y0 = positions[v0 + 1];\r\n dy1 = positions[v1 + 1] - y0;\r\n dy2 = positions[v2 + 1] - y0;\r\n cy = dv2 * dy1 - dv1 * dy2;\r\n if (posDim == 3) {\r\n z0 = positions[v0 + 2];\r\n dz1 = positions[v1 + 2] - z0;\r\n dz2 = positions[v2 + 2] - z0;\r\n cz = dv2 * dz1 - dv1 * dz2;\r\n }\r\n else {\r\n cz = 0;\r\n }\r\n denom = 1 / Math.sqrt(cx * cx + cy * cy + cz * cz);\r\n faceTangents[i] = denom * cx;\r\n faceTangents[i + 1] = denom * cy;\r\n faceTangents[i + 2] = denom * cz;\r\n }\r\n return faceTangentAttributes;\r\n };\r\n ElementsUtils.generateTangents = function (indexAttributes, faceTangentAttributes, faceNormalAttributes, tangentAttributes, concatenatedBuffer) {\r\n var indices = indexAttributes.get(indexAttributes.count);\r\n var faceTangents = faceTangentAttributes.get(faceTangentAttributes.count);\r\n var faceNormals = faceNormalAttributes.get(faceNormalAttributes.count);\r\n if (tangentAttributes == null)\r\n tangentAttributes = new Float3Attributes(concatenatedBuffer);\r\n var indexDim = indexAttributes.dimensions;\r\n var tangentStride = tangentAttributes.stride;\r\n var tangents = tangentAttributes.get(tangentAttributes.count);\r\n var i;\r\n var len = tangentAttributes.count * tangentStride;\r\n //clear tangent values\r\n for (i = 0; i < len; i += tangentStride) {\r\n tangents[i] = 0;\r\n tangents[i + 1] = 0;\r\n tangents[i + 2] = 0;\r\n }\r\n var weight;\r\n var index;\r\n var f1 = 0;\r\n var f2 = 1;\r\n var f3 = 2;\r\n var f4 = 3;\r\n len = indexAttributes.count * indexDim;\r\n //collect face tangents\r\n for (i = 0; i < len; i += indexDim) {\r\n weight = faceNormals[f4];\r\n index = indices[i] * tangentStride;\r\n tangents[index++] += faceTangents[f1] * weight;\r\n tangents[index++] += faceTangents[f2] * weight;\r\n tangents[index] += faceTangents[f3] * weight;\r\n index = indices[i + 1] * tangentStride;\r\n tangents[index++] += faceTangents[f1] * weight;\r\n tangents[index++] += faceTangents[f2] * weight;\r\n tangents[index] += faceTangents[f3] * weight;\r\n index = indices[i + 2] * tangentStride;\r\n tangents[index++] += faceTangents[f1] * weight;\r\n tangents[index++] += faceTangents[f2] * weight;\r\n tangents[index] += faceTangents[f3] * weight;\r\n f1 += 3;\r\n f2 += 3;\r\n f3 += 3;\r\n f4 += 4;\r\n }\r\n var vx;\r\n var vy;\r\n var vz;\r\n var d;\r\n //normalise tangents collections\r\n for (i = 0; i < len; i += tangentStride) {\r\n vx = tangents[i];\r\n vy = tangents[i + 1];\r\n vz = tangents[i + 2];\r\n d = 1.0 / Math.sqrt(vx * vx + vy * vy + vz * vz);\r\n tangents[i] = vx * d;\r\n tangents[i + 1] = vy * d;\r\n tangents[i + 2] = vz * d;\r\n }\r\n return tangentAttributes;\r\n };\r\n ElementsUtils.generateColors = function (indexAttributes, colorAttributes, concatenatedBuffer, count, offset) {\r\n if (offset === void 0) { offset = 0; }\r\n if (colorAttributes == null)\r\n colorAttributes = new Byte4Attributes(concatenatedBuffer);\r\n if (colorAttributes.count < count + offset)\r\n colorAttributes.count = count + offset;\r\n var colors = colorAttributes.get(count, offset);\r\n var colorStride = colorAttributes.stride;\r\n var len = colorAttributes.count * colorStride;\r\n for (var i = 0; i < len; i += colorStride) {\r\n colors[i] = 0xFF;\r\n colors[i + 1] = 0xFF;\r\n colors[i + 2] = 0xFF;\r\n colors[i + 3] = 0xFF;\r\n }\r\n return colorAttributes;\r\n };\r\n ElementsUtils.scale = function (scaleA, scaleB, scaleC, output, count, offset) {\r\n if (offset === void 0) { offset = 0; }\r\n if (output.count < count + offset)\r\n output.count = count + offset;\r\n var scaleArray = new Float32Array([scaleA, scaleB, scaleC]);\r\n var values = output.get(count, offset);\r\n var outputStride = output.stride;\r\n var outputDim = output.dimensions;\r\n var i;\r\n var j;\r\n var len = count * outputStride;\r\n for (i = 0; i < len; i += outputStride)\r\n for (j = 0; j < outputDim; j++)\r\n values[i + j] *= scaleArray[j];\r\n output.invalidate();\r\n };\r\n ElementsUtils.applyTransformation = function (transform, positionAttributes, normalAttributes, tangentAttributes, count, offset) {\r\n if (offset === void 0) { offset = 0; }\r\n //todo: make this compatible with 2-dimensional positions\r\n var positions = positionAttributes.get(count, offset);\r\n var positionStride = positionAttributes.stride;\r\n var normals;\r\n var normalStride;\r\n if (normalAttributes) {\r\n normals = normalAttributes.get(count, offset);\r\n normalStride = normalAttributes.stride;\r\n }\r\n var tangents;\r\n var tangentStride;\r\n if (tangentAttributes) {\r\n tangents = tangentAttributes.get(count, offset);\r\n tangentStride = tangentAttributes.stride;\r\n }\r\n var i;\r\n var i1;\r\n var i2;\r\n var vector = new Vector3D();\r\n var invTranspose;\r\n if (normalAttributes || tangentAttributes) {\r\n invTranspose = transform.clone();\r\n invTranspose.invert();\r\n invTranspose.transpose();\r\n }\r\n var vi0 = 0;\r\n var ni0 = 0;\r\n var ti0 = 0;\r\n for (i = 0; i < count; ++i) {\r\n // bake position\r\n i1 = vi0 + 1;\r\n i2 = vi0 + 2;\r\n vector.x = positions[vi0];\r\n vector.y = positions[i1];\r\n vector.z = positions[i2];\r\n vector = transform.transformVector(vector);\r\n positions[vi0] = vector.x;\r\n positions[i1] = vector.y;\r\n positions[i2] = vector.z;\r\n vi0 += positionStride;\r\n if (normals) {\r\n // bake normal\r\n i1 = ni0 + 1;\r\n i2 = ni0 + 2;\r\n vector.x = normals[ni0];\r\n vector.y = normals[i1];\r\n vector.z = normals[i2];\r\n vector = invTranspose.deltaTransformVector(vector);\r\n vector.normalize();\r\n normals[ni0] = vector.x;\r\n normals[i1] = vector.y;\r\n normals[i2] = vector.z;\r\n ni0 += normalStride;\r\n }\r\n if (tangents) {\r\n // bake tangent\r\n i1 = ti0 + 1;\r\n i2 = ti0 + 2;\r\n vector.x = tangents[ti0];\r\n vector.y = tangents[i1];\r\n vector.z = tangents[i2];\r\n vector = invTranspose.deltaTransformVector(vector);\r\n vector.normalize();\r\n tangents[ti0] = vector.x;\r\n tangents[i1] = vector.y;\r\n tangents[i2] = vector.z;\r\n ti0 += tangentStride;\r\n }\r\n }\r\n positionAttributes.invalidate();\r\n if (normalAttributes)\r\n normalAttributes.invalidate();\r\n if (tangentAttributes)\r\n tangentAttributes.invalidate();\r\n };\r\n ElementsUtils.getSubIndices = function (indexAttributes, numVertices, indexMappings, indexOffset) {\r\n if (indexOffset === void 0) { indexOffset = 0; }\r\n var buffer = indexAttributes.attributesBuffer;\r\n var numIndices = indexAttributes.length;\r\n //reset mappings\r\n indexMappings.length = 0;\r\n //shortcut for those buffers that fit into the maximum buffer sizes\r\n if (numIndices < ElementsUtils.LIMIT_INDICES && numVertices < ElementsUtils.LIMIT_VERTS)\r\n return buffer;\r\n var i;\r\n var indices = indexAttributes.get(indexAttributes.count, indexOffset);\r\n var splitIndices = new Array();\r\n var indexSwap = ElementsUtils._indexSwap;\r\n indexSwap.length = numIndices;\r\n for (i = 0; i < numIndices; i++)\r\n indexSwap[i] = -1;\r\n var originalIndex;\r\n var splitIndex;\r\n var index = 0;\r\n var offsetLength = indexOffset * indexAttributes.dimensions;\r\n // Loop over all triangles\r\n i = 0;\r\n while (i < numIndices + offsetLength && i + 1 < ElementsUtils.LIMIT_INDICES && index + 1 < ElementsUtils.LIMIT_VERTS) {\r\n originalIndex = indices[i];\r\n if (indexSwap[originalIndex] >= 0) {\r\n splitIndex = indexSwap[originalIndex];\r\n }\r\n else {\r\n // This vertex does not yet exist in the split list and\r\n // needs to be copied from the long list.\r\n splitIndex = index++;\r\n indexSwap[originalIndex] = splitIndex;\r\n indexMappings[splitIndex] = originalIndex;\r\n }\r\n // Store new index, which may have come from the swap look-up,\r\n // or from copying a new set of vertex data from the original vector\r\n splitIndices[i++] = splitIndex;\r\n }\r\n buffer = new AttributesBuffer(indexAttributes.size * indexAttributes.dimensions, splitIndices.length / indexAttributes.dimensions);\r\n indexAttributes = indexAttributes.clone(buffer);\r\n indexAttributes.set(splitIndices);\r\n return buffer;\r\n };\r\n ElementsUtils.getSubVertices = function (vertexBuffer, indexMappings) {\r\n if (!indexMappings.length)\r\n return vertexBuffer;\r\n var stride = vertexBuffer.stride;\r\n var vertices = vertexBuffer.bufferView;\r\n var splitVerts = new Uint8Array(indexMappings.length * stride);\r\n var splitIndex;\r\n var originalIndex;\r\n var i = 0;\r\n var j = 0;\r\n var len = indexMappings.length;\r\n for (i = 0; i < len; i++) {\r\n splitIndex = i * stride;\r\n originalIndex = indexMappings[i] * stride;\r\n for (j = 0; j < stride; j++)\r\n splitVerts[splitIndex + j] = vertices[originalIndex + j];\r\n }\r\n vertexBuffer = new AttributesBuffer(stride, len);\r\n vertexBuffer.bufferView = splitVerts;\r\n return vertexBuffer;\r\n };\r\n //TODO - generate this dyanamically based on num tris\r\n ElementsUtils.hitTestTriangleElements = function (x, y, z, box, triangleElements, count, offset) {\r\n if (offset === void 0) { offset = 0; }\r\n var positionAttributes = triangleElements.positions;\r\n var curveAttributes = triangleElements.getCustomAtributes(\"curves\");\r\n var posStride = positionAttributes.stride;\r\n var curveStride = curveAttributes ? curveAttributes.stride : null;\r\n var positions = positionAttributes.get(count, offset);\r\n var curves = curveAttributes ? curveAttributes.get(count, offset) : null;\r\n var indices;\r\n var len;\r\n if (triangleElements.indices) {\r\n indices = triangleElements.indices.get(count, offset);\r\n positions = positionAttributes.get(positionAttributes.count);\r\n curves = curveAttributes ? curveAttributes.get(curveAttributes.count) : null;\r\n len = count * triangleElements.indices.dimensions;\r\n }\r\n else {\r\n positions = positionAttributes.get(count, offset);\r\n curves = curveAttributes ? curveAttributes.get(count, offset) : null;\r\n len = count;\r\n }\r\n var id0;\r\n var id1;\r\n var id2;\r\n var ax;\r\n var ay;\r\n var bx;\r\n var by;\r\n var cx;\r\n var cy;\r\n var hitTestCache = triangleElements.hitTestCache[offset] || (triangleElements.hitTestCache[offset] = new HitTestCache());\r\n var index = hitTestCache.lastCollisionIndex;\r\n if (index != -1 && index < len) {\r\n precheck: {\r\n if (indices) {\r\n id0 = indices[index + 2];\r\n id1 = indices[index + 1];\r\n id2 = indices[index];\r\n }\r\n else {\r\n id0 = index + 2;\r\n id1 = index + 1;\r\n id2 = index;\r\n }\r\n ax = positions[id0 * posStride];\r\n ay = positions[id0 * posStride + 1];\r\n bx = positions[id1 * posStride];\r\n by = positions[id1 * posStride + 1];\r\n cx = positions[id2 * posStride];\r\n cy = positions[id2 * posStride + 1];\r\n //from a to p\r\n var dx = ax - x;\r\n var dy = ay - y;\r\n //edge normal (a-b)\r\n var nx = by - ay;\r\n var ny = -(bx - ax);\r\n var dot = (dx * nx) + (dy * ny);\r\n if (dot > 0)\r\n break precheck;\r\n dx = bx - x;\r\n dy = by - y;\r\n nx = cy - by;\r\n ny = -(cx - bx);\r\n dot = (dx * nx) + (dy * ny);\r\n if (dot > 0)\r\n break precheck;\r\n dx = cx - x;\r\n dy = cy - y;\r\n nx = ay - cy;\r\n ny = -(ax - cx);\r\n dot = (dx * nx) + (dy * ny);\r\n if (dot > 0)\r\n break precheck;\r\n if (curves) {\r\n //check if not solid\r\n if (curves[id0 * curveStride + 2] != -128) {\r\n var v0x = bx - ax;\r\n var v0y = by - ay;\r\n var v1x = cx - ax;\r\n var v1y = cy - ay;\r\n var v2x = x - ax;\r\n var v2y = y - ay;\r\n var den = v0x * v1y - v1x * v0y;\r\n var v = (v2x * v1y - v1x * v2y) / den;\r\n var w = (v0x * v2y - v2x * v0y) / den;\r\n //var u:number = 1 - v - w;\t//commented out as inlined away\r\n //here be dragons\r\n var uu = 0.5 * v + w;\r\n var vv = w;\r\n var d = uu * uu - vv;\r\n var az = curves[id0 * curveStride];\r\n if (d > 0 && az == -128) {\r\n break precheck;\r\n }\r\n else if (d < 0 && az == 127) {\r\n break precheck;\r\n }\r\n }\r\n }\r\n return true;\r\n }\r\n }\r\n //hard coded min vertex count to bother using a grid for\r\n if (len > 150) {\r\n var cells = hitTestCache.cells;\r\n var divisions = cells.length ? hitTestCache.divisions : (hitTestCache.divisions = Math.min(Math.ceil(Math.sqrt(len)), 32));\r\n var conversionX = divisions / box.width;\r\n var conversionY = divisions / box.height;\r\n var minx = box.x;\r\n var miny = box.y;\r\n if (!cells.length) {\r\n //now we have bounds start creating grid cells and filling\r\n cells.length = divisions * divisions;\r\n for (var k = 0; k < len; k += 3) {\r\n if (indices) {\r\n id0 = indices[k + 2];\r\n id1 = indices[k + 1];\r\n id2 = indices[k];\r\n }\r\n else {\r\n id0 = k + 2;\r\n id1 = k + 1;\r\n id2 = k;\r\n }\r\n ax = positions[id0 * posStride];\r\n ay = positions[id0 * posStride + 1];\r\n bx = positions[id1 * posStride];\r\n by = positions[id1 * posStride + 1];\r\n cx = positions[id2 * posStride];\r\n cy = positions[id2 * posStride + 1];\r\n //subtractions to push into positive space\r\n var min_index_x = Math.floor((Math.min(ax, bx, cx) - minx) * conversionX);\r\n var min_index_y = Math.floor((Math.min(ay, by, cy) - miny) * conversionY);\r\n var max_index_x = Math.floor((Math.max(ax, bx, cx) - minx) * conversionX);\r\n var max_index_y = Math.floor((Math.max(ay, by, cy) - miny) * conversionY);\r\n for (var i = min_index_x; i <= max_index_x; i++) {\r\n for (var j = min_index_y; j <= max_index_y; j++) {\r\n var c = i + j * divisions;\r\n var nodes = cells[c] || (cells[c] = new Array());\r\n //push in the triangle ids\r\n nodes.push(k);\r\n }\r\n }\r\n }\r\n }\r\n var index_x = Math.floor((x - minx) * conversionX);\r\n var index_y = Math.floor((y - miny) * conversionY);\r\n var nodes = cells[index_x + index_y * divisions];\r\n if (nodes == null) {\r\n hitTestCache.lastCollisionIndex = -1;\r\n return false;\r\n }\r\n var nodeCount = nodes.length;\r\n for (var n = 0; n < nodeCount; n++) {\r\n var k = nodes[n];\r\n if (indices) {\r\n id2 = indices[k];\r\n }\r\n else {\r\n id2 = k;\r\n }\r\n if (id2 == index)\r\n continue;\r\n if (indices) {\r\n id0 = indices[k + 2];\r\n id1 = indices[k + 1];\r\n }\r\n else {\r\n id0 = k + 2;\r\n id1 = k + 1;\r\n }\r\n ax = positions[id0 * posStride];\r\n ay = positions[id0 * posStride + 1];\r\n bx = positions[id1 * posStride];\r\n by = positions[id1 * posStride + 1];\r\n cx = positions[id2 * posStride];\r\n cy = positions[id2 * posStride + 1];\r\n //from a to p\r\n var dx = ax - x;\r\n var dy = ay - y;\r\n //edge normal (a-b)\r\n var nx = by - ay;\r\n var ny = -(bx - ax);\r\n var dot = (dx * nx) + (dy * ny);\r\n if (dot > 0)\r\n continue;\r\n dx = bx - x;\r\n dy = by - y;\r\n nx = cy - by;\r\n ny = -(cx - bx);\r\n dot = (dx * nx) + (dy * ny);\r\n if (dot > 0)\r\n continue;\r\n dx = cx - x;\r\n dy = cy - y;\r\n nx = ay - cy;\r\n ny = -(ax - cx);\r\n dot = (dx * nx) + (dy * ny);\r\n if (dot > 0)\r\n continue;\r\n if (curves) {\r\n //check if not solid\r\n if (curves[id0 * curveStride + 2] != -128) {\r\n var v0x = bx - ax;\r\n var v0y = by - ay;\r\n var v1x = cx - ax;\r\n var v1y = cy - ay;\r\n var v2x = x - ax;\r\n var v2y = y - ay;\r\n var den = v0x * v1y - v1x * v0y;\r\n var v = (v2x * v1y - v1x * v2y) / den;\r\n var w = (v0x * v2y - v2x * v0y) / den;\r\n //var u:number = 1 - v - w;\t//commented out as inlined away\r\n //here be dragons\r\n var uu = 0.5 * v + w;\r\n var vv = w;\r\n var d = uu * uu - vv;\r\n var az = curves[id0 * curveStride];\r\n if (d > 0 && az == -128) {\r\n continue;\r\n }\r\n else if (d < 0 && az == 127) {\r\n continue;\r\n }\r\n }\r\n }\r\n hitTestCache.lastCollisionIndex = k;\r\n return true;\r\n }\r\n hitTestCache.lastCollisionIndex = -1;\r\n return false;\r\n }\r\n //brute force\r\n for (var k = 0; k < len; k += 3) {\r\n if (indices) {\r\n id2 = indices[k];\r\n }\r\n else {\r\n id2 = k;\r\n }\r\n if (id2 == index)\r\n continue;\r\n if (indices) {\r\n id0 = indices[k + 2];\r\n id1 = indices[k + 1];\r\n }\r\n else {\r\n id0 = k + 2;\r\n id1 = k + 1;\r\n }\r\n ax = positions[id0 * posStride];\r\n ay = positions[id0 * posStride + 1];\r\n bx = positions[id1 * posStride];\r\n by = positions[id1 * posStride + 1];\r\n cx = positions[id2 * posStride];\r\n cy = positions[id2 * posStride + 1];\r\n //from a to p\r\n var dx = ax - x;\r\n var dy = ay - y;\r\n //edge normal (a-b)\r\n var nx = by - ay;\r\n var ny = -(bx - ax);\r\n var dot = (dx * nx) + (dy * ny);\r\n if (dot > 0)\r\n continue;\r\n dx = bx - x;\r\n dy = by - y;\r\n nx = cy - by;\r\n ny = -(cx - bx);\r\n dot = (dx * nx) + (dy * ny);\r\n if (dot > 0)\r\n continue;\r\n dx = cx - x;\r\n dy = cy - y;\r\n nx = ay - cy;\r\n ny = -(ax - cx);\r\n dot = (dx * nx) + (dy * ny);\r\n if (dot > 0)\r\n continue;\r\n if (curves) {\r\n //check if not solid\r\n if (curves[id0 * curveStride + 2] != -128) {\r\n var v0x = bx - ax;\r\n var v0y = by - ay;\r\n var v1x = cx - ax;\r\n var v1y = cy - ay;\r\n var v2x = x - ax;\r\n var v2y = y - ay;\r\n var den = v0x * v1y - v1x * v0y;\r\n var v = (v2x * v1y - v1x * v2y) / den;\r\n var w = (v0x * v2y - v2x * v0y) / den;\r\n //var u:number = 1 - v - w;\t//commented out as inlined away\r\n //here be dragons\r\n var uu = 0.5 * v + w;\r\n var vv = w;\r\n var d = uu * uu - vv;\r\n var az = curves[id0 * curveStride];\r\n if (d > 0 && az == -128) {\r\n continue;\r\n }\r\n else if (d < 0 && az == 127) {\r\n continue;\r\n }\r\n }\r\n }\r\n hitTestCache.lastCollisionIndex = k;\r\n return true;\r\n }\r\n hitTestCache.lastCollisionIndex = -1;\r\n return false;\r\n };\r\n ElementsUtils.getTriangleGraphicsBoxBounds = function (positionAttributes, indexAttributes, output, count, offset, halfThickness) {\r\n if (offset === void 0) { offset = 0; }\r\n if (halfThickness === void 0) { halfThickness = 0; }\r\n var positions;\r\n var posDim = positionAttributes.dimensions;\r\n var posStride = positionAttributes.stride;\r\n var pos;\r\n var minX = 0, minY = 0, minZ = 0;\r\n var maxX = 0, maxY = 0, maxZ = 0;\r\n var indices;\r\n var len;\r\n if (indexAttributes) {\r\n len = count * indexAttributes.dimensions;\r\n indices = indexAttributes.get(count, offset);\r\n positions = positionAttributes.get(positionAttributes.count);\r\n }\r\n else {\r\n len = count;\r\n positions = positionAttributes.get(count, offset);\r\n }\r\n var index;\r\n for (var i = 0; i < len; i++) {\r\n index = (indices) ? indices[i] * posStride : i * posStride;\r\n if (i == 0) {\r\n maxX = minX = positions[index];\r\n maxY = minY = positions[index + 1];\r\n maxZ = minZ = (posDim == 3) ? positions[index + 2] : 0;\r\n }\r\n else {\r\n pos = positions[index];\r\n if (pos < minX)\r\n minX = pos;\r\n else if (pos > maxX)\r\n maxX = pos;\r\n pos = positions[index + 1];\r\n if (pos < minY)\r\n minY = pos;\r\n else if (pos > maxY)\r\n maxY = pos;\r\n if (posDim == 3) {\r\n pos = positions[index + 2];\r\n if (pos < minZ)\r\n minZ = pos;\r\n else if (pos > maxZ)\r\n maxZ = pos;\r\n }\r\n }\r\n }\r\n if (output == null)\r\n output = new Box();\r\n output.x = minX + halfThickness;\r\n output.y = minY + halfThickness;\r\n output.z = minZ;\r\n output.right = maxX - halfThickness;\r\n output.bottom = maxY - halfThickness;\r\n output.back = maxZ;\r\n return output;\r\n };\r\n ElementsUtils.getTriangleGraphicsSphereBounds = function (positionAttributes, center, output, count, offset) {\r\n if (offset === void 0) { offset = 0; }\r\n var positions = positionAttributes.get(count, offset);\r\n var posDim = positionAttributes.dimensions;\r\n var posStride = positionAttributes.stride;\r\n var maxRadiusSquared = 0;\r\n var radiusSquared;\r\n var len = count * posStride;\r\n var distanceX;\r\n var distanceY;\r\n var distanceZ;\r\n for (var i = 0; i < len; i += posStride) {\r\n distanceX = positions[i] - center.x;\r\n distanceY = positions[i + 1] - center.y;\r\n distanceZ = (posDim == 3) ? positions[i + 2] - center.z : -center.z;\r\n radiusSquared = distanceX * distanceX + distanceY * distanceY + distanceZ * distanceZ;\r\n if (maxRadiusSquared < radiusSquared)\r\n maxRadiusSquared = radiusSquared;\r\n }\r\n if (output == null)\r\n output = new Sphere();\r\n output.x = center.x;\r\n output.y = center.y;\r\n output.z = center.z;\r\n output.radius = Math.sqrt(maxRadiusSquared);\r\n return output;\r\n };\r\n ElementsUtils.updateTriangleGraphicsSlice9 = function (triangleElements, originalRect, scaleX, scaleY, init, copy) {\r\n // todo: for now this only works for Float2Attributes.\r\n if (init === void 0) { init = false; }\r\n if (copy === void 0) { copy = false; }\r\n if (triangleElements.slice9Indices.length != 9) {\r\n throw (\"ElementUtils: Error - triangleElement does not provide valid slice9Indices!\");\r\n }\r\n var s_len = triangleElements.slice9Indices.length;\r\n var innerWidth = originalRect.width - (triangleElements.slice9offsets.x + triangleElements.slice9offsets.width) / scaleX;\r\n var innerHeight = originalRect.height - (triangleElements.slice9offsets.y + triangleElements.slice9offsets.height) / scaleY;\r\n if (innerWidth < 0) {\r\n innerWidth = 0;\r\n scaleX = (triangleElements.slice9offsets.x + triangleElements.slice9offsets.width) / originalRect.width;\r\n }\r\n if (innerHeight < 0) {\r\n innerHeight = 0;\r\n scaleY = (triangleElements.slice9offsets.y + triangleElements.slice9offsets.height) / originalRect.height;\r\n }\r\n var newElem;\r\n var positions;\r\n if (copy) {\r\n var newverts = new Uint8Array(triangleElements.positions.count * 8);\r\n while (v < triangleElements.positions.count * 2) {\r\n newverts[v] = positions[v++];\r\n newverts[v] = positions[v++];\r\n }\r\n var vertexBuffer = new AttributesBuffer(8, triangleElements.positions.count);\r\n vertexBuffer.bufferView = newverts;\r\n var newElem = new TriangleElements(vertexBuffer);\r\n newElem.setPositions(new Float2Attributes(vertexBuffer));\r\n newElem.slice9offsets = triangleElements.slice9offsets;\r\n newElem.initialSlice9Positions = triangleElements.initialSlice9Positions;\r\n newElem.slice9Indices = triangleElements.slice9Indices;\r\n positions = newElem.positions.get(newElem.positions.count);\r\n v = 0;\r\n }\r\n else {\r\n positions = triangleElements.positions.get(triangleElements.positions.count);\r\n }\r\n // todo: i had trouble when just cloning the positions \r\n //\tfor now i just create the initialSlice9Positions by iterating the positions\r\n var v = 0;\r\n var init_positions;\r\n if (init) {\r\n init_positions = [];\r\n init_positions.length = triangleElements.positions.count * 2;\r\n while (v < triangleElements.positions.count * 2) {\r\n init_positions[v] = positions[v++];\r\n init_positions[v] = positions[v++];\r\n }\r\n triangleElements.initialSlice9Positions = init_positions;\r\n }\r\n else {\r\n init_positions = triangleElements.initialSlice9Positions;\r\n }\r\n var slice9Indices = triangleElements.slice9Indices;\r\n var s = 0;\r\n v = 0;\r\n var slice9Offsets_x = [];\r\n slice9Offsets_x.length = 3;\r\n var slice9Offsets_y = [];\r\n slice9Offsets_y.length = 3;\r\n slice9Offsets_x[0] = originalRect.x;\r\n slice9Offsets_x[1] = originalRect.x + triangleElements.slice9offsets.x / scaleX;\r\n slice9Offsets_x[2] = originalRect.x + triangleElements.slice9offsets.x / scaleX + innerWidth;\r\n slice9Offsets_y[0] = originalRect.y;\r\n slice9Offsets_y[1] = originalRect.y + triangleElements.slice9offsets.y / scaleY;\r\n slice9Offsets_y[2] = originalRect.y + triangleElements.slice9offsets.y / scaleY + innerHeight;\r\n //console.log(\"slice9Offsets_x\",slice9Offsets_x);\r\n //console.log(\"slice9Offsets_y\",slice9Offsets_x);\r\n var row_cnt = -1;\r\n var col_cnt = 0;\r\n var scalex = 0;\r\n var scaley = 0;\r\n var offsetx = 0;\r\n var offsety = 0;\r\n // iterating over the 9 chunks - keep in mind that we are constructing a 3x3 grid:\r\n for (s = 0; s < s_len; s++) {\r\n // keep track of column and row index\r\n if (row_cnt == 2) {\r\n col_cnt++;\r\n row_cnt = -1;\r\n }\r\n row_cnt++;\r\n // only need to x-scale if this is the middle column\r\n // if the innerWidth<=0 we can skip this complete column\r\n if (col_cnt == 1) {\r\n scalex = innerWidth;\r\n }\r\n else {\r\n scalex = 1 / scaleX;\r\n }\r\n // only need to y-scale if this is the middle row\r\n // if the innerHeight<=0 we can skip this complete row\r\n if (row_cnt == 1) {\r\n scaley = innerHeight;\r\n }\r\n else {\r\n scaley = 1 / scaleY;\r\n }\r\n // offsetx is different for each column\r\n offsetx = slice9Offsets_x[col_cnt];\r\n // offsety is different for each row\r\n offsety = slice9Offsets_y[row_cnt];\r\n // iterate the verts and apply the translation / scale\r\n while (v < slice9Indices[s]) {\r\n positions[v] = offsetx + (init_positions[v++] * scalex);\r\n positions[v] = offsety + (init_positions[v++] * scaley);\r\n }\r\n }\r\n //console.log(\"positions\",positions);\r\n if (copy) {\r\n newElem.positions.invalidate();\r\n return newElem;\r\n }\r\n triangleElements.positions.invalidate();\r\n return triangleElements;\r\n };\r\n return ElementsUtils;\r\n}());\r\nexport { ElementsUtils };\r\nElementsUtils.tempFloat32x4 = new Float32Array(4);\r\nElementsUtils.LIMIT_VERTS = 0xffff;\r\nElementsUtils.LIMIT_INDICES = 0xffffff;\r\nElementsUtils._indexSwap = new Array();\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/utils/ElementsUtils.js","import * as tslib_1 from \"tslib\";\r\nimport { EventBase } from \"@awayjs/core\";\r\n/**\r\n * Dispatched to notify changes in a sub geometry object's state.\r\n *\r\n * @class away.events.ElementsEvent\r\n * @see away.core.base.Graphics\r\n */\r\nvar ElementsEvent = (function (_super) {\r\n tslib_1.__extends(ElementsEvent, _super);\r\n /**\r\n * Create a new GraphicsEvent\r\n * @param type The event type.\r\n * @param attributesView An optional data type of the vertex data being updated.\r\n */\r\n function ElementsEvent(type, attributesView) {\r\n var _this = _super.call(this, type) || this;\r\n _this._attributesView = attributesView;\r\n return _this;\r\n }\r\n Object.defineProperty(ElementsEvent.prototype, \"attributesView\", {\r\n /**\r\n * The attributes view of the vertex data.\r\n */\r\n get: function () {\r\n return this._attributesView;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * Clones the event.\r\n *\r\n * @return An exact duplicate of the current object.\r\n */\r\n ElementsEvent.prototype.clone = function () {\r\n return new ElementsEvent(this.type, this._attributesView);\r\n };\r\n return ElementsEvent;\r\n}(EventBase));\r\nexport { ElementsEvent };\r\n/**\r\n * Dispatched when a Elements's index data has been updated.\r\n */\r\nElementsEvent.INVALIDATE_INDICES = \"invalidateIndices\";\r\n/**\r\n * Dispatched when a Elements's index data has been disposed.\r\n */\r\nElementsEvent.CLEAR_INDICES = \"clearIndices\";\r\n/**\r\n * Dispatched when a Elements's vertex data has been updated.\r\n */\r\nElementsEvent.INVALIDATE_VERTICES = \"invalidateVertices\";\r\n/**\r\n * Dispatched when a Elements's vertex data has been disposed.\r\n */\r\nElementsEvent.CLEAR_VERTICES = \"clearVertices\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/events/ElementsEvent.js","import * as tslib_1 from \"tslib\";\r\nimport { AttributesView, Float3Attributes, Short3Attributes, AbstractMethodError, AssetBase } from \"@awayjs/core\";\r\nimport { ElementsEvent } from \"../events/ElementsEvent\";\r\n/**\r\n * @class away.base.TriangleElements\r\n */\r\nvar ElementsBase = (function (_super) {\r\n tslib_1.__extends(ElementsBase, _super);\r\n /**\r\n *\r\n */\r\n function ElementsBase(concatenatedBuffer) {\r\n if (concatenatedBuffer === void 0) { concatenatedBuffer = null; }\r\n var _this = _super.call(this) || this;\r\n _this._customAttributesNames = new Array();\r\n _this._customAttributes = new Object();\r\n _this._numElements = 0;\r\n _this._numVertices = 0;\r\n _this._verticesDirty = new Object();\r\n _this._invalidateVertices = new Object();\r\n _this._concatenatedBuffer = concatenatedBuffer;\r\n return _this;\r\n }\r\n Object.defineProperty(ElementsBase.prototype, \"traverseName\", {\r\n get: function () {\r\n throw new AbstractMethodError();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ElementsBase.prototype, \"concatenatedBuffer\", {\r\n get: function () {\r\n return this._concatenatedBuffer;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ElementsBase.prototype, \"indices\", {\r\n /**\r\n * The raw index data that define the faces.\r\n */\r\n get: function () {\r\n return this._indices;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n *\r\n */\r\n ElementsBase.prototype.getCustomAtributesNames = function () {\r\n return this._customAttributesNames;\r\n };\r\n /**\r\n *\r\n */\r\n ElementsBase.prototype.getCustomAtributes = function (name) {\r\n return this._customAttributes[name];\r\n };\r\n Object.defineProperty(ElementsBase.prototype, \"numElements\", {\r\n /**\r\n * The total amount of triangles in the TriangleElements.\r\n */\r\n get: function () {\r\n return this._numElements;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ElementsBase.prototype, \"numVertices\", {\r\n get: function () {\r\n return this._numVertices;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n ElementsBase.prototype.copyTo = function (elements) {\r\n if (this.indices)\r\n elements.setIndices(this.indices.clone());\r\n for (var name in this._customAttributes)\r\n elements.setCustomAttributes(name, this.getCustomAtributes(name).clone());\r\n };\r\n /**\r\n *\r\n */\r\n ElementsBase.prototype.dispose = function () {\r\n _super.prototype.dispose.call(this);\r\n if (this._indices) {\r\n this._indices.dispose();\r\n this._indices = null;\r\n }\r\n for (var name in this._customAttributes) {\r\n this._customAttributes[name].dispose();\r\n delete this._customAttributes;\r\n }\r\n };\r\n ElementsBase.prototype.setIndices = function (values, offset) {\r\n if (offset === void 0) { offset = 0; }\r\n if (values instanceof Short3Attributes) {\r\n if (this._indices)\r\n this.clearIndices();\r\n this._indices = values;\r\n }\r\n else if (values) {\r\n if (!this._indices)\r\n this._indices = new Short3Attributes();\r\n this._indices.set(values, offset);\r\n }\r\n else if (this._indices) {\r\n this._indices.dispose();\r\n this._indices = null;\r\n this.clearIndices();\r\n }\r\n if (this._indices) {\r\n this._numElements = this._indices.count;\r\n this.invalidateIndices();\r\n }\r\n else {\r\n this._numElements = 0;\r\n }\r\n };\r\n ElementsBase.prototype.setCustomAttributes = function (name, values, offset) {\r\n if (offset === void 0) { offset = 0; }\r\n if (values == this._customAttributes[name])\r\n return;\r\n if (values instanceof AttributesView) {\r\n this.clearVertices(this._customAttributes[name]);\r\n this._customAttributes[name] = values;\r\n }\r\n else if (values) {\r\n if (!this._customAttributes[name])\r\n this._customAttributes[name] = new Float3Attributes(this._concatenatedBuffer); //default custom atrributes is Float3\r\n this._customAttributes[name].set(values, offset);\r\n }\r\n else if (this._customAttributes[name]) {\r\n this.clearVertices(this._customAttributes[name]);\r\n this._customAttributesNames.splice(this._customAttributesNames.indexOf(name), 1);\r\n delete this._customAttributes[name];\r\n return;\r\n }\r\n this.invalidateVertices(this._customAttributes[name]);\r\n this._verticesDirty[this._customAttributes[name].id] = false;\r\n if (this._customAttributesNames.indexOf(name) == -1)\r\n this._customAttributesNames.push(name);\r\n };\r\n /**\r\n * Clones the current object\r\n * @return An exact duplicate of the current object.\r\n */\r\n ElementsBase.prototype.clone = function () {\r\n throw new AbstractMethodError();\r\n };\r\n ElementsBase.prototype.applyTransformation = function (transform, count, offset) {\r\n if (count === void 0) { count = 0; }\r\n if (offset === void 0) { offset = 0; }\r\n throw new AbstractMethodError();\r\n };\r\n /**\r\n * Scales the geometry.\r\n * @param scale The amount by which to scale.\r\n */\r\n ElementsBase.prototype.scale = function (scale, count, offset) {\r\n if (count === void 0) { count = 0; }\r\n if (offset === void 0) { offset = 0; }\r\n throw new AbstractMethodError();\r\n };\r\n ElementsBase.prototype.scaleUV = function (scaleU, scaleV, count, offset) {\r\n if (scaleU === void 0) { scaleU = 1; }\r\n if (scaleV === void 0) { scaleV = 1; }\r\n if (count === void 0) { count = 0; }\r\n if (offset === void 0) { offset = 0; }\r\n throw new AbstractMethodError();\r\n };\r\n ElementsBase.prototype.getBoxBounds = function (target, count, offset) {\r\n if (target === void 0) { target = null; }\r\n if (count === void 0) { count = 0; }\r\n if (offset === void 0) { offset = 0; }\r\n throw new AbstractMethodError();\r\n };\r\n ElementsBase.prototype.getSphereBounds = function (center, target, count, offset) {\r\n if (target === void 0) { target = null; }\r\n if (count === void 0) { count = 0; }\r\n if (offset === void 0) { offset = 0; }\r\n throw new AbstractMethodError();\r\n };\r\n ElementsBase.prototype.hitTestPoint = function (x, y, z, box, count, offset) {\r\n if (count === void 0) { count = 0; }\r\n if (offset === void 0) { offset = 0; }\r\n throw new AbstractMethodError();\r\n };\r\n ElementsBase.prototype.invalidateIndices = function () {\r\n if (!this._invalidateIndices)\r\n this._invalidateIndices = new ElementsEvent(ElementsEvent.INVALIDATE_INDICES, this._indices);\r\n this.dispatchEvent(this._invalidateIndices);\r\n };\r\n ElementsBase.prototype.clearIndices = function () {\r\n this.dispatchEvent(new ElementsEvent(ElementsEvent.CLEAR_INDICES, this._indices));\r\n };\r\n ElementsBase.prototype.invalidateVertices = function (attributesView) {\r\n if (!attributesView || this._verticesDirty[attributesView.id])\r\n return;\r\n this._verticesDirty[attributesView.id] = true;\r\n if (!this._invalidateVertices[attributesView.id])\r\n this._invalidateVertices[attributesView.id] = new ElementsEvent(ElementsEvent.INVALIDATE_VERTICES, attributesView);\r\n this.dispatchEvent(this._invalidateVertices[attributesView.id]);\r\n };\r\n ElementsBase.prototype.clearVertices = function (attributesView) {\r\n if (!attributesView)\r\n return;\r\n attributesView.dispose();\r\n this.dispatchEvent(new ElementsEvent(ElementsEvent.CLEAR_VERTICES, attributesView));\r\n this._verticesDirty[attributesView.id] = null;\r\n this._invalidateVertices[attributesView.id] = null;\r\n };\r\n return ElementsBase;\r\n}(AssetBase));\r\nexport { ElementsBase };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/elements/ElementsBase.js","import * as tslib_1 from \"tslib\";\r\nimport { AttributesView, Float3Attributes, Float2Attributes } from \"@awayjs/core\";\r\nimport { TraverserBase } from \"../base/TraverserBase\";\r\nimport { ElementsUtils } from \"../utils/ElementsUtils\";\r\nimport { ElementsBase } from \"./ElementsBase\";\r\n/**\r\n * @class away.base.TriangleElements\r\n */\r\nvar TriangleElements = (function (_super) {\r\n tslib_1.__extends(TriangleElements, _super);\r\n function TriangleElements() {\r\n var _this = _super.apply(this, arguments) || this;\r\n _this._faceNormalsDirty = true;\r\n _this._faceTangentsDirty = true;\r\n _this._autoDeriveNormals = true;\r\n _this._autoDeriveTangents = true;\r\n //used for hittesting geometry\r\n _this.hitTestCache = new Object();\r\n _this.halfStrokeThickness = 0;\r\n return _this;\r\n // public _iTestCollision(pickingCollider:IPickingCollider, material:MaterialBase, pickingCollision:PickingCollision, count:number = 0, offset:number = 0):boolean\r\n // {\r\n // \treturn pickingCollider.testTriangleCollision(this, material, pickingCollision, count || this._numVertices, offset);\r\n // }\r\n }\r\n TriangleElements.prototype.updateSlice9 = function (width, height) {\r\n };\r\n Object.defineProperty(TriangleElements.prototype, \"assetType\", {\r\n get: function () {\r\n return TriangleElements.assetType;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TriangleElements.prototype, \"traverseName\", {\r\n get: function () {\r\n return TriangleElements.traverseName;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TriangleElements.prototype, \"useCondensedIndices\", {\r\n /**\r\n * Offers the option of enabling GPU accelerated animation on skeletons larger than 32 joints\r\n * by condensing the number of joint index values required per sprite. Only applicable to\r\n * skeleton animations that utilise more than one sprite object. Defaults to false.\r\n */\r\n get: function () {\r\n return this._useCondensedIndices;\r\n },\r\n set: function (value) {\r\n if (this._useCondensedIndices == value)\r\n return;\r\n this._useCondensedIndices = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TriangleElements.prototype, \"jointsPerVertex\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return this._jointsPerVertex;\r\n },\r\n set: function (value) {\r\n if (this._jointsPerVertex == value)\r\n return;\r\n this._jointsPerVertex = value;\r\n if (this._jointIndices)\r\n this._jointIndices.dimensions = this._jointsPerVertex;\r\n if (this._jointWeights)\r\n this._jointWeights.dimensions = this._jointsPerVertex;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TriangleElements.prototype, \"autoDeriveNormals\", {\r\n /**\r\n * True if the vertex normals should be derived from the geometry, false if the vertex normals are set\r\n * explicitly.\r\n */\r\n get: function () {\r\n return this._autoDeriveNormals;\r\n },\r\n set: function (value) {\r\n if (this._autoDeriveNormals == value)\r\n return;\r\n this._autoDeriveNormals = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TriangleElements.prototype, \"autoDeriveTangents\", {\r\n /**\r\n * True if the vertex tangents should be derived from the geometry, false if the vertex normals are set\r\n * explicitly.\r\n */\r\n get: function () {\r\n return this._autoDeriveTangents;\r\n },\r\n set: function (value) {\r\n if (this._autoDeriveTangents == value)\r\n return;\r\n this._autoDeriveTangents = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TriangleElements.prototype, \"positions\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n if (!this._positions)\r\n this.setPositions(new Float3Attributes(this._concatenatedBuffer));\r\n return this._positions;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TriangleElements.prototype, \"normals\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n if (!this._normals || this._verticesDirty[this._normals.id])\r\n this.setNormals(this._normals);\r\n return this._normals;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TriangleElements.prototype, \"tangents\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n if (!this._tangents || this._verticesDirty[this._tangents.id])\r\n this.setTangents(this._tangents);\r\n return this._tangents;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TriangleElements.prototype, \"faceNormals\", {\r\n /**\r\n * The raw data of the face normals, in the same order as the faces are listed in the index list.\r\n */\r\n get: function () {\r\n if (this._faceNormalsDirty)\r\n this.updateFaceNormals();\r\n return this._faceNormals;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TriangleElements.prototype, \"faceTangents\", {\r\n /**\r\n * The raw data of the face tangets, in the same order as the faces are listed in the index list.\r\n */\r\n get: function () {\r\n if (this._faceTangentsDirty)\r\n this.updateFaceTangents();\r\n return this._faceTangents;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TriangleElements.prototype, \"uvs\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n if (!this._uvs && TriangleElements.isIE) {\r\n var attributesView2 = new AttributesView(Float32Array, 2);\r\n attributesView2.set(this._positions.get(this._positions.count));\r\n var attributesBuffer2 = attributesView2.attributesBuffer;\r\n attributesView2.dispose();\r\n this._uvs = new Float2Attributes(attributesBuffer2);\r\n }\r\n return this._uvs;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TriangleElements.prototype, \"jointIndices\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return this._jointIndices;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TriangleElements.prototype, \"jointWeights\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return this._jointWeights;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TriangleElements.prototype, \"condensedIndexLookUp\", {\r\n get: function () {\r\n return this._condensedIndexLookUp;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n TriangleElements.prototype.getBoxBounds = function (target, count, offset) {\r\n if (target === void 0) { target = null; }\r\n if (count === void 0) { count = 0; }\r\n if (offset === void 0) { offset = 0; }\r\n return ElementsUtils.getTriangleGraphicsBoxBounds(this.positions, this.indices, target, count || this._numElements || this._numVertices, offset, this.halfStrokeThickness);\r\n };\r\n TriangleElements.prototype.getSphereBounds = function (center, target, count, offset) {\r\n if (target === void 0) { target = null; }\r\n if (count === void 0) { count = 0; }\r\n if (offset === void 0) { offset = 0; }\r\n return ElementsUtils.getTriangleGraphicsSphereBounds(this.positions, center, target, count || this._numVertices, offset);\r\n };\r\n TriangleElements.prototype.hitTestPoint = function (x, y, z, box, count, offset, idx_count, idx_offset) {\r\n if (count === void 0) { count = 0; }\r\n if (offset === void 0) { offset = 0; }\r\n if (idx_count === void 0) { idx_count = 0; }\r\n if (idx_offset === void 0) { idx_offset = 0; }\r\n return ElementsUtils.hitTestTriangleElements(x, y, 0, box, this, count || this._numElements || this._numVertices, offset);\r\n };\r\n TriangleElements.prototype.setPositions = function (values, offset) {\r\n if (offset === void 0) { offset = 0; }\r\n if (values == this._positions)\r\n return;\r\n if (values instanceof AttributesView) {\r\n this.clearVertices(this._positions);\r\n this._positions = values;\r\n }\r\n else if (values) {\r\n if (!this._positions)\r\n this._positions = new Float3Attributes(this._concatenatedBuffer);\r\n this._positions.set(values, offset);\r\n }\r\n else {\r\n this.clearVertices(this._positions);\r\n this._positions = new Float3Attributes(this._concatenatedBuffer); //positions cannot be null\r\n }\r\n this._numVertices = this._positions.count;\r\n if (this._autoDeriveNormals)\r\n this.invalidateVertices(this._normals);\r\n if (this._autoDeriveTangents)\r\n this.invalidateVertices(this._tangents);\r\n this.invalidateVertices(this._positions);\r\n this._verticesDirty[this._positions.id] = false;\r\n };\r\n TriangleElements.prototype.setNormals = function (values, offset) {\r\n if (offset === void 0) { offset = 0; }\r\n if (!this._autoDeriveNormals) {\r\n if (values == this._normals)\r\n return;\r\n if (values instanceof Float3Attributes) {\r\n this.clearVertices(this._normals);\r\n this._normals = values;\r\n }\r\n else if (values) {\r\n if (!this._normals)\r\n this._normals = new Float3Attributes(this._concatenatedBuffer);\r\n this._normals.set(values, offset);\r\n }\r\n else if (this._normals) {\r\n this.clearVertices(this._normals);\r\n this._normals = null;\r\n return;\r\n }\r\n }\r\n else {\r\n this._normals = ElementsUtils.generateNormals(this.indices, this.faceNormals, this._normals, this._concatenatedBuffer);\r\n }\r\n this.invalidateVertices(this._normals);\r\n this._verticesDirty[this._normals.id] = false;\r\n };\r\n TriangleElements.prototype.setTangents = function (values, offset) {\r\n if (offset === void 0) { offset = 0; }\r\n if (!this._autoDeriveTangents) {\r\n if (values == this._tangents)\r\n return;\r\n if (values instanceof Float3Attributes) {\r\n this.clearVertices(this._tangents);\r\n this._tangents = values;\r\n }\r\n else if (values) {\r\n if (!this._tangents)\r\n this._tangents = new Float3Attributes(this._concatenatedBuffer);\r\n this._tangents.set(values, offset);\r\n }\r\n else if (this._tangents) {\r\n this.clearVertices(this._tangents);\r\n this._tangents = null;\r\n return;\r\n }\r\n }\r\n else {\r\n this._tangents = ElementsUtils.generateTangents(this.indices, this.faceTangents, this.faceNormals, this._tangents, this._concatenatedBuffer);\r\n }\r\n this.invalidateVertices(this._tangents);\r\n this._verticesDirty[this._tangents.id] = false;\r\n };\r\n TriangleElements.prototype.setUVs = function (values, offset) {\r\n if (offset === void 0) { offset = 0; }\r\n if (values == this._uvs)\r\n return;\r\n if (values instanceof AttributesView) {\r\n this.clearVertices(this._uvs);\r\n this._uvs = values;\r\n }\r\n else if (values) {\r\n if (!this._uvs)\r\n this._uvs = new Float2Attributes(this._concatenatedBuffer);\r\n this._uvs.set(values, offset);\r\n }\r\n else if (this._uvs) {\r\n this.clearVertices(this._uvs);\r\n this._uvs = null;\r\n return;\r\n }\r\n this.invalidateVertices(this._uvs);\r\n this._verticesDirty[this._uvs.id] = false;\r\n };\r\n TriangleElements.prototype.setJointIndices = function (values, offset) {\r\n if (offset === void 0) { offset = 0; }\r\n if (values == this._jointIndices)\r\n return;\r\n if (values instanceof AttributesView) {\r\n this.clearVertices(this._jointIndices);\r\n this._jointIndices = values;\r\n }\r\n else if (values) {\r\n if (!this._jointIndices)\r\n this._jointIndices = new AttributesView(Float32Array, this._jointsPerVertex, this._concatenatedBuffer);\r\n if (this._useCondensedIndices) {\r\n var i = 0;\r\n var oldIndex;\r\n var newIndex = 0;\r\n var dic = new Object();\r\n this._condensedIndexLookUp = new Array();\r\n while (i < values.length) {\r\n oldIndex = values[i];\r\n // if we encounter a new index, assign it a new condensed index\r\n if (dic[oldIndex] == undefined) {\r\n dic[oldIndex] = newIndex;\r\n this._condensedIndexLookUp[newIndex++] = oldIndex;\r\n }\r\n //reset value to dictionary lookup\r\n values[i++] = dic[oldIndex];\r\n }\r\n }\r\n this._jointIndices.set(values, offset);\r\n }\r\n else if (this._jointIndices) {\r\n this.clearVertices(this._jointIndices);\r\n this._jointIndices = null;\r\n return;\r\n }\r\n this.invalidateVertices(this._jointIndices);\r\n this._verticesDirty[this._jointIndices.id] = false;\r\n };\r\n TriangleElements.prototype.setJointWeights = function (values, offset) {\r\n if (offset === void 0) { offset = 0; }\r\n if (values == this._jointWeights)\r\n return;\r\n if (values instanceof AttributesView) {\r\n this.clearVertices(this._jointWeights);\r\n this._jointWeights = values;\r\n }\r\n else if (values) {\r\n if (!this._jointWeights)\r\n this._jointWeights = new AttributesView(Float32Array, this._jointsPerVertex, this._concatenatedBuffer);\r\n this._jointWeights.set(values, offset);\r\n }\r\n else if (this._jointWeights) {\r\n this.clearVertices(this._jointWeights);\r\n this._jointWeights = null;\r\n return;\r\n }\r\n this.invalidateVertices(this._jointWeights);\r\n this._verticesDirty[this._jointWeights.id] = false;\r\n };\r\n /**\r\n *\r\n */\r\n TriangleElements.prototype.dispose = function () {\r\n _super.prototype.dispose.call(this);\r\n if (this._positions) {\r\n this._positions.dispose();\r\n this._positions = null;\r\n }\r\n if (this._normals) {\r\n this._normals.dispose();\r\n this._normals = null;\r\n }\r\n if (this._tangents) {\r\n this._tangents.dispose();\r\n this._tangents = null;\r\n }\r\n if (this._uvs) {\r\n this._uvs.dispose();\r\n this._uvs = null;\r\n }\r\n if (this._jointIndices) {\r\n this._jointIndices.dispose();\r\n this._jointIndices = null;\r\n }\r\n if (this._jointWeights) {\r\n this._jointWeights.dispose();\r\n this._jointWeights = null;\r\n }\r\n if (this._faceNormals) {\r\n this._faceNormals.dispose();\r\n this._faceNormals = null;\r\n }\r\n if (this._faceTangents) {\r\n this._faceTangents.dispose();\r\n this._faceTangents = null;\r\n }\r\n };\r\n TriangleElements.prototype.setIndices = function (values, offset) {\r\n if (offset === void 0) { offset = 0; }\r\n _super.prototype.setIndices.call(this, values, offset);\r\n this._faceNormalsDirty = true;\r\n this._faceTangentsDirty = true;\r\n if (this._autoDeriveNormals)\r\n this.invalidateVertices(this._normals);\r\n if (this._autoDeriveTangents)\r\n this.invalidateVertices(this._tangents);\r\n };\r\n TriangleElements.prototype.copyTo = function (elements) {\r\n _super.prototype.copyTo.call(this, elements);\r\n //temp disable auto derives\r\n var autoDeriveNormals = this._autoDeriveNormals;\r\n var autoDeriveTangents = this._autoDeriveTangents;\r\n elements.autoDeriveNormals = this._autoDeriveNormals = false;\r\n elements.autoDeriveTangents = this._autoDeriveTangents = false;\r\n elements.setPositions(this.positions.clone());\r\n if (this.normals)\r\n elements.setNormals(this.normals.clone());\r\n if (this.tangents)\r\n elements.setTangents(this.tangents.clone());\r\n if (this.uvs)\r\n elements.setUVs(this.uvs.clone());\r\n elements.jointsPerVertex = this._jointsPerVertex;\r\n if (this.jointIndices)\r\n elements.setJointIndices(this.jointIndices.clone());\r\n if (this.jointWeights)\r\n elements.setJointWeights(this.jointWeights.clone());\r\n //return auto derives to cloned values\r\n elements.autoDeriveNormals = this._autoDeriveNormals = autoDeriveNormals;\r\n elements.autoDeriveTangents = this._autoDeriveTangents = autoDeriveTangents;\r\n if (this.slice9Indices) {\r\n elements.originalSlice9Size = this.originalSlice9Size;\r\n elements.slice9offsets = this.slice9offsets;\r\n elements.slice9Indices = this.slice9Indices;\r\n elements.initialSlice9Positions = this.initialSlice9Positions;\r\n }\r\n };\r\n /**\r\n * Clones the current object\r\n * @return An exact duplicate of the current object.\r\n */\r\n TriangleElements.prototype.clone = function () {\r\n var clone = new TriangleElements(this._concatenatedBuffer ? this._concatenatedBuffer.clone() : null);\r\n this.copyTo(clone);\r\n return clone;\r\n };\r\n TriangleElements.prototype.scaleUV = function (scaleU, scaleV, count, offset) {\r\n if (scaleU === void 0) { scaleU = 1; }\r\n if (scaleV === void 0) { scaleV = 1; }\r\n if (count === void 0) { count = 0; }\r\n if (offset === void 0) { offset = 0; }\r\n if (this.uvs)\r\n ElementsUtils.scale(scaleU, scaleV, 0, this.uvs, count || this._numVertices, offset);\r\n };\r\n /**\r\n * Scales the geometry.\r\n * @param scale The amount by which to scale.\r\n */\r\n TriangleElements.prototype.scale = function (scale, count, offset) {\r\n if (count === void 0) { count = 0; }\r\n if (offset === void 0) { offset = 0; }\r\n ElementsUtils.scale(scale, scale, scale, this.positions, count || this._numVertices, offset);\r\n };\r\n TriangleElements.prototype.applyTransformation = function (transform, count, offset) {\r\n if (count === void 0) { count = 0; }\r\n if (offset === void 0) { offset = 0; }\r\n ElementsUtils.applyTransformation(transform, this.positions, this.normals, this.tangents, count || this._numVertices, offset);\r\n };\r\n /**\r\n * Updates the tangents for each face.\r\n */\r\n TriangleElements.prototype.updateFaceTangents = function () {\r\n this._faceTangents = ElementsUtils.generateFaceTangents(this.indices, this.positions, this.uvs || this.positions, this._faceTangents, this.numElements);\r\n this._faceTangentsDirty = false;\r\n };\r\n /**\r\n * Updates the normals for each face.\r\n */\r\n TriangleElements.prototype.updateFaceNormals = function () {\r\n this._faceNormals = ElementsUtils.generateFaceNormals(this.indices, this.positions, this._faceNormals, this.numElements);\r\n this._faceNormalsDirty = false;\r\n };\r\n return TriangleElements;\r\n}(ElementsBase));\r\nexport { TriangleElements };\r\nTriangleElements.isIE = !!navigator.userAgent.match(/Trident/g) || !!navigator.userAgent.match(/MSIE/g);\r\nTriangleElements.traverseName = TraverserBase.addRenderableName(\"applyTriangleShape\");\r\nTriangleElements.assetType = \"[asset TriangleElements]\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/elements/TriangleElements.js","/**\r\n * Defines the values to use for specifying path-drawing commands.\r\n * The values in this class are used by the Graphics.drawPath() method,\r\n *or stored in the commands vector of a GraphicsPath object.\r\n */\r\nvar GraphicsPathCommand = (function () {\r\n function GraphicsPathCommand() {\r\n }\r\n return GraphicsPathCommand;\r\n}());\r\nexport { GraphicsPathCommand };\r\n/**\r\n * Represents the default \"do nothing\" command.\r\n */\r\nGraphicsPathCommand.NO_OP = 0;\r\n/**\r\n * Specifies a drawing command that moves the current drawing position\r\n * to the x- and y-coordinates specified in the data vector.\r\n */\r\nGraphicsPathCommand.MOVE_TO = 1;\r\n/**\r\n * Specifies a drawing command that draws a line from the current drawing position\r\n * to the x- and y-coordinates specified in the data vector.\r\n */\r\nGraphicsPathCommand.LINE_TO = 2;\r\n/**\r\n * Specifies a drawing command that draws a curve from the current drawing position\r\n * to the x- and y-coordinates specified in the data vector, using a control point.\r\n */\r\nGraphicsPathCommand.CURVE_TO = 3;\r\n/**\r\n * Specifies a drawing command that draws a curve from the current drawing position\r\n * to the x- and y-coordinates specified in the data vector, using a control point.\r\n */\r\nGraphicsPathCommand.BUILD_JOINT = 13;\r\nGraphicsPathCommand.BUILD_ROUND_JOINT = 14;\r\n/**\r\n * Specifies a \"line to\" drawing command,\r\n * but uses two sets of coordinates (four values) instead of one set.\r\n */\r\nGraphicsPathCommand.WIDE_LINE_TO = 4;\r\n/**\r\n * Specifies a \"move to\" drawing command,\r\n * but uses two sets of coordinates (four values) instead of one set.\r\n */\r\nGraphicsPathCommand.WIDE_MOVE_TO = 5;\r\n/**\r\n * Specifies a drawing command that draws a curve from the current drawing position\r\n * to the x- and y-coordinates specified in the data vector, using 2 control points.\r\n */\r\nGraphicsPathCommand.CUBIC_CURVE = 6;\r\nexport default GraphicsPathCommand;\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/draw/GraphicsPathCommand.js","import * as tslib_1 from \"tslib\";\r\nimport { AssetBase } from \"@awayjs/core\";\r\n/**\r\n *\r\n */\r\nvar SamplerBase = (function (_super) {\r\n tslib_1.__extends(SamplerBase, _super);\r\n /**\r\n *\r\n */\r\n function SamplerBase(smooth, mipmap) {\r\n if (smooth === void 0) { smooth = false; }\r\n if (mipmap === void 0) { mipmap = false; }\r\n var _this = _super.call(this) || this;\r\n _this._smooth = smooth;\r\n _this._mipmap = mipmap;\r\n return _this;\r\n }\r\n Object.defineProperty(SamplerBase.prototype, \"smooth\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return this._smooth;\r\n },\r\n set: function (value) {\r\n if (this._smooth == value)\r\n return;\r\n this._smooth = value;\r\n //TODO: update dependencies\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(SamplerBase.prototype, \"mipmap\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return this._mipmap;\r\n },\r\n set: function (value) {\r\n if (this._mipmap == value)\r\n return;\r\n this._mipmap = value;\r\n //TODO: update dependencies\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n return SamplerBase;\r\n}(AssetBase));\r\nexport { SamplerBase };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/image/SamplerBase.js","import * as tslib_1 from \"tslib\";\r\nimport { SamplerBase } from \"../image/SamplerBase\";\r\n/**\r\n * The Sampler2D export class represents display objects that represent bitmap images.\r\n * These can be images that you load with the flash.Assets or\r\n * flash.display.Loader classes, or they can be images that you\r\n * create with the Sampler2D() constructor.\r\n *\r\n * The Sampler2D() constructor allows you to create a Sampler2D\r\n * object that contains a reference to a Image2D object. After you create a\r\n * Sampler2D object, use the addChild() or addChildAt()\r\n * method of the parent DisplayObjectContainer instance to place the bitmap on\r\n * the display list.
A Sampler2D object can share its Image2D reference among several Sampler2D\r\n * objects, independent of translation or rotation properties. Because you can\r\n * create multiple Sampler2D objects that reference the same Image2D object,\r\n * multiple texture objects can use the same complex Image2D object without\r\n * incurring the memory overhead of a Image2D object for each texture\r\n * object instance.
\r\n\r\n */\r\nvar Sampler2D = (function (_super) {\r\n tslib_1.__extends(Sampler2D, _super);\r\n /**\r\n *\r\n * @param image2D\r\n * @param smoothing\r\n */\r\n function Sampler2D(repeat, smooth, mipmap) {\r\n if (repeat === void 0) { repeat = false; }\r\n if (smooth === void 0) { smooth = false; }\r\n if (mipmap === void 0) { mipmap = false; }\r\n var _this = _super.call(this, smooth, mipmap) || this;\r\n _this._repeat = repeat;\r\n _this._updateRect();\r\n return _this;\r\n }\r\n Object.defineProperty(Sampler2D.prototype, \"assetType\", {\r\n /**\r\n *\r\n * @returns {string}\r\n */\r\n get: function () {\r\n return Sampler2D.assetType;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Sampler2D.prototype, \"repeat\", {\r\n /**\r\n * Controls whether or not the Sampler2D object is snapped to the nearest pixel.\r\n * This value is ignored in the native and HTML5 targets.\r\n * The PixelSnapping export class includes possible values:\r\n *- \r\n *
PixelSnapping.NEVER- No pixel snapping occurs. \r\n * PixelSnapping.ALWAYS- The image is always snapped to\r\n * the nearest pixel, independent of transformation. \r\n * PixelSnapping.AUTO- The image is snapped to the\r\n * nearest pixel if it is drawn with no rotation or skew and it is drawn at a\r\n * scale factor of 99.9% to 100.1%. If these conditions are satisfied, the\r\n * bitmap image is drawn at 100% scale, snapped to the nearest pixel.\r\n * When targeting Flash Player, this value allows the image to be drawn as fast\r\n * as possible using the internal vector renderer. \r\n *
true, the bitmap is smoothed when scaled. If\r\n * false, the bitmap is not smoothed when scaled.\r\n */\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return this._repeat;\r\n },\r\n set: function (value) {\r\n if (this._repeat == value)\r\n return;\r\n this._repeat = value;\r\n //TODO: update dependencies\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Sampler2D.prototype, \"imageRect\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return this._imageRect;\r\n },\r\n set: function (value) {\r\n if (this._imageRect == value)\r\n return;\r\n this._imageRect = value;\r\n this._updateRect();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Sampler2D.prototype, \"frameRect\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return this._frameRect;\r\n },\r\n set: function (value) {\r\n if (this._frameRect == value)\r\n return;\r\n this._frameRect = value;\r\n this._updateRect();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Sampler2D.prototype._updateRect = function () {\r\n };\r\n return Sampler2D;\r\n}(SamplerBase));\r\nexport { Sampler2D };\r\nSampler2D.assetType = \"[asset Sampler2D]\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/image/Sampler2D.js","/**\r\n * The GraphicsPathWinding class provides values for the\r\n * flash.display.GraphicsPath.winding property and the\r\n * flash.display.Graphics.drawPath() method to determine the\r\n * direction to draw a path. A clockwise path is positively wound, and a\r\n * counter-clockwise path is negatively wound:\r\n *\r\n * When paths intersect or overlap, the winding direction determines the\r\n * rules for filling the areas created by the intersection or overlap:
\r\n */\r\nvar GraphicsPathWinding = (function () {\r\n function GraphicsPathWinding() {\r\n }\r\n return GraphicsPathWinding;\r\n}());\r\nexport { GraphicsPathWinding };\r\nGraphicsPathWinding.EVEN_ODD = \"evenOdd\";\r\nGraphicsPathWinding.NON_ZERO = \"nonZero\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/draw/GraphicsPathWinding.js","/**\r\n * The JointStyle class is an enumeration of constant values that specify the\r\n * joint style to use in drawing lines. These constants are provided for use\r\n * as values in thejoints parameter of the\r\n * flash.display.Graphics.lineStyle() method. The method supports\r\n * three types of joints: miter, round, and bevel, as the following example\r\n * shows:\r\n */\r\nvar JointStyle = (function () {\r\n function JointStyle() {\r\n }\r\n return JointStyle;\r\n}());\r\nexport { JointStyle };\r\n/**\r\n * Specifies beveled joints in the joints parameter of the\r\n * flash.display.Graphics.lineStyle() method.\r\n */\r\nJointStyle.BEVEL = 2;\r\n/**\r\n * Specifies mitered joints in the joints parameter of the\r\n * flash.display.Graphics.lineStyle() method.\r\n */\r\nJointStyle.MITER = 0;\r\n/**\r\n * Specifies round joints in the joints parameter of the\r\n * flash.display.Graphics.lineStyle() method.\r\n */\r\nJointStyle.ROUND = 1;\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/draw/JointStyle.js","import { JointStyle } from \"../draw/JointStyle\";\r\nimport { CapsStyle } from \"../draw/CapsStyle\";\r\nvar GraphicsStrokeStyle = (function () {\r\n function GraphicsStrokeStyle(color, alpha, thickness, jointstyle, capstyle, miter_limit) {\r\n if (color === void 0) { color = 0xffffff; }\r\n if (alpha === void 0) { alpha = 1; }\r\n if (thickness === void 0) { thickness = 10; }\r\n if (jointstyle === void 0) { jointstyle = JointStyle.ROUND; }\r\n if (capstyle === void 0) { capstyle = CapsStyle.SQUARE; }\r\n if (miter_limit === void 0) { miter_limit = 10; }\r\n this._color = color;\r\n this._alpha = alpha;\r\n this._thickness = thickness;\r\n this._jointstyle = jointstyle;\r\n this._capstyle = capstyle;\r\n this._miter_limit = miter_limit;\r\n }\r\n Object.defineProperty(GraphicsStrokeStyle.prototype, \"data_type\", {\r\n get: function () {\r\n return GraphicsStrokeStyle.data_type;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(GraphicsStrokeStyle.prototype, \"color\", {\r\n get: function () {\r\n return this._color;\r\n },\r\n set: function (value) {\r\n this._color = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(GraphicsStrokeStyle.prototype, \"alpha\", {\r\n get: function () {\r\n return this._alpha;\r\n },\r\n set: function (value) {\r\n this._alpha = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(GraphicsStrokeStyle.prototype, \"half_thickness\", {\r\n get: function () {\r\n return this._thickness / 2;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(GraphicsStrokeStyle.prototype, \"thickness\", {\r\n get: function () {\r\n return this._thickness;\r\n },\r\n set: function (value) {\r\n this._thickness = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(GraphicsStrokeStyle.prototype, \"jointstyle\", {\r\n get: function () {\r\n return this._jointstyle;\r\n },\r\n set: function (value) {\r\n this._jointstyle = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(GraphicsStrokeStyle.prototype, \"miter_limit\", {\r\n get: function () {\r\n return this._miter_limit;\r\n },\r\n set: function (value) {\r\n this._miter_limit = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(GraphicsStrokeStyle.prototype, \"capstyle\", {\r\n get: function () {\r\n return this._capstyle;\r\n },\r\n set: function (value) {\r\n this._capstyle = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n return GraphicsStrokeStyle;\r\n}());\r\nexport { GraphicsStrokeStyle };\r\nGraphicsStrokeStyle.data_type = \"[graphicsdata StrokeStyle]\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/draw/GraphicsStrokeStyle.js","import { Point, MathConsts } from \"@awayjs/core\";\r\nimport { GraphicsPathWinding } from \"../draw/GraphicsPathWinding\";\r\nimport { GraphicsPathCommand } from \"../draw/GraphicsPathCommand\";\r\nimport { GraphicsFillStyle } from \"../draw/GraphicsFillStyle\";\r\nimport { GraphicsStrokeStyle } from \"../draw/GraphicsStrokeStyle\";\r\nimport { GraphicsFactoryHelper } from \"../draw/GraphicsFactoryHelper\";\r\n/**\r\n\r\n * Defines the values to use for specifying path-drawing commands.\r\n * The values in this class are used by the Graphics.drawPath() method,\r\n *or stored in the commands vector of a GraphicsPath object.\r\n */\r\nvar GraphicsPath = (function () {\r\n function GraphicsPath(commands, data, winding_rule) {\r\n if (commands === void 0) { commands = null; }\r\n if (data === void 0) { data = null; }\r\n if (winding_rule === void 0) { winding_rule = GraphicsPathWinding.EVEN_ODD; }\r\n this.forceClose = false;\r\n this._data = [];\r\n this._commands = [];\r\n this._style = null;\r\n this.verts = [];\r\n this._positions = [];\r\n this._newCommands = [];\r\n if (commands != null && data != null) {\r\n this._data[0] = data;\r\n this._commands[0] = commands;\r\n }\r\n else {\r\n this._data[0] = [];\r\n this._commands[0] = [];\r\n }\r\n this._startPoint = new Point();\r\n this._cur_point = new Point();\r\n this._winding_rule = winding_rule;\r\n this._winding_directions = [];\r\n }\r\n Object.defineProperty(GraphicsPath.prototype, \"data_type\", {\r\n get: function () {\r\n return GraphicsPath.data_type;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(GraphicsPath.prototype, \"style\", {\r\n get: function () {\r\n return this._style;\r\n },\r\n set: function (value) {\r\n this._style = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n GraphicsPath.prototype.fill = function () {\r\n if (this._style == null)\r\n return null;\r\n if (this._style.data_type == GraphicsFillStyle.data_type)\r\n return this._style;\r\n return null;\r\n };\r\n GraphicsPath.prototype.stroke = function () {\r\n if (this._style == null)\r\n return null;\r\n if (this._style.data_type == GraphicsStrokeStyle.data_type)\r\n return this._style;\r\n return null;\r\n };\r\n Object.defineProperty(GraphicsPath.prototype, \"commands\", {\r\n get: function () {\r\n return this._commands;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(GraphicsPath.prototype, \"data\", {\r\n get: function () {\r\n return this._data;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n GraphicsPath.prototype.curveTo = function (controlX, controlY, anchorX, anchorY) {\r\n // if controlpoint and anchor are same, we add lineTo command\r\n if ((controlX == anchorX) && (controlY == anchorY)) {\r\n this.lineTo(controlX, controlY);\r\n this.moveTo(anchorX, anchorY);\r\n return;\r\n }\r\n // if anchor is current point, but controlpoint is different, we lineto controlpoint\r\n if (((this._cur_point.x == anchorX) && (this._cur_point.y == anchorY)) && ((this._cur_point.x != controlX) || (this._cur_point.y != controlY))) {\r\n this.lineTo(controlX, controlY);\r\n this.moveTo(anchorX, anchorY);\r\n return;\r\n }\r\n // if controlpoint is current point, but anchor is different, we lineto anchor\r\n if (((this._cur_point.x != anchorX) || (this._cur_point.y != anchorY)) && ((this._cur_point.x == controlX) && (this._cur_point.y == controlY))) {\r\n this.lineTo(anchorX, anchorY);\r\n return;\r\n }\r\n // if controlpoint and anchor are same as current point\r\n if (((this._cur_point.x == anchorX) && (this._cur_point.y == anchorY)) && ((this._cur_point.x == controlX) && (this._cur_point.y == controlY))) {\r\n //console.log(\"curveTo command not added because startpoint and endpoint are the same.\");\r\n this.lineTo(anchorX, anchorY);\r\n return;\r\n }\r\n if (this._commands[this._commands.length - 1].length == 0) {\r\n // every contour must start with a moveTo command, so we make sure we have correct startpoint\r\n this._commands[this._commands.length - 1].push(GraphicsPathCommand.MOVE_TO);\r\n this._data[this._data.length - 1].push(this._cur_point.x);\r\n this._data[this._data.length - 1].push(this._cur_point.y);\r\n }\r\n this._commands[this._commands.length - 1].push(GraphicsPathCommand.CURVE_TO);\r\n this._data[this._data.length - 1].push(controlX);\r\n this._data[this._data.length - 1].push(controlY);\r\n this._data[this._data.length - 1].push(anchorX);\r\n this._data[this._data.length - 1].push(anchorY);\r\n this._cur_point.x = anchorX;\r\n this._cur_point.y = anchorY;\r\n };\r\n GraphicsPath.prototype.cubicCurveTo = function (controlX, controlY, control2X, control2Y, anchorX, anchorY) {\r\n console.log(\"cubicCurveTo not yet fully supported.\");\r\n if ((this._cur_point.x == anchorX) && (this._cur_point.y == anchorY)) {\r\n //console.log(\"curveTo command not added because startpoint and endpoint are the same.\");\r\n return;\r\n }\r\n if (this._commands[this._commands.length - 1].length == 0) {\r\n // every contour must start with a moveTo command, so we make sure we have correct startpoint\r\n this._commands[this._commands.length - 1].push(GraphicsPathCommand.MOVE_TO);\r\n this._data[this._data.length - 1].push(this._cur_point.x);\r\n this._data[this._data.length - 1].push(this._cur_point.y);\r\n }\r\n this._commands[this._commands.length - 1].push(GraphicsPathCommand.CURVE_TO);\r\n this._data[this._data.length - 1].push(controlX);\r\n this._data[this._data.length - 1].push(controlY);\r\n this._data[this._data.length - 1].push(anchorX);\r\n this._data[this._data.length - 1].push(anchorY);\r\n this._cur_point.x = anchorX;\r\n this._cur_point.y = anchorY;\r\n };\r\n GraphicsPath.prototype.lineTo = function (x, y) {\r\n if ((this._cur_point.x == x) && (this._cur_point.y == y)) {\r\n //console.log(\"lineTo command not added because startpoint and endpoint are the same.\");\r\n return;\r\n }\r\n if (this._commands[this._commands.length - 1].length == 0) {\r\n // every contour must start with a moveTo command, so we make sure we have correct startpoint\r\n this._commands[this._commands.length - 1].push(GraphicsPathCommand.MOVE_TO);\r\n this._data[this._data.length - 1].push(this._cur_point.x);\r\n this._data[this._data.length - 1].push(this._cur_point.y);\r\n }\r\n this._commands[this._commands.length - 1].push(GraphicsPathCommand.LINE_TO);\r\n this._data[this._data.length - 1].push(x);\r\n this._data[this._data.length - 1].push(y);\r\n this._cur_point.x = x;\r\n this._cur_point.y = y;\r\n };\r\n GraphicsPath.prototype.moveTo = function (x, y) {\r\n if ((this._cur_point.x == x) && (this._cur_point.y == y)) {\r\n //console.log(\"moveTo command not added because startpoint and endpoint are the same.\");\r\n return;\r\n }\r\n // whenever a moveTo command apears, we start a new contour\r\n if (this._commands[this._commands.length - 1].length > 0) {\r\n this._commands.push([GraphicsPathCommand.MOVE_TO]);\r\n this._data.push([x, y]);\r\n }\r\n this._startPoint.x = x;\r\n this._startPoint.y = y;\r\n this._cur_point.x = x;\r\n this._cur_point.y = y;\r\n };\r\n GraphicsPath.prototype.wideLineTo = function (x, y) {\r\n // not used\r\n /*\r\n this._commands.push(GraphicsPathCommand.WIDE_LINE_TO);\r\n this._data.push(0);\r\n this._data.push(0);\r\n this._data.push(x);\r\n this._data.push(y);\r\n */\r\n };\r\n GraphicsPath.prototype.wideMoveTo = function (x, y) {\r\n // not used\r\n /*\r\n this._commands.push(GraphicsPathCommand.WIDE_MOVE_TO);\r\n this._data.push(0);\r\n this._data.push(0);\r\n this._data.push(x);\r\n this._data.push(y);\r\n */\r\n };\r\n GraphicsPath.prototype.prepare = function () {\r\n var new_dir;\r\n var dir_delta;\r\n var last_direction;\r\n var closed;\r\n var tmp_dir_point = new Point();\r\n var prev_dir_vec = new Point();\r\n var prev_point = new Point();\r\n var end_point = new Point();\r\n var commands;\r\n var data;\r\n var c, i = 0;\r\n var cmd_len = this.commands.length;\r\n for (c = 0; c < cmd_len; c++) {\r\n commands = this.commands[c];\r\n data = this.data[c];\r\n new_dir = 0;\r\n dir_delta = 0;\r\n last_direction = 0;\r\n tmp_dir_point.x = 0;\r\n tmp_dir_point.y = 0;\r\n prev_dir_vec.x = 0;\r\n prev_dir_vec.y = 0;\r\n this._positions[c] = [];\r\n this._newCommands[c] = [];\r\n // check if the path is closed. \r\n // if its not closed, we optionally close it by adding the extra lineTo-cmd\r\n closed = true;\r\n if ((data[0] != data[data.length - 2]) || (data[1] != data[data.length - 1])) {\r\n if (this.forceClose) {\r\n commands[commands.length] = GraphicsPathCommand.LINE_TO;\r\n data[data.length] = data[0];\r\n data[data.length] = data[1];\r\n }\r\n else {\r\n closed = false;\r\n }\r\n }\r\n // if the path is closed, we init the prevDirection with the last segments direction\r\n if (closed) {\r\n //console.log(\"path is closed\");\r\n prev_dir_vec.x = data[data.length - 2] - data[data.length - 4];\r\n prev_dir_vec.y = data[data.length - 1] - data[data.length - 3];\r\n prev_dir_vec.normalize();\r\n last_direction = Math.atan2(prev_dir_vec.y, prev_dir_vec.x) * MathConsts.RADIANS_TO_DEGREES;\r\n }\r\n else {\r\n }\r\n var data_cnt = 0;\r\n prev_point.x = data[data_cnt++];\r\n prev_point.y = data[data_cnt++];\r\n var prev_x = prev_point.x;\r\n var prev_y = prev_point.y;\r\n this._positions[c].push(prev_point.x);\r\n this._positions[c].push(prev_point.y);\r\n this._newCommands[c].push(GraphicsPathCommand.MOVE_TO);\r\n var ctr_point = new Point();\r\n for (i = 1; i < commands.length; i++) {\r\n switch (commands[i]) {\r\n case GraphicsPathCommand.MOVE_TO:\r\n console.log(\"ERROR ! ONLY THE FIRST COMMAND FOR A CONTOUR IS ALLOWED TO BE A 'MOVE_TO' COMMAND\");\r\n break;\r\n case GraphicsPathCommand.LINE_TO:\r\n end_point = new Point(data[data_cnt++], data[data_cnt++]);\r\n // console.log(\"LINE_TO \", i, end_point.x, end_point.y);\r\n this._positions[c].push(end_point.x);\r\n this._positions[c].push(end_point.y);\r\n this._newCommands[c].push(GraphicsPathCommand.LINE_TO);\r\n prev_x = end_point.x;\r\n prev_y = end_point.y;\r\n break;\r\n case GraphicsPathCommand.CURVE_TO:\r\n end_point = new Point(data[data_cnt++], data[data_cnt++]);\r\n ctr_point = new Point(data[data_cnt++], data[data_cnt++]);\r\n //console.log(\"CURVE_TO \", i, ctr_point.x, ctr_point.y, end_point.x, end_point.y);\r\n var curve_verts = [];\r\n GraphicsFactoryHelper.tesselateCurve(prev_x, prev_y, ctr_point.x, ctr_point.y, end_point.x, end_point.y, curve_verts);\r\n var k_len = curve_verts.length;\r\n var k = 0;\r\n for (k = 0; k < k_len; k += 2) {\r\n var newPoint = new Point(curve_verts[k], curve_verts[k + 1]);\r\n // console.log(\"tesselated curve to \", k, newPoint.x, newPoint.y);\r\n this._newCommands[c].push(GraphicsPathCommand.LINE_TO);\r\n this._positions[c].push(newPoint.x);\r\n this._positions[c].push(newPoint.y);\r\n }\r\n prev_x = end_point.x;\r\n prev_y = end_point.y;\r\n break;\r\n }\r\n }\r\n }\r\n };\r\n return GraphicsPath;\r\n}());\r\nexport { GraphicsPath };\r\nGraphicsPath.data_type = \"[graphicsdata path]\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/draw/GraphicsPath.js","/**\r\n * The LineScaleMode class provides values for the scaleMode\r\n * parameter in the Graphics.lineStyle() method.\r\n */\r\nvar LineScaleMode = (function () {\r\n function LineScaleMode() {\r\n }\r\n return LineScaleMode;\r\n}());\r\nexport { LineScaleMode };\r\n/**\r\n * With this setting used as the scaleMode parameter of the\r\n * lineStyle() method, the thickness of the line scales\r\n * only vertically. For example, consider the following circles, drawn\r\n * with a one-pixel line, and each with the scaleMode parameter\r\n * set to LineScaleMode.VERTICAL. The circle on the left is\r\n * scaled only vertically, and the circle on the right is scaled both\r\n * vertically and horizontally.\r\n */\r\nLineScaleMode.HORIZONTAL = \"horizontal\";\r\n/**\r\n * With this setting used as the scaleMode parameter of the\r\n * lineStyle() method, the thickness of the line never scales.\r\n */\r\nLineScaleMode.NONE = \"none\";\r\n/**\r\n * With this setting used as the scaleMode parameter of the\r\n * lineStyle() method, the thickness of the line always scales\r\n * when the object is scaled(the default).\r\n */\r\nLineScaleMode.NORMAL = \"normal\";\r\n/**\r\n * With this setting used as the scaleMode parameter of the\r\n * lineStyle() method, the thickness of the line scales\r\n * only horizontally. For example, consider the following circles,\r\n * drawn with a one-pixel line, and each with the scaleMode\r\n * parameter set to LineScaleMode.HORIZONTAL. The circle on the\r\n * left is scaled only horizontally, and the circle on the right is scaled\r\n * both vertically and horizontally.\r\n */\r\nLineScaleMode.VERTICAL = \"vertical\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/draw/LineScaleMode.js","import { Point, AttributesView, Float2Attributes, MathConsts, Matrix } from \"@awayjs/core\";\r\nimport { TriangleElements } from \"../elements/TriangleElements\";\r\nimport { JointStyle } from \"../draw/JointStyle\";\r\nimport { GraphicsPathCommand } from \"../draw/GraphicsPathCommand\";\r\nimport { GraphicsFactoryHelper } from \"../draw/GraphicsFactoryHelper\";\r\nimport { LineScaleMode } from \"../draw/LineScaleMode\";\r\nimport { Shape } from \"../base/Shape\";\r\nimport { Graphics } from \"../Graphics\";\r\nimport { Style } from \"../base/Style\";\r\nimport { Sampler2D } from \"../image/Sampler2D\";\r\n/**\r\n * The Graphics class contains a set of methods that you can use to create a\r\n * vector shape. Display objects that support drawing include Sprite and Shape\r\n * objects. Each of these classes includes a graphics property\r\n * that is a Graphics object. The following are among those helper functions\r\n * provided for ease of use: drawRect(),\r\n * drawRoundRect(), drawCircle(), and\r\n * drawEllipse().\r\n *\r\n * You cannot create a Graphics object directly from ActionScript code. If\r\n * you call new Graphics(), an exception is thrown.
The Graphics class is final; it cannot be subclassed.
\r\n */\r\nvar GraphicsFactoryStrokes = (function () {\r\n function GraphicsFactoryStrokes() {\r\n }\r\n GraphicsFactoryStrokes.draw_pathes = function (targetGraphics) {\r\n var len = targetGraphics.queued_stroke_pathes.length;\r\n var i = 0;\r\n for (i = 0; i < len; i++) {\r\n var strokePath = targetGraphics.queued_stroke_pathes[i];\r\n var strokeStyle = strokePath.style;\r\n var obj = Graphics.get_material_for_color(strokeStyle.color, strokeStyle.alpha);\r\n var material = obj.material;\r\n var final_vert_list = [];\r\n strokePath.prepare();\r\n GraphicsFactoryStrokes.draw_path([strokePath], final_vert_list, material.curves);\r\n final_vert_list = final_vert_list.concat(strokePath.verts);\r\n var attributesView = new AttributesView(Float32Array, material.curves ? 3 : 2);\r\n attributesView.set(final_vert_list);\r\n var attributesBuffer = attributesView.attributesBuffer;\r\n attributesView.dispose();\r\n var elements = new TriangleElements(attributesBuffer);\r\n elements.setPositions(new Float2Attributes(attributesBuffer));\r\n elements.halfStrokeThickness = strokeStyle.half_thickness;\r\n //\tif(material.curves)\r\n //\t\telements.setCustomAttributes(\"curves\", new Byte4Attributes(attributesBuffer, false));\r\n //\tmaterial.alpha=(flash.Assets or\r\n * flash.display.Loader classes.\r\n *\r\n * This export class lets you separate bitmap rendering operations from the\r\n * internal display updating routines of flash. By manipulating a\r\n * BitmapImage2D object directly, you can create complex images without incurring\r\n * the per-frame overhead of constantly redrawing the content from vector\r\n * data.
\r\n *\r\n *The methods of the BitmapImage2D export class support effects that are not\r\n * available through the filters available to non-bitmap display objects.
\r\n *\r\n *A BitmapImage2D object contains an array of pixel data. This data can\r\n * represent either a fully opaque bitmap or a transparent bitmap that\r\n * contains alpha channel data. Either type of BitmapImage2D object is stored as\r\n * a buffer of 32-bit integers. Each 32-bit integer determines the properties\r\n * of a single pixel in the bitmap.
\r\n *\r\n *Each 32-bit integer is a combination of four 8-bit channel values(from\r\n * 0 to 255) that describe the alpha transparency and the red, green, and blue\r\n * (ARGB) values of the pixel.(For ARGB values, the most significant byte\r\n * represents the alpha channel value, followed by red, green, and blue.)
\r\n *\r\n *The four channels(alpha, red, green, and blue) are represented as\r\n * numbers when you use them with the BitmapImage2D.copyChannel()\r\n * method or the DisplacementMapFilter.componentX and\r\n * DisplacementMapFilter.componentY properties, and these numbers\r\n * are represented by the following constants in the BitmapImage2DChannel\r\n * class:
- \r\n *
BitmapImage2DChannel.ALPHA\r\n * BitmapImage2DChannel.RED\r\n * BitmapImage2DChannel.GREEN\r\n * BitmapImage2DChannel.BLUE\r\n *
You can attach BitmapImage2D objects to a Bitmap object by using the\r\n * bitmapData property of the Bitmap object.
You can use a BitmapImage2D object to fill a Graphics object by using the\r\n * Graphics.beginBitmapFill() method.
You can also use a BitmapImage2D object to perform batch tile rendering\r\n * using the flash.display.Tilesheet class.
In Flash Player 10, the maximum size for a BitmapImage2D object\r\n * is 8,191 pixels in width or height, and the total number of pixels cannot\r\n * exceed 16,777,215 pixels.(So, if a BitmapImage2D object is 8,191 pixels wide,\r\n * it can only be 2,048 pixels high.) In Flash Player 9 and earlier, the limitation\r\n * is 2,880 pixels in height and 2,880 in width.
\r\n */\r\nvar BitmapImage2D = (function (_super) {\r\n tslib_1.__extends(BitmapImage2D, _super);\r\n /**\r\n * Creates a BitmapImage2D object with a specified width and height. If you\r\n * specify a value for thefillColor parameter, every pixel in\r\n * the bitmap is set to that color.\r\n *\r\n * By default, the bitmap is created as transparent, unless you pass\r\n * the value false for the transparent parameter. After you\r\n * create an opaque bitmap, you cannot change it to a transparent bitmap.\r\n * Every pixel in an opaque bitmap uses only 24 bits of color channel\r\n * information. If you define the bitmap as transparent, every pixel uses 32\r\n * bits of color channel information, including an alpha transparency\r\n * channel.
true\r\n * (transparent). To create a fully transparent bitmap,\r\n * set the value of the transparent\r\n * parameter to true and the value of the\r\n * fillColor parameter to 0x00000000(or to\r\n * 0). Setting the transparent property to\r\n * false can result in minor improvements\r\n * in rendering performance.\r\n * @param fillColor A 32-bit ARGB color value that you use to fill the\r\n * bitmap image area. The default value is\r\n * 0xFFFFFFFF(solid white).\r\n */\r\n function BitmapImage2D(width, height, transparent, fillColor, powerOfTwo) {\r\n if (transparent === void 0) { transparent = true; }\r\n if (fillColor === void 0) { fillColor = null; }\r\n if (powerOfTwo === void 0) { powerOfTwo = true; }\r\n var _this = _super.call(this, width, height, powerOfTwo) || this;\r\n _this._locked = false;\r\n _this._transparent = transparent;\r\n if (typeof document !== \"undefined\") {\r\n _this._imageCanvas = document.createElement(\"canvas\");\r\n }\r\n else {\r\n _this._imageCanvas = new CPUCanvas();\r\n }\r\n _this._imageCanvas.width = _this._rect.width;\r\n _this._imageCanvas.height = _this._rect.height;\r\n _this._context = _this._imageCanvas.getContext(\"2d\");\r\n if (fillColor != null)\r\n _this.fillRect(_this._rect, fillColor);\r\n return _this;\r\n }\r\n Object.defineProperty(BitmapImage2D.prototype, \"assetType\", {\r\n /**\r\n *\r\n * @returns {string}\r\n */\r\n get: function () {\r\n return BitmapImage2D.assetType;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(BitmapImage2D.prototype, \"transparent\", {\r\n /**\r\n * Defines whether the bitmap image supports per-pixel transparency. You can\r\n * set this value only when you construct a BitmapImage2D object by passing in\r\n * true for the transparent parameter of the\r\n * constructor. Then, after you create a BitmapImage2D object, you can check\r\n * whether it supports per-pixel transparency by determining if the value of\r\n * the transparent property is true.\r\n */\r\n get: function () {\r\n return this._transparent;\r\n },\r\n set: function (value) {\r\n this._transparent = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * Returns a new BitmapImage2D object that is a clone of the original instance\r\n * with an exact copy of the contained bitmap.\r\n *\r\n * @return A new BitmapImage2D object that is identical to the original.\r\n */\r\n BitmapImage2D.prototype.clone = function () {\r\n var t = new BitmapImage2D(this.width, this.height, this.transparent, null, this.powerOfTwo);\r\n t.copyPixels(this, this.rect, new Point());\r\n return t;\r\n };\r\n /**\r\n * Adjusts the color values in a specified area of a bitmap image by using a\r\n * ColorTransform object. If the rectangle matches the\r\n * boundaries of the bitmap image, this method transforms the color values of\r\n * the entire image.\r\n *\r\n * @param rect A Rectangle object that defines the area of the\r\n * image in which the ColorTransform object is applied.\r\n * @param colorTransform A ColorTransform object that describes the color\r\n * transformation values to apply.\r\n */\r\n BitmapImage2D.prototype.colorTransform = function (rect, colorTransform) {\r\n if (!this._imageData)\r\n this._imageData = this._context.getImageData(0, 0, this._rect.width, this._rect.height);\r\n var data = this._imageData.data;\r\n var i, j, index;\r\n for (i = 0; i < rect.width; ++i) {\r\n for (j = 0; j < rect.height; ++j) {\r\n index = (i + rect.x + (j + rect.y) * this.width) * 4;\r\n data[index] = data[index] * colorTransform.redMultiplier + colorTransform.redOffset;\r\n data[index + 1] = data[index + 1] * colorTransform.greenMultiplier + colorTransform.greenOffset;\r\n data[index + 2] = data[index + 2] * colorTransform.blueMultiplier + colorTransform.blueOffset;\r\n data[index + 3] = data[index + 3] * colorTransform.alphaMultiplier + colorTransform.alphaOffset;\r\n }\r\n }\r\n if (!this._locked)\r\n this.invalidate();\r\n };\r\n /**\r\n * Transfers data from one channel of another BitmapImage2D object or the\r\n * current BitmapImage2D object into a channel of the current BitmapImage2D object.\r\n * All of the data in the other channels in the destination BitmapImage2D object\r\n * are preserved.\r\n *\r\n * The source channel value and destination channel value can be one of\r\n * following values:
\r\n *\r\n *- \r\n *
BitmapImage2DChannel.RED\r\n * BitmapImage2DChannel.GREEN\r\n * BitmapImage2DChannel.BLUE\r\n * BitmapImage2DChannel.ALPHA\r\n *
BitmapImage2DChannel.RED,\r\n * BitmapImage2DChannel.BLUE,\r\n * BitmapImage2DChannel.GREEN,\r\n * BitmapImage2DChannel.ALPHA).\r\n * @param destChannel The destination channel. Use a value from the\r\n * BitmapImage2DChannel class\r\n * (BitmapImage2DChannel.RED,\r\n * BitmapImage2DChannel.BLUE,\r\n * BitmapImage2DChannel.GREEN,\r\n * BitmapImage2DChannel.ALPHA).\r\n * @throws TypeError The sourceBitmapImage2D, sourceRect or destPoint are null.\r\n */\r\n BitmapImage2D.prototype.copyChannel = function (sourceBitmap, sourceRect, destPoint, sourceChannel, destChannel) {\r\n var imageData = sourceBitmap.getImageData();\r\n if (!this._imageData)\r\n this._imageData = this._context.getImageData(0, 0, this._rect.width, this._rect.height);\r\n var sourceData = imageData.data;\r\n var destData = this._imageData.data;\r\n var sourceOffset = Math.round(Math.log(sourceChannel) / Math.log(2));\r\n var destOffset = Math.round(Math.log(destChannel) / Math.log(2));\r\n var sourceX = Math.round(sourceRect.x);\r\n var sourceY = Math.round(sourceRect.y);\r\n var destX = Math.round(destPoint.x);\r\n var destY = Math.round(destPoint.y);\r\n var i, j, sourceIndex, destIndex;\r\n for (i = 0; i < sourceRect.width; ++i) {\r\n for (j = 0; j < sourceRect.height; ++j) {\r\n sourceIndex = (i + sourceX + (j + sourceY) * imageData.width) * 4;\r\n destIndex = (i + destX + (j + destY) * this._rect.width) * 4;\r\n destData[destIndex + destOffset] = sourceData[sourceIndex + sourceOffset];\r\n }\r\n }\r\n if (!this._locked)\r\n this.invalidate();\r\n };\r\n BitmapImage2D.prototype.copyPixels = function (source, sourceRect, destPoint) {\r\n if (source instanceof BitmapImage2D)\r\n source = source.getCanvas();\r\n if (this._imageData)\r\n this._context.putImageData(this._imageData, 0, 0); // at coords 0,0\r\n BitmapImageUtils._copyPixels(this._context, source, sourceRect, destPoint);\r\n this._imageData = null;\r\n if (!this._locked)\r\n this.invalidate();\r\n };\r\n BitmapImage2D.prototype.merge = function (source, sourceRect, destPoint, redMultiplier, greenMultiplier, blueMultiplier, alphaMultiplier) {\r\n if (!this._imageData)\r\n this._imageData = this._context.getImageData(0, 0, this._rect.width, this._rect.height);\r\n var dest = this._imageData.data;\r\n var src = source.getImageData().data;\r\n redMultiplier = ~~redMultiplier;\r\n greenMultiplier = ~~greenMultiplier;\r\n blueMultiplier = ~~blueMultiplier;\r\n alphaMultiplier = ~~alphaMultiplier;\r\n var i, j, index;\r\n for (i = 0; i < sourceRect.width; ++i) {\r\n for (j = 0; j < sourceRect.height; ++j) {\r\n index = (i + sourceRect.x + (j + sourceRect.y) * this.width) * 4;\r\n dest[index] = ~~((src[index] * redMultiplier + dest[index] * (0x100 - redMultiplier)) / 0x100);\r\n dest[index + 1] = ~~((src[index + 1] * greenMultiplier + dest[index + 1] * (0x100 - greenMultiplier)) / 0x100);\r\n dest[index + 2] = ~~((src[index + 2] * blueMultiplier + dest[index + 2] * (0x100 - blueMultiplier)) / 0x100);\r\n dest[index + 3] = ~~((src[index + 3] * alphaMultiplier + dest[index + 3] * (0x100 - alphaMultiplier)) / 0x100);\r\n }\r\n }\r\n if (!this._locked)\r\n this.invalidate();\r\n };\r\n /**\r\n * Frees memory that is used to store the BitmapImage2D object.\r\n *\r\n * When the dispose() method is called on an image, the width\r\n * and height of the image are set to 0. All subsequent calls to methods or\r\n * properties of this BitmapImage2D instance fail, and an exception is thrown.\r\n *
BitmapImage2D.dispose() releases the memory occupied by the\r\n * actual bitmap data, immediately(a bitmap can consume up to 64 MB of\r\n * memory). After using BitmapImage2D.dispose(), the BitmapImage2D\r\n * object is no longer usable and an exception may be thrown if\r\n * you call functions on the BitmapImage2D object. However,\r\n * BitmapImage2D.dispose() does not garbage collect the BitmapImage2D\r\n * object(approximately 128 bytes); the memory occupied by the actual\r\n * BitmapImage2D object is released at the time the BitmapImage2D object is\r\n * collected by the garbage collector.
getPixel() method returns an unmultiplied pixel value. No\r\n * alpha information is returned.\r\n *\r\n * All pixels in a BitmapImage2D object are stored as premultiplied color\r\n * values. A premultiplied image pixel has the red, green, and blue color\r\n * channel values already multiplied by the alpha data. For example, if the\r\n * alpha value is 0, the values for the RGB channels are also 0, independent\r\n * of their unmultiplied values. This loss of data can cause some problems\r\n * when you perform operations. All BitmapImage2D methods take and return\r\n * unmultiplied values. The internal pixel representation is converted from\r\n * premultiplied to unmultiplied before it is returned as a value. During a\r\n * set operation, the pixel value is premultiplied before the raw image pixel\r\n * is set.
\r\n *\r\n * @param x The x position of the pixel.\r\n * @param y The y position of the pixel.\r\n * @return A number that represents an RGB pixel value. If the(x,\r\n * y) coordinates are outside the bounds of the image, the\r\n * method returns 0.\r\n */\r\n BitmapImage2D.prototype.getPixel = function (x, y) {\r\n var r;\r\n var g;\r\n var b;\r\n var a;\r\n if (!this._imageData) {\r\n var pixelData = this._context.getImageData(x, y, 1, 1);\r\n r = pixelData.data[0];\r\n g = pixelData.data[1];\r\n b = pixelData.data[2];\r\n a = pixelData.data[3];\r\n }\r\n else {\r\n var index = (x + y * this._imageData.width) * 4;\r\n r = this._imageData.data[index + 0];\r\n g = this._imageData.data[index + 1];\r\n b = this._imageData.data[index + 2];\r\n a = this._imageData.data[index + 3];\r\n }\r\n //returns black if fully transparent\r\n if (!a)\r\n return 0x0;\r\n return (r << 16) | (g << 8) | b;\r\n };\r\n /**\r\n * Returns an ARGB color value that contains alpha channel data and RGB data.\r\n * This method is similar to thegetPixel() method, which\r\n * returns an RGB color without alpha channel data.\r\n *\r\n * All pixels in a BitmapImage2D object are stored as premultiplied color\r\n * values. A premultiplied image pixel has the red, green, and blue color\r\n * channel values already multiplied by the alpha data. For example, if the\r\n * alpha value is 0, the values for the RGB channels are also 0, independent\r\n * of their unmultiplied values. This loss of data can cause some problems\r\n * when you perform operations. All BitmapImage2D methods take and return\r\n * unmultiplied values. The internal pixel representation is converted from\r\n * premultiplied to unmultiplied before it is returned as a value. During a\r\n * set operation, the pixel value is premultiplied before the raw image pixel\r\n * is set.
\r\n *\r\n * @param x The x position of the pixel.\r\n * @param y The y position of the pixel.\r\n * @return A number representing an ARGB pixel value. If the(x,\r\n * y) coordinates are outside the bounds of the image, 0 is\r\n * returned.\r\n */\r\n BitmapImage2D.prototype.getPixel32 = function (x, y) {\r\n var r;\r\n var g;\r\n var b;\r\n var a;\r\n if (!this._imageData) {\r\n var pixelData = this._context.getImageData(~~x, ~~y, 1, 1);\r\n r = pixelData.data[0];\r\n g = pixelData.data[1];\r\n b = pixelData.data[2];\r\n a = pixelData.data[3];\r\n }\r\n else {\r\n var index = (~~x + ~~y * this._imageData.width) * 4;\r\n r = this._imageData.data[index + 0];\r\n g = this._imageData.data[index + 1];\r\n b = this._imageData.data[index + 2];\r\n a = this._imageData.data[index + 3];\r\n }\r\n return (a << 24) | (r << 16) | (g << 8) | b;\r\n };\r\n BitmapImage2D.prototype.getPixelData = function (x, y, imagePixel) {\r\n if (!this._imageData)\r\n this._imageData = this._context.getImageData(0, 0, this._rect.width, this._rect.height);\r\n var index = (x + y * this._imageData.width) * 4;\r\n imagePixel[0] = this._imageData.data[index + 0];\r\n imagePixel[1] = this._imageData.data[index + 1];\r\n imagePixel[2] = this._imageData.data[index + 2];\r\n imagePixel[3] = this._imageData.data[index + 3];\r\n };\r\n BitmapImage2D.prototype.setPixelData = function (x, y, imagePixel) {\r\n if (!this._imageData)\r\n this._imageData = this._context.getImageData(0, 0, this._rect.width, this._rect.height);\r\n var index = (x + y * this._imageData.width) * 4;\r\n this._imageData.data[index + 0] = imagePixel[0];\r\n this._imageData.data[index + 1] = imagePixel[1];\r\n this._imageData.data[index + 2] = imagePixel[2];\r\n this._imageData.data[index + 3] = this._transparent ? imagePixel[3] : 0xFF;\r\n if (!this._locked)\r\n this.invalidate();\r\n };\r\n /**\r\n * Locks an image so that any objects that reference the BitmapImage2D object,\r\n * such as Bitmap objects, are not updated when this BitmapImage2D object\r\n * changes. To improve performance, use this method along with the\r\n *unlock() method before and after numerous calls to the\r\n * setPixel() or setPixel32() method.\r\n *\r\n */\r\n BitmapImage2D.prototype.lock = function () {\r\n if (this._locked)\r\n return;\r\n this._locked = true;\r\n };\r\n /**\r\n * Converts an Array into a rectangular region of pixel data. For each pixel,\r\n * an Array element is read and written into the BitmapImage2D pixel. The data\r\n * in the Array is expected to be 32-bit ARGB pixel values.\r\n *\r\n * @param rect Specifies the rectangular region of the BitmapImage2D\r\n * object.\r\n * @param inputArray An Array that consists of 32-bit unmultiplied pixel\r\n * values to be used in the rectangular region.\r\n * @throws RangeError The vector array is not large enough to read all the\r\n * pixel data.\r\n */\r\n BitmapImage2D.prototype.setArray = function (rect, inputArray) {\r\n if (!this._imageData)\r\n this._imageData = this._context.getImageData(0, 0, this._rect.width, this._rect.height);\r\n var i, j, index, argb;\r\n for (i = 0; i < rect.width; ++i) {\r\n for (j = 0; j < rect.height; ++j) {\r\n argb = ColorUtils.float32ColorToARGB(inputArray[i + j * rect.width]);\r\n index = (i + rect.x + (j + rect.y) * this._imageData.width) * 4;\r\n this._imageData.data[index + 0] = argb[1];\r\n this._imageData.data[index + 1] = argb[2];\r\n this._imageData.data[index + 2] = argb[3];\r\n this._imageData.data[index + 3] = this._transparent ? argb[0] : 0xFF;\r\n }\r\n }\r\n if (!this._locked)\r\n this.invalidate();\r\n };\r\n /**\r\n * Sets a single pixel of a BitmapImage2D object. The current alpha channel\r\n * value of the image pixel is preserved during this operation. The value of\r\n * the RGB color parameter is treated as an unmultiplied color value.\r\n *\r\n * Note: To increase performance, when you use the\r\n * setPixel() or setPixel32() method repeatedly,\r\n * call the lock() method before you call the\r\n * setPixel() or setPixel32() method, and then call\r\n * the unlock() method when you have made all pixel changes.\r\n * This process prevents objects that reference this BitmapImage2D instance from\r\n * updating until you finish making the pixel changes.
setPixel()\r\n * method; the main difference is that the setPixel32() method\r\n * takes an ARGB color value that contains alpha channel information.\r\n *\r\n * All pixels in a BitmapImage2D object are stored as premultiplied color\r\n * values. A premultiplied image pixel has the red, green, and blue color\r\n * channel values already multiplied by the alpha data. For example, if the\r\n * alpha value is 0, the values for the RGB channels are also 0, independent\r\n * of their unmultiplied values. This loss of data can cause some problems\r\n * when you perform operations. All BitmapImage2D methods take and return\r\n * unmultiplied values. The internal pixel representation is converted from\r\n * premultiplied to unmultiplied before it is returned as a value. During a\r\n * set operation, the pixel value is premultiplied before the raw image pixel\r\n * is set.
\r\n *\r\n *Note: To increase performance, when you use the\r\n * setPixel() or setPixel32() method repeatedly,\r\n * call the lock() method before you call the\r\n * setPixel() or setPixel32() method, and then call\r\n * the unlock() method when you have made all pixel changes.\r\n * This process prevents objects that reference this BitmapImage2D instance from\r\n * updating until you finish making the pixel changes.
ByteArray.readUnsignedInt() method is called and\r\n * the return value is written into the pixel. If the byte array ends before\r\n * the full rectangle is written, the function returns. The data in the byte\r\n * array is expected to be 32-bit ARGB pixel values. No seeking is performed\r\n * on the byte array before or after the pixels are read.\r\n *\r\n * @param rect Specifies the rectangular region of the BitmapImage2D\r\n * object.\r\n * @param inputByteArray A ByteArray object that consists of 32-bit\r\n * unmultiplied pixel values to be used in the\r\n * rectangular region.\r\n * @throws EOFError The inputByteArray object does not include\r\n * enough data to fill the area of the rect\r\n * rectangle. The method fills as many pixels as possible\r\n * before throwing the exception.\r\n * @throws TypeError The rect or inputByteArray are null.\r\n */\r\n BitmapImage2D.prototype.setPixels = function (rect, input) {\r\n if (!this._imageData)\r\n this._imageData = this._context.getImageData(0, 0, this._rect.width, this._rect.height);\r\n //fast path for full imageData\r\n if (rect.equals(this._rect)) {\r\n this._imageData.data.set(input);\r\n }\r\n else {\r\n var i;\r\n var imageWidth = this._rect.width;\r\n var inputWidth = rect.width;\r\n for (i = 0; i < rect.height; ++i)\r\n this._imageData.data.set(input.subarray(i * inputWidth * 4, (i + 1) * inputWidth * 4), (rect.x + (i + rect.y) * imageWidth) * 4);\r\n }\r\n if (!this._locked)\r\n this.invalidate();\r\n };\r\n /**\r\n * Unlocks an image so that any objects that reference the BitmapImage2D object,\r\n * such as Bitmap objects, are updated when this BitmapImage2D object changes.\r\n * To improve performance, use this method along with the lock()\r\n * method before and after numerous calls to the setPixel() or\r\n * setPixel32() method.\r\n *\r\n * @param changeRect The area of the BitmapImage2D object that has changed. If\r\n * you do not specify a value for this parameter, the\r\n * entire area of the BitmapImage2D object is considered\r\n * changed.\r\n */\r\n BitmapImage2D.prototype.unlock = function () {\r\n if (!this._locked)\r\n return;\r\n this._locked = false;\r\n this.invalidate();\r\n };\r\n /**\r\n *\r\n * @returns {ImageData}\r\n */\r\n BitmapImage2D.prototype.getImageData = function () {\r\n if (!this._imageData)\r\n this._imageData = this._context.getImageData(0, 0, this._rect.width, this._rect.height);\r\n return this._imageData;\r\n };\r\n /**\r\n *\r\n * @returns {HTMLCanvasElement}\r\n */\r\n BitmapImage2D.prototype.getCanvas = function () {\r\n if (this._imageData)\r\n this._context.putImageData(this._imageData, 0, 0);\r\n this._imageData = null;\r\n return this._imageCanvas;\r\n };\r\n /**\r\n *\r\n * @param width\r\n * @param height\r\n * @private\r\n */\r\n BitmapImage2D.prototype._setSize = function (width, height) {\r\n if (this._imageData)\r\n this._context.putImageData(this._imageData, 0, 0);\r\n if (this._imageCanvas) {\r\n this._imageCanvas.width = width;\r\n this._imageCanvas.height = height;\r\n }\r\n _super.prototype._setSize.call(this, width, height);\r\n this._imageData = null;\r\n };\r\n return BitmapImage2D;\r\n}(Image2D));\r\nexport { BitmapImage2D };\r\nBitmapImage2D.assetType = \"[image BitmapImage2D]\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/image/BitmapImage2D.js","import * as tslib_1 from \"tslib\";\r\nimport { AbstractMethodError } from \"@awayjs/core\";\r\nimport { ImageBase } from \"../image/ImageBase\";\r\nimport { ImageUtils } from \"../utils/ImageUtils\";\r\nvar ImageCube = (function (_super) {\r\n tslib_1.__extends(ImageCube, _super);\r\n /**\r\n *\r\n */\r\n function ImageCube(size) {\r\n var _this = _super.call(this) || this;\r\n _this._size = size;\r\n _this._testDimensions();\r\n return _this;\r\n }\r\n Object.defineProperty(ImageCube.prototype, \"assetType\", {\r\n /**\r\n *\r\n * @returns {string}\r\n */\r\n get: function () {\r\n return ImageCube.assetType;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ImageCube.prototype, \"size\", {\r\n /**\r\n * The size of the cube bitmap in pixels.\r\n */\r\n get: function () {\r\n return this._size;\r\n },\r\n set: function (value) {\r\n if (this._size == value)\r\n return;\r\n this._setSize(this._size);\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n *\r\n * @returns {ImageData}\r\n */\r\n ImageCube.prototype.getImageData = function (side) {\r\n throw new AbstractMethodError();\r\n };\r\n /**\r\n *\r\n * @param width\r\n * @param height\r\n * @private\r\n */\r\n ImageCube.prototype._setSize = function (size) {\r\n if (this._size != size)\r\n this.clear();\r\n this._size = size;\r\n this._testDimensions();\r\n };\r\n /**\r\n *\r\n * @private\r\n */\r\n ImageCube.prototype._testDimensions = function () {\r\n if (!ImageUtils.isDimensionValid(this._size))\r\n throw new Error(\"Invalid dimension: Width and height must be power of 2 and cannot exceed 2048\");\r\n };\r\n return ImageCube;\r\n}(ImageBase));\r\nexport { ImageCube };\r\nImageCube.assetType = \"[image ImageCube]\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/image/ImageCube.js","import * as tslib_1 from \"tslib\";\r\nimport { Rectangle, ColorUtils } from \"@awayjs/core\";\r\nimport { BitmapImage2D } from \"../image/BitmapImage2D\";\r\nimport { ImageCube } from \"../image/ImageCube\";\r\nimport { BitmapImageUtils } from \"../utils/BitmapImageUtils\";\r\nimport { CPUCanvas } from \"../image/CPUCanvas\";\r\n/**\r\n * The BitmapImage2D export class lets you work with the data(pixels) of a Bitmap\r\n * object. You can use the methods of the BitmapImage2D export class to create\r\n * arbitrarily sized transparent or opaque bitmap images and manipulate them\r\n * in various ways at runtime. You can also access the BitmapImage2D for a bitmap\r\n * image that you load with the flash.Assets or\r\n * flash.display.Loader classes.\r\n *\r\n * This export class lets you separate bitmap rendering operations from the\r\n * internal display updating routines of flash. By manipulating a\r\n * BitmapImage2D object directly, you can create complex images without incurring\r\n * the per-frame overhead of constantly redrawing the content from vector\r\n * data.
\r\n *\r\n *The methods of the BitmapImage2D export class support effects that are not\r\n * available through the filters available to non-bitmap display objects.
\r\n *\r\n *A BitmapImage2D object contains an array of pixel data. This data can\r\n * represent either a fully opaque bitmap or a transparent bitmap that\r\n * contains alpha channel data. Either type of BitmapImage2D object is stored as\r\n * a buffer of 32-bit integers. Each 32-bit integer determines the properties\r\n * of a single pixel in the bitmap.
\r\n *\r\n *Each 32-bit integer is a combination of four 8-bit channel values(from\r\n * 0 to 255) that describe the alpha transparency and the red, green, and blue\r\n * (ARGB) values of the pixel.(For ARGB values, the most significant byte\r\n * represents the alpha channel value, followed by red, green, and blue.)
\r\n *\r\n *The four channels(alpha, red, green, and blue) are represented as\r\n * numbers when you use them with the BitmapImage2D.copyChannel()\r\n * method or the DisplacementMapFilter.componentX and\r\n * DisplacementMapFilter.componentY properties, and these numbers\r\n * are represented by the following constants in the BitmapImage2DChannel\r\n * class:
- \r\n *
BitmapImage2DChannel.ALPHA\r\n * BitmapImage2DChannel.RED\r\n * BitmapImage2DChannel.GREEN\r\n * BitmapImage2DChannel.BLUE\r\n *
You can attach BitmapImage2D objects to a Bitmap object by using the\r\n * bitmapData property of the Bitmap object.
You can use a BitmapImage2D object to fill a Graphics object by using the\r\n * Graphics.beginBitmapFill() method.
You can also use a BitmapImage2D object to perform batch tile rendering\r\n * using the flash.display.Tilesheet class.
In Flash Player 10, the maximum size for a BitmapImage2D object\r\n * is 8,191 pixels in width or height, and the total number of pixels cannot\r\n * exceed 16,777,215 pixels.(So, if a BitmapImage2D object is 8,191 pixels wide,\r\n * it can only be 2,048 pixels high.) In Flash Player 9 and earlier, the limitation\r\n * is 2,880 pixels in height and 2,880 in width.
\r\n */\r\nvar BitmapImageCube = (function (_super) {\r\n tslib_1.__extends(BitmapImageCube, _super);\r\n /**\r\n * Creates a BitmapImage2D object with a specified width and height. If you\r\n * specify a value for thefillColor parameter, every pixel in\r\n * the bitmap is set to that color.\r\n *\r\n * By default, the bitmap is created as transparent, unless you pass\r\n * the value false for the transparent parameter. After you\r\n * create an opaque bitmap, you cannot change it to a transparent bitmap.\r\n * Every pixel in an opaque bitmap uses only 24 bits of color channel\r\n * information. If you define the bitmap as transparent, every pixel uses 32\r\n * bits of color channel information, including an alpha transparency\r\n * channel.
true\r\n * (transparent). To create a fully transparent bitmap,\r\n * set the value of the transparent\r\n * parameter to true and the value of the\r\n * fillColor parameter to 0x00000000(or to\r\n * 0). Setting the transparent property to\r\n * false can result in minor improvements\r\n * in rendering performance.\r\n * @param fillColor A 32-bit ARGB color value that you use to fill the\r\n * bitmap image area. The default value is\r\n * 0xFFFFFFFF(solid white).\r\n */\r\n function BitmapImageCube(size, transparent, fillColor) {\r\n if (transparent === void 0) { transparent = true; }\r\n if (fillColor === void 0) { fillColor = null; }\r\n var _this = _super.call(this, size) || this;\r\n _this._imageCanvas = new Array(6);\r\n _this._context = new Array(6);\r\n _this._imageData = new Array(6);\r\n _this._locked = false;\r\n _this._transparent = transparent;\r\n for (var i = 0; i < 6; i++) {\r\n if (typeof document !== \"undefined\") {\r\n _this._imageCanvas[i] = document.createElement(\"canvas\");\r\n }\r\n else {\r\n _this._imageCanvas[i] = new CPUCanvas();\r\n }\r\n _this._imageCanvas[i].width = size;\r\n _this._imageCanvas[i].height = size;\r\n _this._context[i] = _this._imageCanvas[i].getContext(\"2d\");\r\n if (fillColor != null)\r\n _this.fillRect(i, new Rectangle(0, 0, size, size), fillColor);\r\n }\r\n return _this;\r\n }\r\n Object.defineProperty(BitmapImageCube.prototype, \"assetType\", {\r\n /**\r\n *\r\n * @returns {string}\r\n */\r\n get: function () {\r\n return BitmapImageCube.assetType;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(BitmapImageCube.prototype, \"transparent\", {\r\n /**\r\n * Defines whether the bitmap image supports per-pixel transparency. You can\r\n * set this value only when you construct a BitmapImage2D object by passing in\r\n * true for the transparent parameter of the\r\n * constructor. Then, after you create a BitmapImage2D object, you can check\r\n * whether it supports per-pixel transparency by determining if the value of\r\n * the transparent property is true.\r\n */\r\n get: function () {\r\n return this._transparent;\r\n },\r\n set: function (value) {\r\n this._transparent = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * Returns a new BitmapImage2D object that is a clone of the original instance\r\n * with an exact copy of the contained bitmap.\r\n *\r\n * @return A new BitmapImage2D object that is identical to the original.\r\n */\r\n BitmapImageCube.prototype.clone = function () {\r\n var t = new BitmapImageCube(this._size, this.transparent);\r\n for (var i = 0; i < 6; i++) {\r\n t.draw(i, this.getCanvas(i));\r\n }\r\n return t;\r\n };\r\n /**\r\n * Adjusts the color values in a specified area of a bitmap image by using a\r\n * ColorTransform object. If the rectangle matches the\r\n * boundaries of the bitmap image, this method transforms the color values of\r\n * the entire image.\r\n *\r\n * @param rect A Rectangle object that defines the area of the\r\n * image in which the ColorTransform object is applied.\r\n * @param colorTransform A ColorTransform object that describes the color\r\n * transformation values to apply.\r\n */\r\n BitmapImageCube.prototype.colorTransform = function (side, rect, colorTransform) {\r\n if (!this._locked)\r\n this._imageData[side] = this._context[side].getImageData(0, 0, this._size, this._size);\r\n var data = this._imageData[side].data;\r\n var i, j, index;\r\n for (i = 0; i < rect.width; ++i) {\r\n for (j = 0; j < rect.height; ++j) {\r\n index = (i + rect.x + (j + rect.y) * this._size) * 4;\r\n data[index] = data[index] * colorTransform.redMultiplier + colorTransform.redOffset;\r\n data[index + 1] = data[index + 1] * colorTransform.greenMultiplier + colorTransform.greenOffset;\r\n data[index + 2] = data[index + 2] * colorTransform.blueMultiplier + colorTransform.blueOffset;\r\n data[index + 3] = data[index + 3] * colorTransform.alphaMultiplier + colorTransform.alphaOffset;\r\n }\r\n }\r\n if (!this._locked) {\r\n this._context[side].putImageData(this._imageData[side], 0, 0);\r\n this._imageData[side] = null;\r\n }\r\n this.invalidate();\r\n };\r\n /**\r\n * Transfers data from one channel of another BitmapImage2D object or the\r\n * current BitmapImage2D object into a channel of the current BitmapImage2D object.\r\n * All of the data in the other channels in the destination BitmapImage2D object\r\n * are preserved.\r\n *\r\n * The source channel value and destination channel value can be one of\r\n * following values:
\r\n *\r\n *- \r\n *
BitmapImage2DChannel.RED\r\n * BitmapImage2DChannel.GREEN\r\n * BitmapImage2DChannel.BLUE\r\n * BitmapImage2DChannel.ALPHA\r\n *
BitmapImage2DChannel.RED,\r\n * BitmapImage2DChannel.BLUE,\r\n * BitmapImage2DChannel.GREEN,\r\n * BitmapImage2DChannel.ALPHA).\r\n * @param destChannel The destination channel. Use a value from the\r\n * BitmapImage2DChannel class\r\n * (BitmapImage2DChannel.RED,\r\n * BitmapImage2DChannel.BLUE,\r\n * BitmapImage2DChannel.GREEN,\r\n * BitmapImage2DChannel.ALPHA).\r\n * @throws TypeError The sourceBitmapImage2D, sourceRect or destPoint are null.\r\n */\r\n BitmapImageCube.prototype.copyChannel = function (side, sourceBitmap, sourceRect, destPoint, sourceChannel, destChannel) {\r\n var imageData = sourceBitmap.getImageData();\r\n if (!this._locked)\r\n this._imageData[side] = this._context[side].getImageData(0, 0, this._size, this._size);\r\n var sourceData = sourceBitmap.getImageData().data;\r\n var destData = this._imageData[side].data;\r\n var sourceOffset = Math.round(Math.log(sourceChannel) / Math.log(2));\r\n var destOffset = Math.round(Math.log(destChannel) / Math.log(2));\r\n var i, j, sourceIndex, destIndex;\r\n for (i = 0; i < sourceRect.width; ++i) {\r\n for (j = 0; j < sourceRect.height; ++j) {\r\n sourceIndex = (i + sourceRect.x + (j + sourceRect.y) * sourceBitmap.width) * 4;\r\n destIndex = (i + destPoint.x + (j + destPoint.y) * this._size) * 4;\r\n destData[destIndex + destOffset] = sourceData[sourceIndex + sourceOffset];\r\n }\r\n }\r\n if (!this._locked) {\r\n this._context[side].putImageData(this._imageData[side], 0, 0);\r\n this._imageData[side] = null;\r\n }\r\n this.invalidate();\r\n };\r\n BitmapImageCube.prototype.copyPixels = function (side, source, sourceRect, destPoint) {\r\n if (source instanceof BitmapImage2D)\r\n source = source.getCanvas();\r\n if (this._locked) {\r\n // If canvas is locked:\r\n //\r\n // 1) copy image data back to canvas\r\n // 2) draw object\r\n // 3) read _imageData back out\r\n this._context[side].putImageData(this._imageData[side], 0, 0); // at coords 0,0\r\n BitmapImageUtils._copyPixels(this._context[side], source, sourceRect, destPoint);\r\n this._imageData[side] = this._context[side].getImageData(0, 0, this._size, this._size);\r\n }\r\n else {\r\n BitmapImageUtils._copyPixels(this._context[side], source, sourceRect, destPoint);\r\n }\r\n this.invalidate();\r\n };\r\n /**\r\n * Frees memory that is used to store the BitmapImage2D object.\r\n *\r\n * When the dispose() method is called on an image, the width\r\n * and height of the image are set to 0. All subsequent calls to methods or\r\n * properties of this BitmapImage2D instance fail, and an exception is thrown.\r\n *
BitmapImage2D.dispose() releases the memory occupied by the\r\n * actual bitmap data, immediately(a bitmap can consume up to 64 MB of\r\n * memory). After using BitmapImage2D.dispose(), the BitmapImage2D\r\n * object is no longer usable and an exception may be thrown if\r\n * you call functions on the BitmapImage2D object. However,\r\n * BitmapImage2D.dispose() does not garbage collect the BitmapImage2D\r\n * object(approximately 128 bytes); the memory occupied by the actual\r\n * BitmapImage2D object is released at the time the BitmapImage2D object is\r\n * collected by the garbage collector.
getPixel() method returns an unmultiplied pixel value. No\r\n * alpha information is returned.\r\n *\r\n * All pixels in a BitmapImage2D object are stored as premultiplied color\r\n * values. A premultiplied image pixel has the red, green, and blue color\r\n * channel values already multiplied by the alpha data. For example, if the\r\n * alpha value is 0, the values for the RGB channels are also 0, independent\r\n * of their unmultiplied values. This loss of data can cause some problems\r\n * when you perform operations. All BitmapImage2D methods take and return\r\n * unmultiplied values. The internal pixel representation is converted from\r\n * premultiplied to unmultiplied before it is returned as a value. During a\r\n * set operation, the pixel value is premultiplied before the raw image pixel\r\n * is set.
\r\n *\r\n * @param x The x position of the pixel.\r\n * @param y The y position of the pixel.\r\n * @return A number that represents an RGB pixel value. If the(x,\r\n * y) coordinates are outside the bounds of the image, the\r\n * method returns 0.\r\n */\r\n BitmapImageCube.prototype.getPixel = function (side, x, y) {\r\n var r;\r\n var g;\r\n var b;\r\n var a;\r\n if (!this._locked) {\r\n var pixelData = this._context[side].getImageData(x, y, 1, 1);\r\n r = pixelData.data[0];\r\n g = pixelData.data[1];\r\n b = pixelData.data[2];\r\n a = pixelData.data[3];\r\n }\r\n else {\r\n var index = (x + y * this._size) * 4;\r\n r = this._imageData[side].data[index + 0];\r\n g = this._imageData[side].data[index + 1];\r\n b = this._imageData[side].data[index + 2];\r\n a = this._imageData[side].data[index + 3];\r\n }\r\n //returns black if fully transparent\r\n if (!a)\r\n return 0x0;\r\n return (r << 16) | (g << 8) | b;\r\n };\r\n /**\r\n * Returns an ARGB color value that contains alpha channel data and RGB data.\r\n * This method is similar to thegetPixel() method, which\r\n * returns an RGB color without alpha channel data.\r\n *\r\n * All pixels in a BitmapImage2D object are stored as premultiplied color\r\n * values. A premultiplied image pixel has the red, green, and blue color\r\n * channel values already multiplied by the alpha data. For example, if the\r\n * alpha value is 0, the values for the RGB channels are also 0, independent\r\n * of their unmultiplied values. This loss of data can cause some problems\r\n * when you perform operations. All BitmapImage2D methods take and return\r\n * unmultiplied values. The internal pixel representation is converted from\r\n * premultiplied to unmultiplied before it is returned as a value. During a\r\n * set operation, the pixel value is premultiplied before the raw image pixel\r\n * is set.
\r\n *\r\n * @param x The x position of the pixel.\r\n * @param y The y position of the pixel.\r\n * @return A number representing an ARGB pixel value. If the(x,\r\n * y) coordinates are outside the bounds of the image, 0 is\r\n * returned.\r\n */\r\n BitmapImageCube.prototype.getPixel32 = function (side, x, y) {\r\n var r;\r\n var g;\r\n var b;\r\n var a;\r\n if (!this._locked) {\r\n var pixelData = this._context[side].getImageData(x, y, 1, 1);\r\n r = pixelData.data[0];\r\n g = pixelData.data[1];\r\n b = pixelData.data[2];\r\n a = pixelData.data[3];\r\n }\r\n else {\r\n var index = (x + y * this._size) * 4;\r\n r = this._imageData[side].data[index + 0];\r\n g = this._imageData[side].data[index + 1];\r\n b = this._imageData[side].data[index + 2];\r\n a = this._imageData[side].data[index + 3];\r\n }\r\n return (a << 24) | (r << 16) | (g << 8) | b;\r\n };\r\n /**\r\n * Locks an image so that any objects that reference the BitmapImage2D object,\r\n * such as Bitmap objects, are not updated when this BitmapImage2D object\r\n * changes. To improve performance, use this method along with the\r\n *unlock() method before and after numerous calls to the\r\n * setPixel() or setPixel32() method.\r\n *\r\n */\r\n BitmapImageCube.prototype.lock = function () {\r\n if (this._locked)\r\n return;\r\n this._locked = true;\r\n for (var i = 0; i < 6; i++)\r\n this._imageData[i] = this._context[i].getImageData(0, 0, this._size, this._size);\r\n };\r\n /**\r\n * Converts an Array into a rectangular region of pixel data. For each pixel,\r\n * an Array element is read and written into the BitmapImage2D pixel. The data\r\n * in the Array is expected to be 32-bit ARGB pixel values.\r\n *\r\n * @param rect Specifies the rectangular region of the BitmapImage2D\r\n * object.\r\n * @param inputArray An Array that consists of 32-bit unmultiplied pixel\r\n * values to be used in the rectangular region.\r\n * @throws RangeError The vector array is not large enough to read all the\r\n * pixel data.\r\n */\r\n BitmapImageCube.prototype.setArray = function (side, rect, inputArray) {\r\n if (!this._locked)\r\n this._imageData[side] = this._context[side].getImageData(0, 0, this._size, this._size);\r\n var i, j, index, argb;\r\n for (i = 0; i < rect.width; ++i) {\r\n for (j = 0; j < rect.height; ++j) {\r\n argb = ColorUtils.float32ColorToARGB(inputArray[i + j * rect.width]);\r\n index = (i + rect.x + (j + rect.y) * this._size) * 4;\r\n this._imageData[side].data[index + 0] = argb[1];\r\n this._imageData[side].data[index + 1] = argb[2];\r\n this._imageData[side].data[index + 2] = argb[3];\r\n this._imageData[side].data[index + 3] = argb[0];\r\n }\r\n }\r\n if (!this._locked) {\r\n this._context[side].putImageData(this._imageData[side], 0, 0);\r\n this._imageData[side] = null;\r\n }\r\n this.invalidate();\r\n };\r\n /**\r\n * Sets a single pixel of a BitmapImage2D object. The current alpha channel\r\n * value of the image pixel is preserved during this operation. The value of\r\n * the RGB color parameter is treated as an unmultiplied color value.\r\n *\r\n * Note: To increase performance, when you use the\r\n * setPixel() or setPixel32() method repeatedly,\r\n * call the lock() method before you call the\r\n * setPixel() or setPixel32() method, and then call\r\n * the unlock() method when you have made all pixel changes.\r\n * This process prevents objects that reference this BitmapImage2D instance from\r\n * updating until you finish making the pixel changes.
setPixel()\r\n * method; the main difference is that the setPixel32() method\r\n * takes an ARGB color value that contains alpha channel information.\r\n *\r\n * All pixels in a BitmapImage2D object are stored as premultiplied color\r\n * values. A premultiplied image pixel has the red, green, and blue color\r\n * channel values already multiplied by the alpha data. For example, if the\r\n * alpha value is 0, the values for the RGB channels are also 0, independent\r\n * of their unmultiplied values. This loss of data can cause some problems\r\n * when you perform operations. All BitmapImage2D methods take and return\r\n * unmultiplied values. The internal pixel representation is converted from\r\n * premultiplied to unmultiplied before it is returned as a value. During a\r\n * set operation, the pixel value is premultiplied before the raw image pixel\r\n * is set.
\r\n *\r\n *Note: To increase performance, when you use the\r\n * setPixel() or setPixel32() method repeatedly,\r\n * call the lock() method before you call the\r\n * setPixel() or setPixel32() method, and then call\r\n * the unlock() method when you have made all pixel changes.\r\n * This process prevents objects that reference this BitmapImage2D instance from\r\n * updating until you finish making the pixel changes.
ByteArray.readUnsignedInt() method is called and\r\n * the return value is written into the pixel. If the byte array ends before\r\n * the full rectangle is written, the function returns. The data in the byte\r\n * array is expected to be 32-bit ARGB pixel values. No seeking is performed\r\n * on the byte array before or after the pixels are read.\r\n *\r\n * @param rect Specifies the rectangular region of the BitmapImage2D\r\n * object.\r\n * @param inputByteArray A ByteArray object that consists of 32-bit\r\n * unmultiplied pixel values to be used in the\r\n * rectangular region.\r\n * @throws EOFError The inputByteArray object does not include\r\n * enough data to fill the area of the rect\r\n * rectangle. The method fills as many pixels as possible\r\n * before throwing the exception.\r\n * @throws TypeError The rect or inputByteArray are null.\r\n */\r\n BitmapImageCube.prototype.setPixels = function (side, rect, inputByteArray) {\r\n if (!this._locked)\r\n this._imageData[side] = this._context[side].getImageData(0, 0, this._size, this._size);\r\n inputByteArray.position = 0;\r\n var i, j, index;\r\n for (i = 0; i < rect.width; ++i) {\r\n for (j = 0; j < rect.height; ++j) {\r\n index = (i + rect.x + (j + rect.y) * this._size) * 4;\r\n this._imageData[side].data[index + 0] = inputByteArray.readUnsignedInt();\r\n this._imageData[side].data[index + 1] = inputByteArray.readUnsignedInt();\r\n this._imageData[side].data[index + 2] = inputByteArray.readUnsignedInt();\r\n this._imageData[side].data[index + 3] = inputByteArray.readUnsignedInt();\r\n }\r\n }\r\n if (!this._locked) {\r\n this._context[side].putImageData(this._imageData[side], 0, 0);\r\n this._imageData[side] = null;\r\n }\r\n this.invalidate();\r\n };\r\n /**\r\n * Unlocks an image so that any objects that reference the BitmapImage2D object,\r\n * such as Bitmap objects, are updated when this BitmapImage2D object changes.\r\n * To improve performance, use this method along with the lock()\r\n * method before and after numerous calls to the setPixel() or\r\n * setPixel32() method.\r\n *\r\n * @param changeRect The area of the BitmapImage2D object that has changed. If\r\n * you do not specify a value for this parameter, the\r\n * entire area of the BitmapImage2D object is considered\r\n * changed.\r\n */\r\n BitmapImageCube.prototype.unlock = function () {\r\n if (!this._locked)\r\n return;\r\n this._locked = false;\r\n for (var i = 0; i < 6; i++) {\r\n this._context[i].putImageData(this._imageData[i], 0, 0); // at coords 0,0\r\n this._imageData[i] = null;\r\n }\r\n };\r\n /**\r\n *\r\n * @returns {ImageData}\r\n */\r\n BitmapImageCube.prototype.getImageData = function (side) {\r\n if (!this._locked)\r\n return this._context[side].getImageData(0, 0, this._size, this._size);\r\n return this._imageData[side];\r\n };\r\n /**\r\n *\r\n * @returns {HTMLCanvasElement}\r\n */\r\n BitmapImageCube.prototype.getCanvas = function (side) {\r\n return this._imageCanvas[side];\r\n };\r\n /**\r\n *\r\n * @param width\r\n * @param height\r\n * @private\r\n */\r\n BitmapImageCube.prototype._setSize = function (size) {\r\n _super.prototype._setSize.call(this, size);\r\n for (var i = 0; i < 6; i++) {\r\n if (this._locked)\r\n this._context[i].putImageData(this._imageData[i], 0, 0);\r\n this._imageCanvas[i].width = size;\r\n this._imageCanvas[i].height = size;\r\n if (this._locked)\r\n this._imageData[i] = this._context[i].getImageData(0, 0, this._size, this._size);\r\n }\r\n };\r\n return BitmapImageCube;\r\n}(ImageCube));\r\nexport { BitmapImageCube };\r\nBitmapImageCube.assetType = \"[image BitmapImageCube]\";\r\nBitmapImageCube.posX = 0;\r\nBitmapImageCube.negX = 1;\r\nBitmapImageCube.posY = 2;\r\nBitmapImageCube.negY = 3;\r\nBitmapImageCube.posZ = 4;\r\nBitmapImageCube.negZ = 5;\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/image/BitmapImageCube.js","/**\r\n * A export class that provides constant values for visual blend mode effects. These\r\n * constants are used in the following:\r\n * - \r\n *
- The
blendModeproperty of the\r\n * flash.display.DisplayObject class. \r\n * - The
blendModeparameter of thedraw()\r\n * method of the flash.display.BitmapData class \r\n *
For example, if the display object has a pixel with an RGB value of\r\n * 0xAAA633, and the background pixel has an RGB value of 0xDD2200, the\r\n * resulting RGB value for the displayed pixel is 0xFFC833(because 0xAA +\r\n * 0xDD > 0xFF, 0xA6 + 0x22 = 0xC8, and 0x33 + 0x00 = 0x33).
\r\n */\r\nBlendMode.ADD = \"add\";\r\n/**\r\n * Applies the alpha value of each pixel of the display object to the\r\n * background. This requires theblendMode property of the\r\n * parent display object be set to\r\n * away.base.BlendMode.LAYER.\r\n *\r\n * Not supported under GPU rendering.
\r\n */\r\nBlendMode.ALPHA = \"alpha\";\r\n/**\r\n * Selects the darker of the constituent colors of the display object and the\r\n * colors of the background(the colors with the smaller values). This\r\n * setting is commonly used for superimposing type.\r\n *\r\n *For example, if the display object has a pixel with an RGB value of\r\n * 0xFFCC33, and the background pixel has an RGB value of 0xDDF800, the\r\n * resulting RGB value for the displayed pixel is 0xDDCC00(because 0xFF >\r\n * 0xDD, 0xCC < 0xF8, and 0x33 > 0x00 = 33).
\r\n *\r\n *Not supported under GPU rendering.
\r\n */\r\nBlendMode.DARKEN = \"darken\";\r\n/**\r\n * Compares the constituent colors of the display object with the colors of\r\n * its background, and subtracts the darker of the values of the two\r\n * constituent colors from the lighter value. This setting is commonly used\r\n * for more vibrant colors.\r\n *\r\n *For example, if the display object has a pixel with an RGB value of\r\n * 0xFFCC33, and the background pixel has an RGB value of 0xDDF800, the\r\n * resulting RGB value for the displayed pixel is 0x222C33(because 0xFF -\r\n * 0xDD = 0x22, 0xF8 - 0xCC = 0x2C, and 0x33 - 0x00 = 0x33).
\r\n */\r\nBlendMode.DIFFERENCE = \"difference\";\r\n/**\r\n * Erases the background based on the alpha value of the display object. This\r\n * process requires that theblendMode property of the parent\r\n * display object be set to flash.display.BlendMode.LAYER.\r\n *\r\n * Not supported under GPU rendering.
\r\n */\r\nBlendMode.ERASE = \"erase\";\r\n/**\r\n * Adjusts the color of each pixel based on the darkness of the display\r\n * object. If the display object is lighter than 50% gray, the display object\r\n * and background colors are screened, which results in a lighter color. If\r\n * the display object is darker than 50% gray, the colors are multiplied,\r\n * which results in a darker color. This setting is commonly used for shading\r\n * effects.\r\n *\r\n *Not supported under GPU rendering.
\r\n */\r\nBlendMode.HARDLIGHT = \"hardlight\";\r\n/**\r\n * Inverts the background.\r\n */\r\nBlendMode.INVERT = \"invert\";\r\n/**\r\n * Forces the creation of a transparency group for the display object. This\r\n * means that the display object is precomposed in a temporary buffer before\r\n * it is processed further. The precomposition is done automatically if the\r\n * display object is precached by means of bitmap caching or if the display\r\n * object is a display object container that has at least one child object\r\n * with ablendMode setting other than \"normal\".\r\n *\r\n * Not supported under GPU rendering.
\r\n */\r\nBlendMode.LAYER = \"layer\";\r\n/**\r\n * Selects the lighter of the constituent colors of the display object and\r\n * the colors of the background(the colors with the larger values). This\r\n * setting is commonly used for superimposing type.\r\n *\r\n *For example, if the display object has a pixel with an RGB value of\r\n * 0xFFCC33, and the background pixel has an RGB value of 0xDDF800, the\r\n * resulting RGB value for the displayed pixel is 0xFFF833(because 0xFF >\r\n * 0xDD, 0xCC < 0xF8, and 0x33 > 0x00 = 33).
\r\n *\r\n *Not supported under GPU rendering.
\r\n */\r\nBlendMode.LIGHTEN = \"lighten\";\r\n/**\r\n * Multiplies the values of the display object constituent colors by the\r\n * constituent colors of the background color, and normalizes by dividing by\r\n * 0xFF, resulting in darker colors. This setting is commonly used for\r\n * shadows and depth effects.\r\n *\r\n *For example, if a constituent color(such as red) of one pixel in the\r\n * display object and the corresponding color of the pixel in the background\r\n * both have the value 0x88, the multiplied result is 0x4840. Dividing by\r\n * 0xFF yields a value of 0x48 for that constituent color, which is a darker\r\n * shade than the color of the display object or the color of the\r\n * background.
\r\n */\r\nBlendMode.MULTIPLY = \"multiply\";\r\n/**\r\n * The display object appears in front of the background. Pixel values of the\r\n * display object override the pixel values of the background. Where the\r\n * display object is transparent, the background is visible.\r\n */\r\nBlendMode.NORMAL = \"normal\";\r\n/**\r\n * Adjusts the color of each pixel based on the darkness of the background.\r\n * If the background is lighter than 50% gray, the display object and\r\n * background colors are screened, which results in a lighter color. If the\r\n * background is darker than 50% gray, the colors are multiplied, which\r\n * results in a darker color. This setting is commonly used for shading\r\n * effects.\r\n *\r\n *Not supported under GPU rendering.
\r\n */\r\nBlendMode.OVERLAY = \"overlay\";\r\n/**\r\n * Multiplies the complement(inverse) of the display object color by the\r\n * complement of the background color, resulting in a bleaching effect. This\r\n * setting is commonly used for highlights or to remove black areas of the\r\n * display object.\r\n */\r\nBlendMode.SCREEN = \"screen\";\r\n/**\r\n * Uses a shader to define the blend between objects.\r\n *\r\n *Setting the blendShader property to a Shader instance\r\n * automatically sets the display object's blendMode property to\r\n * BlendMode.SHADER. If the blendMode property is\r\n * set to BlendMode.SHADER without first setting the\r\n * blendShader property, the blendMode property is\r\n * set to BlendMode.NORMAL instead. If the\r\n * blendShader property is set(which sets the\r\n * blendMode property to BlendMode.SHADER), then\r\n * later the value of the blendMode property is changed, the\r\n * blend mode can be reset to use the blend shader simply by setting the\r\n * blendMode property to BlendMode.SHADER. The\r\n * blendShader property does not need to be set again except to\r\n * change the shader that's used to define the blend mode.
Not supported under GPU rendering.
\r\n */\r\nBlendMode.SHADER = \"shader\";\r\n/**\r\n * Subtracts the values of the constituent colors in the display object from\r\n * the values of the background color, applying a floor of 0. This setting is\r\n * commonly used for animating a darkening dissolve between two objects.\r\n *\r\n *For example, if the display object has a pixel with an RGB value of\r\n * 0xAA2233, and the background pixel has an RGB value of 0xDDA600, the\r\n * resulting RGB value for the displayed pixel is 0x338400(because 0xDD -\r\n * 0xAA = 0x33, 0xA6 - 0x22 = 0x84, and 0x00 - 0x33 < 0x00).
\r\n */\r\nBlendMode.SUBTRACT = \"subtract\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/image/BlendMode.js","import * as tslib_1 from \"tslib\";\r\nimport { EventBase } from \"@awayjs/core\";\r\nvar MaterialEvent = (function (_super) {\r\n tslib_1.__extends(MaterialEvent, _super);\r\n /**\r\n * Create a new GraphicsEvent\r\n * @param type The event type.\r\n * @param dataType An optional data type of the vertex data being updated.\r\n */\r\n function MaterialEvent(type, material) {\r\n var _this = _super.call(this, type) || this;\r\n _this._material = material;\r\n return _this;\r\n }\r\n Object.defineProperty(MaterialEvent.prototype, \"material\", {\r\n /**\r\n * The material of the renderable.\r\n */\r\n get: function () {\r\n return this._material;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * Clones the event.\r\n *\r\n * @return An exact duplicate of the current object.\r\n */\r\n MaterialEvent.prototype.clone = function () {\r\n return new MaterialEvent(this.type, this._material);\r\n };\r\n return MaterialEvent;\r\n}(EventBase));\r\nexport { MaterialEvent };\r\nMaterialEvent.INVALIDATE_TEXTURE = \"invalidateTexture\";\r\nMaterialEvent.INVALIDATE_ANIMATION = \"invalidateAnimation\";\r\nMaterialEvent.INVALIDATE_PASSES = \"invalidatePasses\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/events/MaterialEvent.js","import * as tslib_1 from \"tslib\";\r\nimport { ColorTransform, AssetEvent, AssetBase } from \"@awayjs/core\";\r\nimport { BlendMode } from \"../image/BlendMode\";\r\nimport { ImageBase } from \"../image/ImageBase\";\r\nimport { MaterialEvent } from \"../events/MaterialEvent\";\r\nimport { Style } from \"../base/Style\";\r\nimport { StyleEvent } from \"../events/StyleEvent\";\r\n/**\r\n * MaterialBase forms an abstract base class for any material.\r\n * A material consists of several passes, each of which constitutes at least one render call. Several passes could\r\n * be used for special effects (render lighting for many lights in several passes, render an outline in a separate\r\n * pass) or to provide additional render-to-texture passes (rendering diffuse light to texture for texture-space\r\n * subsurface scattering, or rendering a depth map for specialized self-shadowing).\r\n *\r\n * Away3D provides default materials trough SinglePassMaterialBase and TriangleMaterial, which use modular\r\n * methods to build the shader code. MaterialBase can be extended to build specific and high-performant custom\r\n * shaders, or entire new material frameworks.\r\n */\r\nvar MaterialBase = (function (_super) {\r\n tslib_1.__extends(MaterialBase, _super);\r\n function MaterialBase(imageColor, alpha) {\r\n if (imageColor === void 0) { imageColor = 0xFFFFFF; }\r\n if (alpha === void 0) { alpha = 1; }\r\n var _this = _super.call(this) || this;\r\n _this._textures = new Array();\r\n _this._pUseColorTransform = false;\r\n _this._alphaBlending = false;\r\n _this._alpha = 1;\r\n _this._pAlphaThreshold = 0;\r\n _this._pAnimateUVs = false;\r\n _this._style = new Style();\r\n _this._iBaseScreenPassIndex = 0;\r\n _this._bothSides = false; // update\r\n /**\r\n * A list of material owners, renderables or custom Entities.\r\n */\r\n _this._owners = new Array();\r\n _this._pBlendMode = BlendMode.NORMAL;\r\n _this._imageRect = false;\r\n _this._curves = false;\r\n _this._onInvalidatePropertiesDelegate = function (event) { return _this._onInvalidateProperties(event); };\r\n _this._style.addEventListener(StyleEvent.INVALIDATE_PROPERTIES, _this._onInvalidatePropertiesDelegate);\r\n if (imageColor instanceof ImageBase)\r\n _this._style.image = imageColor;\r\n else\r\n _this._style.color = Number(imageColor);\r\n _this.alpha = alpha;\r\n _this._onTextureInvalidateDelegate = function (event) { return _this.onTextureInvalidate(event); };\r\n _this.alphaPremultiplied = false; //TODO: work out why this is different for WebGL\r\n return _this;\r\n }\r\n Object.defineProperty(MaterialBase.prototype, \"alpha\", {\r\n /**\r\n * The alpha of the surface.\r\n */\r\n get: function () {\r\n return this._alpha;\r\n },\r\n set: function (value) {\r\n if (value > 1)\r\n value = 1;\r\n else if (value < 0)\r\n value = 0;\r\n if (this._alpha == value)\r\n return;\r\n this._alpha = value;\r\n if (this._colorTransform == null)\r\n this._colorTransform = new ColorTransform();\r\n this._colorTransform.alphaMultiplier = value;\r\n this.invalidate();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(MaterialBase.prototype, \"colorTransform\", {\r\n /**\r\n * The ColorTransform object to transform the colour of the material with. Defaults to null.\r\n */\r\n get: function () {\r\n return this._colorTransform;\r\n },\r\n set: function (value) {\r\n this._colorTransform = value;\r\n this.invalidate();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(MaterialBase.prototype, \"alphaBlending\", {\r\n /**\r\n * Indicates whether or not the material has transparency. If binary transparency is sufficient, for\r\n * example when using textures of foliage, consider using alphaThreshold instead.\r\n */\r\n get: function () {\r\n return this._alphaBlending;\r\n },\r\n set: function (value) {\r\n if (this._alphaBlending == value)\r\n return;\r\n this._alphaBlending = value;\r\n this.invalidate();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(MaterialBase.prototype, \"animationSet\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return this._animationSet;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(MaterialBase.prototype, \"curves\", {\r\n /**\r\n * Indicates whether material should use curves. Defaults to false.\r\n */\r\n get: function () {\r\n return this._curves;\r\n },\r\n set: function (value) {\r\n if (this._curves == value)\r\n return;\r\n this._curves = value;\r\n this.invalidatePasses();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(MaterialBase.prototype, \"imageRect\", {\r\n /**\r\n * Indicates whether or not any used textures should use an atlas. Defaults to false.\r\n */\r\n get: function () {\r\n return this._imageRect;\r\n },\r\n set: function (value) {\r\n if (this._imageRect == value)\r\n return;\r\n this._imageRect = value;\r\n this.invalidatePasses();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(MaterialBase.prototype, \"style\", {\r\n /**\r\n * The style used to render the current TriangleGraphic. If set to null, its parent Sprite's style will be used instead.\r\n */\r\n get: function () {\r\n return this._style;\r\n },\r\n set: function (value) {\r\n if (this._style == value)\r\n return;\r\n if (this._style)\r\n this._style.removeEventListener(StyleEvent.INVALIDATE_PROPERTIES, this._onInvalidatePropertiesDelegate);\r\n this._style = value;\r\n if (this._style)\r\n this._style.addEventListener(StyleEvent.INVALIDATE_PROPERTIES, this._onInvalidatePropertiesDelegate);\r\n this.invalidatePasses();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(MaterialBase.prototype, \"animateUVs\", {\r\n /**\r\n * Specifies whether or not the UV coordinates should be animated using a transformation matrix.\r\n */\r\n get: function () {\r\n return this._pAnimateUVs;\r\n },\r\n set: function (value) {\r\n if (this._pAnimateUVs == value)\r\n return;\r\n this._pAnimateUVs = value;\r\n this.invalidatePasses();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(MaterialBase.prototype, \"useColorTransform\", {\r\n /**\r\n * Specifies whether or not the UV coordinates should be animated using a transformation matrix.\r\n */\r\n get: function () {\r\n return this._pUseColorTransform;\r\n },\r\n set: function (value) {\r\n if (this._pUseColorTransform == value)\r\n return;\r\n this._pUseColorTransform = value;\r\n this.invalidatePasses();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(MaterialBase.prototype, \"bothSides\", {\r\n /**\r\n * Defines whether or not the material should cull triangles facing away from the camera.\r\n */\r\n get: function () {\r\n return this._bothSides;\r\n },\r\n set: function (value) {\r\n if (this._bothSides = value)\r\n return;\r\n this._bothSides = value;\r\n this.invalidatePasses();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(MaterialBase.prototype, \"blendMode\", {\r\n /**\r\n * The blend mode to use when drawing this renderable. The following blend modes are supported:\r\n *- \r\n *
- BlendMode.NORMAL: No blending, unless the material inherently needs it \r\n *
- BlendMode.LAYER: Force blending. This will draw the object the same as NORMAL, but without writing depth writes. \r\n *
- BlendMode.MULTIPLY \r\n *
- BlendMode.ADD \r\n *
- BlendMode.ALPHA \r\n *
null.\r\n */\r\n get: function () {\r\n return this._animator;\r\n },\r\n set: function (value) {\r\n if (this._animator)\r\n this._animator.removeOwner(this._entity);\r\n this._animator = value;\r\n if (this._animator)\r\n this._animator.addOwner(this._entity);\r\n if (this._material) {\r\n this._material.iRemoveOwner(this._entity);\r\n this._material.iAddOwner(this._entity);\r\n }\r\n var shape;\r\n var len = this._shapes.length;\r\n for (var i = 0; i < len; ++i) {\r\n shape = this._shapes[i];\r\n // cause material to be unregistered and registered again to work with the new animation type (if possible)\r\n if (shape.material && shape.material != this._material) {\r\n shape.material.iRemoveOwner(this._entity);\r\n shape.material.iAddOwner(this._entity);\r\n }\r\n //invalidate any existing shape objects in case they need to pull new elements\r\n shape.invalidateElements();\r\n }\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Graphics.prototype, \"style\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return this._style;\r\n },\r\n set: function (value) {\r\n if (this._style == value)\r\n return;\r\n if (this._style)\r\n this._style.removeEventListener(StyleEvent.INVALIDATE_PROPERTIES, this._onInvalidatePropertiesDelegate);\r\n this._style = value;\r\n if (this._style)\r\n this._style.addEventListener(StyleEvent.INVALIDATE_PROPERTIES, this._onInvalidatePropertiesDelegate);\r\n this.invalidateMaterials();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Graphics.prototype, \"queued_stroke_pathes\", {\r\n get: function () {\r\n return this._queued_stroke_pathes;\r\n },\r\n set: function (value) {\r\n this._queued_stroke_pathes = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Graphics.prototype, \"queued_fill_pathes\", {\r\n get: function () {\r\n return this._queued_fill_pathes;\r\n },\r\n set: function (value) {\r\n this._queued_fill_pathes = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Graphics.prototype, \"material\", {\r\n /**\r\n * The material with which to render the Graphics.\r\n */\r\n get: function () {\r\n return this._material;\r\n },\r\n set: function (value) {\r\n if (value == this._material)\r\n return;\r\n if (this._material && !this._isShapeMaterial(this._material))\r\n this._material.iRemoveOwner(this._entity);\r\n this._material = value;\r\n if (this._material && !this._isShapeMaterial(this._material))\r\n this._material.iAddOwner(this._entity);\r\n this.invalidateMaterials();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * Adds a GraphicBase wrapping a Elements.\r\n *\r\n * @param elements\r\n */\r\n Graphics.prototype.addShape = function (shape) {\r\n var shapeIndex = this.getShapeIndex(shape);\r\n if (shapeIndex != -1)\r\n this.removeShapeAt(shapeIndex);\r\n this._shapes.push(shape);\r\n shape.addEventListener(ElementsEvent.INVALIDATE_VERTICES, this._onInvalidateVerticesDelegate);\r\n //shape.addEventListener(ShapeEvent.ADD_MATERIAL, this._onAddMaterialDelegate);\r\n //shape.addEventListener(ShapeEvent.REMOVE_MATERIAL, this._onRemoveMaterialDelegate);\r\n this.invalidate();\r\n return shape;\r\n };\r\n Graphics.prototype.removeShape = function (shape) {\r\n var shapeIndex = this.getShapeIndex(shape);\r\n if (shapeIndex == -1)\r\n throw new ArgumentError(\"Shape parameter is not a shape of the caller\");\r\n this.removeShapeAt(shapeIndex);\r\n };\r\n Graphics.prototype.removeShapeAt = function (index) {\r\n if (index < 0 || index >= this._shapes.length)\r\n throw new RangeError(\"Index is out of range\");\r\n var shape = this._shapes.splice(index, 1)[0];\r\n shape.removeEventListener(ElementsEvent.INVALIDATE_VERTICES, this._onInvalidateVerticesDelegate);\r\n //shape.removeEventListener(ShapeEvent.ADD_MATERIAL, this._onAddMaterialDelegate);\r\n //shape.removeEventListener(ShapeEvent.REMOVE_MATERIAL, this._onRemoveMaterialDelegate);\r\n this.invalidate();\r\n };\r\n Graphics.prototype.getShapeAt = function (index) {\r\n return this._shapes[index];\r\n };\r\n Graphics.prototype.getShapeIndex = function (shape) {\r\n return this._shapes.indexOf(shape);\r\n };\r\n Graphics.prototype.applyTransformation = function (transform) {\r\n var len = this._shapes.length;\r\n for (var i = 0; i < len; ++i) {\r\n this._shapes[i].applyTransformation(transform);\r\n }\r\n };\r\n Graphics.prototype.copyTo = function (graphics, cloneShapes) {\r\n if (cloneShapes === void 0) { cloneShapes = false; }\r\n graphics.material = this._material;\r\n graphics.style = this._style;\r\n graphics.particles = this.particles;\r\n graphics.numParticles = this.numParticles;\r\n graphics.scaleStrokes = this.scaleStrokes;\r\n if (this.slice9Rectangle) {\r\n graphics.slice9Rectangle = new Rectangle();\r\n graphics.slice9Rectangle.copyFrom(this.slice9Rectangle);\r\n graphics.originalSlice9Size = new Rectangle();\r\n graphics.originalSlice9Size.copyFrom(this.originalSlice9Size);\r\n graphics.minSlice9Width = this.minSlice9Width;\r\n graphics.minSlice9Height = this.minSlice9Height;\r\n }\r\n graphics._addShapes(this._shapes, cloneShapes);\r\n if (this._animator)\r\n graphics.animator = this._animator.clone();\r\n };\r\n /**\r\n * Scales the geometry.\r\n * @param scale The amount by which to scale.\r\n */\r\n Graphics.prototype.scale = function (scale) {\r\n var len = this._shapes.length;\r\n for (var i = 0; i < len; ++i)\r\n this._shapes[i].scale(scale);\r\n };\r\n Graphics.prototype.clearInternal = function () {\r\n for (var i = this._shapes.length - 1; i >= 0; i--)\r\n this._shapes[i].clear();\r\n //this.invalidateElements();\r\n };\r\n Graphics.prototype.clear = function () {\r\n var shape;\r\n var len = this._shapes.length;\r\n for (var i = 0; i < len; i++) {\r\n shape = this._shapes[i];\r\n shape.clear();\r\n shape.removeEventListener(ElementsEvent.INVALIDATE_VERTICES, this._onInvalidateVerticesDelegate);\r\n shape.removeEventListener(ShapeEvent.ADD_MATERIAL, this._onAddMaterialDelegate);\r\n shape.removeEventListener(ShapeEvent.REMOVE_MATERIAL, this._onRemoveMaterialDelegate);\r\n }\r\n this._shapes.length = 0;\r\n this.invalidate();\r\n this._active_fill_path = null;\r\n this._active_stroke_path = null;\r\n this._queued_fill_pathes.length = 0;\r\n this._queued_stroke_pathes.length = 0;\r\n this._drawingDirty = false;\r\n //this.invalidateElements();\r\n };\r\n /**\r\n * Clears all resources used by the Graphics object, including SubGeometries.\r\n */\r\n Graphics.prototype.dispose = function () {\r\n this.material = null;\r\n this.clear();\r\n if (this._animator)\r\n this._animator.dispose();\r\n };\r\n /**\r\n * Scales the uv coordinates (tiling)\r\n * @param scaleU The amount by which to scale on the u axis. Default is 1;\r\n * @param scaleV The amount by which to scale on the v axis. Default is 1;\r\n */\r\n Graphics.prototype.scaleUV = function (scaleU, scaleV) {\r\n if (scaleU === void 0) { scaleU = 1; }\r\n if (scaleV === void 0) { scaleV = 1; }\r\n var len = this._shapes.length;\r\n for (var i = 0; i < len; ++i)\r\n this._shapes[i].scaleUV(scaleU, scaleV);\r\n };\r\n Graphics.prototype.getBoxBounds = function () {\r\n if (this._drawingDirty) {\r\n this.endFill();\r\n }\r\n if (this._boxBoundsInvalid) {\r\n this._boxBoundsInvalid = false;\r\n if (!this._boxBounds)\r\n this._boxBounds = new Box();\r\n this._boxBounds.setEmpty();\r\n var numShapes = this._shapes.length;\r\n if (numShapes) {\r\n var shapeBox;\r\n var first = true;\r\n for (var i = 0; i < numShapes; i++) {\r\n shapeBox = this._shapes[i].getBoxBounds();\r\n if (shapeBox.isEmpty())\r\n continue;\r\n if (first) {\r\n first = false;\r\n this._boxBounds.copyFrom(shapeBox);\r\n }\r\n else {\r\n this._boxBounds = this._boxBounds.union(shapeBox, this._boxBounds);\r\n }\r\n }\r\n }\r\n }\r\n return this._boxBounds;\r\n };\r\n Graphics.prototype.getSphereBounds = function (center, target) {\r\n if (target === void 0) { target = null; }\r\n var len = this._shapes.length;\r\n for (var i = 0; i < len; i++) {\r\n target = this._shapes[i].getSphereBounds(center, target);\r\n }\r\n return target;\r\n };\r\n Graphics.prototype.invalidate = function () {\r\n _super.prototype.invalidate.call(this);\r\n this._boxBoundsInvalid = true;\r\n this._sphereBoundsInvalid = true;\r\n };\r\n Graphics.prototype.invalidateMaterials = function () {\r\n var len = this._shapes.length;\r\n for (var i = 0; i < len; ++i)\r\n this._shapes[i].invalidateMaterial();\r\n };\r\n Graphics.prototype.invalidateElements = function () {\r\n var len = this._shapes.length;\r\n for (var i = 0; i < len; ++i)\r\n this._shapes[i].invalidateElements();\r\n };\r\n Graphics.prototype._hitTestPointInternal = function (x, y) {\r\n //TODO: handle lines as well\r\n var len = this._shapes.length;\r\n for (var i = 0; i < len; i++)\r\n if (this._shapes[i].hitTestPoint(x, y, 0))\r\n return true;\r\n return false;\r\n };\r\n Graphics.prototype.acceptTraverser = function (traverser) {\r\n if (this._drawingDirty) {\r\n this.endFill();\r\n }\r\n var len = this._shapes.length;\r\n for (var i = len - 1; i >= 0; i--)\r\n traverser[this._shapes[i].elements.traverseName](this._shapes[i]);\r\n };\r\n Graphics.prototype._onInvalidateProperties = function (event) {\r\n this.invalidateMaterials();\r\n };\r\n Graphics.prototype._onInvalidateVertices = function (event) {\r\n //callback for bounds update\r\n if (event.attributesView != event.target.positions)\r\n return;\r\n this.invalidate();\r\n };\r\n Graphics.prototype._onAddMaterial = function (event) {\r\n var material = event.shape.material;\r\n if (material != this._material)\r\n material.iAddOwner(this._entity);\r\n };\r\n Graphics.prototype._onRemoveMaterial = function (event) {\r\n var material = event.shape.material;\r\n if (material != this._material)\r\n material.iRemoveOwner(this._entity);\r\n };\r\n Graphics.prototype.draw_fills = function () {\r\n GraphicsFactoryFills.draw_pathes(this);\r\n };\r\n Graphics.prototype.draw_strokes = function () {\r\n GraphicsFactoryStrokes.draw_pathes(this);\r\n };\r\n /**\r\n * Fills a drawing area with a bitmap image. The bitmap can be repeated or\r\n * tiled to fill the area. The fill remains in effect until you call the\r\n * beginFill(), beginBitmapFill(),\r\n * beginGradientFill(), or beginShaderFill()\r\n * method. Calling the clear() method clears the fill.\r\n *\r\n * The application renders the fill whenever three or more points are\r\n * drawn, or when the endFill() method is called.
true, the bitmap image repeats in a tiled\r\n * pattern. If false, the bitmap image does not\r\n * repeat, and the edges of the bitmap are used for any fill\r\n * area that extends beyond the bitmap.\r\n *\r\n * For example, consider the following bitmap(a 20 x\r\n * 20-pixel checkerboard pattern):
\r\n *\r\n *When repeat is set to true(as\r\n * in the following example), the bitmap fill repeats the\r\n * bitmap:
When repeat is set to false,\r\n * the bitmap fill uses the edge pixels for the fill area\r\n * outside the bitmap:
false, upscaled bitmap images are rendered\r\n * by using a nearest-neighbor algorithm and look pixelated. If\r\n * true, upscaled bitmap images are rendered by\r\n * using a bilinear algorithm. Rendering by using the nearest\r\n * neighbor algorithm is faster.\r\n */\r\n Graphics.prototype.beginBitmapFill = function (bitmap, matrix, repeat, smooth) {\r\n if (matrix === void 0) { matrix = null; }\r\n if (repeat === void 0) { repeat = true; }\r\n if (smooth === void 0) { smooth = false; }\r\n this.draw_fills();\r\n this._drawingDirty = true;\r\n // start a new fill path\r\n this._active_fill_path = new GraphicsPath();\r\n // todo: create bitmap fill style\r\n this._active_fill_path.style = new GraphicsFillStyle(0xffffff, 1);\r\n if (this._current_position.x != 0 || this._current_position.y != 0)\r\n this._active_fill_path.moveTo(this._current_position.x, this._current_position.y);\r\n this._queued_fill_pathes.push(this._active_fill_path);\r\n this.invalidate();\r\n };\r\n /**\r\n * Specifies a simple one-color fill that subsequent calls to other Graphics\r\n * methods(such as lineTo() or drawCircle()) use\r\n * when drawing. The fill remains in effect until you call the\r\n * beginFill(), beginBitmapFill(),\r\n * beginGradientFill(), or beginShaderFill()\r\n * method. Calling the clear() method clears the fill.\r\n *\r\n * The application renders the fill whenever three or more points are\r\n * drawn, or when the endFill() method is called.
lineTo() or drawCircle()) for\r\n * the object. The fill remains in effect until you call the\r\n * beginFill(), beginBitmapFill(),\r\n * beginGradientFill(), or beginShaderFill()\r\n * method. Calling the clear() method clears the fill.\r\n *\r\n * The application renders the fill whenever three or more points are\r\n * drawn, or when the endFill() method is called.
GradientType.LINEAR or\r\n * GradientType.RADIAL.\r\n * @param colors An array of RGB hexadecimal color values used\r\n * in the gradient; for example, red is 0xFF0000,\r\n * blue is 0x0000FF, and so on. You can specify\r\n * up to 15 colors. For each color, specify a\r\n * corresponding value in the alphas and ratios\r\n * parameters.\r\n * @param alphas An array of alpha values for the corresponding\r\n * colors in the colors array; valid values are 0\r\n * to 1. If the value is less than 0, the default\r\n * is 0. If the value is greater than 1, the\r\n * default is 1.\r\n * @param ratios An array of color distribution ratios; valid\r\n * values are 0-255. This value defines the\r\n * percentage of the width where the color is\r\n * sampled at 100%. The value 0 represents the\r\n * left position in the gradient box, and 255\r\n * represents the right position in the gradient\r\n * box.\r\n * @param matrix A transformation matrix as defined by the\r\n * flash.geom.Matrix class. The flash.geom.Matrix\r\n * class includes a\r\n * createGradientBox() method, which\r\n * lets you conveniently set up the matrix for use\r\n * with the beginGradientFill()\r\n * method.\r\n * @param spreadMethod A value from the SpreadMethod class that\r\n * specifies which spread method to use, either:\r\n * SpreadMethod.PAD,\r\n * SpreadMethod.REFLECT, or\r\n * SpreadMethod.REPEAT.\r\n *\r\n * For example, consider a simple linear\r\n * gradient between two colors:
\r\n *\r\n *This example uses\r\n * SpreadMethod.PAD for the spread\r\n * method, and the gradient fill looks like the\r\n * following:
If you use SpreadMethod.REFLECT\r\n * for the spread method, the gradient fill looks\r\n * like the following:
If you use SpreadMethod.REPEAT\r\n * for the spread method, the gradient fill looks\r\n * like the following:
InterpolationMethod.LINEAR_RGB or\r\n * InterpolationMethod.RGB\r\n *\r\n * For example, consider a simple linear\r\n * gradient between two colors(with the\r\n * spreadMethod parameter set to\r\n * SpreadMethod.REFLECT). The\r\n * different interpolation methods affect the\r\n * appearance as follows:
focalPointRatio set to 0.75:\r\n * @throws ArgumentError If the type parameter is not valid.\r\n */\r\n Graphics.prototype.beginGradientFill = function (type, colors, alphas, ratios, matrix, spreadMethod, interpolationMethod, focalPointRatio) {\r\n if (matrix === void 0) { matrix = null; }\r\n if (spreadMethod === void 0) { spreadMethod = \"pad\"; }\r\n if (interpolationMethod === void 0) { interpolationMethod = \"rgb\"; }\r\n if (focalPointRatio === void 0) { focalPointRatio = 0; }\r\n this.draw_fills();\r\n // start a new fill path\r\n this._drawingDirty = true;\r\n this._active_fill_path = new GraphicsPath();\r\n // todo: create gradient fill style\r\n //this._active_fill_path.style=new GraphicsFillStyle(colors[0], alphas[0]);//, ratios, matrix, spreadMethod, interpolationMethod, focalPointRatio);\r\n this._active_fill_path.style = new GradientFillStyle(type, colors, alphas, ratios, matrix, spreadMethod, interpolationMethod, focalPointRatio);\r\n if (this._current_position.x != 0 || this._current_position.y != 0)\r\n this._active_fill_path.moveTo(this._current_position.x, this._current_position.y);\r\n this._queued_fill_pathes.push(this._active_fill_path);\r\n this.invalidate();\r\n };\r\n /**\r\n * Copies all of drawing commands from the source Graphics object into the\r\n * calling Graphics object.\r\n *\r\n * @param sourceGraphics The Graphics object from which to copy the drawing\r\n * commands.\r\n */\r\n Graphics.prototype.copyFrom = function (sourceGraphics) {\r\n sourceGraphics.copyTo(this);\r\n };\r\n /**\r\n * Draws a cubic Bezier curve from the current drawing position to the\r\n * specified anchor point. Cubic Bezier curves consist of two anchor points\r\n * and two control points. The curve interpolates the two anchor points and\r\n * curves toward the two control points.\r\n *\r\n * The four points you use to draw a cubic Bezier curve with the\r\n * cubicCurveTo() method are as follows:\r\n *\r\n * - \r\n *
- The current drawing position is the first anchor point. \r\n *
- The anchorX and anchorY parameters specify the second anchor point.\r\n * \r\n *
- The
controlX1andcontrolY1parameters\r\n * specify the first control point. \r\n * - The
controlX2andcontrolY2parameters\r\n * specify the second control point. \r\n *
cubicCurveTo() method before calling the\r\n * moveTo() method, your curve starts at position (0, 0).\r\n *\r\n * If the cubicCurveTo() method succeeds, the Flash runtime sets\r\n * the current drawing position to (anchorX,\r\n * anchorY). If the cubicCurveTo() method fails,\r\n * the current drawing position remains unchanged.\r\n *\r\n * If your movie clip contains content created with the Flash drawing tools,\r\n * the results of calls to the cubicCurveTo() method are drawn\r\n * underneath that content.\r\n *\r\n * @param controlX1 Specifies the horizontal position of the first control\r\n * point relative to the registration point of the parent\r\n * display object.\r\n * @param controlY1 Specifies the vertical position of the first control\r\n * point relative to the registration point of the parent\r\n * display object.\r\n * @param controlX2 Specifies the horizontal position of the second control\r\n * point relative to the registration point of the parent\r\n * display object.\r\n * @param controlY2 Specifies the vertical position of the second control\r\n * point relative to the registration point of the parent\r\n * display object.\r\n * @param anchorX Specifies the horizontal position of the anchor point\r\n * relative to the registration point of the parent display\r\n * object.\r\n * @param anchorY Specifies the vertical position of the anchor point\r\n * relative to the registration point of the parent display\r\n * object.\r\n */\r\n Graphics.prototype.cubicCurveTo = function (controlX1, controlY1, controlX2, controlY2, anchorX, anchorY) {\r\n throw new PartialImplementationError(\"cubicCurveTo\");\r\n /*\r\n t = 0.5; // given example value\r\n x = (1 - t) * (1 - t) * p[0].x + 2 * (1 - t) * t * p[1].x + t * t * p[2].x;\r\n y = (1 - t) * (1 - t) * p[0].y + 2 * (1 - t) * t * p[1].y + t * t * p[2].y;\r\n\r\n this.queued_command_types.push(Graphics.CMD_BEZIER);\r\n this.queued_command_data.push(controlX1);\r\n this.queued_command_data.push(controlY1);\r\n this.queued_command_data.push(controlX2);\r\n this.queued_command_data.push(controlY2);\r\n this.queued_command_data.push(anchorX);\r\n this.queued_command_data.push(anchorY);\r\n\r\n // todo: somehow convert cubic bezier curve into 2 quadric curves...\r\n\r\n this.draw_direction+=0;\r\n */\r\n };\r\n /**\r\n * Draws a curve using the current line style from the current drawing\r\n * position to(anchorX, anchorY) and using the control point that\r\n * (controlX, controlY) specifies. The current\r\n * drawing position is then set to(anchorX,\r\n * anchorY). If the movie clip in which you are drawing contains\r\n * content created with the Flash drawing tools, calls to the\r\n * curveTo() method are drawn underneath this content. If you\r\n * call the curveTo() method before any calls to the\r\n * moveTo() method, the default of the current drawing position\r\n * is(0, 0). If any of the parameters are missing, this method fails and the\r\n * current drawing position is not changed.\r\n *\r\n * The curve drawn is a quadratic Bezier curve. Quadratic Bezier curves\r\n * consist of two anchor points and one control point. The curve interpolates\r\n * the two anchor points and curves toward the control point.
\r\n *\r\n * @param controlX A number that specifies the horizontal position of the\r\n * control point relative to the registration point of the\r\n * parent display object.\r\n * @param controlY A number that specifies the vertical position of the\r\n * control point relative to the registration point of the\r\n * parent display object.\r\n * @param anchorX A number that specifies the horizontal position of the\r\n * next anchor point relative to the registration point of\r\n * the parent display object.\r\n * @param anchorY A number that specifies the vertical position of the next\r\n * anchor point relative to the registration point of the\r\n * parent display object.\r\n */\r\n Graphics.prototype.curveTo = function (controlX, controlY, anchorX, anchorY) {\r\n this._drawingDirty = true;\r\n if (this._active_fill_path != null) {\r\n this._active_fill_path.curveTo(controlX, controlY, anchorX, anchorY);\r\n }\r\n if (this._active_stroke_path != null) {\r\n this._active_stroke_path.curveTo(controlX, controlY, anchorX, anchorY);\r\n }\r\n this._current_position.x = anchorX;\r\n this._current_position.y = anchorY;\r\n };\r\n /**\r\n * Draws a circle. Set the line style, fill, or both before you call the\r\n *drawCircle() method, by calling the linestyle(),\r\n * lineGradientStyle(), beginFill(),\r\n * beginGradientFill(), or beginBitmapFill()\r\n * method.\r\n *\r\n * @param x The x location of the center of the circle relative\r\n * to the registration point of the parent display object(in\r\n * pixels).\r\n * @param y The y location of the center of the circle relative\r\n * to the registration point of the parent display object(in\r\n * pixels).\r\n * @param radius The radius of the circle(in pixels).\r\n */\r\n Graphics.prototype.drawCircle = function (x, y, radius) {\r\n this._drawingDirty = true;\r\n //var radius2=radius*1.065;\r\n if (this._active_fill_path != null) {\r\n this._active_fill_path.moveTo(x, y);\r\n /*\r\n for(var i=8; i>=0;i--){\r\n\r\n var degree = (i) *(360/8)*Math.PI/180;\r\n var degree2 = degree + ((360/16)*Math.PI/180);\r\n this._active_fill_path.curveTo(x-(Math.cos(degree2)*radius2), y+(Math.sin(degree2)*radius2),x-(Math.cos(degree)*radius), y+(Math.sin(degree)*radius));\r\n }*/\r\n var r = radius;\r\n if (this._active_stroke_path != null) {\r\n r -= this._active_stroke_path.style.thickness / 2;\r\n }\r\n GraphicsFactoryHelper.drawElipse(x, y, r, r, this._active_fill_path.verts, 0, 360, 5, false);\r\n }\r\n if (this._active_stroke_path != null) {\r\n this._active_stroke_path.moveTo(x, y);\r\n /*\r\n var radius2=radius*0.93;\r\n this._active_stroke_path.curveTo(x-(radius2), y+(radius2), x-radius, y);\r\n this._active_stroke_path.curveTo(x-(radius2), y-(radius2), x, y-radius);\r\n this._active_stroke_path.curveTo(x+(radius2), y-(radius2), x+radius, y);\r\n this._active_stroke_path.curveTo(x+(radius2), y+(radius2), x, y+radius);\r\n */\r\n GraphicsFactoryHelper.drawElipseStrokes(x, y, radius, radius, this._active_stroke_path.verts, 0, 360, 5, this._active_stroke_path.style.thickness / 2, false);\r\n }\r\n };\r\n /**\r\n * Draws an ellipse. Set the line style, fill, or both before you call the\r\n * drawEllipse() method, by calling the\r\n * linestyle(), lineGradientStyle(),\r\n * beginFill(), beginGradientFill(), or\r\n * beginBitmapFill() method.\r\n *\r\n * @param x The x location of the top-left of the bounding-box of\r\n * the ellipse relative to the registration point of the parent\r\n * display object(in pixels).\r\n * @param y The y location of the top left of the bounding-box of\r\n * the ellipse relative to the registration point of the parent\r\n * display object(in pixels).\r\n * @param width The width of the ellipse(in pixels).\r\n * @param height The height of the ellipse(in pixels).\r\n */\r\n Graphics.prototype.drawEllipse = function (x, y, width, height) {\r\n this._drawingDirty = true;\r\n //var radius2=radius*1.065;\r\n if (this._active_fill_path != null) {\r\n this._active_fill_path.moveTo(x, y);\r\n /*\r\n for(var i=8; i>=0;i--){\r\n\r\n var degree = (i) *(360/8)*Math.PI/180;\r\n var degree2 = degree + ((360/16)*Math.PI/180);\r\n this._active_fill_path.curveTo(x-(Math.cos(degree2)*radius2), y+(Math.sin(degree2)*radius2),x-(Math.cos(degree)*radius), y+(Math.sin(degree)*radius));\r\n }*/\r\n var w = width;\r\n var h = height;\r\n if (this._active_stroke_path != null) {\r\n w -= this._active_stroke_path.style.thickness / 2;\r\n h -= this._active_stroke_path.style.thickness / 2;\r\n }\r\n GraphicsFactoryHelper.drawElipse(x, y, w, h, this._active_fill_path.verts, 0, 360, 5, false);\r\n }\r\n if (this._active_stroke_path != null) {\r\n this._active_stroke_path.moveTo(x, y);\r\n GraphicsFactoryHelper.drawElipseStrokes(x, y, width, height, this._active_stroke_path.verts, 0, 360, 5, this._active_stroke_path.style.thickness / 2, false);\r\n }\r\n };\r\n /**\r\n * Submits a series of IGraphicsData instances for drawing. This method\r\n * accepts a Vector containing objects including paths, fills, and strokes\r\n * that implement the IGraphicsData interface. A Vector of IGraphicsData\r\n * instances can refer to a part of a shape, or a complex fully defined set\r\n * of data for rendering a complete shape.\r\n *\r\n * Graphics paths can contain other graphics paths. If the\r\n * graphicsData Vector includes a path, that path and all its\r\n * sub-paths are rendered during this operation.
moveTo(),\r\n * lineTo(), and curveTo() drawing commands into a\r\n * single call. The drawPath() method parameters combine drawing\r\n * commands with x- and y-coordinate value pairs and a drawing direction. The\r\n * drawing commands are values from the GraphicsPathCommand class. The x- and\r\n * y-coordinate value pairs are Numbers in an array where each pair defines a\r\n * coordinate location. The drawing direction is a value from the\r\n * GraphicsPathWinding class.\r\n *\r\n * Generally, drawings render faster with drawPath() than\r\n * with a series of individual lineTo() and\r\n * curveTo() methods.
The drawPath() method uses a uses a floating computation\r\n * so rotation and scaling of shapes is more accurate and gives better\r\n * results. However, curves submitted using the drawPath()\r\n * method can have small sub-pixel alignment errors when used in conjunction\r\n * with the lineTo() and curveTo() methods.
The drawPath() method also uses slightly different rules\r\n * for filling and drawing lines. They are:
- \r\n *
- When a fill is applied to rendering a path:\r\n *
- \r\n *
- A sub-path of less than 3 points is not rendered.(But note that the\r\n * stroke rendering will still occur, consistent with the rules for strokes\r\n * below.) \r\n *
- A sub-path that isn't closed(the end point is not equal to the\r\n * begin point) is implicitly closed. \r\n *
\r\n * - When a stroke is applied to rendering a path:\r\n *
- \r\n *
- The sub-paths can be composed of any number of points. \r\n *
- The sub-path is never implicitly closed. \r\n *
\r\n *
drawRect() method, by calling the linestyle(),\r\n * lineGradientStyle(), beginFill(),\r\n * beginGradientFill(), or beginBitmapFill()\r\n * method.\r\n *\r\n * @param x A number indicating the horizontal position relative to the\r\n * registration point of the parent display object(in pixels).\r\n * @param y A number indicating the vertical position relative to the\r\n * registration point of the parent display object(in pixels).\r\n * @param width The width of the rectangle(in pixels).\r\n * @param height The height of the rectangle(in pixels).\r\n * @throws ArgumentError If the width or height\r\n * parameters are not a number\r\n * (Number.NaN).\r\n */\r\n Graphics.prototype.drawRect = function (x, y, width, height) {\r\n this._drawingDirty = true;\r\n if (this._active_fill_path != null) {\r\n this._active_fill_path.moveTo(x, y);\r\n /*\r\n this._active_fill_path.lineTo(x+width, y);\r\n this._active_fill_path.lineTo(x+width, y+height);\r\n this._active_fill_path.lineTo(x, y+height);\r\n this._active_fill_path.lineTo(x, y);\r\n */\r\n var w = width;\r\n var h = height;\r\n var t = 0;\r\n if (this._active_stroke_path != null) {\r\n t = this._active_stroke_path.style.thickness / 2;\r\n w -= this._active_stroke_path.style.thickness;\r\n h -= this._active_stroke_path.style.thickness;\r\n }\r\n GraphicsFactoryHelper.addTriangle(x + t, y + h + t, x + t, y + t, x + w + t, y + t, 0, this._active_fill_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + t, y + h + t, x + t + w, y + t, x + w + t, y + h + t, 0, this._active_fill_path.verts, false);\r\n }\r\n if (this._active_stroke_path != null) {\r\n this._active_stroke_path.moveTo(x, y);\r\n //var t:number=(drawRoundRect() method, by calling the\r\n * linestyle(), lineGradientStyle(),\r\n * beginFill(), beginGradientFill(), or\r\n * beginBitmapFill() method.\r\n *\r\n * @param x A number indicating the horizontal position relative\r\n * to the registration point of the parent display\r\n * object(in pixels).\r\n * @param y A number indicating the vertical position relative to\r\n * the registration point of the parent display object\r\n * (in pixels).\r\n * @param width The width of the round rectangle(in pixels).\r\n * @param height The height of the round rectangle(in pixels).\r\n * @param ellipseWidth The width of the ellipse used to draw the rounded\r\n * corners(in pixels).\r\n * @param ellipseHeight The height of the ellipse used to draw the rounded\r\n * corners(in pixels). Optional; if no value is\r\n * specified, the default value matches that provided\r\n * for the ellipseWidth parameter.\r\n * @throws ArgumentError If the width, height,\r\n * ellipseWidth or\r\n * ellipseHeight parameters are not a\r\n * number(Number.NaN).\r\n */\r\n Graphics.prototype.drawRoundRect = function (x, y, width, height, ellipseWidth, ellipseHeight) {\r\n if (ellipseHeight === void 0) { ellipseHeight = NaN; }\r\n this._drawingDirty = true;\r\n if (isNaN(ellipseHeight)) {\r\n ellipseHeight = ellipseWidth;\r\n }\r\n var w = width;\r\n var h = height;\r\n var ew = ellipseWidth / 2;\r\n var eh = ellipseHeight / 2;\r\n var t = 0;\r\n if (this._active_fill_path != null) {\r\n this._active_fill_path.moveTo(x, y);\r\n if (this._active_stroke_path != null) {\r\n t = this._active_stroke_path.style.thickness / 2;\r\n w -= this._active_stroke_path.style.thickness;\r\n h -= this._active_stroke_path.style.thickness;\r\n }\r\n GraphicsFactoryHelper.addTriangle(x + t, y + h - eh, x + t, y + eh, x + w - t, y + eh, 0, this._active_fill_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + t, y + h - eh, x + w - t, y + eh, x + w - t, y + h - eh, 0, this._active_fill_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + ew, y + t, x + w - ew, y + eh, x + ew, y + eh, 0, this._active_fill_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + ew, y + t, x + w - ew, y + t, x + w - ew, y + eh, 0, this._active_fill_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + ew, y + h - eh, x + w - ew, y + h - t, x + ew, y + h - t, 0, this._active_fill_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + ew, y + h - eh, x + w - ew, y + h - eh, x + w - ew, y + h - t, 0, this._active_fill_path.verts, false);\r\n GraphicsFactoryHelper.drawElipse(x + ew, y + eh, ew - t, eh - t, this._active_fill_path.verts, 180, 270, 5, false);\r\n GraphicsFactoryHelper.drawElipse(x + w - ew, y + eh, ew - t, eh - t, this._active_fill_path.verts, 270, 360, 5, false);\r\n GraphicsFactoryHelper.drawElipse(x + w - ew, y + h - eh, ew - t, eh - t, this._active_fill_path.verts, 0, 90, 5, false);\r\n GraphicsFactoryHelper.drawElipse(x + ew, y + h - eh, ew - t, eh - t, this._active_fill_path.verts, 90, 180, 5, false);\r\n }\r\n if (this._active_stroke_path != null) {\r\n this._active_stroke_path.moveTo(x, y);\r\n t = this._active_stroke_path.style.thickness / 2;\r\n GraphicsFactoryHelper.addTriangle(x - t, y + h - eh, x - t, y + eh, x + t, y + eh, 0, this._active_stroke_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x - t, y + h - eh, x + t, y + h - eh, x + t, y + eh, 0, this._active_stroke_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + ew, y - t, x + w - ew, y - t, x + ew, y + t, 0, this._active_stroke_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + ew, y + t, x + w - ew, y - t, x + w - ew, y + t, 0, this._active_stroke_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + w - t, y + h - eh, x + w - t, y + eh, x + w + t, y + h - eh, 0, this._active_stroke_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + w + t, y + h - eh, x + w + t, y + eh, x + w - t, y + eh, 0, this._active_stroke_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + ew, y + h + t, x + w - ew, y + h + t, x + ew, y + h - t, 0, this._active_stroke_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + ew, y + h - t, x + w - ew, y + h + t, x + w - ew, y + h - t, 0, this._active_stroke_path.verts, false);\r\n GraphicsFactoryHelper.drawElipseStrokes(x + ew, y + eh, ew, eh, this._active_stroke_path.verts, 180, 270, 5, t, false);\r\n GraphicsFactoryHelper.drawElipseStrokes(x + w - ew, y + eh, ew, eh, this._active_stroke_path.verts, 270, 360, 5, t, false);\r\n GraphicsFactoryHelper.drawElipseStrokes(x + w - ew, y + h - eh, ew, eh, this._active_stroke_path.verts, 0, 90, 5, t, false);\r\n GraphicsFactoryHelper.drawElipseStrokes(x + ew, y + h - eh, ew, eh, this._active_stroke_path.verts, 90, 180, 5, t, false);\r\n }\r\n };\r\n Graphics.prototype.drawRoundRectComplex = function (x, y, width, height, topLeftRadius, topRightRadius, bottomLeftRadius, bottomRightRadius) {\r\n var w = width;\r\n var h = height;\r\n var tl = topLeftRadius;\r\n var tr = topRightRadius;\r\n var bl = bottomLeftRadius;\r\n var br = bottomRightRadius;\r\n this._drawingDirty = true;\r\n var t = 0;\r\n if (this._active_fill_path != null) {\r\n this._active_fill_path.moveTo(x, y);\r\n if (this._active_stroke_path != null) {\r\n t = this._active_stroke_path.style.thickness / 2;\r\n w -= this._active_stroke_path.style.thickness;\r\n h -= this._active_stroke_path.style.thickness;\r\n }\r\n GraphicsFactoryHelper.addTriangle(x + tl, y + tl, x + w - tr, y + tr, x + w - br, y + h - br, 0, this._active_fill_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + tl, y + tl, x + w - br, y + h - br, x + bl, y + h - bl, 0, this._active_fill_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + t, y + tl, x + tl, y + tl, x + t, y + h - bl, 0, this._active_fill_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + tl, y + tl, x + t, y + h - bl, x + bl, y + h - bl, 0, this._active_fill_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + tl, y + t, x + tl, y + tl, x + w - tr, y + t, 0, this._active_fill_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + tl, y + tl, x + w - tr, y + tr, x + w - tr, y + t, 0, this._active_fill_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + w - t, y + tr, x + w - tr, y + tr, x + w - t, y + h - br, 0, this._active_fill_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + w - tr, y + tr, x + w - br, y + h - br, x + w - t, y + h - br, 0, this._active_fill_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + bl, y + h - t, x + w - br, y + h - t, x + bl, y + h - bl, 0, this._active_fill_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + bl, y + h - bl, x + w - br, y + h - t, x + w - br, y + h - br, 0, this._active_fill_path.verts, false);\r\n GraphicsFactoryHelper.drawElipse(x + tl, y + tl, tl - t, tl - t, this._active_fill_path.verts, 180, 270, 5, false);\r\n GraphicsFactoryHelper.drawElipse(x + w - tr, y + tr, tr - t, tr - t, this._active_fill_path.verts, 270, 360, 5, false);\r\n GraphicsFactoryHelper.drawElipse(x + w - br, y + h - br, br - t, br - t, this._active_fill_path.verts, 0, 90, 5, false);\r\n GraphicsFactoryHelper.drawElipse(x + bl, y + h - bl, bl - t, bl - t, this._active_fill_path.verts, 90, 180, 5, false);\r\n }\r\n if (this._active_stroke_path != null) {\r\n this._active_stroke_path.moveTo(x, y);\r\n t = this._active_stroke_path.style.thickness / 2;\r\n GraphicsFactoryHelper.addTriangle(x - t, y + h - bl, x - t, y + tl, x + t, y + tl, 0, this._active_stroke_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x - t, y + h - bl, x + t, y + h - bl, x + t, y + tl, 0, this._active_stroke_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + tl, y - t, x + w - tr, y - t, x + tr, y + t, 0, this._active_stroke_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + tl, y + t, x + w - tr, y - t, x + w - tr, y + t, 0, this._active_stroke_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + w - t, y + h - br, x + w - t, y + tr, x + w + t, y + h - br, 0, this._active_stroke_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + w + t, y + h - br, x + w + t, y + tr, x + w - t, y + tr, 0, this._active_stroke_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + bl, y + h + t, x + w - br, y + h + t, x + bl, y + h - t, 0, this._active_stroke_path.verts, false);\r\n GraphicsFactoryHelper.addTriangle(x + bl, y + h - t, x + w - br, y + h + t, x + w - br, y + h - t, 0, this._active_stroke_path.verts, false);\r\n GraphicsFactoryHelper.drawElipseStrokes(x + tl, y + tl, tl, tl, this._active_stroke_path.verts, 180, 270, 5, t, false);\r\n GraphicsFactoryHelper.drawElipseStrokes(x + w - tr, y + tr, tr, tr, this._active_stroke_path.verts, 270, 360, 5, t, false);\r\n GraphicsFactoryHelper.drawElipseStrokes(x + w - br, y + h - br, br, br, this._active_stroke_path.verts, 0, 90, 5, t, false);\r\n GraphicsFactoryHelper.drawElipseStrokes(x + bl, y + h - bl, bl, bl, this._active_stroke_path.verts, 90, 180, 5, t, false);\r\n }\r\n };\r\n /**\r\n * Renders a set of triangles, typically to distort bitmaps and give them a\r\n * three-dimensional appearance. The drawTriangles() method maps\r\n * either the current fill, or a bitmap fill, to the triangle faces using a\r\n * set of(u,v) coordinates.\r\n *\r\n * Any type of fill can be used, but if the fill has a transform matrix\r\n * that transform matrix is ignored.
\r\n *\r\n * A uvtData parameter improves texture mapping when a\r\n * bitmap fill is used.
beginFill(), beginGradientFill(), or\r\n * beginBitmapFill() method. Flash uses the fill that was\r\n * specified in the previous call to the beginFill(),\r\n * beginGradientFill(), or beginBitmapFill()\r\n * method. If the current drawing position does not equal the previous\r\n * position specified in a moveTo() method and a fill is\r\n * defined, the path is closed with a line and then filled.\r\n *\r\n */\r\n Graphics.prototype.endFill = function () {\r\n this._drawingDirty = false;\r\n this.draw_fills();\r\n this.draw_strokes();\r\n this._active_fill_path = null;\r\n this._active_stroke_path = null;\r\n //this.invalidate();\r\n //this.invalidateElements();\r\n };\r\n /**\r\n * Specifies a bitmap to use for the line stroke when drawing lines.\r\n *\r\n * The bitmap line style is used for subsequent calls to Graphics methods\r\n * such as the lineTo() method or the drawCircle()\r\n * method. The line style remains in effect until you call the\r\n * lineStyle() or lineGradientStyle() methods, or\r\n * the lineBitmapStyle() method again with different parameters.\r\n *
You can call the lineBitmapStyle() method in the middle of\r\n * drawing a path to specify different styles for different line segments\r\n * within a path.
Call the lineStyle() method before you call the\r\n * lineBitmapStyle() method to enable a stroke, or else the\r\n * value of the line style is undefined.
Calls to the clear() method set the line style back to\r\n * undefined.
The gradient line style is used for subsequent calls to Graphics\r\n * methods such as the lineTo() methods or the\r\n * drawCircle() method. The line style remains in effect until\r\n * you call the lineStyle() or lineBitmapStyle()\r\n * methods, or the lineGradientStyle() method again with\r\n * different parameters.
You can call the lineGradientStyle() method in the middle\r\n * of drawing a path to specify different styles for different line segments\r\n * within a path.
Call the lineStyle() method before you call the\r\n * lineGradientStyle() method to enable a stroke, or else the\r\n * value of the line style is undefined.
Calls to the clear() method set the line style back to\r\n * undefined.
createGradientBox() method, which\r\n * lets you conveniently set up the matrix for use\r\n * with the lineGradientStyle()\r\n * method.\r\n * @param spreadMethod A value from the SpreadMethod class that\r\n * specifies which spread method to use:\r\n * @param interpolationMethod A value from the InterpolationMethod class that\r\n * specifies which value to use. For example,\r\n * consider a simple linear gradient between two\r\n * colors(with the spreadMethod\r\n * parameter set to\r\n * SpreadMethod.REFLECT). The\r\n * different interpolation methods affect the\r\n * appearance as follows:\r\n * @param focalPointRatio A number that controls the location of the\r\n * focal point of the gradient. The value 0 means\r\n * the focal point is in the center. The value 1\r\n * means the focal point is at one border of the\r\n * gradient circle. The value -1 means that the\r\n * focal point is at the other border of the\r\n * gradient circle. Values less than -1 or greater\r\n * than 1 are rounded to -1 or 1. The following\r\n * image shows a gradient with a\r\n * focalPointRatio of -0.75:\r\n */\r\n Graphics.prototype.lineGradientStyle = function (type, colors, alphas, ratios, matrix, spreadMethod, interpolationMethod, focalPointRatio) {\r\n if (matrix === void 0) { matrix = null; }\r\n if (spreadMethod === void 0) { spreadMethod = null; }\r\n if (interpolationMethod === void 0) { interpolationMethod = null; }\r\n if (focalPointRatio === void 0) { focalPointRatio = 0; }\r\n this._drawingDirty = true;\r\n // start a new stroke path\r\n this._active_stroke_path = new GraphicsPath();\r\n this._active_stroke_path.style = new GraphicsStrokeStyle(colors[0], alphas[0], 1); //, jointstyle, capstyle, miterLimit);\r\n if (this._current_position.x != 0 || this._current_position.y != 0)\r\n this._active_stroke_path.moveTo(this._current_position.x, this._current_position.y);\r\n this._queued_stroke_pathes.push(this._active_stroke_path);\r\n this.invalidate();\r\n };\r\n /**\r\n * Specifies a shader to use for the line stroke when drawing lines.\r\n *\r\n * The shader line style is used for subsequent calls to Graphics methods\r\n * such as the lineTo() method or the drawCircle()\r\n * method. The line style remains in effect until you call the\r\n * lineStyle() or lineGradientStyle() methods, or\r\n * the lineBitmapStyle() method again with different parameters.\r\n *
You can call the lineShaderStyle() method in the middle of\r\n * drawing a path to specify different styles for different line segments\r\n * within a path.
Call the lineStyle() method before you call the\r\n * lineShaderStyle() method to enable a stroke, or else the\r\n * value of the line style is undefined.
Calls to the clear() method set the line style back to\r\n * undefined.
lineTo() method or the drawCircle()\r\n * method. The line style remains in effect until you call the\r\n * lineGradientStyle() method, the\r\n * lineBitmapStyle() method, or the lineStyle()\r\n * method with different parameters.\r\n *\r\n * You can call the lineStyle() method in the middle of\r\n * drawing a path to specify different styles for different line segments\r\n * within the path.
Note: Calls to the clear() method set the line\r\n * style back to undefined.
Note: Flash Lite 4 supports only the first three parameters\r\n * (thickness, color, and alpha).
pixelHinting set to true,\r\n * line widths are adjusted to full pixel widths. With\r\n * pixelHinting set to false,\r\n * disjoints can appear for curves and straight lines.\r\n * For example, the following illustrations show how\r\n * Flash Player or Adobe AIR renders two rounded\r\n * rectangles that are identical, except that the\r\n * pixelHinting parameter used in the\r\n * lineStyle() method is set differently\r\n * (the images are scaled by 200%, to emphasize the\r\n * difference):\r\n *\r\n * If a value is not supplied, the line does not use\r\n * pixel hinting.
\r\n * @param scaleMode (Not supported in Flash Lite 4) A value from the\r\n * LineScaleMode class that specifies which scale mode to\r\n * use:\r\n *- \r\n *
-
LineScaleMode.NORMAL- Always\r\n * scale the line thickness when the object is scaled\r\n * (the default). \r\n * -
LineScaleMode.NONE- Never scale\r\n * the line thickness. \r\n * -
LineScaleMode.VERTICAL- Do not\r\n * scale the line thickness if the object is scaled\r\n * vertically only. For example, consider the\r\n * following circles, drawn with a one-pixel line, and\r\n * each with thescaleModeparameter set to\r\n *LineScaleMode.VERTICAL. The circle on the\r\n * left is scaled vertically only, and the circle on the\r\n * right is scaled both vertically and horizontally:\r\n * \r\n * -
LineScaleMode.HORIZONTAL- Do not\r\n * scale the line thickness if the object is scaled\r\n * horizontally only. For example, consider the\r\n * following circles, drawn with a one-pixel line, and\r\n * each with thescaleModeparameter set to\r\n *LineScaleMode.HORIZONTAL. The circle on\r\n * the left is scaled horizontally only, and the circle\r\n * on the right is scaled both vertically and\r\n * horizontally: \r\n *
CapsStyle.NONE,\r\n * CapsStyle.ROUND, and\r\n * CapsStyle.SQUARE. If a value is not\r\n * indicated, Flash uses round caps.\r\n *\r\n * For example, the following illustrations show the\r\n * different capsStyle settings. For each\r\n * setting, the illustration shows a blue line with a\r\n * thickness of 30(for which the capsStyle\r\n * applies), and a superimposed black line with a\r\n * thickness of 1(for which no capsStyle\r\n * applies):
JointStyle.BEVEL,\r\n * JointStyle.MITER, and\r\n * JointStyle.ROUND. If a value is not\r\n * indicated, Flash uses round joints.\r\n *\r\n * For example, the following illustrations show the\r\n * different joints settings. For each\r\n * setting, the illustration shows an angled blue line\r\n * with a thickness of 30(for which the\r\n * jointStyle applies), and a superimposed\r\n * angled black line with a thickness of 1(for which no\r\n * jointStyle applies):
Note: For joints set to\r\n * JointStyle.MITER, you can use the\r\n * miterLimit parameter to limit the length\r\n * of the miter.
jointStyle is set to\r\n * \"miter\". The miterLimit\r\n * value represents the length that a miter can extend\r\n * beyond the point at which the lines meet to form a\r\n * joint. The value expresses a factor of the line\r\n * thickness. For example, with a\r\n * miterLimit factor of 2.5 and a\r\n * thickness of 10 pixels, the miter is cut\r\n * off at 25 pixels.\r\n *\r\n * For example, consider the following angled lines,\r\n * each drawn with a thickness of 20, but\r\n * with miterLimit set to 1, 2, and 4.\r\n * Superimposed are black reference lines showing the\r\n * meeting points of the joints:
Notice that a given miterLimit value\r\n * has a specific maximum angle for which the miter is\r\n * cut off. The following table lists some examples:
x, y); the current drawing position\r\n * is then set to(x, y). If the display object in\r\n * which you are drawing contains content that was created with the Flash\r\n * drawing tools, calls to the lineTo() method are drawn\r\n * underneath the content. If you call lineTo() before any calls\r\n * to the moveTo() method, the default position for the current\r\n * drawing is(0, 0). If any of the parameters are missing, this\r\n * method fails and the current drawing position is not changed.\r\n *\r\n * @param x A number that indicates the horizontal position relative to the\r\n * registration point of the parent display object(in pixels).\r\n * @param y A number that indicates the vertical position relative to the\r\n * registration point of the parent display object(in pixels).\r\n */\r\n Graphics.prototype.lineTo = function (x, y) {\r\n this._drawingDirty = true;\r\n if (this._active_fill_path != null) {\r\n this._active_fill_path.lineTo(x, y);\r\n }\r\n if (this._active_stroke_path != null) {\r\n this._active_stroke_path.lineTo(x, y);\r\n }\r\n this._current_position.x = x;\r\n this._current_position.y = y;\r\n };\r\n /**\r\n * Moves the current drawing position to(x, y). If\r\n * any of the parameters are missing, this method fails and the current\r\n * drawing position is not changed.\r\n *\r\n * @param x A number that indicates the horizontal position relative to the\r\n * registration point of the parent display object(in pixels).\r\n * @param y A number that indicates the vertical position relative to the\r\n * registration point of the parent display object(in pixels).\r\n */\r\n Graphics.prototype.moveTo = function (x, y) {\r\n this._drawingDirty = true;\r\n if (this._active_fill_path != null) {\r\n this._active_fill_path.moveTo(x, y);\r\n }\r\n if (this._active_stroke_path != null) {\r\n this._active_stroke_path.moveTo(x, y);\r\n }\r\n this._current_position.x = x;\r\n this._current_position.y = y;\r\n };\r\n Graphics.prototype._addShapes = function (shapes, cloneShapes) {\r\n if (cloneShapes === void 0) { cloneShapes = false; }\r\n var shape;\r\n var len = shapes.length;\r\n for (var i = 0; i < len; i++) {\r\n shape = shapes[i];\r\n if (this.slice9Rectangle)\r\n shape = Shape.getShape(ElementsUtils.updateTriangleGraphicsSlice9(shape.elements, this.originalSlice9Size, 1, 1, false, true), shape.material, shape.style);\r\n else if (cloneShapes)\r\n shape = Shape.getShape(shape.elements, shape.material, shape.style, shape.count, shape.offset);\r\n shape.addEventListener(ElementsEvent.INVALIDATE_VERTICES, this._onInvalidateVerticesDelegate);\r\n shape.addEventListener(ShapeEvent.ADD_MATERIAL, this._onAddMaterialDelegate);\r\n shape.addEventListener(ShapeEvent.REMOVE_MATERIAL, this._onRemoveMaterialDelegate);\r\n this._shapes.push(shape);\r\n }\r\n this.invalidate();\r\n };\r\n Graphics.prototype._isShapeMaterial = function (material) {\r\n var len = this._shapes.length;\r\n for (var i = 0; i < len; i++)\r\n if (material == this._shapes[i].material)\r\n return true;\r\n return false;\r\n };\r\n return Graphics;\r\n}(AssetBase));\r\nexport { Graphics };\r\nGraphics._pool = new Array();\r\nGraphics.get_material_for_color = function (color, alpha) {\r\n return { material: DefaultMaterialManager.getDefaultMaterial() };\r\n};\r\nGraphics.get_material_for_gradient = function (gradient) {\r\n return { material: DefaultMaterialManager.getDefaultMaterial() };\r\n};\r\nGraphics.assetType = \"[asset Graphics]\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/Graphics.js","import { Point, AttributesView, Float2Attributes, MathConsts, Matrix } from \"@awayjs/core\";\r\nimport { GraphicsFillStyle } from \"./GraphicsFillStyle\";\r\nimport { GradientFillStyle } from \"./GradientFillStyle\";\r\nimport { GraphicsFactoryHelper } from \"./GraphicsFactoryHelper\";\r\nimport { TriangleElements } from \"../elements/TriangleElements\";\r\nimport { Shape } from \"../base/Shape\";\r\nimport { GraphicsPathCommand } from \"./GraphicsPathCommand\";\r\nimport { Style } from \"../base/Style\";\r\nimport { Sampler2D } from \"../image/Sampler2D\";\r\nimport { Graphics } from \"../Graphics\";\r\nimport { MappingMode } from \"../textures/MappingMode\";\r\nvar Tess2 = require('tess2');\r\n/**\r\n * The Graphics class contains a set of methods that you can use to create a\r\n * vector shape. Display objects that support drawing include Sprite and Shape\r\n * objects. Each of these classes includes a graphics property\r\n * that is a Graphics object. The following are among those helper functions\r\n * provided for ease of use: drawRect(),\r\n * drawRoundRect(), drawCircle(), and\r\n * drawEllipse().\r\n *\r\n * You cannot create a Graphics object directly from ActionScript code. If\r\n * you call new Graphics(), an exception is thrown.
The Graphics class is final; it cannot be subclassed.
\r\n */\r\nvar GraphicsFactoryFills = (function () {\r\n function GraphicsFactoryFills() {\r\n }\r\n GraphicsFactoryFills.draw_pathes = function (targetGraphics) {\r\n var len = targetGraphics.queued_fill_pathes.length;\r\n var cp = 0;\r\n for (cp = 0; cp < len; cp++) {\r\n var one_path = targetGraphics.queued_fill_pathes[cp];\r\n //one_path.finalizeContour();\r\n var contour_commands = one_path.commands;\r\n var contour_data = one_path.data;\r\n var commands;\r\n var data;\r\n var i = 0;\r\n var k = 0;\r\n var vert_cnt = 0;\r\n var data_cnt = 0;\r\n var draw_direction = 0;\r\n var contours_vertices = [[]];\r\n var final_vert_list = [];\r\n var final_vert_cnt = 0;\r\n var lastPoint = new Point();\r\n var last_dir_vec = new Point();\r\n var end_point = new Point();\r\n if (contour_commands.length > 0 && contour_commands[0].length > 0) {\r\n for (k = 0; k < contour_commands.length; k++) {\r\n contours_vertices.push([]);\r\n vert_cnt = 0;\r\n data_cnt = 0;\r\n commands = contour_commands[k];\r\n data = contour_data[k];\r\n draw_direction = 0;\r\n var new_dir = 0;\r\n var new_dir_1 = 0;\r\n var new_dir_2 = 0;\r\n var dir_delta = 0;\r\n var last_direction = 0;\r\n var tmp_dir_point = new Point();\r\n if ((data[0] != data[data.length - 2]) || (data[1] != data[data.length - 1])) {\r\n data[data.length] = data[0];\r\n data[data.length] = data[1];\r\n }\r\n lastPoint.x = data[0];\r\n lastPoint.y = data[1];\r\n if (commands[1] == GraphicsPathCommand.LINE_TO) {\r\n last_dir_vec.x = data[2] - lastPoint.x;\r\n last_dir_vec.y = data[3] - lastPoint.y;\r\n }\r\n else if (commands[1] == GraphicsPathCommand.CURVE_TO) {\r\n last_dir_vec.x = data[4] - lastPoint.x;\r\n last_dir_vec.y = data[5] - lastPoint.y;\r\n }\r\n data_cnt = 2;\r\n last_dir_vec.normalize();\r\n last_direction = Math.atan2(last_dir_vec.y, last_dir_vec.x) * MathConsts.RADIANS_TO_DEGREES;\r\n for (i = 1; i < commands.length; i++) {\r\n end_point = new Point(data[data_cnt++], data[data_cnt++]);\r\n if (commands[i] == GraphicsPathCommand.MOVE_TO) {\r\n console.log(\"ERROR ! ONLY THE FIRST COMMAND FOR A CONTOUR IS ALLOWED TO BE A 'MOVE_TO' COMMAND\");\r\n }\r\n else if (commands[i] == GraphicsPathCommand.CURVE_TO) {\r\n end_point = new Point(data[data_cnt++], data[data_cnt++]);\r\n }\r\n //get the directional vector and the direction for this segment\r\n tmp_dir_point.x = end_point.x - lastPoint.x;\r\n tmp_dir_point.y = end_point.y - lastPoint.y;\r\n tmp_dir_point.normalize();\r\n new_dir = Math.atan2(tmp_dir_point.y, tmp_dir_point.x) * MathConsts.RADIANS_TO_DEGREES;\r\n // get the difference in angle to the last segment\r\n dir_delta = new_dir - last_direction;\r\n if (dir_delta > 180) {\r\n dir_delta -= 360;\r\n }\r\n if (dir_delta < -180) {\r\n dir_delta += 360;\r\n }\r\n draw_direction += dir_delta;\r\n last_direction = new_dir;\r\n lastPoint.x = end_point.x;\r\n lastPoint.y = end_point.y;\r\n }\r\n lastPoint.x = data[0];\r\n lastPoint.y = data[1];\r\n data_cnt = 2;\r\n contours_vertices[contours_vertices.length - 1][vert_cnt++] = lastPoint.x;\r\n contours_vertices[contours_vertices.length - 1][vert_cnt++] = lastPoint.y;\r\n //console.log(\"Draw directions complete: \"+draw_direction);\r\n for (i = 1; i < commands.length; i++) {\r\n switch (commands[i]) {\r\n case GraphicsPathCommand.MOVE_TO:\r\n console.log(\"ERROR ! ONLY THE FIRST COMMAND FOR A CONTOUR IS ALLOWED TO BE A 'MOVE_TO' COMMAND\");\r\n break;\r\n case GraphicsPathCommand.LINE_TO:\r\n lastPoint.x = data[data_cnt++];\r\n lastPoint.y = data[data_cnt++];\r\n contours_vertices[contours_vertices.length - 1][vert_cnt++] = lastPoint.x;\r\n contours_vertices[contours_vertices.length - 1][vert_cnt++] = lastPoint.y;\r\n break;\r\n case GraphicsPathCommand.CURVE_TO:\r\n var control_x = data[data_cnt++];\r\n var control_y = data[data_cnt++];\r\n var end_x = data[data_cnt++];\r\n var end_y = data[data_cnt++];\r\n tmp_dir_point.x = control_x - lastPoint.x;\r\n tmp_dir_point.y = control_y - lastPoint.y;\r\n tmp_dir_point.normalize();\r\n new_dir_1 = Math.atan2(tmp_dir_point.y, tmp_dir_point.x) * MathConsts.RADIANS_TO_DEGREES;\r\n tmp_dir_point.x = end_x - lastPoint.x;\r\n tmp_dir_point.y = end_y - lastPoint.y;\r\n tmp_dir_point.normalize();\r\n new_dir_2 = Math.atan2(tmp_dir_point.y, tmp_dir_point.x) * MathConsts.RADIANS_TO_DEGREES;\r\n // get the difference in angle to the last segment\r\n var curve_direction = new_dir_2 - new_dir_1;\r\n if (curve_direction > 180) {\r\n curve_direction -= 360;\r\n }\r\n if (curve_direction < -180) {\r\n curve_direction += 360;\r\n }\r\n if ((curve_direction == 0) && (curve_direction == 180) && (curve_direction == -180)) {\r\n lastPoint.x = end_x;\r\n lastPoint.y = end_y;\r\n contours_vertices[contours_vertices.length - 1][vert_cnt++] = lastPoint.x;\r\n contours_vertices[contours_vertices.length - 1][vert_cnt++] = lastPoint.y;\r\n break;\r\n }\r\n var curve_attr_1 = -1;\r\n if (draw_direction < 0) {\r\n if (curve_direction > 0) {\r\n //convex\r\n //console.log(\"convex\");\r\n curve_attr_1 = 1;\r\n contours_vertices[contours_vertices.length - 1][vert_cnt++] = control_x;\r\n contours_vertices[contours_vertices.length - 1][vert_cnt++] = control_y;\r\n }\r\n contours_vertices[contours_vertices.length - 1][vert_cnt++] = end_x;\r\n contours_vertices[contours_vertices.length - 1][vert_cnt++] = end_y;\r\n }\r\n else {\r\n if (curve_direction < 0) {\r\n //convex\r\n //console.log(\"convex\");\r\n curve_attr_1 = 1;\r\n contours_vertices[contours_vertices.length - 1][vert_cnt++] = control_x;\r\n contours_vertices[contours_vertices.length - 1][vert_cnt++] = control_y;\r\n }\r\n contours_vertices[contours_vertices.length - 1][vert_cnt++] = end_x;\r\n contours_vertices[contours_vertices.length - 1][vert_cnt++] = end_y;\r\n }\r\n if (GraphicsFactoryHelper.isClockWiseXY(end_x, end_y, control_x, control_y, lastPoint.x, lastPoint.y)) {\r\n final_vert_list[final_vert_cnt++] = end_x;\r\n final_vert_list[final_vert_cnt++] = end_y;\r\n /*\r\n final_vert_list[final_vert_cnt++] = curve_attr_1;\r\n final_vert_list[final_vert_cnt++] = 1.0;\r\n final_vert_list[final_vert_cnt++] = 1.0;\r\n final_vert_list[final_vert_cnt++] = 1.0;\r\n final_vert_list[final_vert_cnt++] = 0.0;\r\n */\r\n final_vert_list[final_vert_cnt++] = control_x;\r\n final_vert_list[final_vert_cnt++] = control_y;\r\n /*\r\n final_vert_list[final_vert_cnt++] = curve_attr_1;\r\n final_vert_list[final_vert_cnt++] = 0.5;\r\n final_vert_list[final_vert_cnt++] = 0.0;\r\n final_vert_list[final_vert_cnt++] = 1.0;\r\n final_vert_list[final_vert_cnt++] = 0.0;\r\n */\r\n final_vert_list[final_vert_cnt++] = lastPoint.x;\r\n final_vert_list[final_vert_cnt++] = lastPoint.y;\r\n }\r\n else {\r\n final_vert_list[final_vert_cnt++] = lastPoint.x;\r\n final_vert_list[final_vert_cnt++] = lastPoint.y;\r\n /*\r\n final_vert_list[final_vert_cnt++] = curve_attr_1;\r\n final_vert_list[final_vert_cnt++] = 1.0;\r\n final_vert_list[final_vert_cnt++] = 1.0;\r\n final_vert_list[final_vert_cnt++] = 1.0;\r\n final_vert_list[final_vert_cnt++] = 0.0;\r\n */\r\n final_vert_list[final_vert_cnt++] = control_x;\r\n final_vert_list[final_vert_cnt++] = control_y;\r\n /*\r\n final_vert_list[final_vert_cnt++] = curve_attr_1;\r\n final_vert_list[final_vert_cnt++] = 0.5;\r\n final_vert_list[final_vert_cnt++] = 0.0;\r\n final_vert_list[final_vert_cnt++] = 1.0;\r\n final_vert_list[final_vert_cnt++] = 0.0;\r\n */\r\n final_vert_list[final_vert_cnt++] = end_x;\r\n final_vert_list[final_vert_cnt++] = end_y;\r\n }\r\n lastPoint.x = end_x;\r\n lastPoint.y = end_y;\r\n break;\r\n case GraphicsPathCommand.CUBIC_CURVE:\r\n //todo\r\n break;\r\n }\r\n }\r\n }\r\n var verts = [];\r\n var all_verts = [];\r\n var elems = [];\r\n var res = Tess2.tesselate({\r\n contours: contours_vertices,\r\n windingRule: Tess2.WINDING_ODD,\r\n elementType: Tess2.POLYGONS,\r\n polySize: 3,\r\n vertexSize: 2\r\n });\r\n var numElems = res.elements.length / 3;\r\n var p1 = 0;\r\n var p2 = 0;\r\n var p3 = 0;\r\n for (i = 0; i < numElems; ++i) {\r\n p1 = res.elements[i * 3];\r\n p2 = res.elements[i * 3 + 1];\r\n p3 = res.elements[i * 3 + 2];\r\n final_vert_list[final_vert_cnt++] = res.vertices[p3 * 2];\r\n final_vert_list[final_vert_cnt++] = res.vertices[p3 * 2 + 1];\r\n /*\r\n final_vert_list[final_vert_cnt++] = 1;\r\n final_vert_list[final_vert_cnt++] = 2.0;\r\n final_vert_list[final_vert_cnt++] = 0.0;\r\n final_vert_list[final_vert_cnt++] = 1.0;\r\n final_vert_list[final_vert_cnt++] = 0.0;\r\n */\r\n final_vert_list[final_vert_cnt++] = res.vertices[p2 * 2];\r\n final_vert_list[final_vert_cnt++] = res.vertices[p2 * 2 + 1];\r\n /*\r\n final_vert_list[final_vert_cnt++] = 1;\r\n final_vert_list[final_vert_cnt++] = 2.0;\r\n final_vert_list[final_vert_cnt++] = 0.0;\r\n final_vert_list[final_vert_cnt++] = 1.0;\r\n final_vert_list[final_vert_cnt++] = 0.0;\r\n */\r\n final_vert_list[final_vert_cnt++] = res.vertices[p1 * 2];\r\n final_vert_list[final_vert_cnt++] = res.vertices[p1 * 2 + 1];\r\n }\r\n }\r\n final_vert_list = final_vert_list.concat(targetGraphics.queued_fill_pathes[cp].verts);\r\n if (final_vert_list.length > 0) {\r\n //for (i = 0; i < final_vert_list.length/7; ++i)\r\n //\tconsole.log(\"final verts \"+i+\" = \"+final_vert_list[i*7]+\" / \"+final_vert_list[i*7+1]);\r\n var attributesView = new AttributesView(Float32Array, 2);\r\n attributesView.set(final_vert_list);\r\n var attributesBuffer = attributesView.attributesBuffer;\r\n attributesView.dispose();\r\n var elements = new TriangleElements(attributesBuffer);\r\n elements.setPositions(new Float2Attributes(attributesBuffer));\r\n //elements.setCustomAttributes(\"curves\", new Float3Attributes(attributesBuffer));\r\n //elements.setUVs(new Float2Attributes(attributesBuffer));\r\n var sampler;\r\n var style;\r\n var material;\r\n if (targetGraphics.queued_fill_pathes[cp].style.data_type == GraphicsFillStyle.data_type) {\r\n var obj = Graphics.get_material_for_color(targetGraphics.queued_fill_pathes[cp].style.color, targetGraphics.queued_fill_pathes[cp].style.alpha);\r\n material = obj.material;\r\n var shape = targetGraphics.addShape(Shape.getShape(elements, material));\r\n if (obj.colorPos) {\r\n shape.style = new Style();\r\n sampler = new Sampler2D();\r\n material.animateUVs = true;\r\n shape.style.addSamplerAt(sampler, material.getTextureAt(0));\r\n shape.style.uvMatrix = new Matrix(0, 0, 0, 0, obj.colorPos.x, obj.colorPos.y);\r\n }\r\n }\r\n else if (targetGraphics.queued_fill_pathes[cp].style.data_type == GradientFillStyle.data_type) {\r\n var gradientStyle = targetGraphics.queued_fill_pathes[cp].style;\r\n var obj = Graphics.get_material_for_gradient(gradientStyle);\r\n material = obj.material;\r\n var shape = targetGraphics.addShape(Shape.getShape(elements, material));\r\n shape.style = new Style();\r\n sampler = new Sampler2D();\r\n shape.style.addSamplerAt(sampler, material.getTextureAt(0));\r\n material.animateUVs = true;\r\n shape.style.uvMatrix = gradientStyle.getUVMatrix();\r\n // todo: always use mappingmode = Radial ?\r\n sampler.imageRect = gradientStyle.uvRectangle;\r\n material.imageRect = true;\r\n material.getTextureAt(0).mappingMode = MappingMode.RADIAL;\r\n }\r\n }\r\n }\r\n targetGraphics.queued_fill_pathes.length = 0;\r\n };\r\n return GraphicsFactoryFills;\r\n}());\r\nexport { GraphicsFactoryFills };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/draw/GraphicsFactoryFills.js","/**\r\n * The InterpolationMethod class provides values for the\r\n *interpolationMethod parameter in the\r\n * Graphics.beginGradientFill() and\r\n * Graphics.lineGradientStyle() methods. This parameter\r\n * determines the RGB space to use when rendering the gradient.\r\n */\r\nvar InterpolationMethod = (function () {\r\n function InterpolationMethod() {\r\n }\r\n return InterpolationMethod;\r\n}());\r\nexport { InterpolationMethod };\r\n/**\r\n * Specifies that the RGB interpolation method should be used. This means\r\n * that the gradient is rendered with exponential sRGB(standard RGB) space.\r\n * The sRGB space is a W3C-endorsed standard that defines a non-linear\r\n * conversion between red, green, and blue component values and the actual\r\n * intensity of the visible component color.\r\n *\r\n * For example, consider a simple linear gradient between two colors(with\r\n * the spreadMethod parameter set to\r\n * SpreadMethod.REFLECT). The different interpolation methods\r\n * affect the appearance as follows:
For example, consider a simple linear gradient between two colors(with\r\n * the spreadMethod parameter set to\r\n * SpreadMethod.REFLECT). The different interpolation methods\r\n * affect the appearance as follows:
pixelSnapping property\r\n * of a Bitmap object.\r\n */\r\nvar PixelSnapping = (function () {\r\n function PixelSnapping() {\r\n }\r\n return PixelSnapping;\r\n}());\r\nexport { PixelSnapping };\r\n/**\r\n * A constant value used in the pixelSnapping property of a\r\n * Bitmap object to specify that the bitmap image is always snapped to the\r\n * nearest pixel, independent of any transformation.\r\n */\r\nPixelSnapping.ALWAYS = \"always\";\r\n/**\r\n * A constant value used in the pixelSnapping property of a\r\n * Bitmap object to specify that the bitmap image is snapped to the nearest\r\n * pixel if it is drawn with no rotation or skew and it is drawn at a scale\r\n * factor of 99.9% to 100.1%. If these conditions are satisfied, the image is\r\n * drawn at 100% scale, snapped to the nearest pixel. Internally, this\r\n * setting allows the image to be drawn as fast as possible by using the\r\n * vector renderer.\r\n */\r\nPixelSnapping.AUTO = \"auto\";\r\n/**\r\n * A constant value used in the pixelSnapping property of a\r\n * Bitmap object to specify that no pixel snapping occurs.\r\n */\r\nPixelSnapping.NEVER = \"never\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/draw/PixelSnapping.js","/**\r\n * The SpreadMethod class provides values for the spreadMethod\r\n * parameter in the beginGradientFill() and\r\n * lineGradientStyle() methods of the Graphics class.\r\n *\r\n * The following example shows the same gradient fill using various spread\r\n * methods:
\r\n */\r\nvar SpreadMethod = (function () {\r\n function SpreadMethod() {\r\n }\r\n return SpreadMethod;\r\n}());\r\nexport { SpreadMethod };\r\n/**\r\n * Specifies that the gradient use the pad spread method.\r\n */\r\nSpreadMethod.PAD = \"pad\";\r\n/**\r\n * Specifies that the gradient use the reflect spread method.\r\n */\r\nSpreadMethod.REFLECT = \"reflect\";\r\n/**\r\n * Specifies that the gradient use the repeat spread method.\r\n */\r\nSpreadMethod.REPEAT = \"repeat\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/draw/SpreadMethod.js","/**\r\n * Defines codes for culling algorithms that determine which triangles not to\r\n * render when drawing triangle paths.\r\n *\r\n * The terms POSITIVE and NEGATIVE refer to the\r\n * sign of a triangle's normal along the z-axis. The normal is a 3D vector\r\n * that is perpendicular to the surface of the triangle.
A triangle whose vertices 0, 1, and 2 are arranged in a clockwise order\r\n * has a positive normal value. That is, its normal points in a positive\r\n * z-axis direction, away from the current view point. When the\r\n * TriangleCulling.POSITIVE algorithm is used, triangles with\r\n * positive normals are not rendered. Another term for this is backface\r\n * culling.
A triangle whose vertices are arranged in a counter-clockwise order has\r\n * a negative normal value. That is, its normal points in a negative z-axis\r\n * direction, toward the current view point. When the\r\n * TriangleCulling.NEGATIVE algorithm is used, triangles with\r\n * negative normals will not be rendered.
flash.Assets or\r\n * flash.display.Loader classes, or they can be images that you\r\n * create with the Bitmap() constructor.\r\n *\r\n * The Bitmap() constructor allows you to create a Bitmap\r\n * object that contains a reference to a BitmapData object. After you create a\r\n * Bitmap object, use the addChild() or addChildAt()\r\n * method of the parent DisplayObjectContainer instance to place the bitmap on\r\n * the display list.
A Bitmap object can share its BitmapData reference among several Bitmap\r\n * objects, independent of translation or rotation properties. Because you can\r\n * create multiple Bitmap objects that reference the same BitmapData object,\r\n * multiple texture objects can use the same complex BitmapData object without\r\n * incurring the memory overhead of a BitmapData object for each texture\r\n * object instance.
\r\n\r\n */\r\nvar SamplerCube = (function (_super) {\r\n tslib_1.__extends(SamplerCube, _super);\r\n /**\r\n *\r\n * @param bitmapData\r\n * @param smoothing\r\n */\r\n function SamplerCube(smooth, mipmap) {\r\n if (smooth === void 0) { smooth = false; }\r\n if (mipmap === void 0) { mipmap = false; }\r\n return _super.call(this, smooth, mipmap) || this;\r\n }\r\n Object.defineProperty(SamplerCube.prototype, \"assetType\", {\r\n /**\r\n *\r\n * @returns {string}\r\n */\r\n get: function () {\r\n return SamplerCube.assetType;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n return SamplerCube;\r\n}(SamplerBase));\r\nexport { SamplerCube };\r\nSamplerCube.assetType = \"[asset SamplerCube]\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/image/SamplerCube.js","import * as tslib_1 from \"tslib\";\r\nimport { Point } from \"@awayjs/core\";\r\nimport { BitmapImage2D } from \"../image/BitmapImage2D\";\r\nimport { BitmapImageChannel } from \"../image/BitmapImageChannel\";\r\nimport { Image2D } from \"../image/Image2D\";\r\n/**\r\n *\r\n */\r\nvar SpecularImage2D = (function (_super) {\r\n tslib_1.__extends(SpecularImage2D, _super);\r\n /**\r\n *\r\n */\r\n function SpecularImage2D(specularSource, glossSource) {\r\n if (specularSource === void 0) { specularSource = null; }\r\n if (glossSource === void 0) { glossSource = null; }\r\n var _this = _super.call(this, 1, 1) || this;\r\n _this._specularSource = specularSource;\r\n _this._glossSource = glossSource;\r\n _this._output = new BitmapImage2D(1, 1, false, 0xffffff);\r\n _this._testSize();\r\n return _this;\r\n }\r\n Object.defineProperty(SpecularImage2D.prototype, \"assetType\", {\r\n /**\r\n *\r\n * @returns {string}\r\n */\r\n get: function () {\r\n return SpecularImage2D.assetType;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(SpecularImage2D.prototype, \"specularSource\", {\r\n get: function () {\r\n return this._specularSource;\r\n },\r\n set: function (value) {\r\n if (this._specularSource == value)\r\n return;\r\n this._specularSource = value;\r\n this.invalidate();\r\n this._testSize();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(SpecularImage2D.prototype, \"glossSource\", {\r\n get: function () {\r\n return this._glossSource;\r\n },\r\n set: function (value) {\r\n if (this._glossSource == value)\r\n return;\r\n this._glossSource = value;\r\n this.invalidate();\r\n this._testSize();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * Returns a new SpecularImage2D object that is a clone of the original instance\r\n * with an exact copy of the contained bitmap.\r\n *\r\n * @return A new SpecularImage2D object that is identical to the original.\r\n */\r\n SpecularImage2D.prototype.clone = function () {\r\n return new SpecularImage2D(this._specularSource, this._glossSource);\r\n };\r\n /**\r\n * Frees memory that is used to store the SpecularImage2D object.\r\n *\r\n *When the dispose() method is called on an image, the width\r\n * and height of the image are set to 0. All subsequent calls to methods or\r\n * properties of this SpecularImage2D instance fail, and an exception is thrown.\r\n *
SpecularImage2D.dispose() releases the memory occupied by the\r\n * actual bitmap data, immediately(a bitmap can consume up to 64 MB of\r\n * memory). After using SpecularImage2D.dispose(), the SpecularImage2D\r\n * object is no longer usable and an exception may be thrown if\r\n * you call functions on the SpecularImage2D object. However,\r\n * SpecularImage2D.dispose() does not garbage collect the SpecularImage2D\r\n * object(approximately 128 bytes); the memory occupied by the actual\r\n * SpecularImage2D object is released at the time the SpecularImage2D object is\r\n * collected by the garbage collector.
PickingCollision object.\r\n *\r\n * @param entity The entity to which this collision object belongs.\r\n */\r\n function PickingCollision(entity) {\r\n this.entity = entity;\r\n }\r\n return PickingCollision;\r\n}());\r\nexport { PickingCollision };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/pick/PickingCollision.js","import { Matrix, Rectangle } from \"@awayjs/core\";\r\nimport { BitmapImage2D } from \"../image/BitmapImage2D\";\r\nvar MipmapGenerator = (function () {\r\n function MipmapGenerator() {\r\n }\r\n MipmapGenerator._generateMipMaps = function (source, output, alpha) {\r\n if (alpha === void 0) { alpha = false; }\r\n var w = source.width;\r\n var h = source.height;\r\n var i = 0;\r\n var mipmap;\r\n MipmapGenerator._rect.width = w;\r\n MipmapGenerator._rect.height = h;\r\n //use (OR) to create non-square texture mipmaps\r\n while (w >= 1 || h >= 1) {\r\n mipmap = output[i] = MipmapGenerator._getMipmapHolder(output[i], MipmapGenerator._rect.width, MipmapGenerator._rect.height);\r\n if (alpha)\r\n mipmap.fillRect(MipmapGenerator._rect, 0);\r\n MipmapGenerator._matrix.a = MipmapGenerator._rect.width / source.width;\r\n MipmapGenerator._matrix.d = MipmapGenerator._rect.height / source.height;\r\n //todo: add support for NPOT textures\r\n if (typeof document !== \"undefined\") {\r\n mipmap.draw(source, MipmapGenerator._matrix); //TODO: smoothing?\r\n }\r\n else {\r\n if (source.constructor.toString().indexOf(\"BitmapImage2D\") > -1) {\r\n //for BitmapImage2D\r\n var bitmapImage = source;\r\n bitmapImage.lock();\r\n mipmap.lock();\r\n this.downsampleImage(bitmapImage.getImageData(), mipmap.getImageData());\r\n mipmap.unlock();\r\n bitmapImage.unlock();\r\n }\r\n else if (source.constructor.toString().indexOf(\"CPUCanvas\") > -1) {\r\n this.downsampleImage(source.getImageData(), mipmap.getImageData());\r\n }\r\n else {\r\n //for imageData\r\n this.downsampleImage(source, mipmap.getImageData());\r\n }\r\n }\r\n w >>= 1;\r\n h >>= 1;\r\n MipmapGenerator._rect.width = w > 1 ? w : 1;\r\n MipmapGenerator._rect.height = h > 1 ? h : 1;\r\n i++;\r\n }\r\n };\r\n MipmapGenerator._getMipmapHolder = function (mipMapHolder, newW, newH) {\r\n if (mipMapHolder) {\r\n if (mipMapHolder.width == newW && mipMapHolder.height == newH)\r\n return mipMapHolder;\r\n MipmapGenerator._freeMipMapHolder(mipMapHolder);\r\n }\r\n if (!MipmapGenerator._mipMaps[newW]) {\r\n MipmapGenerator._mipMaps[newW] = [];\r\n MipmapGenerator._mipMapUses[newW] = [];\r\n }\r\n if (!MipmapGenerator._mipMaps[newW][newH]) {\r\n mipMapHolder = MipmapGenerator._mipMaps[newW][newH] = new BitmapImage2D(newW, newH, true);\r\n MipmapGenerator._mipMapUses[newW][newH] = 1;\r\n }\r\n else {\r\n MipmapGenerator._mipMapUses[newW][newH] = MipmapGenerator._mipMapUses[newW][newH] + 1;\r\n mipMapHolder = MipmapGenerator._mipMaps[newW][newH];\r\n }\r\n return mipMapHolder;\r\n };\r\n MipmapGenerator._freeMipMapHolder = function (mipMapHolder) {\r\n var holderWidth = mipMapHolder.width;\r\n var holderHeight = mipMapHolder.height;\r\n if (--MipmapGenerator._mipMapUses[holderWidth][holderHeight] == 0) {\r\n MipmapGenerator._mipMaps[holderWidth][holderHeight].dispose();\r\n MipmapGenerator._mipMaps[holderWidth][holderHeight] = null;\r\n }\r\n };\r\n MipmapGenerator.downsampleImage = function (bitmap, destBitmap) {\r\n var box = new BoxFilter();\r\n var xkernel = new PolyphaseKernel(box, bitmap.width, destBitmap.width, 4);\r\n var ykernel = new PolyphaseKernel(box, bitmap.height, destBitmap.height, 4);\r\n var tempBitmap = []; //destBitmap.width, bitmap.height\r\n var scale = 0;\r\n var iscale = 0;\r\n var kernelLength = 0;\r\n var kernelWidth = 0;\r\n var kernelWindowSize = 0;\r\n var sumR = 0;\r\n var sumG = 0;\r\n var sumB = 0;\r\n var sumA = 0;\r\n var center;\r\n var left;\r\n var i = 0;\r\n var j = 0;\r\n var index = 0;\r\n for (var y = 0; y < bitmap.height; y++) {\r\n kernelLength = xkernel.len;\r\n scale = kernelLength / bitmap.width;\r\n iscale = 1.0 / scale;\r\n kernelWidth = xkernel.width;\r\n kernelWindowSize = xkernel.windowSize;\r\n for (i = 0; i < kernelLength; i++) {\r\n center = (0.5 + i) * iscale;\r\n left = Math.floor(center - kernelWidth);\r\n sumR = 0;\r\n sumG = 0;\r\n sumB = 0;\r\n sumA = 0;\r\n for (var j = 0; j < kernelWindowSize; ++j) {\r\n index = (y * bitmap.width + (left + j)) * 4;\r\n var colorR = bitmap.data[index];\r\n var colorG = bitmap.data[index + 1];\r\n var colorB = bitmap.data[index + 2];\r\n var colorA = bitmap.data[index + 3];\r\n var value = xkernel.valueAt(i, j);\r\n sumR += value * colorR;\r\n sumG += value * colorG;\r\n sumB += value * colorB;\r\n sumA += value * colorA;\r\n }\r\n index = (y * destBitmap.width + i) * 4;\r\n tempBitmap[index] = sumR;\r\n tempBitmap[index + 1] = sumG;\r\n tempBitmap[index + 2] = sumB;\r\n tempBitmap[index + 3] = sumA;\r\n }\r\n }\r\n for (var x = 0; x < destBitmap.width; x++) {\r\n kernelLength = ykernel.len;\r\n scale = kernelLength / bitmap.height;\r\n iscale = 1.0 / scale;\r\n kernelWidth = ykernel.width;\r\n kernelWindowSize = ykernel.windowSize;\r\n for (i = 0; i < kernelLength; i++) {\r\n center = (0.5 + i) * iscale;\r\n left = Math.floor(center - kernelWidth);\r\n sumR = 0;\r\n sumG = 0;\r\n sumB = 0;\r\n sumA = 0;\r\n for (j = 0; j < kernelWindowSize; ++j) {\r\n index = ((j + left) * destBitmap.width + x) * 4;\r\n var colorR = tempBitmap[index];\r\n var colorG = tempBitmap[index + 1];\r\n var colorB = tempBitmap[index + 2];\r\n var colorA = tempBitmap[index + 3];\r\n var value = ykernel.valueAt(i, j);\r\n sumR += value * colorR;\r\n sumG += value * colorG;\r\n sumB += value * colorB;\r\n sumA += value * colorA;\r\n }\r\n index = (i * destBitmap.width + x) * 4;\r\n destBitmap.data[index] = sumR;\r\n destBitmap.data[index + 1] = sumG;\r\n destBitmap.data[index + 2] = sumB;\r\n destBitmap.data[index + 3] = sumA;\r\n }\r\n }\r\n return destBitmap;\r\n };\r\n return MipmapGenerator;\r\n}());\r\nexport { MipmapGenerator };\r\nMipmapGenerator._mipMaps = [];\r\nMipmapGenerator._mipMapUses = [];\r\nMipmapGenerator._matrix = new Matrix();\r\nMipmapGenerator._rect = new Rectangle();\r\nvar PolyphaseKernel = (function () {\r\n function PolyphaseKernel(f, srcLength, dstLength, samples) {\r\n var scale = dstLength / srcLength;\r\n var iscale = 1.0 / scale;\r\n if (scale > 1) {\r\n // Upsampling.\r\n samples = 1;\r\n scale = 1;\r\n }\r\n this.len = dstLength;\r\n this.width = f.width * iscale;\r\n this.windowSize = Math.ceil(this.width * 2);\r\n this.data = [];\r\n for (var i = 0; i < this.len; i++) {\r\n var center = (0.5 + i) * iscale;\r\n var left = Math.floor(center - this.width);\r\n var total = 0.0;\r\n for (var j = 0; j < this.windowSize; j++) {\r\n var sample = f.sampleBox(left + j - center, scale, samples);\r\n //printf(\"%f %X\\n\", sample, *(uint32 *)&sample);\r\n this.data[i * this.windowSize + j] = sample;\r\n total += sample;\r\n }\r\n // normalize weights.\r\n for (var j = 0; j < this.windowSize; j++) {\r\n this.data[i * this.windowSize + j] /= total;\r\n }\r\n }\r\n }\r\n PolyphaseKernel.prototype.valueAt = function (column, x) {\r\n return this.data[column * this.windowSize + x];\r\n };\r\n return PolyphaseKernel;\r\n}());\r\nexport { PolyphaseKernel };\r\nvar BoxFilter = (function () {\r\n function BoxFilter() {\r\n }\r\n Object.defineProperty(BoxFilter.prototype, \"width\", {\r\n get: function () {\r\n return 0.5;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n BoxFilter.prototype.sampleBox = function (x, scale, samples) {\r\n var sum = 0;\r\n var isamples = 1.0 / samples;\r\n for (var s = 0; s < samples; s++) {\r\n var p = (x + (s + 0.5) * isamples) * scale;\r\n var value = this.evaluate(p);\r\n sum += value;\r\n }\r\n return sum * isamples;\r\n };\r\n BoxFilter.prototype.evaluate = function (x) {\r\n if (Math.abs(x) <= this.width)\r\n return 1.0;\r\n else\r\n return 0.0;\r\n };\r\n return BoxFilter;\r\n}());\r\nexport { BoxFilter };\r\nexport default MipmapGenerator;\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/utils/MipmapGenerator.js","export * from \"@awayjs/stage\";\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./node_modules/awayjs-full/dist/lib/stage.js\n// module id = 7\n// module chunks = 9","export * from \"@awayjs/renderer\";\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./node_modules/awayjs-full/dist/lib/renderer.js\n// module id = 8\n// module chunks = 9","/**\r\n *\r\n */\r\nvar AlignmentMode = (function () {\r\n function AlignmentMode() {\r\n }\r\n return AlignmentMode;\r\n}());\r\nexport { AlignmentMode };\r\n/**\r\n *\r\n */\r\nAlignmentMode.REGISTRATION_POINT = \"registrationPoint\";\r\n/**\r\n *\r\n */\r\nAlignmentMode.TRANSFORM_POINT = \"transformPoint\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/base/AlignmentMode.js","/**\r\n *\r\n */\r\nvar HierarchicalProperties = (function () {\r\n function HierarchicalProperties() {\r\n }\r\n return HierarchicalProperties;\r\n}());\r\nexport { HierarchicalProperties };\r\n/**\r\n *\r\n */\r\nHierarchicalProperties.MOUSE_ENABLED = 1;\r\n/**\r\n *\r\n */\r\nHierarchicalProperties.VISIBLE = 2;\r\n/**\r\n *\r\n */\r\nHierarchicalProperties.MASK_ID = 4;\r\n/**\r\n *\r\n */\r\nHierarchicalProperties.MASKS = 8;\r\n/**\r\n *\r\n */\r\nHierarchicalProperties.COLOR_TRANSFORM = 16;\r\n/**\r\n *\r\n */\r\nHierarchicalProperties.SCENE_TRANSFORM = 32;\r\n/**\r\n *\r\n */\r\nHierarchicalProperties.ALL = 63;\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/base/HierarchicalProperties.js","var OrientationMode = (function () {\r\n function OrientationMode() {\r\n }\r\n return OrientationMode;\r\n}());\r\nexport { OrientationMode };\r\n/**\r\n *\r\n */\r\nOrientationMode.DEFAULT = \"default\";\r\n/**\r\n *\r\n */\r\nOrientationMode.CAMERA_PLANE = \"cameraPlane\";\r\n/**\r\n *\r\n */\r\nOrientationMode.CAMERA_POSITION = \"cameraPosition\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/base/OrientationMode.js","var FrameScriptManager = (function () {\r\n function FrameScriptManager() {\r\n }\r\n FrameScriptManager.setInterval = function (func) {\r\n this._intervalID++;\r\n this._active_intervals[this._intervalID] = func;\r\n return this._intervalID;\r\n };\r\n FrameScriptManager.clearInterval = function (id) {\r\n delete this._active_intervals[id];\r\n };\r\n FrameScriptManager.execute_intervals = function () {\r\n for (var key in this._active_intervals) {\r\n this._active_intervals[key].call();\r\n }\r\n };\r\n FrameScriptManager.add_child_to_dispose = function (child) {\r\n this._queued_dispose.push(child);\r\n };\r\n FrameScriptManager.add_script_to_queue = function (mc, script) {\r\n // whenever we queue scripts of new objects, we first inject the lists of pass2\r\n var i = this._queued_mcs_pass2.length;\r\n while (i--) {\r\n this._queued_mcs.push(this._queued_mcs_pass2[i]);\r\n this._queued_scripts.push(this._queued_scripts_pass2[i]);\r\n }\r\n this._queued_mcs_pass2.length = 0;\r\n this._queued_scripts_pass2.length = 0;\r\n this._queued_mcs.push(mc);\r\n this._queued_scripts.push(script);\r\n };\r\n FrameScriptManager.add_script_to_queue_pass2 = function (mc, script) {\r\n this._queued_mcs_pass2.push(mc);\r\n this._queued_scripts_pass2.push(script);\r\n };\r\n FrameScriptManager.execute_queue = function () {\r\n if (this._queued_mcs.length == 0 && this._queued_mcs_pass2.length == 0)\r\n return;\r\n var i = this._queued_mcs_pass2.length;\r\n while (i--) {\r\n this._queued_mcs.push(this._queued_mcs_pass2[i]);\r\n this._queued_scripts.push(this._queued_scripts_pass2[i]);\r\n }\r\n this._queued_mcs_pass2.length = 0;\r\n this._queued_scripts_pass2.length = 0;\r\n var mc;\r\n for (i = 0; i < this._queued_mcs.length; i++) {\r\n // during the loop we might add more scripts to the queue\r\n mc = this._queued_mcs[i];\r\n if (mc.scene != null) {\r\n //\ttry {\r\n this._queued_scripts[i].call(mc.adapter);\r\n }\r\n }\r\n // all scripts executed. clear all\r\n this._queued_mcs.length = 0;\r\n this._queued_scripts.length = 0;\r\n };\r\n FrameScriptManager.execute_dispose = function () {\r\n /*\r\n var len:number = this._queued_dispose.length;\r\n for (var i:number = 0; i < len; i++)\r\n this._queued_dispose[i].dispose();\r\n\r\n this._queued_dispose.length = 0;\r\n */\r\n };\r\n return FrameScriptManager;\r\n}());\r\nexport { FrameScriptManager };\r\n// FrameScript debugging:\r\n// the first line of a FrameScript should be a comment that represents the functions unique name\r\n// the exporter creates a js file, containing a object that has the framescripts functions set as properties according to the unique names\r\n// this object can be set as \"frameScriptDebug\" in order to enable debug mode\r\nFrameScriptManager.frameScriptDebug = undefined;\r\n//queue of objects for disposal\r\nFrameScriptManager._queued_dispose = new Array();\r\n// queues pass1 of scripts.\r\nFrameScriptManager._queued_mcs = [];\r\nFrameScriptManager._queued_scripts = [];\r\n// queues pass2 of scripts. this will be inserted in reversed order into pass1 queue right before something should be added to pass1\r\nFrameScriptManager._queued_mcs_pass2 = [];\r\nFrameScriptManager._queued_scripts_pass2 = [];\r\nFrameScriptManager._active_intervals = new Object(); // maps id to function\r\nFrameScriptManager._intervalID = 0;\r\nexport default FrameScriptManager;\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/managers/FrameScriptManager.js","import { ColorTransform } from \"@awayjs/core\";\r\nimport { HierarchicalProperties } from \"../base/HierarchicalProperties\";\r\nimport { FrameScriptManager } from \"../managers/FrameScriptManager\";\r\nvar Timeline = (function () {\r\n function Timeline() {\r\n this._functions = [];\r\n this._update_indices = [];\r\n this.numKeyFrames = 0;\r\n this.keyframe_indices = [];\r\n this._potentialPrototypes = [];\r\n this._labels = {};\r\n this._framescripts = {};\r\n this._framescripts_translated = {};\r\n //cache functions\r\n this._functions[1] = this.update_mtx_all;\r\n this._functions[2] = this.update_colortransform;\r\n this._functions[3] = this.update_masks;\r\n this._functions[4] = this.update_name;\r\n this._functions[5] = this.update_button_name;\r\n this._functions[6] = this.update_visibility;\r\n this._functions[7] = this.update_blendmode;\r\n this._functions[8] = this.update_rendermode;\r\n this._functions[11] = this.update_mtx_scale_rot;\r\n this._functions[12] = this.update_mtx_pos;\r\n this._functions[200] = this.enable_maskmode;\r\n this._functions[201] = this.remove_masks;\r\n }\r\n Timeline.prototype.init = function () {\r\n if ((this.frame_command_indices == null) || (this.frame_recipe == null) || (this.keyframe_durations == null))\r\n return;\r\n this.keyframe_firstframes = [];\r\n this.keyframe_constructframes = [];\r\n var frame_cnt = 0;\r\n var ic = 0;\r\n var ic2 = 0;\r\n var keyframe_cnt = 0;\r\n var last_construct_frame = 0;\r\n for (ic = 0; ic < this.numKeyFrames; ic++) {\r\n var duration = this.keyframe_durations[(ic)];\r\n if (this.frame_recipe[ic] & 1)\r\n last_construct_frame = keyframe_cnt;\r\n this.keyframe_firstframes[keyframe_cnt] = frame_cnt;\r\n this.keyframe_constructframes[keyframe_cnt++] = last_construct_frame;\r\n for (ic2 = 0; ic2 < duration; ic2++)\r\n this.keyframe_indices[frame_cnt++] = ic;\r\n }\r\n };\r\n Timeline.prototype.get_framescript = function (keyframe_index) {\r\n if (this._framescripts[keyframe_index] == null)\r\n return \"\";\r\n if (typeof this._framescripts[keyframe_index] == \"string\")\r\n return this._framescripts[keyframe_index];\r\n else {\r\n throw new Error(\"Framescript is already translated to Function!!!\");\r\n }\r\n };\r\n Timeline.prototype.add_framescript = function (value, keyframe_index) {\r\n if (FrameScriptManager.frameScriptDebug) {\r\n // if we are in debug mode, we try to extract the function name from the first line of framescript code,\r\n // and check if this function is available on the object that is set as frameScriptDebug\r\n // try to get the functions name (it should be the first line as comment)\r\n var functionname = value.split(/[\\r\\n]+/g)[0].split(\"//\")[1];\r\n if (FrameScriptManager.frameScriptDebug[functionname]) {\r\n this._framescripts[keyframe_index] = FrameScriptManager.frameScriptDebug[functionname];\r\n this._framescripts_translated[keyframe_index] = true;\r\n return;\r\n }\r\n else {\r\n throw new Error(\"Framescript could not be found on FrameScriptManager.frameScriptDebug.\\n the Object set as FrameScriptmanager.frameScriptDebug should contain a function with the name '\" + functionname + \"' !!!\");\r\n }\r\n }\r\n this._framescripts[keyframe_index] = value;\r\n };\r\n Timeline.prototype.regexIndexOf = function (str, regex, startpos) {\r\n var indexOf = str.substring(startpos || 0).search(regex);\r\n return (indexOf >= 0) ? (indexOf + (startpos || 0)) : indexOf;\r\n };\r\n Timeline.prototype.add_script_for_postcontruct = function (target_mc, keyframe_idx, scriptPass1) {\r\n if (scriptPass1 === void 0) { scriptPass1 = false; }\r\n if (this._framescripts[keyframe_idx] != null) {\r\n if (this._framescripts_translated[keyframe_idx] == null) {\r\n this._framescripts[keyframe_idx] = target_mc.adapter.evalScript(this._framescripts[keyframe_idx]);\r\n this._framescripts_translated[keyframe_idx] = true;\r\n }\r\n if (scriptPass1)\r\n FrameScriptManager.add_script_to_queue(target_mc, this._framescripts[keyframe_idx]);\r\n else\r\n FrameScriptManager.add_script_to_queue_pass2(target_mc, this._framescripts[keyframe_idx]);\r\n }\r\n };\r\n Object.defineProperty(Timeline.prototype, \"numFrames\", {\r\n get: function () {\r\n return this.keyframe_indices.length;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Timeline.prototype, \"potentialPrototypes\", {\r\n get: function () {\r\n return this._potentialPrototypes;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Timeline.prototype.getPotentialChildPrototype = function (id) {\r\n return this._potentialPrototypes[id];\r\n };\r\n Timeline.prototype.getKeyframeIndexForFrameIndex = function (frame_index) {\r\n return this.keyframe_indices[frame_index];\r\n };\r\n Timeline.prototype.getPotentialChildInstance = function (id) {\r\n var this_clone = this._potentialPrototypes[id].adapter.clone().adaptee;\r\n //this_clone.name = \"\";\r\n //if (this_clone.isAsset(Billboard)){\r\n //var billboard:Billboard=(The DisplayObject class supports basic functionality like the x\r\n * and y position of an object, as well as more advanced properties of\r\n * the object such as its transformation matrix.
\r\n *\r\n *DisplayObject is an abstract base class; therefore, you cannot call\r\n * DisplayObject directly. Invoking new DisplayObject() throws an\r\n * ArgumentError exception.
All display objects inherit from the DisplayObject class.
\r\n *\r\n *The DisplayObject class itself does not include any APIs for rendering\r\n * content onscreen. For that reason, if you want create a custom subclass of\r\n * the DisplayObject class, you will want to extend one of its subclasses that\r\n * do have APIs for rendering content onscreen, such as the Shape, Sprite,\r\n * Bitmap, SimpleButton, TextField, or MovieClip class.
\r\n *\r\n *The DisplayObject class contains several broadcast events. Normally, the\r\n * target of any particular event is a specific DisplayObject instance. For\r\n * example, the target of an added event is the specific\r\n * DisplayObject instance that was added to the display list. Having a single\r\n * target restricts the placement of event listeners to that target and in\r\n * some cases the target's ancestors on the display list. With broadcast\r\n * events, however, the target is not a specific DisplayObject instance, but\r\n * rather all DisplayObject instances, including those that are not on the\r\n * display list. This means that you can add a listener to any DisplayObject\r\n * instance to listen for broadcast events. In addition to the broadcast\r\n * events listed in the DisplayObject class's Events table, the DisplayObject\r\n * class also inherits two broadcast events from the EventDispatcher class:\r\n * activate and deactivate.
Some properties previously used in the ActionScript 1.0 and 2.0\r\n * MovieClip, TextField, and Button classes(such as _alpha,\r\n * _height, _name, _width,\r\n * _x, _y, and others) have equivalents in the\r\n * ActionScript 3.0 DisplayObject class that are renamed so that they no\r\n * longer begin with the underscore(_) character.
For more information, see the \"Display Programming\" chapter of the\r\n * ActionScript 3.0 Developer's Guide.
\r\n *\r\n * @event added Dispatched when a display object is added to the\r\n * display list. The following methods trigger this\r\n * event:\r\n *DisplayObjectContainer.addChild(),\r\n * DisplayObjectContainer.addChildAt().\r\n * @event addedToScene Dispatched when a display object is added to the on\r\n * scene display list, either directly or through the\r\n * addition of a sub tree in which the display object\r\n * is contained. The following methods trigger this\r\n * event:\r\n * DisplayObjectContainer.addChild(),\r\n * DisplayObjectContainer.addChildAt().\r\n * @event enterFrame [broadcast event] Dispatched when the playhead is\r\n * entering a new frame. If the playhead is not\r\n * moving, or if there is only one frame, this event\r\n * is dispatched continuously in conjunction with the\r\n * frame rate. This event is a broadcast event, which\r\n * means that it is dispatched by all display objects\r\n * with a listener registered for this event.\r\n * @event exitFrame [broadcast event] Dispatched when the playhead is\r\n * exiting the current frame. All frame scripts have\r\n * been run. If the playhead is not moving, or if\r\n * there is only one frame, this event is dispatched\r\n * continuously in conjunction with the frame rate.\r\n * This event is a broadcast event, which means that\r\n * it is dispatched by all display objects with a\r\n * listener registered for this event.\r\n * @event frameConstructed [broadcast event] Dispatched after the constructors\r\n * of frame display objects have run but before frame\r\n * scripts have run. If the playhead is not moving, or\r\n * if there is only one frame, this event is\r\n * dispatched continuously in conjunction with the\r\n * frame rate. This event is a broadcast event, which\r\n * means that it is dispatched by all display objects\r\n * with a listener registered for this event.\r\n * @event removed Dispatched when a display object is about to be\r\n * removed from the display list. Two methods of the\r\n * DisplayObjectContainer class generate this event:\r\n * removeChild() and\r\n * removeChildAt().\r\n *\r\n * The following methods of a\r\n * DisplayObjectContainer object also generate this\r\n * event if an object must be removed to make room for\r\n * the new object: addChild(),\r\n * addChildAt(), and\r\n * setChildIndex().
removeChild() and\r\n * removeChildAt().\r\n *\r\n * The following methods of a\r\n * DisplayObjectContainer object also generate this\r\n * event if an object must be removed to make room for\r\n * the new object: addChild(),\r\n * addChildAt(), and\r\n * setChildIndex().
invalidate() method of the Scene\r\n * object each time you want a render\r\n * event to be dispatched. Render events\r\n * are dispatched to an object only if there is mutual\r\n * trust between it and the object that called\r\n * Scene.invalidate(). This event is a\r\n * broadcast event, which means that it is dispatched\r\n * by all display objects with a listener registered\r\n * for this event.\r\n *\r\n * Note: This event is not dispatched if the\r\n * display is not rendering. This is the case when the\r\n * content is either minimized or obscured.
\r\n */\r\nvar DisplayObject = (function (_super) {\r\n tslib_1.__extends(DisplayObject, _super);\r\n /**\r\n * Creates a newDisplayObject instance.\r\n */\r\n function DisplayObject() {\r\n var _this = _super.call(this) || this;\r\n //temp point used in hit testing\r\n _this._tempPoint = new Point();\r\n _this._queuedEvents = new Array();\r\n _this._boxBoundsInvalid = true;\r\n _this._sphereBoundsInvalid = true;\r\n _this._concatenatedMatrix3D = new Matrix3D();\r\n _this._pIsEntity = false;\r\n _this._pIsContainer = false;\r\n _this._sessionID = -1;\r\n _this._depthID = -16384;\r\n _this._scenePosition = new Vector3D();\r\n _this._explicitVisibility = true;\r\n _this._explicitMaskId = -1;\r\n _this._pImplicitVisibility = true;\r\n _this._pImplicitMaskId = -1;\r\n _this._pImplicitMaskIds = new Array();\r\n _this._explicitMouseEnabled = true;\r\n _this._pImplicitMouseEnabled = true;\r\n _this._orientationMatrix = new Matrix3D();\r\n _this._inheritColorTransform = true;\r\n _this._maskMode = false;\r\n //temp vector used in global to local\r\n _this._tempVector3D = new Vector3D();\r\n _this.isSlice9ScaledMC = false;\r\n _this.isSlice9ScaledSprite = false;\r\n /**\r\n *\r\n */\r\n _this.alignmentMode = AlignmentMode.REGISTRATION_POINT;\r\n /**\r\n *\r\n */\r\n _this.castsShadows = true;\r\n /**\r\n *\r\n */\r\n _this.orientationMode = OrientationMode.DEFAULT;\r\n /**\r\n *\r\n */\r\n _this.zOffset = 0;\r\n //global debug bounding boxes:\r\n //this._debugVisible=true;\r\n _this._onInvalidatePropertiesDelegate = function (event) { return _this._onInvalidateProperties(event); };\r\n //creation of associated transform object\r\n _this._transform = new Transform(null, _this._concatenatedMatrix3D);\r\n //setup transform listeners\r\n _this._transform.addEventListener(TransformEvent.INVALIDATE_MATRIX3D, function (event) { return _this._onInvalidateMatrix3D(event); });\r\n _this._transform.addEventListener(TransformEvent.UPDATE_CONCATENATED_MATRIX3D, function (event) { return _this._onUpdateConcatenatedMatrix3D(event); });\r\n _this._transform.addEventListener(TransformEvent.INVALIDATE_COLOR_TRANSFORM, function (event) { return _this._onInvalidateColorTransform(event); });\r\n //default bounds type\r\n _this._boundsType = BoundsType.AXIS_ALIGNED_BOX;\r\n return _this;\r\n }\r\n Object.defineProperty(DisplayObject.prototype, \"traverseName\", {\r\n get: function () {\r\n return DisplayObject.traverseName;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"inheritColorTransform\", {\r\n get: function () {\r\n return this._inheritColorTransform;\r\n },\r\n set: function (value) {\r\n if (this._inheritColorTransform == value)\r\n return;\r\n this._inheritColorTransform = value;\r\n this.pInvalidateHierarchicalProperties(HierarchicalProperties.COLOR_TRANSFORM);\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"alpha\", {\r\n /**\r\n * Indicates the alpha transparency value of the object specified. Valid\r\n * values are 0(fully transparent) to 1(fully opaque). The default value is\r\n * 1. Display objects with alpha set to 0 are active,\r\n * even though they are invisible.\r\n */\r\n get: function () {\r\n return this._transform.colorTransform.alphaMultiplier;\r\n },\r\n set: function (value) {\r\n this._transform.colorTransform.alphaMultiplier = value;\r\n this._transform.invalidateColorTransform();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"boundsType\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return this._boundsType;\r\n },\r\n set: function (value) {\r\n if (this._boundsType == value)\r\n return;\r\n this._boundsType = value;\r\n this.invalidate();\r\n this._pInvalidateBounds();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"depth\", {\r\n /**\r\n * Indicates the depth of the display object, in pixels. The depth is\r\n * calculated based on the bounds of the content of the display object. When\r\n * you set the depth property, the scaleZ property\r\n * is adjusted accordingly, as shown in the following code:\r\n *\r\n * Except for TextField and Video objects, a display object with no\r\n * content (such as an empty sprite) has a depth of 0, even if you try to\r\n * set depth to a different value.
Vector3D object containing euler angles for rotation around x, y and z axis.\r\n */\r\n get: function () {\r\n if (!this._eulers)\r\n this._eulers = new Vector3D();\r\n this._eulers.x = this.rotationX;\r\n this._eulers.y = this.rotationY;\r\n this._eulers.z = this.rotationZ;\r\n return this._eulers;\r\n },\r\n set: function (value) {\r\n // previously this was using the setters for rotationX etc\r\n // but because this will convert from radians to degree, i changed it to update directly\r\n this._transform.rotation.x = value.x;\r\n this._transform.rotation.y = value.y;\r\n this._transform.rotation.z = value.z;\r\n this._transform.invalidateMatrix3D();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"height\", {\r\n /**\r\n * An indexed array that contains each filter object currently associated\r\n * with the display object. The flash.filters package contains several\r\n * classes that define specific filters you can use.\r\n *\r\n * Filters can be applied in Flash Professional at design time, or at run\r\n * time by using ActionScript code. To apply a filter by using ActionScript,\r\n * you must make a temporary copy of the entire filters array,\r\n * modify the temporary array, then assign the value of the temporary array\r\n * back to the filters array. You cannot directly add a new\r\n * filter object to the filters array.
To add a filter by using ActionScript, perform the following steps\r\n * (assume that the target display object is named\r\n * myDisplayObject):
- \r\n *
- Create a new filter object by using the constructor method of your\r\n * chosen filter class. \r\n *
- Assign the value of the
myDisplayObject.filtersarray\r\n * to a temporary array, such as one namedmyFilters. \r\n * - Add the new filter object to the
myFilterstemporary\r\n * array. \r\n * - Assign the value of the temporary array to the\r\n *
myDisplayObject.filtersarray. \r\n *
If the filters array is undefined, you do not need to use\r\n * a temporary array. Instead, you can directly assign an array literal that\r\n * contains one or more filter objects that you create. The first example in\r\n * the Examples section adds a drop shadow filter by using code that handles\r\n * both defined and undefined filters arrays.
To modify an existing filter object, you must use the technique of\r\n * modifying a copy of the filters array:
- \r\n *
- Assign the value of the
filtersarray to a temporary\r\n * array, such as one namedmyFilters. \r\n * - Modify the property by using the temporary array,\r\n *
myFilters. For example, to set the quality property of the\r\n * first filter in the array, you could use the following code:\r\n *myFilters[0].quality = 1;\r\n * - Assign the value of the temporary array to the
filters\r\n * array. \r\n *
At load time, if a display object has an associated filter, it is\r\n * marked to cache itself as a transparent bitmap. From this point forward,\r\n * as long as the display object has a valid filter list, the player caches\r\n * the display object as a bitmap. This source bitmap is used as a source\r\n * image for the filter effects. Each display object usually has two bitmaps:\r\n * one with the original unfiltered source display object and another for the\r\n * final image after filtering. The final image is used when rendering. As\r\n * long as the display object does not change, the final image does not need\r\n * updating.
\r\n *\r\n *The flash.filters package includes classes for filters. For example, to\r\n * create a DropShadow filter, you would write:
\r\n *\r\n * @throws ArgumentError Whenfilters includes a ShaderFilter\r\n * and the shader output type is not compatible with\r\n * this operation(the shader must specify a\r\n * pixel4 output).\r\n * @throws ArgumentError When filters includes a ShaderFilter\r\n * and the shader doesn't specify any image input or\r\n * the first input is not an image4 input.\r\n * @throws ArgumentError When filters includes a ShaderFilter\r\n * and the shader specifies an image input that isn't\r\n * provided.\r\n * @throws ArgumentError When filters includes a ShaderFilter, a\r\n * ByteArray or Vector.width and\r\n * height properties aren't specified for\r\n * the ShaderInput object, or the specified values\r\n * don't match the amount of data in the input data.\r\n * See the ShaderInput.input property for\r\n * more information.\r\n */\r\n //\t\tpublic filters:Arrayheight property, the scaleY property\r\n * is adjusted accordingly, as shown in the following code:\r\n *\r\n * Except for TextField and Video objects, a display object with no\r\n * content (such as an empty sprite) has a height of 0, even if you try to\r\n * set height to a different value.
getChildByIndex() method of the display object\r\n * container.\r\n *\r\n * If the DisplayObject has no parent container, index defaults to 0.
\r\n */\r\n get: function () {\r\n if (this._pParent)\r\n return this._pParent.getChildIndex(this);\r\n return 0;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"isEntity\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return this._pIsEntity;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"isContainer\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return this._pIsContainer;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"loaderInfo\", {\r\n /**\r\n * Returns a LoaderInfo object containing information about loading the file\r\n * to which this display object belongs. TheloaderInfo property\r\n * is defined only for the root display object of a SWF file or for a loaded\r\n * Bitmap(not for a Bitmap that is drawn with ActionScript). To find the\r\n * loaderInfo object associated with the SWF file that contains\r\n * a display object named myDisplayObject, use\r\n * myDisplayObject.root.loaderInfo.\r\n *\r\n * A large SWF file can monitor its download by calling\r\n * this.root.loaderInfo.addEventListener(Event.COMPLETE,\r\n * func).
true, which means that by\r\n * default any InteractiveObject instance that is on the display list\r\n * receives mouse events or other user input events. If\r\n * mouseEnabled is set to false, the instance does\r\n * not receive any mouse events(or other user input events like keyboard\r\n * events). Any children of this instance on the display list are not\r\n * affected. To change the mouseEnabled behavior for all\r\n * children of an object on the display list, use\r\n * flash.display.DisplayObjectContainer.mouseChildren.\r\n *\r\n * No event is dispatched by setting this property. You must use the\r\n * addEventListener() method to create interactive\r\n * functionality.
Note: For a DisplayObject that has been rotated, the returned x\r\n * coordinate will reflect the non-rotated object.
\r\n */\r\n get: function () {\r\n return this._mouseX;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"mouseY\", {\r\n /**\r\n * Indicates the y coordinate of the mouse or user input device position, in\r\n * pixels.\r\n *\r\n *Note: For a DisplayObject that has been rotated, the returned y\r\n * coordinate will reflect the non-rotated object.
\r\n */\r\n get: function () {\r\n return this._mouseY;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"name\", {\r\n /**\r\n * Indicates the instance name of the DisplayObject. The object can be\r\n * identified in the child list of its parent display object container by\r\n * calling thegetChildByName() method of the display object\r\n * container.\r\n *\r\n * @throws IllegalOperationError If you are attempting to set this property\r\n * on an object that was placed on the timeline\r\n * in the Flash authoring tool.\r\n */\r\n get: function () {\r\n return this._pName;\r\n },\r\n set: function (value) {\r\n this._pName = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"parent\", {\r\n /**\r\n * Indicates the DisplayObjectContainer object that contains this display\r\n * object. Use the parent property to specify a relative path to\r\n * display objects that are above the current display object in the display\r\n * list hierarchy.\r\n *\r\n * You can use parent to move up multiple levels in the\r\n * display list as in the following:
Security.allowDomain() method.\r\n */\r\n get: function () {\r\n return this._pParent;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"isPartition\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return this._iIsPartition;\r\n },\r\n set: function (value) {\r\n if (this._iIsPartition == value)\r\n return;\r\n this._iIsPartition = value;\r\n this._iSetScene(this._pScene, this._pParent ? this._pParent._pPartition : null);\r\n this.dispatchEvent(new DisplayObjectEvent(DisplayObjectEvent.PARTITION_CHANGED, this));\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"registrationPoint\", {\r\n /**\r\n * Defines the local point around which the object rotates.\r\n */\r\n get: function () {\r\n if (this._registrationMatrix3D)\r\n return new Vector3D(-this._registrationMatrix3D._rawData[12] * this.scaleX, -this._registrationMatrix3D._rawData[13] * this.scaleY, -this._registrationMatrix3D._rawData[14] * this.scaleZ);\r\n return null;\r\n },\r\n set: function (value) {\r\n if (!value) {\r\n if (!this._registrationMatrix3D)\r\n return;\r\n this._registrationMatrix3D._rawData[12] = 0;\r\n this._registrationMatrix3D._rawData[13] = 0;\r\n this._registrationMatrix3D._rawData[14] = 0;\r\n if (this._registrationMatrix3D.isIdentity())\r\n this._registrationMatrix3D = null;\r\n }\r\n else {\r\n if (!this._registrationMatrix3D)\r\n this._registrationMatrix3D = new Matrix3D();\r\n this._registrationMatrix3D._rawData[12] = -value.x / this._transform.scale.x;\r\n this._registrationMatrix3D._rawData[13] = -value.y / this._transform.scale.y;\r\n this._registrationMatrix3D._rawData[14] = -value.z / this._transform.scale.z;\r\n }\r\n this._registrationMatrix3D.invalidatePosition();\r\n this.pInvalidateHierarchicalProperties(HierarchicalProperties.SCENE_TRANSFORM);\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"registrationScale\", {\r\n /**\r\n * Defines the local scale.\r\n */\r\n get: function () {\r\n if (this._registrationMatrix3D)\r\n return new Vector3D(this._registrationMatrix3D._rawData[0], this._registrationMatrix3D._rawData[5], this._registrationMatrix3D._rawData[10]);\r\n return null;\r\n },\r\n set: function (value) {\r\n if (!value) {\r\n if (!this._registrationMatrix3D)\r\n return;\r\n this._registrationMatrix3D._rawData[0] = 1;\r\n this._registrationMatrix3D._rawData[5] = 1;\r\n this._registrationMatrix3D._rawData[10] = 1;\r\n if (this._registrationMatrix3D.isIdentity())\r\n this._registrationMatrix3D = null;\r\n }\r\n else {\r\n if (!this._registrationMatrix3D)\r\n this._registrationMatrix3D = new Matrix3D();\r\n this._registrationMatrix3D._rawData[0] = value.x;\r\n this._registrationMatrix3D._rawData[5] = value.y;\r\n this._registrationMatrix3D._rawData[10] = value.z;\r\n }\r\n this.pInvalidateHierarchicalProperties(HierarchicalProperties.SCENE_TRANSFORM);\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"root\", {\r\n /**\r\n * For a display object in a loaded SWF file, the root property\r\n * is the top-most display object in the portion of the display list's tree\r\n * structure represented by that SWF file. For a Bitmap object representing a\r\n * loaded image file, the root property is the Bitmap object\r\n * itself. For the instance of the main class of the first SWF file loaded,\r\n * the root property is the display object itself. The\r\n * root property of the Scene object is the Scene object itself.\r\n * The root property is set to null for any display\r\n * object that has not been added to the display list, unless it has been\r\n * added to a display object container that is off the display list but that\r\n * is a child of the top-most display object in a loaded SWF file.\r\n *\r\n * For example, if you create a new Sprite object by calling the\r\n * Sprite() constructor method, its root property\r\n * is null until you add it to the display list(or to a display\r\n * object container that is off the display list but that is a child of the\r\n * top-most display object in a SWF file).
For a loaded SWF file, even though the Loader object used to load the\r\n * file may not be on the display list, the top-most display object in the\r\n * SWF file has its root property set to itself. The Loader\r\n * object does not have its root property set until it is added\r\n * as a child of a display object for which the root property is\r\n * set.
Scaling the local coordinate system changes the x and\r\n * y property values, which are defined in whole pixels.
Scaling the local coordinate system changes the x and\r\n * y property values, which are defined in whole pixels.
Scaling the local coordinate system changes the x,\r\n * y and z property values, which are defined in\r\n * whole pixels.
null.\r\n */\r\n get: function () {\r\n return this._animator;\r\n },\r\n set: function (value) {\r\n if (this._animator)\r\n this._animator.removeOwner(this);\r\n this._animator = value;\r\n if (this._animator)\r\n this._animator.addOwner(this);\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"material\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return this._material;\r\n },\r\n set: function (value) {\r\n if (this._material == value)\r\n return;\r\n if (this._material)\r\n this._material.iRemoveOwner(this);\r\n this._material = value;\r\n if (this._material)\r\n this._material.iAddOwner(this);\r\n this.invalidateMaterial();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"style\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return this._style;\r\n },\r\n set: function (value) {\r\n if (this._style == value)\r\n return;\r\n if (this._style)\r\n this._style.removeEventListener(StyleEvent.INVALIDATE_PROPERTIES, this._onInvalidatePropertiesDelegate);\r\n this._style = value;\r\n if (this._style)\r\n this._style.addEventListener(StyleEvent.INVALIDATE_PROPERTIES, this._onInvalidatePropertiesDelegate);\r\n this._onInvalidateProperties();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"shaderPickingDetails\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return this._shaderPickingDetails;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"debugVisible\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return this._debugVisible;\r\n },\r\n set: function (value) {\r\n if (value == this._debugVisible)\r\n return;\r\n this._debugVisible = value;\r\n this.invalidate();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"transform\", {\r\n /**\r\n * An object with properties pertaining to a display object's matrix, color\r\n * transform, and pixel bounds. The specific properties - matrix,\r\n * colorTransform, and three read-only properties\r\n * (concatenatedMatrix, concatenatedColorTransform,\r\n * and pixelBounds) - are described in the entry for the\r\n * Transform class.\r\n *\r\n * Each of the transform object's properties is itself an object. This\r\n * concept is important because the only way to set new values for the matrix\r\n * or colorTransform objects is to create a new object and copy that object\r\n * into the transform.matrix or transform.colorTransform property.
\r\n *\r\n *For example, to increase the tx value of a display\r\n * object's matrix, you must make a copy of the entire matrix object, then\r\n * copy the new object into the matrix property of the transform object:
public myMatrix:Matrix =\r\n * myDisplayObject.transform.matrix; myMatrix.tx += 10;\r\n * myDisplayObject.transform.matrix = myMatrix; You cannot directly set the tx property. The following\r\n * code has no effect on myDisplayObject:
myDisplayObject.transform.matrix.tx +=\r\n * 10; You can also copy an entire transform object and assign it to another\r\n * display object's transform property. For example, the following code\r\n * copies the entire transform object from myOldDisplayObj to\r\n * myNewDisplayObj:
myNewDisplayObj.transform = myOldDisplayObj.transform;\r\n *\r\n * The resulting display object, myNewDisplayObj, now has the\r\n * same values for its matrix, color transform, and pixel bounds as the old\r\n * display object, myOldDisplayObj.
Note that AIR for TV devices use hardware acceleration, if it is\r\n * available, for color transforms.
\r\n */\r\n get: function () {\r\n return this._transform;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"visible\", {\r\n /**\r\n * Whether or not the display object is visible. Display objects that are not\r\n * visible are disabled. For example, ifvisible=false for an\r\n * InteractiveObject instance, it cannot be clicked.\r\n */\r\n get: function () {\r\n return this._explicitVisibility;\r\n },\r\n set: function (value) {\r\n if (this._explicitVisibility == value)\r\n return;\r\n this._explicitVisibility = value;\r\n this.pInvalidateHierarchicalProperties(HierarchicalProperties.VISIBLE);\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"masks\", {\r\n get: function () {\r\n return this._explicitMasks;\r\n },\r\n set: function (value) {\r\n if (this._explicitMasks == value)\r\n return;\r\n this._explicitMasks = value;\r\n //make sure maskMode is set to true for all masks\r\n if (value != null && value.length) {\r\n var len = value.length;\r\n for (var i = 0; i < len; i++)\r\n value[i].maskMode = true;\r\n }\r\n this.pInvalidateHierarchicalProperties(HierarchicalProperties.MASKS);\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObject.prototype, \"width\", {\r\n /**\r\n * Indicates the width of the display object, in pixels. The width is\r\n * calculated based on the bounds of the content of the display object. When\r\n * you set the width property, the scaleX property\r\n * is adjusted accordingly, as shown in the following code:\r\n *\r\n * Except for TextField and Video objects, a display object with no\r\n * content(such as an empty sprite) has a width of 0, even if you try to set\r\n * width to a different value.
When you set a z property for a display object to\r\n * something other than the default value of 0, a corresponding\r\n * Matrix3D object is automatically created. for adjusting a display object's\r\n * position and orientation in three dimensions. When working with the\r\n * z-axis, the existing behavior of x and y properties changes from screen or\r\n * pixel coordinates to positions relative to the 3D parent container.
For example, a child of the _root at position x = 100, y =\r\n * 100, z = 200 is not drawn at pixel location(100,100). The child is drawn\r\n * wherever the 3D projection calculation puts it. The calculation is:
(x~~cameraFocalLength/cameraRelativeZPosition,\r\n * y~~cameraFocalLength/cameraRelativeZPosition)
targetCoordinateSpace object.\r\n * Consider the following code, which shows how the rectangle returned can\r\n * vary depending on the targetCoordinateSpace parameter that\r\n * you pass to the method:\r\n *\r\n * Note: Use the localToGlobal() and\r\n * globalToLocal() methods to convert the display object's local\r\n * coordinates to display coordinates, or display coordinates to local\r\n * coordinates, respectively.
The getBounds() method is similar to the\r\n * getRect() method; however, the Rectangle returned by the\r\n * getBounds() method includes any strokes on shapes, whereas\r\n * the Rectangle returned by the getRect() method does not. For\r\n * an example, see the description of the getRect() method.
targetCoordinateSpace object's coordinate\r\n * system.\r\n */\r\n DisplayObject.prototype.getBounds = function (targetCoordinateSpace) {\r\n return this._bounds; //TODO\r\n };\r\n /**\r\n * Returns a rectangle that defines the boundary of the display object, based\r\n * on the coordinate system defined by the targetCoordinateSpace\r\n * parameter, excluding any strokes on shapes. The values that the\r\n * getRect() method returns are the same or smaller than those\r\n * returned by the getBounds() method.\r\n *\r\n * Note: Use localToGlobal() and\r\n * globalToLocal() methods to convert the display object's local\r\n * coordinates to Scene coordinates, or Scene coordinates to local\r\n * coordinates, respectively.
targetCoordinateSpace object's coordinate\r\n * system.\r\n */\r\n DisplayObject.prototype.getRect = function (targetCoordinateSpace) {\r\n if (targetCoordinateSpace === void 0) { targetCoordinateSpace = null; }\r\n return this._bounds; //TODO\r\n };\r\n DisplayObject.prototype.getBox = function (targetCoordinateSpace) {\r\n if (targetCoordinateSpace === void 0) { targetCoordinateSpace = null; }\r\n if (this._iSourcePrefab)\r\n this._iSourcePrefab._iValidate();\r\n //TODO targetCoordinateSpace\r\n if (this._boxBoundsInvalid) {\r\n this._pUpdateBoxBounds();\r\n //scale updates if absolute dimensions are detected\r\n if (this._width != null)\r\n this._setScaleX(this._width / this._pBoxBounds.width);\r\n if (this._height != null)\r\n this._setScaleY(this._height / this._pBoxBounds.height);\r\n if (this._depth != null)\r\n this._setScaleZ(this._depth / this._pBoxBounds.depth);\r\n }\r\n if (targetCoordinateSpace == null || targetCoordinateSpace == this)\r\n return this._pBoxBounds;\r\n if (targetCoordinateSpace == this._pParent) {\r\n if (this._registrationMatrix3D) {\r\n if (this._tempTransform == null)\r\n this._tempTransform = new Matrix3D();\r\n this._tempTransform.copyFrom(this._transform.matrix3D);\r\n this._tempTransform.prepend(this._registrationMatrix3D);\r\n if (this.alignmentMode != AlignmentMode.REGISTRATION_POINT)\r\n this._tempTransform.appendTranslation(-this._registrationMatrix3D._rawData[12] * this._transform.scale.x, -this._registrationMatrix3D._rawData[13] * this._transform.scale.y, -this._registrationMatrix3D._rawData[14] * this._transform.scale.z);\r\n return this._tempTransform.transformBox(this._pBoxBounds);\r\n }\r\n return this._transform.matrix3D.transformBox(this._pBoxBounds);\r\n }\r\n else\r\n return targetCoordinateSpace.transform.inverseConcatenatedMatrix3D.transformBox(this.transform.concatenatedMatrix3D.transformBox(this._pBoxBounds));\r\n };\r\n DisplayObject.prototype.getSphere = function (targetCoordinateSpace) {\r\n if (targetCoordinateSpace === void 0) { targetCoordinateSpace = null; }\r\n if (this._iSourcePrefab)\r\n this._iSourcePrefab._iValidate();\r\n if (this._sphereBoundsInvalid)\r\n this._pUpdateSphereBounds();\r\n return this._pSphereBounds;\r\n };\r\n /**\r\n * Converts the point object from the Scene(global) coordinates\r\n * to the display object's(local) coordinates.\r\n *\r\n * To use this method, first create an instance of the Point class. The\r\n * x and y values that you assign represent global coordinates\r\n * because they relate to the origin(0,0) of the main display area. Then\r\n * pass the Point instance as the parameter to the\r\n * globalToLocal() method. The method returns a new Point object\r\n * with x and y values that relate to the origin of the display\r\n * object instead of the origin of the Scene.
To use this method, first create an instance of the Vector3D class. The x,\r\n * y and z values that you assign to the Vector3D object represent global\r\n * coordinates because they are relative to the origin(0,0,0) of the scene. Then\r\n * pass the Vector3D object to the globalToLocal3D() method as the\r\n * position parameter.\r\n * The method returns three-dimensional coordinates as a Vector3D object\r\n * containing x, y, and z values that\r\n * are relative to the origin of the three-dimensional display object.
obj display object.\r\n *\r\n * @param obj The display object to test against.\r\n * @return true if the bounding boxes of the display objects\r\n * intersect; false if not.\r\n */\r\n DisplayObject.prototype.hitTestObject = function (obj) {\r\n var objBox = obj.getBox(this.scene);\r\n if (!objBox)\r\n return false;\r\n var box = this.getBox(this.scene);\r\n if (!box)\r\n return false;\r\n if (objBox.x > (box.x + box.width)) {\r\n return false;\r\n }\r\n if (box.x > (objBox.x + objBox.width)) {\r\n return false;\r\n }\r\n if ((objBox.y + objBox.height) < box.y) {\r\n return false;\r\n }\r\n if ((box.y + box.height) < objBox.y) {\r\n return false;\r\n }\r\n return true; //TODO\r\n };\r\n /**\r\n * Evaluates the display object to see if it overlaps or intersects with the\r\n * point specified by the x and y parameters. The\r\n * x and y parameters specify a point in the\r\n * coordinate space of the Scene, not the display object container that\r\n * contains the display object(unless that display object container is the\r\n * Scene).\r\n *\r\n * @param x The x coordinate to test against this object.\r\n * @param y The y coordinate to test against this object.\r\n * @param shapeFlag Whether to check against the actual pixels of the object\r\n * (true) or the bounding box\r\n * (false).\r\n * @param maskFlag Whether to check against the object when it is used as mask\r\n * (false).\r\n * @return true if the display object overlaps or intersects\r\n * with the specified point; false otherwise.\r\n */\r\n DisplayObject.prototype.hitTestPoint = function (x, y, shapeFlag, masksFlag) {\r\n if (shapeFlag === void 0) { shapeFlag = false; }\r\n if (masksFlag === void 0) { masksFlag = false; }\r\n if (!this._pImplicitVisibility)\r\n return false;\r\n if (this._pImplicitMaskId != -1 && !masksFlag)\r\n return false;\r\n //set local tempPoint for later reference\r\n this._tempPoint.setTo(x, y);\r\n this.globalToLocal(this._tempPoint, this._tempPoint);\r\n //early out for box test\r\n if (!this.getBox().contains(this._tempPoint.x, this._tempPoint.y, 0))\r\n return false;\r\n if (this._explicitMasks) {\r\n var numMasks = this._explicitMasks.length;\r\n var maskHit = false;\r\n for (var i = 0; i < numMasks; i++) {\r\n if (this._explicitMasks[i].hitTestPoint(x, y, shapeFlag, true)) {\r\n maskHit = true;\r\n break;\r\n }\r\n }\r\n if (!maskHit)\r\n return false;\r\n }\r\n //early out for non-shape tests\r\n if (!shapeFlag || this.assetType == \"[asset TextField]\" || this.assetType == \"[asset Billboard]\")\r\n return true;\r\n return this._hitTestPointInternal(x, y, shapeFlag, masksFlag);\r\n };\r\n /**\r\n * Rotates the 3d object around to face a point defined relative to the local coordinates of the parent ObjectContainer3D.\r\n *\r\n * @param target The vector defining the point to be looked at\r\n * @param upAxis An optional vector used to define the desired up orientation of the 3d object after rotation has occurred\r\n */\r\n DisplayObject.prototype.lookAt = function (scenePosition, upAxis) {\r\n if (upAxis === void 0) { upAxis = null; }\r\n if (upAxis == null)\r\n upAxis = Vector3D.Y_AXIS;\r\n var m = Matrix3D.getPointAtMatrix(new Vector3D(), scenePosition.subtract(this._transform.position), upAxis, Matrix3D.CALCULATION_MATRIX);\r\n var vec = m.decompose()[1];\r\n this.rotationX = vec.x * MathConsts.RADIANS_TO_DEGREES;\r\n this.rotationY = vec.y * MathConsts.RADIANS_TO_DEGREES;\r\n this.rotationZ = vec.z * MathConsts.RADIANS_TO_DEGREES;\r\n };\r\n /**\r\n * Converts the point object from the display object's(local)\r\n * coordinates to the Scene(global) coordinates.\r\n *\r\n * This method allows you to convert any given x and y\r\n * coordinates from values that are relative to the origin(0,0) of a\r\n * specific display object(local coordinates) to values that are relative to\r\n * the origin of the Scene(global coordinates).
\r\n *\r\n *To use this method, first create an instance of the Point class. The\r\n * x and y values that you assign represent local coordinates\r\n * because they relate to the origin of the display object.
\r\n *\r\n *You then pass the Point instance that you created as the parameter to\r\n * the localToGlobal() method. The method returns a new Point\r\n * object with x and y values that relate to the origin of the\r\n * Scene instead of the origin of the display object.
This method allows you to convert any given x, y and\r\n * z coordinates from values that are relative to the origin(0,0,0) of\r\n * a specific display object(local coordinates) to values that are relative to\r\n * the origin of the Scene(global coordinates).
\r\n *\r\n *To use this method, first create an instance of the Point class. The\r\n * x and y values that you assign represent local coordinates\r\n * because they relate to the origin of the display object.
\r\n *\r\n *You then pass the Vector3D instance that you created as the parameter to\r\n * the localToGlobal3D() method. The method returns a new\r\n * Vector3D object with x, y and z values that relate to\r\n * the origin of the Scene instead of the origin of the display object.
DisplayObject is an abstract base class; therefore, you cannot call\r\n * DisplayObject directly. Invoking new DisplayObject() throws an\r\n * ArgumentError exception.
new DisplayObjectContainer() constructor throws an\r\n * ArgumentError exception.\r\n *\r\n * For more information, see the \"Display Programming\" chapter of the\r\n * ActionScript 3.0 Developer's Guide.
\r\n */\r\nvar DisplayObjectContainer = (function (_super) {\r\n tslib_1.__extends(DisplayObjectContainer, _super);\r\n /**\r\n * Calling thenew DisplayObjectContainer() constructor throws\r\n * an ArgumentError exception. You can, however, call\r\n * constructors for the following subclasses of DisplayObjectContainer:\r\n * - \r\n *
new Loader()\r\n * new Sprite()\r\n * new MovieClip()\r\n *
true.\r\n *\r\n * This property is useful when you create a button with an instance of\r\n * the Sprite class(instead of using the SimpleButton class). When you use a\r\n * Sprite instance to create a button, you can choose to decorate the button\r\n * by using the addChild() method to add additional Sprite\r\n * instances. This process can cause unexpected behavior with mouse events\r\n * because the Sprite instances you add as children can become the target\r\n * object of a mouse event when you expect the parent instance to be the\r\n * target object. To ensure that the parent instance serves as the target\r\n * objects for mouse events, you can set the mouseChildren\r\n * property of the parent instance to false.
No event is dispatched by setting this property. You must use the\r\n * addEventListener() method to create interactive\r\n * functionality.
addChildAt() method.)\r\n *\r\n * If you add a child object that already has a different display object\r\n * container as a parent, the object is removed from the child list of the\r\n * other display object container.
\r\n *\r\n *Note: The command stage.addChild() can cause\r\n * problems with a published SWF file, including security problems and\r\n * conflicts with other loaded SWF files. There is only one Stage within a\r\n * Flash runtime instance, no matter how many SWF files you load into the\r\n * runtime. So, generally, objects should not be added to the Stage,\r\n * directly, at all. The only object the Stage should contain is the root\r\n * object. Create a DisplayObjectContainer to contain all of the items on the\r\n * display list. Then, if necessary, add that DisplayObjectContainer instance\r\n * to the Stage.
child\r\n * parameter.\r\n * @throws ArgumentError Throws if the child is the same as the parent. Also\r\n * throws if the caller is a child(or grandchild etc.)\r\n * of the child being added.\r\n * @event added Dispatched when a display object is added to the display\r\n * list.\r\n */\r\n DisplayObjectContainer.prototype.addChild = function (child) {\r\n return this.addChildAt(child, this._children.length);\r\n };\r\n DisplayObjectContainer.prototype.addChildAtDepth = function (child, depth, replace) {\r\n if (replace === void 0) { replace = true; }\r\n if (child == null)\r\n throw new ArgumentError(\"Parameter child cannot be null.\");\r\n //if child already has a parent, remove it.\r\n if (child._pParent)\r\n child._pParent.removeChildAtInternal(child._pParent.getChildIndex(child));\r\n if (this.isSlice9ScaledMC && child.assetType == \"[asset Sprite]\") {\r\n child.isSlice9ScaledSprite = true;\r\n }\r\n var index = this.getDepthIndexInternal(depth);\r\n if (index != -1) {\r\n if (replace) {\r\n this.removeChildAt(index);\r\n }\r\n else {\r\n //move depth of existing child up by 1\r\n this.addChildAtDepth(this._children[index], depth + 1, false);\r\n }\r\n }\r\n if (this._nextHighestDepth < depth + 1)\r\n this._nextHighestDepth = depth + 1;\r\n this._depth_childs[depth] = child;\r\n this._children.push(child);\r\n child._depthID = depth;\r\n child.iSetParent(this);\r\n this._invalidateChildren();\r\n return child;\r\n };\r\n /**\r\n * Adds a child DisplayObject instance to this DisplayObjectContainer\r\n * instance. The child is added at the index position specified. An index of\r\n * 0 represents the back(bottom) of the display list for this\r\n * DisplayObjectContainer object.\r\n *\r\n * For example, the following example shows three display objects, labeled\r\n * a, b, and c, at index positions 0, 2, and 1, respectively:
\r\n *\r\n *If you add a child object that already has a different display object\r\n * container as a parent, the object is removed from the child list of the\r\n * other display object container.
\r\n *\r\n * @param child The DisplayObject instance to add as a child of this\r\n * DisplayObjectContainer instance.\r\n * @param index The index position to which the child is added. If you\r\n * specify a currently occupied index position, the child object\r\n * that exists at that position and all higher positions are\r\n * moved up one position in the child list.\r\n * @return The DisplayObject instance that you pass in thechild\r\n * parameter.\r\n * @throws ArgumentError Throws if the child is the same as the parent. Also\r\n * throws if the caller is a child(or grandchild etc.)\r\n * of the child being added.\r\n * @throws RangeError Throws if the index position does not exist in the\r\n * child list.\r\n * @event added Dispatched when a display object is added to the display\r\n * list.\r\n */\r\n DisplayObjectContainer.prototype.addChildAt = function (child, index) {\r\n return this.addChildAtDepth(child, (index < this._children.length) ? this._children[index]._depthID : this.getNextHighestDepth(), false);\r\n };\r\n DisplayObjectContainer.prototype.addChildren = function () {\r\n var childarray = [];\r\n for (var _i = 0; _i < arguments.length; _i++) {\r\n childarray[_i] = arguments[_i];\r\n }\r\n var len = childarray.length;\r\n for (var i = 0; i < len; i++)\r\n this.addChild(childarray[i]);\r\n };\r\n /**\r\n *\r\n */\r\n DisplayObjectContainer.prototype.clone = function () {\r\n var newInstance = new DisplayObjectContainer();\r\n this.copyTo(newInstance);\r\n return newInstance;\r\n };\r\n DisplayObjectContainer.prototype.copyTo = function (newInstance) {\r\n _super.prototype.copyTo.call(this, newInstance);\r\n newInstance.mouseChildren = this._mouseChildren;\r\n var len = this._children.length;\r\n for (var i = 0; i < len; ++i)\r\n newInstance.addChild(this._children[i].clone());\r\n };\r\n /**\r\n * Determines whether the specified display object is a child of the\r\n * DisplayObjectContainer instance or the instance itself. The search\r\n * includes the entire display list including this DisplayObjectContainer\r\n * instance. Grandchildren, great-grandchildren, and so on each return\r\n * true.\r\n *\r\n * @param child The child object to test.\r\n * @return true if the child object is a child of\r\n * the DisplayObjectContainer or the container itself; otherwise\r\n * false.\r\n */\r\n DisplayObjectContainer.prototype.contains = function (child) {\r\n return this._children.indexOf(child) >= 0;\r\n };\r\n /**\r\n *\r\n */\r\n DisplayObjectContainer.prototype.disposeValues = function () {\r\n for (var i = this._children.length - 1; i >= 0; i--)\r\n this.removeChild(this._children[i]);\r\n _super.prototype.disposeValues.call(this);\r\n };\r\n DisplayObjectContainer.prototype.getChildAtDepth = function (depth) {\r\n return this._depth_childs[depth];\r\n };\r\n /**\r\n * Returns the child display object instance that exists at the specified\r\n * index.\r\n *\r\n * @param index The index position of the child object.\r\n * @return The child display object at the specified index position.\r\n * @throws RangeError Throws if the index does not exist in the child\r\n * list.\r\n */\r\n DisplayObjectContainer.prototype.getChildAt = function (index) {\r\n var child = this._children[index];\r\n if (child == null)\r\n throw new RangeError(\"Index does not exist in the child list of the caller\");\r\n return child;\r\n };\r\n /**\r\n * Returns the child display object that exists with the specified name. If\r\n * more that one child display object has the specified name, the method\r\n * returns the first object in the child list.\r\n *\r\n * The getChildAt() method is faster than the\r\n * getChildByName() method. The getChildAt() method\r\n * accesses a child from a cached array, whereas the\r\n * getChildByName() method has to traverse a linked list to\r\n * access a child.
child DisplayObject instance.\r\n *\r\n * @param child The DisplayObject instance to identify.\r\n * @return The index position of the child display object to identify.\r\n * @throws ArgumentError Throws if the child parameter is not a child of this\r\n * object.\r\n */\r\n DisplayObjectContainer.prototype.getChildIndex = function (child) {\r\n var childIndex = this._children.indexOf(child);\r\n if (childIndex == -1)\r\n throw new ArgumentError(\"Child parameter is not a child of the caller\");\r\n return childIndex;\r\n };\r\n DisplayObjectContainer.prototype.getNextHighestDepth = function () {\r\n if (this._nextHighestDepthDirty)\r\n this._updateNextHighestDepth();\r\n return this._nextHighestDepth;\r\n };\r\n /**\r\n * Returns an array of objects that lie under the specified point and are\r\n * children(or grandchildren, and so on) of this DisplayObjectContainer\r\n * instance. Any child objects that are inaccessible for security reasons are\r\n * omitted from the returned array. To determine whether this security\r\n * restriction affects the returned array, call the\r\n * areInaccessibleObjectsUnderPoint() method.\r\n *\r\n * The point parameter is in the coordinate space of the\r\n * Stage, which may differ from the coordinate space of the display object\r\n * container(unless the display object container is the Stage). You can use\r\n * the globalToLocal() and the localToGlobal()\r\n * methods to convert points between these coordinate spaces.
child DisplayObject instance from the\r\n * child list of the DisplayObjectContainer instance. The parent\r\n * property of the removed child is set to null , and the object\r\n * is garbage collected if no other references to the child exist. The index\r\n * positions of any display objects above the child in the\r\n * DisplayObjectContainer are decreased by 1.\r\n *\r\n * The garbage collector reallocates unused memory space. When a variable\r\n * or object is no longer actively referenced or stored somewhere, the\r\n * garbage collector sweeps through and wipes out the memory space it used to\r\n * occupy if no other references to it exist.
\r\n *\r\n * @param child The DisplayObject instance to remove.\r\n * @return The DisplayObject instance that you pass in thechild\r\n * parameter.\r\n * @throws ArgumentError Throws if the child parameter is not a child of this\r\n * object.\r\n */\r\n DisplayObjectContainer.prototype.removeChild = function (child) {\r\n if (child == null)\r\n throw new ArgumentError(\"Parameter child cannot be null\");\r\n this.removeChildAt(this.getChildIndex(child));\r\n return child;\r\n };\r\n DisplayObjectContainer.prototype.removeChildAtDepth = function (depth) {\r\n return this.removeChildAt(this.getDepthIndexInternal(depth));\r\n };\r\n /**\r\n * Removes a child DisplayObject from the specified index\r\n * position in the child list of the DisplayObjectContainer. The\r\n * parent property of the removed child is set to\r\n * null, and the object is garbage collected if no other\r\n * references to the child exist. The index positions of any display objects\r\n * above the child in the DisplayObjectContainer are decreased by 1.\r\n *\r\n * The garbage collector reallocates unused memory space. When a variable\r\n * or object is no longer actively referenced or stored somewhere, the\r\n * garbage collector sweeps through and wipes out the memory space it used to\r\n * occupy if no other references to it exist.
\r\n *\r\n * @param index The child index of the DisplayObject to remove.\r\n * @return The DisplayObject instance that was removed.\r\n * @throws RangeError Throws if the index does not exist in the child\r\n * list.\r\n * @throws SecurityError This child display object belongs to a sandbox to\r\n * which the calling object does not have access. You\r\n * can avoid this situation by having the child movie\r\n * call theSecurity.allowDomain() method.\r\n */\r\n DisplayObjectContainer.prototype.removeChildAt = function (index) {\r\n var child = this.removeChildAtInternal(index);\r\n child.iSetParent(null);\r\n this._invalidateChildren();\r\n return child;\r\n };\r\n /**\r\n * Removes all child DisplayObject instances from the child list\r\n * of the DisplayObjectContainer instance. The parent property\r\n * of the removed children is set to null, and the objects are\r\n * garbage collected if no other references to the children exist.\r\n *\r\n * The garbage collector reallocates unused memory space. When a variable or\r\n * object is no longer actively referenced or stored somewhere, the garbage\r\n * collector sweeps through and wipes out the memory space it used to occupy\r\n * if no other references to it exist.\r\n *\r\n * @param beginIndex The beginning position. A value smaller than 0 throws a RangeError.\r\n * @param endIndex The ending position. A value smaller than 0 throws a RangeError.\r\n * @throws RangeError Throws if the beginIndex or endIndex positions do\r\n * not exist in the child list.\r\n */\r\n DisplayObjectContainer.prototype.removeChildren = function (beginIndex, endIndex) {\r\n if (beginIndex === void 0) { beginIndex = 0; }\r\n if (endIndex === void 0) { endIndex = 2147483647; }\r\n if (beginIndex < 0)\r\n throw new RangeError(\"beginIndex is out of range of the child list\");\r\n if (endIndex > this._children.length)\r\n throw new RangeError(\"endIndex is out of range of the child list\");\r\n //var oldChilds:DisplayObject[]=this._children.slice();\r\n for (var i = endIndex - 1; i >= beginIndex; i--)\r\n this.removeChildAtInternal(i).iSetParent(null);\r\n this._invalidateChildren();\r\n };\r\n /**\r\n * Changes the position of an existing child in the display object container.\r\n * This affects the layering of child objects. For example, the following\r\n * example shows three display objects, labeled a, b, and c, at index\r\n * positions 0, 1, and 2, respectively:\r\n *\r\n * When you use the setChildIndex() method and specify an\r\n * index position that is already occupied, the only positions that change\r\n * are those in between the display object's former and new position. All\r\n * others will stay the same. If a child is moved to an index LOWER than its\r\n * current index, all children in between will INCREASE by 1 for their index\r\n * reference. If a child is moved to an index HIGHER than its current index,\r\n * all children in between will DECREASE by 1 for their index reference. For\r\n * example, if the display object container in the previous example is named\r\n * container, you can swap the position of the display objects\r\n * labeled a and b by calling the following code:
This code results in the following arrangement of objects:
\r\n *\r\n * @param child The child DisplayObject instance for which you want to change\r\n * the index number.\r\n * @param index The resulting index number for thechild display\r\n * object.\r\n * @throws ArgumentError Throws if the child parameter is not a child of this\r\n * object.\r\n * @throws RangeError Throws if the index does not exist in the child\r\n * list.\r\n */\r\n DisplayObjectContainer.prototype.setChildIndex = function (child, index) {\r\n //TODO\r\n };\r\n /**\r\n * Swaps the z-order (front-to-back order) of the two specified child\r\n * objects. All other child objects in the display object container remain in\r\n * the same index positions.\r\n *\r\n * @param child1 The first child object.\r\n * @param child2 The second child object.\r\n * @throws ArgumentError Throws if either child parameter is not a child of\r\n * this object.\r\n */\r\n DisplayObjectContainer.prototype.swapChildren = function (child1, child2) {\r\n this.swapChildrenAt(this.getChildIndex(child1), this.getChildIndex(child2));\r\n };\r\n /**\r\n * Swaps the z-order(front-to-back order) of the child objects at the two\r\n * specified index positions in the child list. All other child objects in\r\n * the display object container remain in the same index positions.\r\n *\r\n * @param index1 The index position of the first child object.\r\n * @param index2 The index position of the second child object.\r\n * @throws RangeError If either index does not exist in the child list.\r\n */\r\n DisplayObjectContainer.prototype.swapChildrenAt = function (index1, index2) {\r\n var depth = this._children[index2]._depthID;\r\n var child = this._children[index1];\r\n this.addChildAtDepth(this._children[index2], this._children[index1]._depthID);\r\n this.addChildAtDepth(child, depth);\r\n };\r\n /**\r\n * //TODO\r\n *\r\n * @protected\r\n */\r\n DisplayObjectContainer.prototype._pUpdateBoxBounds = function () {\r\n _super.prototype._pUpdateBoxBounds.call(this);\r\n var numChildren = this._children.length;\r\n if (numChildren > 0) {\r\n var childBox;\r\n var first = true;\r\n for (var i = 0; i < numChildren; ++i) {\r\n // ignore bounds of childs that are masked\r\n // todo: this check is only needed for icycle, to get mouseclicks work correct in shop\r\n //if(this._children[i].masks==null){\r\n childBox = this._children[i].getBox();\r\n if (childBox.isEmpty())\r\n continue;\r\n childBox = this._children[i].getBox(this);\r\n if (first) {\r\n first = false;\r\n this._pBoxBounds.copyFrom(childBox);\r\n }\r\n else {\r\n this._pBoxBounds = this._pBoxBounds.union(childBox, this._pBoxBounds);\r\n }\r\n }\r\n }\r\n };\r\n /**\r\n * @protected\r\n */\r\n DisplayObjectContainer.prototype.pInvalidateHierarchicalProperties = function (propDirty) {\r\n if (_super.prototype.pInvalidateHierarchicalProperties.call(this, propDirty))\r\n return true;\r\n var len = this._children.length;\r\n for (var i = 0; i < len; ++i)\r\n this._children[i].pInvalidateHierarchicalProperties(propDirty);\r\n return false;\r\n };\r\n /**\r\n * @internal\r\n */\r\n DisplayObjectContainer.prototype._iSetScene = function (value, partition) {\r\n _super.prototype._iSetScene.call(this, value, partition);\r\n var len = this._children.length;\r\n for (var i = 0; i < len; ++i)\r\n this._children[i]._iSetScene(value, this._pPartition);\r\n };\r\n /**\r\n * @private\r\n *\r\n * @param child\r\n */\r\n DisplayObjectContainer.prototype.removeChildAtInternal = function (index) {\r\n var child = this._children.splice(index, 1)[0];\r\n //update next highest depth\r\n if (this._nextHighestDepth == child._depthID + 1)\r\n this._nextHighestDepthDirty = true;\r\n delete this._depth_childs[child._depthID];\r\n child._depthID = -16384;\r\n return child;\r\n };\r\n DisplayObjectContainer.prototype.getDepthIndexInternal = function (depth) {\r\n if (!this._depth_childs[depth])\r\n return -1;\r\n return this._children.indexOf(this._depth_childs[depth]);\r\n };\r\n DisplayObjectContainer.prototype._updateNextHighestDepth = function () {\r\n this._nextHighestDepthDirty = false;\r\n this._nextHighestDepth = 0;\r\n var len = this._children.length;\r\n for (var i = 0; i < len; i++)\r\n if (this._nextHighestDepth < this._children[i]._depthID)\r\n this._nextHighestDepth = this._children[i]._depthID;\r\n this._nextHighestDepth += 1;\r\n };\r\n DisplayObjectContainer.prototype._hitTestPointInternal = function (x, y, shapeFlag, masksFlag) {\r\n var numChildren = this._children.length;\r\n for (var i = 0; i < numChildren; i++)\r\n if (this._children[i].hitTestPoint(x, y, shapeFlag, masksFlag))\r\n return true;\r\n return false;\r\n };\r\n DisplayObjectContainer.prototype._updateMaskMode = function () {\r\n if (this.maskMode)\r\n this.mouseChildren = false;\r\n _super.prototype._updateMaskMode.call(this);\r\n };\r\n DisplayObjectContainer.prototype._isEntityInternal = function () {\r\n return Boolean(this._children.length);\r\n };\r\n DisplayObjectContainer.prototype._invalidateChildren = function () {\r\n var isContainer = Boolean(this._children.length);\r\n var isEntity = this._isEntityInternal();\r\n if (this._pIsContainer != isContainer || this._pIsEntity != isEntity) {\r\n if (this._pScene)\r\n this._pScene._iUnregisterObject(this);\r\n this._pIsContainer = isContainer;\r\n this._pIsEntity = isEntity;\r\n if (this._pScene)\r\n this._pScene._iRegisterObject(this);\r\n }\r\n this._pInvalidateBounds();\r\n };\r\n return DisplayObjectContainer;\r\n}(DisplayObject));\r\nexport { DisplayObjectContainer };\r\nDisplayObjectContainer.assetType = \"[asset DisplayObjectContainer]\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/display/DisplayObjectContainer.js","import * as tslib_1 from \"tslib\";\r\nimport { AssetEvent, Vector3D } from \"@awayjs/core\";\r\nimport { Graphics } from \"@awayjs/graphics\";\r\nimport { DisplayObjectContainer } from \"./DisplayObjectContainer\";\r\n/**\r\n * Sprite is an instance of a Graphics, augmenting it with a presence in the scene graph, a material, and an animation\r\n * state. It consists out of Graphices, which in turn correspond to SubGeometries. Graphices allow different parts\r\n * of the graphics to be assigned different materials.\r\n */\r\nvar Sprite = (function (_super) {\r\n tslib_1.__extends(Sprite, _super);\r\n /**\r\n * Create a new Sprite object.\r\n *\r\n * @param material [optional] The material with which to render the Sprite.\r\n */\r\n function Sprite(material) {\r\n if (material === void 0) { material = null; }\r\n var _this = _super.call(this) || this;\r\n _this._onGraphicsInvalidateDelegate = function (event) { return _this._onGraphicsInvalidate(event); };\r\n _this._graphics = Graphics.getGraphics(_this); //unique graphics object for each Sprite\r\n _this._graphics.addEventListener(AssetEvent.INVALIDATE, _this._onGraphicsInvalidateDelegate);\r\n _this.material = material;\r\n return _this;\r\n }\r\n Sprite.getNewSprite = function (material) {\r\n if (material === void 0) { material = null; }\r\n if (Sprite._sprites.length) {\r\n var sprite = Sprite._sprites.pop();\r\n sprite.material = material;\r\n return sprite;\r\n }\r\n return new Sprite(material);\r\n };\r\n Object.defineProperty(Sprite.prototype, \"assetType\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return Sprite.assetType;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Sprite.prototype, \"graphics\", {\r\n /**\r\n * Specifies the Graphics object belonging to this Sprite object, where\r\n * drawing commands can occur.\r\n */\r\n get: function () {\r\n if (this._iSourcePrefab)\r\n this._iSourcePrefab._iValidate();\r\n if (this.isSlice9ScaledSprite) {\r\n //var comps:Arraynull.\r\n */\r\n get: function () {\r\n return this._graphics.animator;\r\n },\r\n set: function (value) {\r\n this._graphics.animator = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Sprite.prototype, \"material\", {\r\n /**\r\n * The material with which to render the Sprite.\r\n */\r\n get: function () {\r\n return this._graphics.material;\r\n },\r\n set: function (value) {\r\n this._graphics.material = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Sprite.prototype, \"style\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return this._graphics.style;\r\n },\r\n set: function (value) {\r\n this._graphics.style = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * @inheritDoc\r\n */\r\n Sprite.prototype.dispose = function () {\r\n this.disposeValues();\r\n Sprite._sprites.push(this);\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n Sprite.prototype.disposeValues = function () {\r\n _super.prototype.disposeValues.call(this);\r\n this._graphics.dispose();\r\n };\r\n /**\r\n * Clones this Sprite instance along with all it's children, while re-using the same\r\n * material, graphics and animation set. The returned result will be a copy of this sprite,\r\n * containing copies of all of it's children.\r\n *\r\n * Properties that are re-used (i.e. not cloned) by the new copy include name,\r\n * graphics, and material. Properties that are cloned or created anew for the copy\r\n * include subSpritees, children of the sprite, and the animator.\r\n *\r\n * If you want to copy just the sprite, reusing it's graphics and material while not\r\n * cloning it's children, the simplest way is to create a new sprite manually:\r\n *\r\n * \r\n * var clone : Sprite = new Sprite(original.graphics, original.material);\r\n * \r\n */\r\n Sprite.prototype.clone = function () {\r\n var newInstance = (Sprite._sprites.length) ? Sprite._sprites.pop() : new Sprite();\r\n this.copyTo(newInstance);\r\n return newInstance;\r\n };\r\n Sprite.prototype.copyTo = function (sprite, cloneShapes) {\r\n if (cloneShapes === void 0) { cloneShapes = false; }\r\n _super.prototype.copyTo.call(this, sprite);\r\n this._graphics.copyTo(sprite.graphics, cloneShapes);\r\n };\r\n /**\r\n * //TODO\r\n *\r\n * @protected\r\n */\r\n Sprite.prototype._pUpdateBoxBounds = function () {\r\n _super.prototype._pUpdateBoxBounds.call(this);\r\n var graphicsBox = this._graphics.getBoxBounds();\r\n if (!graphicsBox.isEmpty())\r\n this._pBoxBounds.union(this._graphics.getBoxBounds(), this._pBoxBounds);\r\n };\r\n Sprite.prototype._pUpdateSphereBounds = function () {\r\n _super.prototype._pUpdateSphereBounds.call(this);\r\n var box = this.getBox();\r\n if (!this._center)\r\n this._center = new Vector3D();\r\n this._center.x = box.x + box.width / 2;\r\n this._center.y = box.y + box.height / 2;\r\n this._center.z = box.z + box.depth / 2;\r\n this._pSphereBounds = this._graphics.getSphereBounds(this._center, this._pSphereBounds);\r\n };\r\n Sprite.prototype._isEntityInternal = function () {\r\n return Boolean(this._graphics.count) || Boolean(this._children.length);\r\n };\r\n /**\r\n * //TODO\r\n *\r\n * @private\r\n */\r\n Sprite.prototype._onGraphicsInvalidate = function (event) {\r\n this._invalidateChildren();\r\n };\r\n /**\r\n *\r\n * @param renderer\r\n *\r\n * @internal\r\n */\r\n Sprite.prototype._acceptTraverser = function (traverser) {\r\n this.graphics.acceptTraverser(traverser);\r\n };\r\n Sprite.prototype._hitTestPointInternal = function (x, y, shapeFlag, masksFlag) {\r\n if (this._graphics.count) {\r\n //early out for non-shape tests\r\n if (!shapeFlag)\r\n return true;\r\n //ok do the graphics thing\r\n if (this._graphics._hitTestPointInternal(this._tempPoint.x, this._tempPoint.y))\r\n return true;\r\n }\r\n return _super.prototype._hitTestPointInternal.call(this, x, y, shapeFlag, masksFlag);\r\n };\r\n Sprite.prototype.clear = function () {\r\n _super.prototype.clear.call(this);\r\n this._graphics.clearInternal();\r\n };\r\n /**\r\n *\r\n */\r\n Sprite.prototype.bakeTransformations = function () {\r\n this._graphics.applyTransformation(this.transform.matrix3D);\r\n this.transform.clearMatrix3D();\r\n };\r\n Sprite.prototype.invalidateElements = function () {\r\n this.graphics.invalidateElements();\r\n };\r\n Sprite.prototype.invalidateMaterial = function () {\r\n this.graphics.invalidateMaterials();\r\n };\r\n return Sprite;\r\n}(DisplayObjectContainer));\r\nexport { Sprite };\r\nSprite._sprites = new Array();\r\nSprite.assetType = \"[asset Sprite]\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/display/Sprite.js","import * as tslib_1 from \"tslib\";\r\nimport { AssetBase, AbstractMethodError } from \"@awayjs/core\";\r\n/**\r\n * PrefabBase is an abstract base class for prefabs, which are prebuilt display objects that allow easy cloning and updating\r\n */\r\nvar PrefabBase = (function (_super) {\r\n tslib_1.__extends(PrefabBase, _super);\r\n //\t\tpublic _pBatchObjects:ArrayAxisAlignedBoundingBox object.\r\n */\r\n function AxisAlignedBoundingBox(entity) {\r\n var _this = _super.call(this, entity) || this;\r\n _this._x = 0;\r\n _this._y = 0;\r\n _this._z = 0;\r\n _this._width = 0;\r\n _this._height = 0;\r\n _this._depth = 0;\r\n _this._centerX = 0;\r\n _this._centerY = 0;\r\n _this._centerZ = 0;\r\n _this._halfExtentsX = 0;\r\n _this._halfExtentsY = 0;\r\n _this._halfExtentsZ = 0;\r\n return _this;\r\n }\r\n /**\r\n * @inheritDoc\r\n */\r\n AxisAlignedBoundingBox.prototype.nullify = function () {\r\n this._x = this._y = this._z = 0;\r\n this._width = this._height = this._depth = 0;\r\n this._centerX = this._centerY = this._centerZ = 0;\r\n this._halfExtentsX = this._halfExtentsY = this._halfExtentsZ = 0;\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n AxisAlignedBoundingBox.prototype.isInFrustum = function (planes, numPlanes) {\r\n if (this._pInvalidated)\r\n this._pUpdate();\r\n for (var i = 0; i < numPlanes; ++i) {\r\n var plane = planes[i];\r\n var a = plane.a;\r\n var b = plane.b;\r\n var c = plane.c;\r\n var flippedExtentX = a < 0 ? -this._halfExtentsX : this._halfExtentsX;\r\n var flippedExtentY = b < 0 ? -this._halfExtentsY : this._halfExtentsY;\r\n var flippedExtentZ = c < 0 ? -this._halfExtentsZ : this._halfExtentsZ;\r\n var projDist = a * (this._centerX + flippedExtentX) + b * (this._centerY + flippedExtentY) + c * (this._centerZ + flippedExtentZ) - plane.d;\r\n if (projDist < 0)\r\n return false;\r\n }\r\n return true;\r\n };\r\n AxisAlignedBoundingBox.prototype.rayIntersection = function (position, direction, targetNormal) {\r\n if (this._pInvalidated)\r\n this._pUpdate();\r\n return this._box.rayIntersection(position, direction, targetNormal);\r\n };\r\n AxisAlignedBoundingBox.prototype.classifyToPlane = function (plane) {\r\n var a = plane.a;\r\n var b = plane.b;\r\n var c = plane.c;\r\n var centerDistance = a * this._centerX + b * this._centerY + c * this._centerZ - plane.d;\r\n if (a < 0)\r\n a = -a;\r\n if (b < 0)\r\n b = -b;\r\n if (c < 0)\r\n c = -c;\r\n var boundOffset = a * this._halfExtentsX + b * this._halfExtentsY + c * this._halfExtentsZ;\r\n return centerDistance > boundOffset ? PlaneClassification.FRONT : centerDistance < -boundOffset ? PlaneClassification.BACK : PlaneClassification.INTERSECT;\r\n };\r\n AxisAlignedBoundingBox.prototype._pUpdate = function () {\r\n _super.prototype._pUpdate.call(this);\r\n this._box = this._entity.getBox();\r\n var matrix = this._entity.transform.concatenatedMatrix3D;\r\n var hx = this._box.width / 2;\r\n var hy = this._box.height / 2;\r\n var hz = this._box.depth / 2;\r\n var cx = this._box.x + hx;\r\n var cy = this._box.y + hy;\r\n var cz = this._box.z + hz;\r\n var raw = matrix._rawData;\r\n var m11 = raw[0], m12 = raw[4], m13 = raw[8], m14 = raw[12];\r\n var m21 = raw[1], m22 = raw[5], m23 = raw[9], m24 = raw[13];\r\n var m31 = raw[2], m32 = raw[6], m33 = raw[10], m34 = raw[14];\r\n this._centerX = cx * m11 + cy * m12 + cz * m13 + m14;\r\n this._centerY = cx * m21 + cy * m22 + cz * m23 + m24;\r\n this._centerZ = cx * m31 + cy * m32 + cz * m33 + m34;\r\n this._halfExtentsX = Math.abs(hx * m11 + hy * m12 + hz * m13);\r\n this._halfExtentsY = Math.abs(hx * m21 + hy * m22 + hz * m23);\r\n this._halfExtentsZ = Math.abs(hx * m31 + hy * m32 + hz * m33);\r\n if (this._prefab) {\r\n this._prefab.width = this._box.width;\r\n this._prefab.height = this._box.height;\r\n this._prefab.depth = this._box.depth;\r\n this._pBoundsPrimitive.transform.matrix3D = matrix;\r\n this._pBoundsPrimitive.registrationPoint = new Vector3D(-cx * this._pBoundsPrimitive.transform.scale.x, -cy * this._pBoundsPrimitive.transform.scale.y, -cz * this._pBoundsPrimitive.transform.scale.z);\r\n }\r\n this._width = this._halfExtentsX * 2;\r\n this._height = this._halfExtentsY * 2;\r\n this._depth = this._halfExtentsZ * 2;\r\n this._x = this._centerX - this._halfExtentsX;\r\n this._y = this._centerY - this._halfExtentsY;\r\n this._z = this._centerZ - this._halfExtentsZ;\r\n };\r\n AxisAlignedBoundingBox.prototype._pCreateBoundsPrimitive = function () {\r\n this._prefab = new PrimitiveCubePrefab(null, ElementsType.LINE);\r\n return this._prefab.getNewObject();\r\n };\r\n return AxisAlignedBoundingBox;\r\n}(BoundingVolumeBase));\r\nexport { AxisAlignedBoundingBox };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/bounds/AxisAlignedBoundingBox.js","import * as tslib_1 from \"tslib\";\r\nimport { AxisAlignedBoundingBox } from \"./AxisAlignedBoundingBox\";\r\n/**\r\n * AxisAlignedBoundingBox represents a bounding box volume that has its planes aligned to the local coordinate axes of the bounded object.\r\n * This is useful for most meshes.\r\n */\r\nvar AxisAlignedBoundingBox2D = (function (_super) {\r\n tslib_1.__extends(AxisAlignedBoundingBox2D, _super);\r\n /**\r\n * Creates a new AxisAlignedBoundingBox object.\r\n */\r\n function AxisAlignedBoundingBox2D(entity) {\r\n return _super.call(this, entity) || this;\r\n }\r\n AxisAlignedBoundingBox2D.prototype.rayIntersection = function (position, direction, targetNormal) {\r\n if (this._pInvalidated)\r\n this._pUpdate();\r\n var halfExtentsX = this._box.width / 2;\r\n var halfExtentsY = this._box.height / 2;\r\n var centerX = this._box.x + halfExtentsX;\r\n var centerY = this._box.y + halfExtentsY;\r\n var px = position.x - centerX;\r\n var py = position.y - centerY;\r\n var pz = position.z;\r\n var vx = direction.x;\r\n var vy = direction.y;\r\n var vz = direction.z;\r\n var ix;\r\n var iy;\r\n var intersects;\r\n var rayEntryDistance;\r\n if (!intersects && vz < 0) {\r\n rayEntryDistance = -pz / vz;\r\n if (rayEntryDistance > 0) {\r\n ix = px + rayEntryDistance * vx;\r\n iy = py + rayEntryDistance * vy;\r\n if (iy > -halfExtentsY && iy < halfExtentsY && ix > -halfExtentsX && ix < halfExtentsX) {\r\n targetNormal.x = 0;\r\n targetNormal.y = 0;\r\n targetNormal.z = 1;\r\n intersects = true;\r\n }\r\n }\r\n }\r\n if (!intersects && vz > 0) {\r\n rayEntryDistance = -pz / vz;\r\n if (rayEntryDistance > 0) {\r\n ix = px + rayEntryDistance * vx;\r\n iy = py + rayEntryDistance * vy;\r\n if (iy > -halfExtentsY && iy < halfExtentsY && ix > -halfExtentsX && ix < halfExtentsX) {\r\n targetNormal.x = 0;\r\n targetNormal.y = 0;\r\n targetNormal.z = -1;\r\n intersects = true;\r\n }\r\n }\r\n }\r\n return intersects ? rayEntryDistance : -1;\r\n };\r\n return AxisAlignedBoundingBox2D;\r\n}(AxisAlignedBoundingBox));\r\nexport { AxisAlignedBoundingBox2D };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/bounds/AxisAlignedBoundingBox2D.js","import * as tslib_1 from \"tslib\";\r\nimport { ElementsType } from \"@awayjs/graphics\";\r\nimport { PrimitivePrefabBase } from \"../prefabs/PrimitivePrefabBase\";\r\n/**\r\n * A UV Sphere primitive sprite.\r\n */\r\nvar PrimitiveSpherePrefab = (function (_super) {\r\n tslib_1.__extends(PrimitiveSpherePrefab, _super);\r\n /**\r\n * Creates a new Sphere object.\r\n *\r\n * @param radius The radius of the sphere.\r\n * @param segmentsW Defines the number of horizontal segments that make up the sphere.\r\n * @param segmentsH Defines the number of vertical segments that make up the sphere.\r\n * @param yUp Defines whether the sphere poles should lay on the Y-axis (true) or on the Z-axis (false).\r\n */\r\n function PrimitiveSpherePrefab(material, elementsType, radius, segmentsW, segmentsH, yUp) {\r\n if (material === void 0) { material = null; }\r\n if (elementsType === void 0) { elementsType = \"triangle\"; }\r\n if (radius === void 0) { radius = 50; }\r\n if (segmentsW === void 0) { segmentsW = 16; }\r\n if (segmentsH === void 0) { segmentsH = 12; }\r\n if (yUp === void 0) { yUp = true; }\r\n var _this = _super.call(this, material, elementsType) || this;\r\n _this._radius = radius;\r\n _this._segmentsW = segmentsW;\r\n _this._segmentsH = segmentsH;\r\n _this._yUp = yUp;\r\n return _this;\r\n }\r\n Object.defineProperty(PrimitiveSpherePrefab.prototype, \"radius\", {\r\n /**\r\n * The radius of the sphere.\r\n */\r\n get: function () {\r\n return this._radius;\r\n },\r\n set: function (value) {\r\n this._radius = value;\r\n this._pInvalidatePrimitive();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(PrimitiveSpherePrefab.prototype, \"segmentsW\", {\r\n /**\r\n * Defines the number of horizontal segments that make up the sphere. Defaults to 16.\r\n */\r\n get: function () {\r\n return this._segmentsW;\r\n },\r\n set: function (value) {\r\n this._segmentsW = value;\r\n this._pInvalidatePrimitive();\r\n this._pInvalidateUVs();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(PrimitiveSpherePrefab.prototype, \"segmentsH\", {\r\n /**\r\n * Defines the number of vertical segments that make up the sphere. Defaults to 12.\r\n */\r\n get: function () {\r\n return this._segmentsH;\r\n },\r\n set: function (value) {\r\n this._segmentsH = value;\r\n this._pInvalidatePrimitive();\r\n this._pInvalidateUVs();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(PrimitiveSpherePrefab.prototype, \"yUp\", {\r\n /**\r\n * Defines whether the sphere poles should lay on the Y-axis (true) or on the Z-axis (false).\r\n */\r\n get: function () {\r\n return this._yUp;\r\n },\r\n set: function (value) {\r\n this._yUp = value;\r\n this._pInvalidatePrimitive();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * @inheritDoc\r\n */\r\n PrimitiveSpherePrefab.prototype._pBuildGraphics = function (target, elementsType) {\r\n var indices;\r\n var positions;\r\n var normals;\r\n var tangents;\r\n var stride;\r\n var i;\r\n var j;\r\n var vidx, fidx; // indices\r\n var comp1;\r\n var comp2;\r\n var numVertices;\r\n if (elementsType == ElementsType.TRIANGLE) {\r\n var triangleGraphics = target;\r\n numVertices = (this._segmentsH + 1) * (this._segmentsW + 1);\r\n if (numVertices == triangleGraphics.numVertices && triangleGraphics.indices != null) {\r\n triangleGraphics.invalidateIndices();\r\n triangleGraphics.invalidateVertices(triangleGraphics.positions);\r\n triangleGraphics.invalidateVertices(triangleGraphics.normals);\r\n triangleGraphics.invalidateVertices(triangleGraphics.tangents);\r\n }\r\n else {\r\n triangleGraphics.setIndices(new Uint16Array((this._segmentsH - 1) * this._segmentsW * 6));\r\n triangleGraphics.setPositions(new Float32Array(numVertices * 3));\r\n triangleGraphics.setNormals(new Float32Array(numVertices * 3));\r\n triangleGraphics.setTangents(new Float32Array(numVertices * 3));\r\n this._pInvalidateUVs();\r\n }\r\n indices = triangleGraphics.indices.get(triangleGraphics.numElements);\r\n positions = triangleGraphics.positions.get(numVertices);\r\n normals = triangleGraphics.normals.get(numVertices);\r\n tangents = triangleGraphics.tangents.get(numVertices);\r\n stride = triangleGraphics.concatenatedBuffer.stride / 4;\r\n vidx = 0;\r\n fidx = 0;\r\n var startIndex;\r\n var t1;\r\n var t2;\r\n for (j = 0; j <= this._segmentsH; ++j) {\r\n startIndex = vidx;\r\n var horangle = Math.PI * j / this._segmentsH;\r\n var z = -this._radius * Math.cos(horangle);\r\n var ringradius = this._radius * Math.sin(horangle);\r\n for (i = 0; i <= this._segmentsW; ++i) {\r\n var verangle = 2 * Math.PI * i / this._segmentsW;\r\n var x = ringradius * Math.cos(verangle);\r\n var y = ringradius * Math.sin(verangle);\r\n var normLen = 1 / Math.sqrt(x * x + y * y + z * z);\r\n var tanLen = Math.sqrt(y * y + x * x);\r\n if (this._yUp) {\r\n t1 = 0;\r\n t2 = tanLen > .007 ? x / tanLen : 0;\r\n comp1 = -z;\r\n comp2 = y;\r\n }\r\n else {\r\n t1 = tanLen > .007 ? x / tanLen : 0;\r\n t2 = 0;\r\n comp1 = y;\r\n comp2 = z;\r\n }\r\n if (i == this._segmentsW) {\r\n positions[vidx] = positions[startIndex];\r\n positions[vidx + 1] = positions[startIndex + 1];\r\n positions[vidx + 2] = positions[startIndex + 2];\r\n normals[vidx] = normals[startIndex] + (x * normLen) * .5;\r\n normals[vidx + 1] = normals[startIndex + 1] + (comp1 * normLen) * .5;\r\n normals[vidx + 2] = normals[startIndex + 2] + (comp2 * normLen) * .5;\r\n tangents[vidx] = tanLen > .007 ? -y / tanLen : 1;\r\n tangents[vidx + 1] = t1;\r\n tangents[vidx + 2] = t2;\r\n }\r\n else {\r\n positions[vidx] = x;\r\n positions[vidx + 1] = comp1;\r\n positions[vidx + 2] = comp2;\r\n normals[vidx] = x * normLen;\r\n normals[vidx + 1] = comp1 * normLen;\r\n normals[vidx + 2] = comp2 * normLen;\r\n tangents[vidx] = tanLen > .007 ? -y / tanLen : 1;\r\n tangents[vidx + 1] = t1;\r\n tangents[vidx + 2] = t2;\r\n }\r\n if (i > 0 && j > 0) {\r\n var a = (this._segmentsW + 1) * j + i;\r\n var b = (this._segmentsW + 1) * j + i - 1;\r\n var c = (this._segmentsW + 1) * (j - 1) + i - 1;\r\n var d = (this._segmentsW + 1) * (j - 1) + i;\r\n if (j == this._segmentsH) {\r\n positions[vidx] = positions[startIndex];\r\n positions[vidx + 1] = positions[startIndex + 1];\r\n positions[vidx + 2] = positions[startIndex + 2];\r\n indices[fidx++] = a;\r\n indices[fidx++] = c;\r\n indices[fidx++] = d;\r\n }\r\n else if (j == 1) {\r\n indices[fidx++] = a;\r\n indices[fidx++] = b;\r\n indices[fidx++] = c;\r\n }\r\n else {\r\n indices[fidx++] = a;\r\n indices[fidx++] = b;\r\n indices[fidx++] = c;\r\n indices[fidx++] = a;\r\n indices[fidx++] = c;\r\n indices[fidx++] = d;\r\n }\r\n }\r\n vidx += stride;\r\n }\r\n }\r\n }\r\n else if (elementsType == ElementsType.LINE) {\r\n var lineGraphics = target;\r\n var numSegments = this._segmentsH * this._segmentsW * 2 + this._segmentsW;\r\n var positions = new Float32Array(numSegments * 6);\r\n var thickness = new Float32Array(numSegments);\r\n vidx = 0;\r\n fidx = 0;\r\n for (j = 0; j <= this._segmentsH; ++j) {\r\n var horangle = Math.PI * j / this._segmentsH;\r\n var z = -this._radius * Math.cos(horangle);\r\n var ringradius = this._radius * Math.sin(horangle);\r\n for (i = 0; i <= this._segmentsW; ++i) {\r\n var verangle = 2 * Math.PI * i / this._segmentsW;\r\n var x = ringradius * Math.cos(verangle);\r\n var y = ringradius * Math.sin(verangle);\r\n if (this._yUp) {\r\n comp1 = -z;\r\n comp2 = y;\r\n }\r\n else {\r\n comp1 = y;\r\n comp2 = z;\r\n }\r\n if (i > 0) {\r\n //horizonal lines\r\n positions[vidx++] = x;\r\n positions[vidx++] = comp1;\r\n positions[vidx++] = comp2;\r\n thickness[fidx++] = 1;\r\n //vertical lines\r\n if (j > 0) {\r\n var addx = (j == 1) ? 3 - (6 * (this._segmentsW - i) + 12 * i) : 3 - this._segmentsW * 12;\r\n positions[vidx] = positions[vidx++ + addx];\r\n positions[vidx] = positions[vidx++ + addx];\r\n positions[vidx] = positions[vidx++ + addx];\r\n positions[vidx++] = x;\r\n positions[vidx++] = comp1;\r\n positions[vidx++] = comp2;\r\n thickness[fidx++] = 1;\r\n }\r\n }\r\n //horizonal lines\r\n if (i < this._segmentsW) {\r\n positions[vidx++] = x;\r\n positions[vidx++] = comp1;\r\n positions[vidx++] = comp2;\r\n }\r\n }\r\n }\r\n // build real data from raw data\r\n lineGraphics.setPositions(positions);\r\n lineGraphics.setThickness(thickness);\r\n }\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n PrimitiveSpherePrefab.prototype._pBuildUVs = function (target, elementsType) {\r\n var i, j;\r\n var numVertices = (this._segmentsH + 1) * (this._segmentsW + 1);\r\n var uvs;\r\n var stride;\r\n if (elementsType == ElementsType.TRIANGLE) {\r\n numVertices = (this._segmentsH + 1) * (this._segmentsW + 1);\r\n var triangleGraphics = target;\r\n if (triangleGraphics.uvs && numVertices == triangleGraphics.numVertices) {\r\n triangleGraphics.invalidateVertices(triangleGraphics.uvs);\r\n }\r\n else {\r\n triangleGraphics.setUVs(new Float32Array(numVertices * 2));\r\n }\r\n uvs = triangleGraphics.uvs.get(numVertices);\r\n stride = triangleGraphics.uvs.stride;\r\n var index = 0;\r\n for (j = 0; j <= this._segmentsH; ++j) {\r\n for (i = 0; i <= this._segmentsW; ++i) {\r\n uvs[index] = (i / this._segmentsW) * this._scaleU;\r\n uvs[index + 1] = (j / this._segmentsH) * this._scaleV;\r\n index += stride;\r\n }\r\n }\r\n }\r\n else if (elementsType == ElementsType.LINE) {\r\n }\r\n };\r\n return PrimitiveSpherePrefab;\r\n}(PrimitivePrefabBase));\r\nexport { PrimitiveSpherePrefab };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/prefabs/PrimitiveSpherePrefab.js","import * as tslib_1 from \"tslib\";\r\nimport { PlaneClassification } from \"@awayjs/core\";\r\nimport { ElementsType } from \"@awayjs/graphics\";\r\nimport { PrimitiveSpherePrefab } from \"../prefabs/PrimitiveSpherePrefab\";\r\nimport { BoundingVolumeBase } from \"./BoundingVolumeBase\";\r\nvar BoundingSphere = (function (_super) {\r\n tslib_1.__extends(BoundingSphere, _super);\r\n function BoundingSphere(entity) {\r\n var _this = _super.call(this, entity) || this;\r\n _this._radius = 0;\r\n _this._centerX = 0;\r\n _this._centerY = 0;\r\n _this._centerZ = 0;\r\n return _this;\r\n }\r\n BoundingSphere.prototype.nullify = function () {\r\n this._centerX = this._centerY = this._centerZ = 0;\r\n this._radius = 0;\r\n };\r\n BoundingSphere.prototype.isInFrustum = function (planes, numPlanes) {\r\n if (this._pInvalidated)\r\n this._pUpdate();\r\n for (var i = 0; i < numPlanes; ++i) {\r\n var plane = planes[i];\r\n var flippedExtentX = plane.a < 0 ? -this._radius : this._radius;\r\n var flippedExtentY = plane.b < 0 ? -this._radius : this._radius;\r\n var flippedExtentZ = plane.c < 0 ? -this._radius : this._radius;\r\n var projDist = plane.a * (this._centerX + flippedExtentX) + plane.b * (this._centerY + flippedExtentY) + plane.c * (this._centerZ + flippedExtentZ) - plane.d;\r\n if (projDist < 0) {\r\n return false;\r\n }\r\n }\r\n return true;\r\n };\r\n BoundingSphere.prototype.rayIntersection = function (position, direction, targetNormal) {\r\n if (this._pInvalidated)\r\n this._pUpdate();\r\n return this._sphere.rayIntersection(position, direction, targetNormal);\r\n };\r\n //@override\r\n BoundingSphere.prototype.classifyToPlane = function (plane) {\r\n var a = plane.a;\r\n var b = plane.b;\r\n var c = plane.c;\r\n var dd = a * this._centerX + b * this._centerY + c * this._centerZ - plane.d;\r\n if (a < 0)\r\n a = -a;\r\n if (b < 0)\r\n b = -b;\r\n if (c < 0)\r\n c = -c;\r\n var rr = (a + b + c) * this._radius;\r\n return dd > rr ? PlaneClassification.FRONT : dd < -rr ? PlaneClassification.BACK : PlaneClassification.INTERSECT;\r\n };\r\n BoundingSphere.prototype._pUpdate = function () {\r\n _super.prototype._pUpdate.call(this);\r\n this._sphere = this._entity.getSphere();\r\n var matrix = this._entity.transform.concatenatedMatrix3D;\r\n var cx = this._sphere.x;\r\n var cy = this._sphere.y;\r\n var cz = this._sphere.z;\r\n var r = this._sphere.radius;\r\n var raw = matrix._rawData;\r\n var m11 = raw[0], m12 = raw[4], m13 = raw[8], m14 = raw[12];\r\n var m21 = raw[1], m22 = raw[5], m23 = raw[9], m24 = raw[13];\r\n var m31 = raw[2], m32 = raw[6], m33 = raw[10], m34 = raw[14];\r\n this._centerX = cx * m11 + cy * m12 + cz * m13 + m14;\r\n this._centerY = cx * m21 + cy * m22 + cz * m23 + m24;\r\n this._centerZ = cx * m31 + cy * m32 + cz * m33 + m34;\r\n var rx = m11 + m12 + m13;\r\n var ry = m21 + m22 + m23;\r\n var rz = m31 + m32 + m33;\r\n this._radius = r * Math.sqrt((rx * rx + ry * ry + rz * rz) / 3);\r\n if (this._prefab) {\r\n this._prefab.radius = r;\r\n this._pBoundsPrimitive.x = cx;\r\n this._pBoundsPrimitive.y = cy;\r\n this._pBoundsPrimitive.z = cz;\r\n this._pBoundsPrimitive.transform.matrix3D = matrix;\r\n }\r\n };\r\n BoundingSphere.prototype._pCreateBoundsPrimitive = function () {\r\n this._prefab = new PrimitiveSpherePrefab(null, ElementsType.LINE);\r\n return this._prefab.getNewObject();\r\n };\r\n return BoundingSphere;\r\n}(BoundingVolumeBase));\r\nexport { BoundingSphere };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/bounds/BoundingSphere.js","import * as tslib_1 from \"tslib\";\r\nimport { PlaneClassification } from \"@awayjs/core\";\r\nimport { BoundingVolumeBase } from \"../bounds/BoundingVolumeBase\";\r\nvar NullBounds = (function (_super) {\r\n tslib_1.__extends(NullBounds, _super);\r\n function NullBounds(alwaysIn) {\r\n if (alwaysIn === void 0) { alwaysIn = true; }\r\n var _this = _super.call(this, null) || this;\r\n _this._alwaysIn = alwaysIn;\r\n return _this;\r\n }\r\n //@override\r\n NullBounds.prototype.clone = function () {\r\n return new NullBounds(this._alwaysIn);\r\n };\r\n //@override\r\n NullBounds.prototype.isInFrustum = function (planes, numPlanes) {\r\n return this._alwaysIn;\r\n };\r\n NullBounds.prototype.classifyToPlane = function (plane) {\r\n return PlaneClassification.INTERSECT;\r\n };\r\n return NullBounds;\r\n}(BoundingVolumeBase));\r\nexport { NullBounds };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/bounds/NullBounds.js","import { AbstractMethodError } from \"@awayjs/core\";\r\nvar ControllerBase = (function () {\r\n function ControllerBase(targetObject) {\r\n if (targetObject === void 0) { targetObject = null; }\r\n this._pAutoUpdate = true;\r\n this.targetObject = targetObject;\r\n }\r\n ControllerBase.prototype.pNotifyUpdate = function () {\r\n if (this._pTargetObject)\r\n this._pTargetObject.invalidatePartitionBounds();\r\n };\r\n Object.defineProperty(ControllerBase.prototype, \"targetObject\", {\r\n get: function () {\r\n return this._pTargetObject;\r\n },\r\n set: function (val) {\r\n if (this._pTargetObject == val)\r\n return;\r\n if (this._pTargetObject && this._pAutoUpdate)\r\n this._pTargetObject._iController = null;\r\n this._pTargetObject = val;\r\n if (this._pTargetObject && this._pAutoUpdate)\r\n this._pTargetObject._iController = this;\r\n this.pNotifyUpdate();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(ControllerBase.prototype, \"autoUpdate\", {\r\n get: function () {\r\n return this._pAutoUpdate;\r\n },\r\n set: function (val) {\r\n if (this._pAutoUpdate == val)\r\n return;\r\n this._pAutoUpdate = val;\r\n if (this._pTargetObject) {\r\n if (this._pAutoUpdate)\r\n this._pTargetObject._iController = this;\r\n else\r\n this._pTargetObject._iController = null;\r\n }\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n ControllerBase.prototype.update = function (interpolate) {\r\n if (interpolate === void 0) { interpolate = true; }\r\n throw new AbstractMethodError();\r\n };\r\n ControllerBase.prototype.updateController = function () {\r\n if (this._pControllerDirty && this._pAutoUpdate) {\r\n this._pControllerDirty = false;\r\n this.pNotifyUpdate();\r\n }\r\n };\r\n return ControllerBase;\r\n}());\r\nexport { ControllerBase };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/controllers/ControllerBase.js","import * as tslib_1 from \"tslib\";\r\nimport { MathConsts } from \"@awayjs/core\";\r\nimport { ControllerBase } from \"../controllers/ControllerBase\";\r\n/**\r\n * Extended camera used to hover round a specified target object.\r\n *\r\n * @see away3d.containers.View3D\r\n */\r\nvar FirstPersonController = (function (_super) {\r\n tslib_1.__extends(FirstPersonController, _super);\r\n /**\r\n * Creates a new HoverController object.\r\n */\r\n function FirstPersonController(targetObject, panAngle, tiltAngle, minTiltAngle, maxTiltAngle, steps, wrapPanAngle) {\r\n if (targetObject === void 0) { targetObject = null; }\r\n if (panAngle === void 0) { panAngle = 0; }\r\n if (tiltAngle === void 0) { tiltAngle = 90; }\r\n if (minTiltAngle === void 0) { minTiltAngle = -90; }\r\n if (maxTiltAngle === void 0) { maxTiltAngle = 90; }\r\n if (steps === void 0) { steps = 8; }\r\n if (wrapPanAngle === void 0) { wrapPanAngle = false; }\r\n var _this = _super.call(this, targetObject) || this;\r\n _this._iCurrentPanAngle = 0;\r\n _this._iCurrentTiltAngle = 90;\r\n _this._panAngle = 0;\r\n _this._tiltAngle = 90;\r\n _this._minTiltAngle = -90;\r\n _this._maxTiltAngle = 90;\r\n _this._steps = 8;\r\n _this._walkIncrement = 0;\r\n _this._strafeIncrement = 0;\r\n _this._wrapPanAngle = false;\r\n _this.fly = false;\r\n _this.panAngle = panAngle;\r\n _this.tiltAngle = tiltAngle;\r\n _this.minTiltAngle = minTiltAngle;\r\n _this.maxTiltAngle = maxTiltAngle;\r\n _this.steps = steps;\r\n _this.wrapPanAngle = wrapPanAngle;\r\n //values passed in contrustor are applied immediately\r\n _this._iCurrentPanAngle = _this._panAngle;\r\n _this._iCurrentTiltAngle = _this._tiltAngle;\r\n return _this;\r\n }\r\n Object.defineProperty(FirstPersonController.prototype, \"steps\", {\r\n /**\r\n * Fractional step taken each time the hover() method is called. Defaults to 8.\r\n *\r\n * Affects the speed at which the tiltAngle and panAngle resolve to their targets.\r\n *\r\n * @see #tiltAngle\r\n * @see #panAngle\r\n */\r\n get: function () {\r\n return this._steps;\r\n },\r\n set: function (val) {\r\n val = (val < 1) ? 1 : val;\r\n if (this._steps == val)\r\n return;\r\n this._steps = val;\r\n this.pNotifyUpdate();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(FirstPersonController.prototype, \"panAngle\", {\r\n /**\r\n * Rotation of the camera in degrees around the y axis. Defaults to 0.\r\n */\r\n get: function () {\r\n return this._panAngle;\r\n },\r\n set: function (val) {\r\n if (this._panAngle == val)\r\n return;\r\n this._panAngle = val;\r\n this.pNotifyUpdate();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(FirstPersonController.prototype, \"tiltAngle\", {\r\n /**\r\n * Elevation angle of the camera in degrees. Defaults to 90.\r\n */\r\n get: function () {\r\n return this._tiltAngle;\r\n },\r\n set: function (val) {\r\n val = Math.max(this._minTiltAngle, Math.min(this._maxTiltAngle, val));\r\n if (this._tiltAngle == val)\r\n return;\r\n this._tiltAngle = val;\r\n this.pNotifyUpdate();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(FirstPersonController.prototype, \"minTiltAngle\", {\r\n /**\r\n * Minimum bounds for the tiltAngle. Defaults to -90.\r\n *\r\n * @see #tiltAngle\r\n */\r\n get: function () {\r\n return this._minTiltAngle;\r\n },\r\n set: function (val) {\r\n if (this._minTiltAngle == val)\r\n return;\r\n this._minTiltAngle = val;\r\n this.tiltAngle = Math.max(this._minTiltAngle, Math.min(this._maxTiltAngle, this._tiltAngle));\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(FirstPersonController.prototype, \"maxTiltAngle\", {\r\n /**\r\n * Maximum bounds for the tiltAngle. Defaults to 90.\r\n *\r\n * @see #tiltAngle\r\n */\r\n get: function () {\r\n return this._maxTiltAngle;\r\n },\r\n set: function (val) {\r\n if (this._maxTiltAngle == val)\r\n return;\r\n this._maxTiltAngle = val;\r\n this.tiltAngle = Math.max(this._minTiltAngle, Math.min(this._maxTiltAngle, this._tiltAngle));\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(FirstPersonController.prototype, \"wrapPanAngle\", {\r\n /**\r\n * Defines whether the value of the pan angle wraps when over 360 degrees or under 0 degrees. Defaults to false.\r\n */\r\n get: function () {\r\n return this._wrapPanAngle;\r\n },\r\n set: function (val) {\r\n if (this._wrapPanAngle == val)\r\n return;\r\n this._wrapPanAngle = val;\r\n this.pNotifyUpdate();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * Updates the current tilt angle and pan angle values.\r\n *\r\n * Values are calculated using the defined tiltAngle, panAngle and steps variables.\r\n *\r\n * @param interpolate If the update to a target pan- or tiltAngle is interpolated. Default is true.\r\n *\r\n * @see #tiltAngle\r\n * @see #panAngle\r\n * @see #steps\r\n */\r\n FirstPersonController.prototype.update = function (interpolate) {\r\n if (interpolate === void 0) { interpolate = true; }\r\n if (this._tiltAngle != this._iCurrentTiltAngle || this._panAngle != this._iCurrentPanAngle) {\r\n this._pControllerDirty = true;\r\n if (this._wrapPanAngle) {\r\n if (this._panAngle < 0) {\r\n this._iCurrentPanAngle += this._panAngle % 360 + 360 - this._panAngle;\r\n this._panAngle = this._panAngle % 360 + 360;\r\n }\r\n else {\r\n this._iCurrentPanAngle += this._panAngle % 360 - this._panAngle;\r\n this._panAngle = this._panAngle % 360;\r\n }\r\n while (this._panAngle - this._iCurrentPanAngle < -180)\r\n this._iCurrentPanAngle -= 360;\r\n while (this._panAngle - this._iCurrentPanAngle > 180)\r\n this._iCurrentPanAngle += 360;\r\n }\r\n if (interpolate) {\r\n this._iCurrentTiltAngle += (this._tiltAngle - this._iCurrentTiltAngle) / (this.steps + 1);\r\n this._iCurrentPanAngle += (this._panAngle - this._iCurrentPanAngle) / (this.steps + 1);\r\n }\r\n else {\r\n this._iCurrentTiltAngle = this._tiltAngle;\r\n this._iCurrentPanAngle = this._panAngle;\r\n }\r\n //snap coords if angle differences are close\r\n if ((Math.abs(this.tiltAngle - this._iCurrentTiltAngle) < 0.01) && (Math.abs(this._panAngle - this._iCurrentPanAngle) < 0.01)) {\r\n this._iCurrentTiltAngle = this._tiltAngle;\r\n this._iCurrentPanAngle = this._panAngle;\r\n }\r\n }\r\n this.targetObject.rotationX = this._iCurrentTiltAngle;\r\n this.targetObject.rotationY = this._iCurrentPanAngle;\r\n if (this._walkIncrement) {\r\n if (this.fly) {\r\n this.targetObject.transform.moveForward(this._walkIncrement);\r\n }\r\n else {\r\n this.targetObject.x += this._walkIncrement * Math.sin(this._panAngle * MathConsts.DEGREES_TO_RADIANS);\r\n this.targetObject.z += this._walkIncrement * Math.cos(this._panAngle * MathConsts.DEGREES_TO_RADIANS);\r\n }\r\n this._walkIncrement = 0;\r\n }\r\n if (this._strafeIncrement) {\r\n this.targetObject.transform.moveRight(this._strafeIncrement);\r\n this._strafeIncrement = 0;\r\n }\r\n };\r\n FirstPersonController.prototype.incrementWalk = function (val) {\r\n if (val == 0)\r\n return;\r\n this._walkIncrement += val;\r\n this.pNotifyUpdate();\r\n };\r\n FirstPersonController.prototype.incrementStrafe = function (val) {\r\n if (val == 0)\r\n return;\r\n this._strafeIncrement += val;\r\n this.pNotifyUpdate();\r\n };\r\n return FirstPersonController;\r\n}(ControllerBase));\r\nexport { FirstPersonController };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/controllers/FirstPersonController.js","import * as tslib_1 from \"tslib\";\r\nimport { Vector3D } from \"@awayjs/core\";\r\nimport { ControllerBase } from \"../controllers/ControllerBase\";\r\nimport { DisplayObjectEvent } from \"../events/DisplayObjectEvent\";\r\nvar LookAtController = (function (_super) {\r\n tslib_1.__extends(LookAtController, _super);\r\n function LookAtController(targetObject, lookAtObject) {\r\n if (targetObject === void 0) { targetObject = null; }\r\n if (lookAtObject === void 0) { lookAtObject = null; }\r\n var _this = _super.call(this, targetObject) || this;\r\n _this._pOrigin = new Vector3D(0.0, 0.0, 0.0);\r\n _this._onLookAtObjectChangedDelegate = function (event) { return _this.onLookAtObjectChanged(event); };\r\n if (lookAtObject)\r\n _this.lookAtObject = lookAtObject;\r\n else\r\n _this.lookAtPosition = new Vector3D();\r\n return _this;\r\n }\r\n Object.defineProperty(LookAtController.prototype, \"lookAtPosition\", {\r\n get: function () {\r\n return this._pLookAtPosition;\r\n },\r\n set: function (val) {\r\n if (this._pLookAtObject) {\r\n this._pLookAtObject.removeEventListener(DisplayObjectEvent.SCENETRANSFORM_CHANGED, this._onLookAtObjectChangedDelegate);\r\n this._pLookAtObject = null;\r\n }\r\n this._pLookAtPosition = val;\r\n this.pNotifyUpdate();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(LookAtController.prototype, \"lookAtObject\", {\r\n get: function () {\r\n return this._pLookAtObject;\r\n },\r\n set: function (val) {\r\n if (this._pLookAtPosition)\r\n this._pLookAtPosition = null;\r\n if (this._pLookAtObject == val)\r\n return;\r\n if (this._pLookAtObject)\r\n this._pLookAtObject.removeEventListener(DisplayObjectEvent.SCENETRANSFORM_CHANGED, this._onLookAtObjectChangedDelegate);\r\n this._pLookAtObject = val;\r\n if (this._pLookAtObject)\r\n this._pLookAtObject.addEventListener(DisplayObjectEvent.SCENETRANSFORM_CHANGED, this._onLookAtObjectChangedDelegate);\r\n this.pNotifyUpdate();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n //@override\r\n LookAtController.prototype.update = function (interpolate) {\r\n if (interpolate === void 0) { interpolate = true; }\r\n if (this._pTargetObject) {\r\n if (this._pLookAtPosition)\r\n this._pTargetObject.lookAt(this._pLookAtPosition);\r\n else if (this._pLookAtObject)\r\n this._pTargetObject.lookAt(this._pLookAtObject.scene ? this._pLookAtObject.scenePosition : this._pLookAtObject.transform.position);\r\n }\r\n };\r\n LookAtController.prototype.onLookAtObjectChanged = function (event) {\r\n this.pNotifyUpdate();\r\n };\r\n return LookAtController;\r\n}(ControllerBase));\r\nexport { LookAtController };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/controllers/LookAtController.js","import * as tslib_1 from \"tslib\";\r\nimport { MathConsts, Vector3D } from \"@awayjs/core\";\r\nimport { LookAtController } from \"../controllers/LookAtController\";\r\n/**\r\n * Extended camera used to hover round a specified target object.\r\n *\r\n * @see away.containers.View\r\n */\r\nvar HoverController = (function (_super) {\r\n tslib_1.__extends(HoverController, _super);\r\n /**\r\n * Creates a new HoverController object.\r\n */\r\n function HoverController(targetObject, lookAtObject, panAngle, tiltAngle, distance, minTiltAngle, maxTiltAngle, minPanAngle, maxPanAngle, steps, yFactor, wrapPanAngle) {\r\n if (targetObject === void 0) { targetObject = null; }\r\n if (lookAtObject === void 0) { lookAtObject = null; }\r\n if (panAngle === void 0) { panAngle = 0; }\r\n if (tiltAngle === void 0) { tiltAngle = 90; }\r\n if (distance === void 0) { distance = 1000; }\r\n if (minTiltAngle === void 0) { minTiltAngle = -90; }\r\n if (maxTiltAngle === void 0) { maxTiltAngle = 90; }\r\n if (minPanAngle === void 0) { minPanAngle = null; }\r\n if (maxPanAngle === void 0) { maxPanAngle = null; }\r\n if (steps === void 0) { steps = 8; }\r\n if (yFactor === void 0) { yFactor = 2; }\r\n if (wrapPanAngle === void 0) { wrapPanAngle = false; }\r\n var _this = _super.call(this, targetObject, lookAtObject) || this;\r\n _this._iCurrentPanAngle = 0;\r\n _this._iCurrentTiltAngle = 90;\r\n _this._panAngle = 0;\r\n _this._tiltAngle = 90;\r\n _this._distance = 1000;\r\n _this._minPanAngle = -Infinity;\r\n _this._maxPanAngle = Infinity;\r\n _this._minTiltAngle = -90;\r\n _this._maxTiltAngle = 90;\r\n _this._steps = 8;\r\n _this._yFactor = 2;\r\n _this._wrapPanAngle = false;\r\n _this._upAxis = new Vector3D();\r\n _this.distance = distance;\r\n _this.panAngle = panAngle;\r\n _this.tiltAngle = tiltAngle;\r\n _this.minPanAngle = (minPanAngle != null) ? minPanAngle : -Infinity;\r\n _this.maxPanAngle = (maxPanAngle != null) ? maxPanAngle : Infinity;\r\n _this.minTiltAngle = minTiltAngle;\r\n _this.maxTiltAngle = maxTiltAngle;\r\n _this.steps = steps;\r\n _this.yFactor = yFactor;\r\n _this.wrapPanAngle = wrapPanAngle;\r\n //values passed in contrustor are applied immediately\r\n _this._iCurrentPanAngle = _this._panAngle;\r\n _this._iCurrentTiltAngle = _this._tiltAngle;\r\n return _this;\r\n }\r\n Object.defineProperty(HoverController.prototype, \"steps\", {\r\n /**\r\n * Fractional step taken each time the hover() method is called. Defaults to 8.\r\n *\r\n * Affects the speed at which the tiltAngle and panAngle resolve to their targets.\r\n *\r\n * @see #tiltAngle\r\n * @see #panAngle\r\n */\r\n get: function () {\r\n return this._steps;\r\n },\r\n set: function (val) {\r\n val = (val < 1) ? 1 : val;\r\n if (this._steps == val)\r\n return;\r\n this._steps = val;\r\n this.pNotifyUpdate();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(HoverController.prototype, \"panAngle\", {\r\n /**\r\n * Rotation of the camera in degrees around the y axis. Defaults to 0.\r\n */\r\n get: function () {\r\n return this._panAngle;\r\n },\r\n set: function (val) {\r\n val = Math.max(this._minPanAngle, Math.min(this._maxPanAngle, val));\r\n if (this._panAngle == val)\r\n return;\r\n this._panAngle = val;\r\n this.pNotifyUpdate();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(HoverController.prototype, \"tiltAngle\", {\r\n /**\r\n * Elevation angle of the camera in degrees. Defaults to 90.\r\n */\r\n get: function () {\r\n return this._tiltAngle;\r\n },\r\n set: function (val) {\r\n val = Math.max(this._minTiltAngle, Math.min(this._maxTiltAngle, val));\r\n if (this._tiltAngle == val)\r\n return;\r\n this._tiltAngle = val;\r\n this.pNotifyUpdate();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(HoverController.prototype, \"distance\", {\r\n /**\r\n * Distance between the camera and the specified target. Defaults to 1000.\r\n */\r\n get: function () {\r\n return this._distance;\r\n },\r\n set: function (val) {\r\n if (this._distance == val)\r\n return;\r\n this._distance = val;\r\n this.pNotifyUpdate();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(HoverController.prototype, \"minPanAngle\", {\r\n /**\r\n * Minimum bounds for the panAngle. Defaults to -Infinity.\r\n *\r\n * @see #panAngle\r\n */\r\n get: function () {\r\n return this._minPanAngle;\r\n },\r\n set: function (val) {\r\n if (this._minPanAngle == val)\r\n return;\r\n this._minPanAngle = val;\r\n this.panAngle = Math.max(this._minPanAngle, Math.min(this._maxPanAngle, this._panAngle));\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(HoverController.prototype, \"maxPanAngle\", {\r\n /**\r\n * Maximum bounds for the panAngle. Defaults to Infinity.\r\n *\r\n * @see #panAngle\r\n */\r\n get: function () {\r\n return this._maxPanAngle;\r\n },\r\n set: function (val) {\r\n if (this._maxPanAngle == val)\r\n return;\r\n this._maxPanAngle = val;\r\n this.panAngle = Math.max(this._minPanAngle, Math.min(this._maxPanAngle, this._panAngle));\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(HoverController.prototype, \"minTiltAngle\", {\r\n /**\r\n * Minimum bounds for the tiltAngle. Defaults to -90.\r\n *\r\n * @see #tiltAngle\r\n */\r\n get: function () {\r\n return this._minTiltAngle;\r\n },\r\n set: function (val) {\r\n if (this._minTiltAngle == val)\r\n return;\r\n this._minTiltAngle = val;\r\n this.tiltAngle = Math.max(this._minTiltAngle, Math.min(this._maxTiltAngle, this._tiltAngle));\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(HoverController.prototype, \"maxTiltAngle\", {\r\n /**\r\n * Maximum bounds for the tiltAngle. Defaults to 90.\r\n *\r\n * @see #tiltAngle\r\n */\r\n get: function () {\r\n return this._maxTiltAngle;\r\n },\r\n set: function (val) {\r\n if (this._maxTiltAngle == val)\r\n return;\r\n this._maxTiltAngle = val;\r\n this.tiltAngle = Math.max(this._minTiltAngle, Math.min(this._maxTiltAngle, this._tiltAngle));\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(HoverController.prototype, \"yFactor\", {\r\n /**\r\n * Fractional difference in distance between the horizontal camera orientation and vertical camera orientation. Defaults to 2.\r\n *\r\n * @see #distance\r\n */\r\n get: function () {\r\n return this._yFactor;\r\n },\r\n set: function (val) {\r\n if (this._yFactor == val)\r\n return;\r\n this._yFactor = val;\r\n this.pNotifyUpdate();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(HoverController.prototype, \"wrapPanAngle\", {\r\n /**\r\n * Defines whether the value of the pan angle wraps when over 360 degrees or under 0 degrees. Defaults to false.\r\n */\r\n get: function () {\r\n return this._wrapPanAngle;\r\n },\r\n set: function (val) {\r\n if (this._wrapPanAngle == val)\r\n return;\r\n this._wrapPanAngle = val;\r\n this.pNotifyUpdate();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * Updates the current tilt angle and pan angle values.\r\n *\r\n * Values are calculated using the defined tiltAngle, panAngle and steps variables.\r\n *\r\n * @param interpolate If the update to a target pan- or tiltAngle is interpolated. Default is true.\r\n *\r\n * @see #tiltAngle\r\n * @see #panAngle\r\n * @see #steps\r\n */\r\n HoverController.prototype.update = function (interpolate) {\r\n if (interpolate === void 0) { interpolate = true; }\r\n if (this._tiltAngle != this._iCurrentTiltAngle || this._panAngle != this._iCurrentPanAngle) {\r\n this._pControllerDirty = true;\r\n if (this._wrapPanAngle) {\r\n if (this._panAngle < 0) {\r\n this._iCurrentPanAngle += this._panAngle % 360 + 360 - this._panAngle;\r\n this._panAngle = this._panAngle % 360 + 360;\r\n }\r\n else {\r\n this._iCurrentPanAngle += this._panAngle % 360 - this._panAngle;\r\n this._panAngle = this._panAngle % 360;\r\n }\r\n while (this._panAngle - this._iCurrentPanAngle < -180)\r\n this._iCurrentPanAngle -= 360;\r\n while (this._panAngle - this._iCurrentPanAngle > 180)\r\n this._iCurrentPanAngle += 360;\r\n }\r\n if (interpolate) {\r\n this._iCurrentTiltAngle += (this._tiltAngle - this._iCurrentTiltAngle) / (this.steps + 1);\r\n this._iCurrentPanAngle += (this._panAngle - this._iCurrentPanAngle) / (this.steps + 1);\r\n }\r\n else {\r\n this._iCurrentPanAngle = this._panAngle;\r\n this._iCurrentTiltAngle = this._tiltAngle;\r\n }\r\n //snap coords if angle differences are close\r\n if ((Math.abs(this.tiltAngle - this._iCurrentTiltAngle) < 0.01) && (Math.abs(this._panAngle - this._iCurrentPanAngle) < 0.01)) {\r\n this._iCurrentTiltAngle = this._tiltAngle;\r\n this._iCurrentPanAngle = this._panAngle;\r\n }\r\n }\r\n var pos = (this.lookAtObject) ? this.lookAtObject.transform.position : (this.lookAtPosition) ? this.lookAtPosition : this._pOrigin;\r\n this.targetObject.x = pos.x + this.distance * Math.sin(this._iCurrentPanAngle * MathConsts.DEGREES_TO_RADIANS) * Math.cos(this._iCurrentTiltAngle * MathConsts.DEGREES_TO_RADIANS);\r\n this.targetObject.y = pos.y + this.distance * Math.sin(this._iCurrentTiltAngle * MathConsts.DEGREES_TO_RADIANS) * this.yFactor;\r\n this.targetObject.z = pos.z + this.distance * Math.cos(this._iCurrentPanAngle * MathConsts.DEGREES_TO_RADIANS) * Math.cos(this._iCurrentTiltAngle * MathConsts.DEGREES_TO_RADIANS);\r\n this._upAxis.x = -Math.sin(this._iCurrentPanAngle * MathConsts.DEGREES_TO_RADIANS) * Math.sin(this._iCurrentTiltAngle * MathConsts.DEGREES_TO_RADIANS);\r\n this._upAxis.y = Math.cos(this._iCurrentTiltAngle * MathConsts.DEGREES_TO_RADIANS);\r\n this._upAxis.z = -Math.cos(this._iCurrentPanAngle * MathConsts.DEGREES_TO_RADIANS) * Math.sin(this._iCurrentTiltAngle * MathConsts.DEGREES_TO_RADIANS);\r\n if (this._pTargetObject) {\r\n if (this._pLookAtPosition)\r\n this._pTargetObject.lookAt(this._pLookAtPosition, this._upAxis);\r\n else if (this._pLookAtObject)\r\n this._pTargetObject.lookAt(this._pLookAtObject.scene ? this._pLookAtObject.scenePosition : this._pLookAtObject.transform.position, this._upAxis);\r\n }\r\n };\r\n return HoverController;\r\n}(LookAtController));\r\nexport { HoverController };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/controllers/HoverController.js","import * as tslib_1 from \"tslib\";\r\nimport { HoverController } from \"../controllers/HoverController\";\r\n/**\r\n * Controller used to follow behind an object on the XZ plane, with an optional\r\n * elevation (tiltAngle).\r\n *\r\n * @see away3d.containers.View3D\r\n */\r\nvar FollowController = (function (_super) {\r\n tslib_1.__extends(FollowController, _super);\r\n function FollowController(targetObject, lookAtObject, tiltAngle, distance) {\r\n if (targetObject === void 0) { targetObject = null; }\r\n if (lookAtObject === void 0) { lookAtObject = null; }\r\n if (tiltAngle === void 0) { tiltAngle = 45; }\r\n if (distance === void 0) { distance = 700; }\r\n return _super.call(this, targetObject, lookAtObject, 0, tiltAngle, distance) || this;\r\n }\r\n FollowController.prototype.update = function (interpolate) {\r\n if (interpolate === void 0) { interpolate = true; }\r\n if (!this.lookAtObject)\r\n return;\r\n this.panAngle = this._pLookAtObject.rotationY - 180;\r\n _super.prototype.update.call(this);\r\n };\r\n return FollowController;\r\n}(HoverController));\r\nexport { FollowController };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/controllers/FollowController.js","import * as tslib_1 from \"tslib\";\r\nimport { Vector3D } from \"@awayjs/core\";\r\nimport { LookAtController } from \"../controllers/LookAtController\";\r\n/**\r\n * Uses spring physics to animate the target object towards a position that is\r\n * defined as the lookAtTarget object's position plus the vector defined by the\r\n * positionOffset property.\r\n */\r\nvar SpringController = (function (_super) {\r\n tslib_1.__extends(SpringController, _super);\r\n function SpringController(targetObject, lookAtObject, stiffness, mass, damping) {\r\n if (targetObject === void 0) { targetObject = null; }\r\n if (lookAtObject === void 0) { lookAtObject = null; }\r\n if (stiffness === void 0) { stiffness = 1; }\r\n if (mass === void 0) { mass = 40; }\r\n if (damping === void 0) { damping = 4; }\r\n var _this = _super.call(this, targetObject, lookAtObject) || this;\r\n /**\r\n * Offset of spring center from target in target object space, ie: Where the camera should ideally be in the target object space.\r\n */\r\n _this.positionOffset = new Vector3D(0, 500, -1000);\r\n _this.stiffness = stiffness;\r\n _this.damping = damping;\r\n _this.mass = mass;\r\n _this._velocity = new Vector3D();\r\n _this._dv = new Vector3D();\r\n _this._stretch = new Vector3D();\r\n _this._force = new Vector3D();\r\n _this._acceleration = new Vector3D();\r\n _this._desiredPosition = new Vector3D();\r\n return _this;\r\n }\r\n SpringController.prototype.update = function (interpolate) {\r\n if (interpolate === void 0) { interpolate = true; }\r\n var offs;\r\n if (!this._pLookAtObject || !this._pTargetObject)\r\n return;\r\n this._pControllerDirty = true;\r\n offs = this._pLookAtObject.transform.matrix3D.deltaTransformVector(this.positionOffset);\r\n this._desiredPosition.x = this._pLookAtObject.x + offs.x;\r\n this._desiredPosition.y = this._pLookAtObject.y + offs.y;\r\n this._desiredPosition.z = this._pLookAtObject.z + offs.z;\r\n this._stretch = this._pTargetObject.transform.position.add(this._desiredPosition);\r\n this._stretch.scaleBy(-this.stiffness);\r\n this._dv.copyFrom(this._velocity);\r\n this._dv.scaleBy(this.damping);\r\n this._force.x = this._stretch.x - this._dv.x;\r\n this._force.y = this._stretch.y - this._dv.y;\r\n this._force.z = this._stretch.z - this._dv.z;\r\n this._acceleration.copyFrom(this._force);\r\n this._acceleration.scaleBy(1 / this.mass);\r\n this._velocity.incrementBy(this._acceleration);\r\n var position = this._pTargetObject.transform.position.add(this._velocity);\r\n this._pTargetObject.transform.moveTo(position.x, position.y, position.z);\r\n _super.prototype.update.call(this);\r\n };\r\n return SpringController;\r\n}(LookAtController));\r\nexport { SpringController };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/controllers/SpringController.js","import * as tslib_1 from \"tslib\";\r\nimport { Rectangle } from \"@awayjs/core\";\r\nimport { TraverserBase, RenderableEvent, MaterialEvent, DefaultMaterialManager } from \"@awayjs/graphics\";\r\nimport { BoundsType } from \"../bounds/BoundsType\";\r\nimport { DisplayObjectContainer } from \"./DisplayObjectContainer\";\r\n/**\r\n * The Billboard class represents display objects that represent bitmap images.\r\n * These can be images that you load with the flash.Assets or\r\n * flash.display.Loader classes, or they can be images that you\r\n * create with the Billboard() constructor.\r\n *\r\n * The Billboard() constructor allows you to create a Billboard\r\n * object that contains a reference to a Image2D object. After you create a\r\n * Billboard object, use the addChild() or addChildAt()\r\n * method of the parent DisplayObjectContainer instance to place the bitmap on\r\n * the display list.
A Billboard object can share its Image2D reference among several Billboard\r\n * objects, independent of translation or rotation properties. Because you can\r\n * create multiple Billboard objects that reference the same Image2D object,\r\n * multiple display objects can use the same complex Image2D object without\r\n * incurring the memory overhead of a Image2D object for each display\r\n * object instance.
\r\n *\r\n *A Image2D object can be drawn to the screen by a Billboard object in one\r\n * of two ways: by using the default hardware renderer with a single hardware surface,\r\n * or by using the slower software renderer when 3D acceleration is not available.
\r\n *\r\n *If you would prefer to perform a batch rendering command, rather than using a\r\n * single surface for each Billboard object, you can also draw to the screen using the\r\n * drawTiles() or drawTriangles() methods which are\r\n * available to flash.display.Tilesheet and flash.display.Graphics\r\n * objects.
Note: The Billboard class is not a subclass of the InteractiveObject\r\n * class, so it cannot dispatch mouse events. However, you can use the\r\n * addEventListener() method of the display object container that\r\n * contains the Billboard object.
load() method to initiate loading. The loaded\r\n * display object is added as a child of the LoaderContainer object.\r\n *\r\n * Use the URLLoader class to load text or binary data.
\r\n *\r\n *The LoaderContainer class overrides the following methods that it inherits,\r\n * because a LoaderContainer object can only have one child display object - the\r\n * display object that it loads. Calling the following methods throws an\r\n * exception: addChild(), addChildAt(),\r\n * removeChild(), removeChildAt(), and\r\n * setChildIndex(). To remove a loaded display object, you must\r\n * remove the LoaderContainer object from its parent DisplayObjectContainer\r\n * child array.
Note: The ActionScript 2.0 MovieClipLoader and LoadVars classes\r\n * are not used in ActionScript 3.0. The LoaderContainer and URLLoader classes replace\r\n * them.
\r\n *\r\n *When you use the LoaderContainer class, consider the Flash Player and Adobe AIR\r\n * security model:
\r\n *\r\n *- \r\n *
- You can load content from any accessible source. \r\n *
- Loading is not allowed if the calling SWF file is in a network\r\n * sandbox and the file to be loaded is local. \r\n *
- If the loaded content is a SWF file written with ActionScript 3.0, it\r\n * cannot be cross-scripted by a SWF file in another security sandbox unless\r\n * that cross-scripting arrangement was approved through a call to the\r\n *
System.allowDomain()or the\r\n *System.allowInsecureDomain()method in the loaded content\r\n * file. \r\n * - If the loaded content is an AVM1 SWF file(written using ActionScript\r\n * 1.0 or 2.0), it cannot be cross-scripted by an AVM2 SWF file(written using\r\n * ActionScript 3.0). However, you can communicate between the two SWF files\r\n * by using the LocalConnection class. \r\n *
- If the loaded content is an image, its data cannot be accessed by a\r\n * SWF file outside of the security sandbox, unless the domain of that SWF\r\n * file was included in a URL policy file at the origin domain of the\r\n * image. \r\n *
- Movie clips in the local-with-file-system sandbox cannot script movie\r\n * clips in the local-with-networking sandbox, and the reverse is also\r\n * prevented. \r\n *
- You cannot connect to commonly reserved ports. For a complete list of\r\n * blocked ports, see \"Restricting Networking APIs\" in the ActionScript 3.0\r\n * Developer's Guide. \r\n *
However, in AIR, content in the application security\r\n * sandbox(content installed with the AIR application) are not restricted by\r\n * these security limitations.
For more information related to security, see the Flash Player Developer\r\n * Center Topic: Security.
\r\n *\r\n *When loading a SWF file from an untrusted source(such as a domain other\r\n * than that of the LoaderContainer object's root SWF file), you may want to define a\r\n * mask for the LoaderContainer object, to prevent the loaded content(which is a child\r\n * of the LoaderContainer object) from drawing to portions of the Stage outside of that\r\n * mask, as shown in the following code:
\r\n */\r\nvar LoaderContainer = (function (_super) {\r\n tslib_1.__extends(LoaderContainer, _super);\r\n /**\r\n * Creates a Loader object that you can use to load files, such as SWF, JPEG,\r\n * GIF, or PNG files. Call theload() method to load the asset\r\n * as a child of the Loader instance. You can then add the Loader object to\r\n * the display list(for instance, by using the addChild()\r\n * method of a DisplayObjectContainer instance). The asset appears on the\r\n * Stage as it loads.\r\n *\r\n * You can also use a Loader instance \"offlist,\" that is without adding it\r\n * to a display object container on the display list. In this mode, the\r\n * Loader instance might be used to load a SWF file that contains additional\r\n * modules of an application.
\r\n *\r\n *To detect when the SWF file is finished loading, you can use the events\r\n * of the LoaderInfo object associated with the\r\n * contentLoaderInfo property of the Loader object. At that\r\n * point, the code in the module SWF file can be executed to initialize and\r\n * start the module. In the offlist mode, a Loader instance might also be\r\n * used to load a SWF file that contains components or media assets. Again,\r\n * you can use the LoaderInfo object event notifications to detect when the\r\n * components are finished loading. At that point, the application can start\r\n * using the components and media assets in the library of the SWF file by\r\n * instantiating the ActionScript 3.0 classes that represent those components\r\n * and assets.
To determine the status of a Loader object, monitor the following\r\n * events that the LoaderInfo object associated with the\r\n * contentLoaderInfo property of the Loader object:
- \r\n *
- The
openevent is dispatched when loading begins. \r\n * - The
ioErrororsecurityErrorevent is\r\n * dispatched if the file cannot be loaded or if an error occured during the\r\n * load process. \r\n * - The
progressevent fires continuously while the file is\r\n * being loaded. \r\n * - The
completeevent is dispatched when a file completes\r\n * downloading, but before the loaded movie clip's methods and properties are\r\n * available. \r\n * - The
initevent is dispatched after the properties and\r\n * methods of the loaded SWF file are accessible, so you can begin\r\n * manipulating the loaded SWF file. This event is dispatched before the\r\n *completehandler. In streaming SWF files, the\r\n *initevent can occur significantly earlier than the\r\n *completeevent. For most purposes, use theinit\r\n * handler. \r\n *
load() or\r\n * loadBytes() methods.\r\n *\r\n * @throws SecurityError The loaded SWF file or image file belongs to a\r\n * security sandbox to which you do not have access.\r\n * For a loaded SWF file, you can avoid this situation\r\n * by having the file call the\r\n * Security.allowDomain() method or by\r\n * having the loading file specify a\r\n * loaderContext parameter with its\r\n * securityDomain property set to\r\n * SecurityDomain.currentDomain when you\r\n * call the load() or\r\n * loadBytes() method.\r\n */\r\n get: function () {\r\n return this._content;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * Cancels a load() method operation that is currently in\r\n * progress for the Loader instance.\r\n *\r\n */\r\n LoaderContainer.prototype.close = function () {\r\n if (!this._loader)\r\n return;\r\n if (this._useAssetLib) {\r\n var lib;\r\n lib = AssetLibraryBundle.getInstance(this._assetLibId);\r\n lib.disposeLoader(this._loader);\r\n }\r\n this._disposeLoader();\r\n };\r\n /**\r\n * Loads a SWF, JPEG, progressive JPEG, unanimated GIF, or PNG file into an\r\n * object that is a child of this Loader object. If you load an animated GIF\r\n * file, only the first frame is displayed. As the Loader object can contain\r\n * only a single child, issuing a subsequent load() request\r\n * terminates the previous request, if still pending, and commences a new\r\n * load.\r\n *\r\n * Note: In AIR 1.5 and Flash Player 10, the maximum size for a\r\n * loaded image is 8,191 pixels in width or height, and the total number of\r\n * pixels cannot exceed 16,777,215 pixels.(So, if an loaded image is 8,191\r\n * pixels wide, it can only be 2,048 pixels high.) In Flash Player 9 and\r\n * earlier and AIR 1.1 and earlier, the limitation is 2,880 pixels in height\r\n * and 2,880 pixels in width.
\r\n *\r\n *A SWF file or image loaded into a Loader object inherits the position,\r\n * rotation, and scale properties of the parent display objects of the Loader\r\n * object.
\r\n *\r\n *Use the unload() method to remove movies or images loaded\r\n * with this method, or to cancel a load operation that is in progress.
You can prevent a SWF file from using this method by setting the\r\n * allowNetworking parameter of the the object and\r\n * embed tags in the HTML page that contains the SWF\r\n * content.
When you use this method, consider the Flash Player security model,\r\n * which is described in the Loader class description.
\r\n *\r\n *In Flash Player 10 and later, if you use a multipart Content-Type(for\r\n * example \"multipart/form-data\") that contains an upload(indicated by a\r\n * \"filename\" parameter in a \"content-disposition\" header within the POST\r\n * body), the POST operation is subject to the security rules applied to\r\n * uploads:
\r\n *\r\n *- \r\n *
- The POST operation must be performed in response to a user-initiated\r\n * action, such as a mouse click or key press. \r\n *
- If the POST operation is cross-domain(the POST target is not on the\r\n * same server as the SWF file that is sending the POST request), the target\r\n * server must provide a URL policy file that permits cross-domain\r\n * access. \r\n *
Also, for any multipart Content-Type, the syntax must be valid\r\n * (according to the RFC2046 standard). If the syntax appears to be invalid,\r\n * the POST operation is subject to the security rules applied to\r\n * uploads.
\r\n *\r\n *For more information related to security, see the Flash Player\r\n * Developer Center Topic:
- \r\n *
- Whether or not to check for the existence of a policy\r\n * file upon loading the object \r\n *
- The ApplicationDomain for the loaded object \r\n *
- The SecurityDomain for the loaded object \r\n *
- The ImageDecodingPolicy for the loaded image\r\n * object \r\n *
If the context parameter is not specified\r\n * or refers to a null object, the loaded content remains in\r\n * its own security domain.
For complete details, see the description of the\r\n * properties in the
digest property of the\r\n * request object is not\r\n * null. You should only set the\r\n * digest property of a URLRequest\r\n * object when calling the\r\n * URLLoader.load() method when\r\n * loading a SWZ file(an Adobe platform\r\n * component).\r\n * @throws IllegalOperationError If the requestedContentParent\r\n * property of the context\r\n * parameter is a Loader.\r\n * @throws IllegalOperationError If the LoaderContext.parameters\r\n * parameter is set to non-null and has some\r\n * values which are not Strings.\r\n * @throws SecurityError The value of\r\n * LoaderContext.securityDomain\r\n * must be either null or\r\n * SecurityDomain.currentDomain.\r\n * This reflects the fact that you can only\r\n * place the loaded media in its natural\r\n * security sandbox or your own(the latter\r\n * requires a policy file).\r\n * @throws SecurityError Local SWF files may not set\r\n * LoaderContext.securityDomain to anything\r\n * other than null. It is not\r\n * permitted to import non-local media into a\r\n * local sandbox, or to place other local media\r\n * in anything other than its natural sandbox.\r\n * @throws SecurityError You cannot connect to commonly reserved\r\n * ports. For a complete list of blocked ports,\r\n * see \"Restricting Networking APIs\" in the\r\n * ActionScript 3.0 Developer's Guide.\r\n * @throws SecurityError If the applicationDomain or\r\n * securityDomain properties of\r\n * the context parameter are from\r\n * a disallowed domain.\r\n * @throws SecurityError If a local SWF file is attempting to use the\r\n * securityDomain property of the\r\n * context parameter.\r\n * @event asyncError Dispatched by the contentLoaderInfo\r\n * object if the\r\n * LoaderContext.requestedContentParent\r\n * property has been specified and it is not possible to\r\n * add the loaded content as a child to the specified\r\n * DisplayObjectContainer. This could happen if the\r\n * loaded content is a\r\n * flash.display.AVM1Movie or if the\r\n * addChild() call to the\r\n * requestedContentParent throws an error.\r\n * @event complete Dispatched by the contentLoaderInfo\r\n * object when the file has completed loading. The\r\n * complete event is always dispatched\r\n * after the init event.\r\n * @event httpStatus Dispatched by the contentLoaderInfo\r\n * object when a network request is made over HTTP and\r\n * Flash Player can detect the HTTP status code.\r\n * @event init Dispatched by the contentLoaderInfo\r\n * object when the properties and methods of the loaded\r\n * SWF file are accessible. The init event\r\n * always precedes the complete event.\r\n * @event ioError Dispatched by the contentLoaderInfo\r\n * object when an input or output error occurs that\r\n * causes a load operation to fail.\r\n * @event open Dispatched by the contentLoaderInfo\r\n * object when the loading operation starts.\r\n * @event progress Dispatched by the contentLoaderInfo\r\n * object as data is received while load operation\r\n * progresses.\r\n * @event securityError Dispatched by the contentLoaderInfo\r\n * object if a SWF file in the local-with-filesystem\r\n * sandbox attempts to load content in the\r\n * local-with-networking sandbox, or vice versa.\r\n * @event securityError Dispatched by the contentLoaderInfo\r\n * object if the\r\n * LoaderContext.requestedContentParent\r\n * property has been specified and the security sandbox\r\n * of the\r\n * LoaderContext.requestedContentParent\r\n * does not have access to the loaded SWF.\r\n * @event unload Dispatched by the contentLoaderInfo\r\n * object when a loaded object is removed.\r\n */\r\n LoaderContainer.prototype.load = function (request, context, ns, parser) {\r\n if (context === void 0) { context = null; }\r\n if (ns === void 0) { ns = null; }\r\n if (parser === void 0) { parser = null; }\r\n this._getLoader().load(request, context, ns, parser);\r\n };\r\n /**\r\n * Loads from binary data stored in a ByteArray object.\r\n *\r\n * The loadBytes() method is asynchronous. You must wait for\r\n * the \"init\" event before accessing the properties of a loaded object.
When you use this method, consider the Flash Player security model,\r\n * which is described in the Loader class description.
\r\n *\r\n * @param bytes A ByteArray object. The contents of the ByteArray can be\r\n * any of the file formats supported by the Loader class: SWF,\r\n * GIF, JPEG, or PNG.\r\n * @param context A LoaderContext object. Only the\r\n *applicationDomain property of the\r\n * LoaderContext object applies; the\r\n * checkPolicyFile and\r\n * securityDomain properties of the LoaderContext\r\n * object do not apply.\r\n *\r\n * If the context parameter is not specified\r\n * or refers to a null object, the content is loaded into the\r\n * current security domain - a process referred to as \"import\r\n * loading\" in Flash Player security documentation.\r\n * Specifically, if the loading SWF file trusts the remote SWF\r\n * by incorporating the remote SWF into its code, then the\r\n * loading SWF can import it directly into its own security\r\n * domain.
For more information related to security, see the Flash\r\n * Player Developer Center Topic:
length property of the\r\n * ByteArray object is not greater than 0.\r\n * @throws IllegalOperationError If the checkPolicyFile or\r\n * securityDomain property of the\r\n * context parameter are non-null.\r\n * @throws IllegalOperationError If the requestedContentParent\r\n * property of the context\r\n * parameter is a Loader.\r\n * @throws IllegalOperationError If the LoaderContext.parameters\r\n * parameter is set to non-null and has some\r\n * values which are not Strings.\r\n * @throws SecurityError If the provided\r\n * applicationDomain property of\r\n * the context property is from a\r\n * disallowed domain.\r\n * @throws SecurityError You cannot connect to commonly reserved\r\n * ports. For a complete list of blocked ports,\r\n * see \"Restricting Networking APIs\" in the\r\n * ActionScript 3.0 Developer's Guide.\r\n * @event asyncError Dispatched by the contentLoaderInfo\r\n * object if the\r\n * LoaderContext.requestedContentParent\r\n * property has been specified and it is not possible to\r\n * add the loaded content as a child to the specified\r\n * DisplayObjectContainer. This could happen if the\r\n * loaded content is a\r\n * flash.display.AVM1Movie or if the\r\n * addChild() call to the\r\n * requestedContentParent throws an error.\r\n * @event complete Dispatched by the contentLoaderInfo\r\n * object when the operation is complete. The\r\n * complete event is always dispatched\r\n * after the init event.\r\n * @event init Dispatched by the contentLoaderInfo\r\n * object when the properties and methods of the loaded\r\n * data are accessible. The init event\r\n * always precedes the complete event.\r\n * @event ioError Dispatched by the contentLoaderInfo\r\n * object when the runtime cannot parse the data in the\r\n * byte array.\r\n * @event open Dispatched by the contentLoaderInfo\r\n * object when the operation starts.\r\n * @event progress Dispatched by the contentLoaderInfo\r\n * object as data is transfered in memory.\r\n * @event securityError Dispatched by the contentLoaderInfo\r\n * object if the\r\n * LoaderContext.requestedContentParent\r\n * property has been specified and the security sandbox\r\n * of the\r\n * LoaderContext.requestedContentParent\r\n * does not have access to the loaded SWF.\r\n * @event unload Dispatched by the contentLoaderInfo\r\n * object when a loaded object is removed.\r\n */\r\n LoaderContainer.prototype.loadData = function (data, context, ns, parser) {\r\n if (context === void 0) { context = null; }\r\n if (ns === void 0) { ns = null; }\r\n if (parser === void 0) { parser = null; }\r\n this._getLoader().loadData(data, '', context, ns, parser);\r\n };\r\n LoaderContainer.prototype._getLoader = function () {\r\n if (this._useAssetLib) {\r\n var lib = AssetLibraryBundle.getInstance(this._assetLibId);\r\n this._loader = lib.getLoader();\r\n }\r\n else {\r\n this._loader = new Loader();\r\n }\r\n this._loader.addEventListener(LoaderEvent.LOAD_COMPLETE, this._onLoadCompleteDelegate);\r\n this._loader.addEventListener(AssetEvent.TEXTURE_SIZE_ERROR, this._onTextureSizeErrorDelegate);\r\n this._loader.addEventListener(AssetEvent.ASSET_COMPLETE, this._onAssetCompleteDelegate);\r\n // Error are handled separately (see documentation for addErrorHandler)\r\n this._loader._iAddErrorHandler(this._onLoadErrorDelegate);\r\n this._loader._iAddParseErrorHandler(this._onParseErrorDelegate);\r\n return this._loader;\r\n };\r\n LoaderContainer.prototype._disposeLoader = function () {\r\n this._loader.removeEventListener(LoaderEvent.LOAD_COMPLETE, this._onLoadCompleteDelegate);\r\n this._loader.removeEventListener(AssetEvent.TEXTURE_SIZE_ERROR, this._onTextureSizeErrorDelegate);\r\n this._loader.removeEventListener(AssetEvent.ASSET_COMPLETE, this._onAssetCompleteDelegate);\r\n if (!this._useAssetLib)\r\n this._loader.stop();\r\n this._loader = null;\r\n };\r\n /**\r\n * Removes a child of this Loader object that was loaded by using the\r\n * load() method. The property of the associated\r\n * LoaderInfo object is reset to null. The child is not\r\n * necessarily destroyed because other objects might have references to it;\r\n * however, it is no longer a child of the Loader object.\r\n *\r\n * As a best practice, before you unload a child SWF file, you should\r\n * explicitly close any streams in the child SWF file's objects, such as\r\n * LocalConnection, NetConnection, NetStream, and Sound objects. Otherwise,\r\n * audio in the child SWF file might continue to play, even though the child\r\n * SWF file was unloaded. To close streams in the child SWF file, add an\r\n * event listener to the child that listens for the unload\r\n * event. When the parent calls Loader.unload(), the\r\n * unload event is dispatched to the child. The following code\r\n * shows how you might do this:
public closeAllStreams(evt:Event) {\r\n * myNetStream.close(); mySound.close(); myNetConnection.close();\r\n * myLocalConnection.close(); }\r\n * myMovieClip.loaderInfo.addEventListener(Event.UNLOAD,\r\n * closeAllStreams);\r\n *\r\n */\r\n LoaderContainer.prototype.unload = function () {\r\n //TODO\r\n };\r\n /**\r\n * Enables a specific parser.\r\n * When no specific parser is set for a loading/parsing opperation,\r\n * loader3d can autoselect the correct parser to use.\r\n * A parser must have been enabled, to be considered when autoselecting the parser.\r\n *\r\n * @param parserClass The parser class to enable.\r\n * @see away.parsers.Parsers\r\n */\r\n LoaderContainer.enableParser = function (parserClass) {\r\n Loader.enableParser(parserClass);\r\n };\r\n /**\r\n * Enables a list of parsers.\r\n * When no specific parser is set for a loading/parsing opperation,\r\n * loader3d can autoselect the correct parser to use.\r\n * A parser must have been enabled, to be considered when autoselecting the parser.\r\n *\r\n * @param parserClasses A Vector of parser classes to enable.\r\n * @see away.parsers.Parsers\r\n */\r\n LoaderContainer.enableParsers = function (parserClasses) {\r\n Loader.enableParsers(parserClasses);\r\n };\r\n LoaderContainer.prototype.onAssetComplete = function (event) {\r\n this.dispatchEvent(event);\r\n };\r\n /**\r\n * Called when an error occurs during loading\r\n */\r\n LoaderContainer.prototype.onLoadError = function (event) {\r\n if (this.hasEventListener(URLLoaderEvent.LOAD_ERROR)) {\r\n this.dispatchEvent(event);\r\n return true;\r\n }\r\n else {\r\n return false;\r\n }\r\n };\r\n /**\r\n * Called when a an error occurs during parsing\r\n */\r\n LoaderContainer.prototype.onParseError = function (event) {\r\n if (this.hasEventListener(ParserEvent.PARSE_ERROR)) {\r\n this.dispatchEvent(event);\r\n return true;\r\n }\r\n else {\r\n return false;\r\n }\r\n };\r\n LoaderContainer.prototype.onTextureSizeError = function (event) {\r\n this.dispatchEvent(event);\r\n };\r\n /**\r\n * Called when the resource and all of its dependencies was retrieved.\r\n */\r\n LoaderContainer.prototype.onLoadComplete = function (event) {\r\n this._content = event.content;\r\n if (this._content)\r\n this.addChild(this._content);\r\n this.dispatchEvent(event);\r\n this._disposeLoader();\r\n };\r\n return LoaderContainer;\r\n}(DisplayObjectContainer));\r\nexport { LoaderContainer };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/display/LoaderContainer.js","import * as tslib_1 from \"tslib\";\r\nimport { EventBase } from \"@awayjs/core\";\r\n/**\r\n * A MouseEvent is dispatched when a mouse event occurs over a mouseEnabled object in View.\r\n * TODO: we don't have screenZ data, tho this should be easy to implement\r\n */\r\nvar MouseEvent = (function (_super) {\r\n tslib_1.__extends(MouseEvent, _super);\r\n /**\r\n * Create a new MouseEvent object.\r\n * @param type The type of the MouseEvent.\r\n */\r\n function MouseEvent(type) {\r\n var _this = _super.call(this, type) || this;\r\n // Private.\r\n _this._iAllowedToPropagate = true;\r\n return _this;\r\n }\r\n Object.defineProperty(MouseEvent.prototype, \"bubbles\", {\r\n /**\r\n * @inheritDoc\r\n */\r\n get: function () {\r\n var doesBubble = this._iAllowedToPropagate;\r\n this._iAllowedToPropagate = true;\r\n // Don't bubble if propagation has been stopped.\r\n return doesBubble;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * @inheritDoc\r\n */\r\n MouseEvent.prototype.stopPropagation = function () {\r\n this._iAllowedToPropagate = false;\r\n if (this._iParentEvent)\r\n this._iParentEvent.stopPropagation();\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n MouseEvent.prototype.stopImmediatePropagation = function () {\r\n this._iAllowedToPropagate = false;\r\n if (this._iParentEvent)\r\n this._iParentEvent.stopImmediatePropagation();\r\n };\r\n /**\r\n * Creates a copy of the MouseEvent object and sets the value of each property to match that of the original.\r\n */\r\n MouseEvent.prototype.clone = function () {\r\n var result = new MouseEvent(this.type);\r\n /* TODO: Debug / test - look into isDefaultPrevented\r\n if (isDefaultPrevented())\r\n result.preventDefault();\r\n */\r\n result.screenX = this.screenX;\r\n result.screenY = this.screenY;\r\n result.view = this.view;\r\n result.entity = this.entity;\r\n result.renderable = this.renderable;\r\n result.material = this.material;\r\n result.uv = this.uv;\r\n result.position = this.position;\r\n result.normal = this.normal;\r\n result.elementIndex = this.elementIndex;\r\n result.delta = this.delta;\r\n result.ctrlKey = this.ctrlKey;\r\n result.shiftKey = this.shiftKey;\r\n result._iParentEvent = this;\r\n result._iAllowedToPropagate = this._iAllowedToPropagate;\r\n return result;\r\n };\r\n Object.defineProperty(MouseEvent.prototype, \"scenePosition\", {\r\n /**\r\n * The position in scene space where the event took place\r\n */\r\n get: function () {\r\n return this.entity.transform.concatenatedMatrix3D.transformVector(this.position);\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(MouseEvent.prototype, \"sceneNormal\", {\r\n /**\r\n * The normal in scene space where the event took place\r\n */\r\n get: function () {\r\n var sceneNormal = this.entity.transform.concatenatedMatrix3D.deltaTransformVector(this.normal);\r\n sceneNormal.normalize();\r\n return sceneNormal;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n return MouseEvent;\r\n}(EventBase));\r\nexport { MouseEvent };\r\n/**\r\n * Defines the value of the type property of a mouseOver3d event object.\r\n */\r\nMouseEvent.MOUSE_OVER = \"mouseOver3d\";\r\n/**\r\n * Defines the value of the type property of a mouseOut3d event object.\r\n */\r\nMouseEvent.MOUSE_OUT = \"mouseOut3d\";\r\n/**\r\n * Defines the value of the type property of a mouseUp3d event object.\r\n */\r\nMouseEvent.MOUSE_UP = \"mouseUp3d\";\r\n/**\r\n * Defines the value of the type property of a mouseDown3d event object.\r\n */\r\nMouseEvent.MOUSE_DOWN = \"mouseDown3d\";\r\n/**\r\n * Defines the value of the type property of a mouseMove3d event object.\r\n */\r\nMouseEvent.MOUSE_MOVE = \"mouseMove3d\";\r\n/**\r\n * Defines the value of the type property of a rollOver3d event object.\r\n */\r\n//\t\tpublic static ROLL_OVER : string = \"rollOver3d\";\r\n/**\r\n * Defines the value of the type property of a rollOut3d event object.\r\n */\r\n//\t\tpublic static ROLL_OUT : string = \"rollOut3d\";\r\n/**\r\n * Defines the value of the type property of a click3d event object.\r\n */\r\nMouseEvent.CLICK = \"click3d\";\r\n/**\r\n * Defines the value of the type property of a doubleClick3d event object.\r\n */\r\nMouseEvent.DOUBLE_CLICK = \"doubleClick3d\";\r\n/**\r\n * Defines the value of the type property of a mouseWheel3d event object.\r\n */\r\nMouseEvent.MOUSE_WHEEL = \"mouseWheel3d\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/events/MouseEvent.js","/**\r\n * The TextFormat class represents character formatting information. Use the\r\n * TextFormat class to create specific text formatting for text fields. You\r\n * can apply text formatting to both static and dynamic text fields. The\r\n * properties of the TextFormat class apply to device and embedded fonts.\r\n * However, for embedded fonts, bold and italic text actually require specific\r\n * fonts. If you want to display bold or italic text with an embedded font,\r\n * you need to embed the bold and italic variations of that font.\r\n *\r\n * You must use the constructor new TextFormat() to create a\r\n * TextFormat object before setting its properties. When you apply a\r\n * TextFormat object to a text field using the\r\n * TextField.defaultTextFormat property or the\r\n * TextField.setTextFormat() method, only its defined properties\r\n * are applied. Use the TextField.defaultTextFormat property to\r\n * apply formatting BEFORE you add text to the TextField, and the\r\n * setTextFormat() method to add formatting AFTER you add text to\r\n * the TextField. The TextFormat properties are null\r\n * by default because if you don't provide values for the properties, Flash\r\n * Player uses its own default formatting. The default formatting that Flash\r\n * Player uses for each property(if property's value is null) is\r\n * as follows:
The default formatting for each property is also described in each\r\n * property description.
\r\n */\r\nvar TesselatedFontChar = (function () {\r\n function TesselatedFontChar(fill_data, stroke_data) {\r\n if (fill_data === void 0) { fill_data = null; }\r\n if (stroke_data === void 0) { stroke_data = null; }\r\n /**\r\n * the char_codes that this geom has kerning set for\r\n */\r\n this.kerningCharCodes = [];\r\n /**\r\n * the kerning values per char_code\r\n */\r\n this.kerningValues = [];\r\n this.fill_data = fill_data;\r\n this.stroke_data = stroke_data;\r\n }\r\n return TesselatedFontChar;\r\n}());\r\nexport { TesselatedFontChar };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/text/TesselatedFontChar.js","import * as tslib_1 from \"tslib\";\r\nimport { AssetBase, AttributesView } from \"@awayjs/core\";\r\nimport { GraphicsPath, JointStyle, CapsStyle, DrawMode, GraphicsStrokeStyle } from \"@awayjs/graphics\";\r\nimport { TesselatedFontChar } from \"./TesselatedFontChar\";\r\n/**\r\n * GraphicBase wraps a TriangleElements as a scene graph instantiation. A GraphicBase is owned by a Sprite object.\r\n *\r\n *\r\n * @see away.base.TriangleElements\r\n * @see away.entities.Sprite\r\n *\r\n * @class away.base.GraphicBase\r\n */\r\nvar TesselatedFontTable = (function (_super) {\r\n tslib_1.__extends(TesselatedFontTable, _super);\r\n //TODO test shader picking\r\n //\t\tpublic get shaderPickingDetails():boolean\r\n //\t\t{\r\n //\r\n //\t\t\treturn this.sourceEntity.shaderPickingDetails;\r\n //\t\t}\r\n /**\r\n * Creates a new TesselatedFont object\r\n * If a opentype_font object is passed, the chars will get tessellated whenever requested.\r\n * If no opentype font object is passed, it is expected that tesselated chars\r\n */\r\n function TesselatedFontTable(opentype_font) {\r\n if (opentype_font === void 0) { opentype_font = null; }\r\n var _this = _super.call(this) || this;\r\n _this._font_chars = [];\r\n _this._font_chars_dic = new Object();\r\n _this._current_size = 0;\r\n _this._size_multiply = 0;\r\n _this._ascent = 0;\r\n _this._descent = 0;\r\n _this._usesCurves = false;\r\n if (opentype_font) {\r\n _this._opentype_font = opentype_font;\r\n /*\r\n console.log(\"head.yMax \"+head.yMax);\r\n console.log(\"head.yMin \"+head.yMin);\r\n console.log(\"font.numGlyphs \"+font.numGlyphs);\r\n console.log('Ascender', font.tables.hhea.ascender);\r\n console.log('Descender', font.tables.hhea.descender);\r\n console.log('Typo Ascender', font.tables.os2.sTypoAscender);\r\n console.log('Typo Descender', font.tables.os2.sTypoDescender);\r\n */\r\n //this._ascent=this._opentype_font.tables.hhea.ascender;\r\n //this._descent=this._opentype_font.tables.hhea.descender;\r\n _this._font_em_size = 72;\r\n _this._current_size = 0;\r\n _this._size_multiply = 0;\r\n return _this;\r\n }\r\n return _this;\r\n }\r\n TesselatedFontTable.prototype.hasChar = function (char_code) {\r\n return this._font_chars_dic[char_code] != null;\r\n };\r\n TesselatedFontTable.prototype.changeOpenTypeFont = function (newOpenTypeFont, tesselateAllOld) {\r\n if (tesselateAllOld === void 0) { tesselateAllOld = true; }\r\n if ((tesselateAllOld) && (this._opentype_font)) {\r\n }\r\n // todo: when updating a font we must take care that they are compatible in terms of em_size\r\n this._opentype_font = newOpenTypeFont;\r\n };\r\n TesselatedFontTable.prototype.initFontSize = function (font_size) {\r\n if (this.fallbackTable)\r\n this.fallbackTable.initFontSize(font_size);\r\n if (this._current_size == font_size)\r\n return;\r\n this._current_size = font_size;\r\n this._size_multiply = font_size / this._font_em_size;\r\n //console.log(\"text-font-table: \",this._ascent, this._descent, this._font_em_size)\r\n };\r\n TesselatedFontTable.prototype.getCharVertCnt = function (char_code) {\r\n var tesselated_font_char = this._font_chars_dic[char_code];\r\n if (tesselated_font_char) {\r\n return tesselated_font_char.fill_data.length;\r\n }\r\n return 0;\r\n };\r\n TesselatedFontTable.prototype.getCharWidth = function (char_code) {\r\n if (char_code == \"32\") {\r\n return this._whitespace_width * this._size_multiply;\r\n }\r\n var tesselated_font_char = this._font_chars_dic[char_code];\r\n if (tesselated_font_char) {\r\n return tesselated_font_char.char_width * this._size_multiply;\r\n }\r\n if (this.fallbackTable)\r\n return this.fallbackTable.getCharWidth(char_code);\r\n return 0;\r\n };\r\n Object.defineProperty(TesselatedFontTable.prototype, \"usesCurves\", {\r\n get: function () {\r\n return this._usesCurves;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n TesselatedFontTable.prototype.getLineHeight = function () {\r\n var thisLineheighttest = this._current_size * (this._font_em_size / this._ascent);\r\n if (this.name == \"BoldStyle\") {\r\n thisLineheighttest = this._current_size;\r\n }\r\n return thisLineheighttest; // sf\r\n //return (this._ascent+this._descent)*this._size_multiply;\t// enable for icycle\r\n };\r\n Object.defineProperty(TesselatedFontTable.prototype, \"assetType\", {\r\n get: function () {\r\n return TesselatedFontTable.assetType;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n *\r\n */\r\n TesselatedFontTable.prototype.dispose = function () {\r\n };\r\n Object.defineProperty(TesselatedFontTable.prototype, \"ascent\", {\r\n get: function () {\r\n return this._ascent;\r\n },\r\n set: function (value) {\r\n this._ascent = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TesselatedFontTable.prototype, \"descent\", {\r\n get: function () {\r\n return this._descent;\r\n },\r\n set: function (value) {\r\n this._descent = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TesselatedFontTable.prototype, \"offset_x\", {\r\n get: function () {\r\n return this._offset_x;\r\n },\r\n set: function (value) {\r\n this._offset_x = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TesselatedFontTable.prototype, \"offset_y\", {\r\n get: function () {\r\n return this._offset_y;\r\n },\r\n set: function (value) {\r\n this._offset_y = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n TesselatedFontTable.prototype.get_font_chars = function () {\r\n return this._font_chars;\r\n };\r\n TesselatedFontTable.prototype.get_font_em_size = function () {\r\n return this._font_em_size;\r\n };\r\n TesselatedFontTable.prototype.set_whitespace_width = function (value) {\r\n this._whitespace_width = value;\r\n };\r\n TesselatedFontTable.prototype.get_whitespace_width = function () {\r\n return this._whitespace_width;\r\n };\r\n TesselatedFontTable.prototype.set_font_em_size = function (font_em_size) {\r\n this._font_em_size = font_em_size;\r\n };\r\n TesselatedFontTable.prototype.fillTextRun = function (tf, format, startWord, wordCnt) {\r\n var textShape = tf.getTextShapeForIdentifierAndFormat(format.color.toString(), format);\r\n var charGlyph;\r\n var w = 0;\r\n var w_len = startWord + (wordCnt * 5);\r\n var char_vertices;\r\n var c = 0;\r\n var c_len = 0;\r\n var x = 0;\r\n var y = 0;\r\n var startIdx = 0;\r\n var buffer;\r\n var v;\r\n var size_multiply;\r\n var hack_x_mirror = false;\r\n // loop over all the words and create the text data for it\r\n // each word provides its own start-x and start-y values, so we can just ignore whitespace-here\r\n for (w = startWord; w < w_len; w += 5) {\r\n startIdx = tf.words[w];\r\n x = tf.words[w + 1];\r\n y = tf.words[w + 2]; //-this.getLineHeight())+(this._size_multiply*this.ascent); // sunflower\r\n if (this.name == \"BoldStyle\") {\r\n y -= 0.2 * this.getLineHeight();\r\n }\r\n else {\r\n }\r\n //todo: this is a temporary fix for sunflower `si` VoltMeter text vertical align\r\n if (format.font_name == \"DJB Get Digital\") {\r\n y -= 2;\r\n }\r\n //y=tf.words[w+2]+(this.ascent-this.get_font_em_size())*this._size_multiply; // enable for icycle\r\n c_len = startIdx + tf.words[w + 4];\r\n for (c = startIdx; c < c_len; c++) {\r\n hack_x_mirror = false;\r\n if (tf.chars_codes[c] == 40) {\r\n tf.chars_codes[c] = 41;\r\n hack_x_mirror = true;\r\n }\r\n if (tf.chars_codes[c] != 32) {\r\n charGlyph = this.getChar(tf.chars_codes[c].toString());\r\n size_multiply = this._size_multiply;\r\n if (!charGlyph && this.fallbackTable) {\r\n charGlyph = this.fallbackTable.getChar(tf.chars_codes[c].toString());\r\n size_multiply = this.fallbackTable._size_multiply;\r\n }\r\n if (charGlyph) {\r\n char_vertices = charGlyph.fill_data;\r\n buffer = new Float32Array(char_vertices.buffer);\r\n if (this.usesCurves) {\r\n for (v = 0; v < char_vertices.count; v++) {\r\n textShape.verts[textShape.verts.length] = buffer[v * 3] * size_multiply + x;\r\n textShape.verts[textShape.verts.length] = buffer[v * 3 + 1] * size_multiply + y;\r\n textShape.verts[textShape.verts.length] = buffer[v * 3 + 2];\r\n }\r\n }\r\n else {\r\n if (hack_x_mirror) {\r\n for (v = 0; v < char_vertices.count; v++) {\r\n textShape.verts[textShape.verts.length] = (charGlyph.char_width - buffer[v * 2]) * size_multiply + x;\r\n textShape.verts[textShape.verts.length] = buffer[v * 2 + 1] * size_multiply + y;\r\n }\r\n }\r\n else {\r\n for (v = 0; v < char_vertices.count; v++) {\r\n textShape.verts[textShape.verts.length] = buffer[v * 2] * size_multiply + x;\r\n textShape.verts[textShape.verts.length] = buffer[v * 2 + 1] * size_multiply + y;\r\n }\r\n }\r\n }\r\n x += charGlyph.char_width * size_multiply;\r\n }\r\n else {\r\n console.log(\"TesselatedFontTable: Error: char not found in fontTable\");\r\n }\r\n }\r\n }\r\n }\r\n };\r\n /**\r\n *\r\n */\r\n TesselatedFontTable.prototype.getChar = function (name) {\r\n if (this._font_chars_dic[name] == null) {\r\n if (this._opentype_font) {\r\n //console.log(\"get char for '\"+String.fromCharCode(parseInt(name))+\"'. char does not exists yet. try creating it from opentype.\");\r\n var thisGlyph = this._opentype_font.charToGlyph(String.fromCharCode(parseInt(name)));\r\n if (thisGlyph) {\r\n //console.log(\"got the glyph from opentype\");\r\n if (true) {\r\n var thisPath = thisGlyph.getPath();\r\n var awayPath = new GraphicsPath();\r\n var i = 0;\r\n var len = thisPath.commands.length;\r\n //awayPath.lineTo(0, 0);\r\n //awayPath.moveTo(0,0);//-100);\r\n //awayPath.curveTo(100, 250, 200,0);\r\n //awayPath.lineTo(150, 100);\r\n //awayPath.moveTo(0,20);\r\n //awayPath.curveTo(100, 270, 200,20);\r\n //awayPath.moveTo(0,-20);\r\n //awayPath.moveTo(0,-10);\r\n //awayPath.curveTo(100, -110, 200,-10);\r\n var startx = 0;\r\n var starty = 0;\r\n for (i = 0; i < len; i++) {\r\n var cmd = thisPath.commands[i];\r\n if (cmd.type === 'M') {\r\n awayPath.moveTo(cmd.x, cmd.y);\r\n startx = cmd.x;\r\n starty = cmd.y;\r\n }\r\n else if (cmd.type === 'L') {\r\n awayPath.lineTo(cmd.x, cmd.y);\r\n }\r\n else if (cmd.type === 'Q') {\r\n awayPath.curveTo(cmd.x1, cmd.y1, cmd.x, cmd.y);\r\n }\r\n else if (cmd.type === 'C') {\r\n awayPath.cubicCurveTo(cmd.x1, cmd.y1, cmd.x2, cmd.y2, cmd.x, cmd.y);\r\n }\r\n else if (cmd.type === 'Z') {\r\n awayPath.lineTo(startx, starty);\r\n }\r\n }\r\n awayPath.style = new GraphicsStrokeStyle(0xff0000, 1, 1, JointStyle.MITER, CapsStyle.NONE, 100);\r\n var final_vert_list = [];\r\n //todo\r\n //GraphicsFactoryStrokes.draw_pathes([awayPath], final_vert_list, false);\r\n var attributesView = new AttributesView(Float32Array, 3);\r\n attributesView.set(final_vert_list);\r\n var attributesBuffer = attributesView.attributesBuffer;\r\n attributesView.dispose();\r\n var tesselated_font_char = new TesselatedFontChar(attributesBuffer, null);\r\n tesselated_font_char.char_width = (thisGlyph.advanceWidth * (1 / thisGlyph.path.unitsPerEm * 72));\r\n //console.log(\"tesselated_font_char.char_width \"+tesselated_font_char.char_width);\r\n this._font_chars.push(tesselated_font_char);\r\n this._font_chars_dic[name] = tesselated_font_char;\r\n }\r\n }\r\n }\r\n }\r\n return this._font_chars_dic[name];\r\n };\r\n /**\r\n *\r\n */\r\n TesselatedFontTable.prototype.setChar = function (name, char_width, fills_data, stroke_data, uses_curves) {\r\n if (fills_data === void 0) { fills_data = null; }\r\n if (stroke_data === void 0) { stroke_data = null; }\r\n if (uses_curves === void 0) { uses_curves = false; }\r\n if ((fills_data == null) && (stroke_data == null))\r\n throw (\"TesselatedFontTable: trying to create a TesselatedFontChar with no data (fills_data and stroke_data is null)\");\r\n if (this._font_chars.length > 0) {\r\n if (uses_curves != this._usesCurves) {\r\n throw (\"TesselatedFontTable: Can not set different types of graphic-glyphs (curves vs non-cuves) on the same FontTable!\");\r\n }\r\n }\r\n else {\r\n this._usesCurves = uses_curves;\r\n }\r\n var tesselated_font_char = new TesselatedFontChar(fills_data, stroke_data);\r\n tesselated_font_char.char_width = char_width;\r\n this._font_chars.push(tesselated_font_char);\r\n this._font_chars_dic[name] = tesselated_font_char;\r\n };\r\n TesselatedFontTable.prototype.buildTextRuns = function (textRuns, output_verts) {\r\n if ((textRuns.length * 2) != (output_verts.length))\r\n throw (\"Invalid data passed to TesselatedFontTable.buildTextRuns(). output_verts.length is not double textRuns.length.\");\r\n var i = 0;\r\n var font_size = 0;\r\n var drawMode = 0;\r\n var charCode = 0;\r\n var xpos = 0;\r\n var ypos = 0;\r\n var runCnt = 0;\r\n var runLen = 0;\r\n var vertCnt = 0;\r\n var len = textRuns.length;\r\n var textrun;\r\n var thisChar;\r\n for (i = 0; i < len; i++) {\r\n textrun = textRuns[i];\r\n font_size = textrun[0];\r\n drawMode = textrun[1];\r\n ypos = textrun[2];\r\n runLen = textrun.length;\r\n for (runCnt = 3; runCnt < runLen; runCnt += 2) {\r\n charCode = textrun[runCnt];\r\n xpos = textrun[runCnt + 1];\r\n thisChar = this.getChar(charCode.toString());\r\n if ((drawMode == DrawMode.BOTH) || (drawMode == DrawMode.STROKE)) {\r\n if (output_verts[i * 2] == null) {\r\n throw (\"Trying to render strokes for a textrun, but no output_vert list was set for this textrun strokes\");\r\n }\r\n }\r\n if ((drawMode == DrawMode.BOTH) || (drawMode == DrawMode.FILL)) {\r\n if (output_verts[i * 2 + 1] == null) {\r\n throw (\"Trying to render fills for a textrun, but no output_vert list was set for this textrun fills\");\r\n }\r\n }\r\n }\r\n }\r\n };\r\n return TesselatedFontTable;\r\n}(AssetBase));\r\nexport { TesselatedFontTable };\r\nTesselatedFontTable.assetType = \"[asset TesselatedFontTable]\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/text/TesselatedFontTable.js","/**\r\n * The TextFieldAutoSize class is an enumeration of constant values used in\r\n * setting theautoSize property of the TextField class.\r\n */\r\nvar TextFieldAutoSize = (function () {\r\n function TextFieldAutoSize() {\r\n }\r\n return TextFieldAutoSize;\r\n}());\r\nexport { TextFieldAutoSize };\r\n/**\r\n * Specifies that the text is to be treated as center-justified text. Any\r\n * resizing of a single line of a text field is equally distributed to both\r\n * the right and left sides.\r\n */\r\nTextFieldAutoSize.CENTER = \"center\";\r\n/**\r\n * Specifies that the text is to be treated as left-justified text, meaning\r\n * that the left side of the text field remains fixed and any resizing of a\r\n * single line is on the right side.\r\n */\r\nTextFieldAutoSize.LEFT = \"left\";\r\n/**\r\n * Specifies that no resizing is to occur.\r\n */\r\nTextFieldAutoSize.NONE = \"none\";\r\n/**\r\n * Specifies that the text is to be treated as right-justified text, meaning\r\n * that the right side of the text field remains fixed and any resizing of a\r\n * single line is on the left side.\r\n */\r\nTextFieldAutoSize.RIGHT = \"right\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/text/TextFieldAutoSize.js","/**\r\n * The TextFieldType class is an enumeration of constant values used in setting the\r\n * type property of the TextField class.\r\n *\r\n * @see away.entities.TextField#type\r\n */\r\nvar TextFieldType = (function () {\r\n function TextFieldType() {\r\n }\r\n return TextFieldType;\r\n}());\r\nexport { TextFieldType };\r\n/**\r\n * Used to specify a dynamic TextField.\r\n */\r\nTextFieldType.DYNAMIC = \"dynamic\";\r\n/**\r\n * Used to specify an input TextField.\r\n */\r\nTextFieldType.INPUT = \"input\";\r\n/**\r\n * Used to specify an static TextField.\r\n */\r\nTextFieldType.STATIC = \"input\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/text/TextFieldType.js","import * as tslib_1 from \"tslib\";\r\nimport { AssetBase } from \"@awayjs/core\";\r\nimport { TesselatedFontTable } from \"./TesselatedFontTable\";\r\n/**\r\n * The TextFormat class represents character formatting information. Use the\r\n * TextFormat class to create specific text formatting for text fields. You\r\n * can apply text formatting to both static and dynamic text fields. The\r\n * properties of the TextFormat class apply to device and embedded fonts.\r\n * However, for embedded fonts, bold and italic text actually require specific\r\n * fonts. If you want to display bold or italic text with an embedded font,\r\n * you need to embed the bold and italic variations of that font.\r\n *\r\n * You must use the constructor new TextFormat() to create a\r\n * TextFormat object before setting its properties. When you apply a\r\n * TextFormat object to a text field using the\r\n * TextField.defaultTextFormat property or the\r\n * TextField.setTextFormat() method, only its defined properties\r\n * are applied. Use the TextField.defaultTextFormat property to\r\n * apply formatting BEFORE you add text to the TextField, and the\r\n * setTextFormat() method to add formatting AFTER you add text to\r\n * the TextField. The TextFormat properties are null\r\n * by default because if you don't provide values for the properties, Flash\r\n * Player uses its own default formatting. The default formatting that Flash\r\n * Player uses for each property(if property's value is null) is\r\n * as follows:
The default formatting for each property is also described in each\r\n * property description.
\r\n */\r\nvar TextFormat = (function (_super) {\r\n tslib_1.__extends(TextFormat, _super);\r\n /**\r\n * Creates a TextFormat object with the specified properties. You can then\r\n * change the properties of the TextFormat object to change the formatting of\r\n * text fields.\r\n *\r\n *Any parameter may be set to null to indicate that it is\r\n * not defined. All of the parameters are optional; any omitted parameters\r\n * are treated as null.
url is an empty string, the\r\n * text does not have a hyperlink.\r\n * @param target The target window where the hyperlink is displayed. If\r\n * the target window is an empty string, the text is\r\n * displayed in the default target window\r\n * _self. If the url parameter\r\n * is set to an empty string or to the value\r\n * null, you can get or set this property,\r\n * but the property will have no effect.\r\n * @param align The alignment of the paragraph, as a TextFormatAlign\r\n * value.\r\n * @param leftMargin Indicates the left margin of the paragraph, in pixels.\r\n * @param rightMargin Indicates the right margin of the paragraph, in pixels.\r\n * @param indent An integer that indicates the indentation from the left\r\n * margin to the first character in the paragraph.\r\n * @param leading A number that indicates the amount of leading vertical\r\n * space between lines.\r\n */\r\n function TextFormat(font, size, color, bold, italic, underline, url, link_target, align, leftMargin, rightMargin, indent, leading) {\r\n if (font === void 0) { font = \"Times New Roman\"; }\r\n if (size === void 0) { size = 12; }\r\n if (color === void 0) { color = 0x000000; }\r\n if (bold === void 0) { bold = false; }\r\n if (italic === void 0) { italic = false; }\r\n if (underline === void 0) { underline = false; }\r\n if (url === void 0) { url = \"\"; }\r\n if (link_target === void 0) { link_target = \"\"; }\r\n if (align === void 0) { align = \"left\"; }\r\n if (leftMargin === void 0) { leftMargin = 0; }\r\n if (rightMargin === void 0) { rightMargin = 0; }\r\n if (indent === void 0) { indent = 0; }\r\n if (leading === void 0) { leading = 0; }\r\n var _this = _super.call(this) || this;\r\n /**\r\n * Specifies custom tab stops as an array of non-negative integers. Each tab\r\n * stop is specified in pixels. If custom tab stops are not specified\r\n * (null), the default tab stop is 4(average character width).\r\n */\r\n //todo: not used with in tesselated-font-table yet\r\n _this.tabStops = [];\r\n _this.font_name = font;\r\n _this.size = size;\r\n _this.color = color;\r\n _this.bold = bold;\r\n _this.italic = italic;\r\n _this.underline = underline;\r\n _this.url = url;\r\n _this.link_target = link_target;\r\n _this.align = align;\r\n _this.leftMargin = leftMargin;\r\n _this.rightMargin = rightMargin;\r\n _this.indent = indent;\r\n _this.leading = leading;\r\n _this.letterSpacing = 0;\r\n // todo: implement a way to supply a default fonttable / font to formats\r\n _this.font_table = new TesselatedFontTable();\r\n return _this;\r\n }\r\n Object.defineProperty(TextFormat.prototype, \"size\", {\r\n get: function () {\r\n return this._size;\r\n },\r\n set: function (value) {\r\n this._size = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TextFormat.prototype, \"assetType\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return TextFormat.assetType;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n return TextFormat;\r\n}(AssetBase));\r\nexport { TextFormat };\r\nTextFormat.assetType = \"[asset TextFormat]\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/text/TextFormat.js","var TextShape = (function () {\r\n function TextShape() {\r\n this.verts = [];\r\n }\r\n return TextShape;\r\n}());\r\nexport { TextShape };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/text/TextShape.js","import * as tslib_1 from \"tslib\";\r\nimport { AttributesView, Float2Attributes, Matrix, Matrix3D, ColorTransform } from \"@awayjs/core\";\r\nimport { Sampler2D, Style, Graphics, Shape, TriangleElements } from \"@awayjs/graphics\";\r\nimport { HierarchicalProperties } from \"../base/HierarchicalProperties\";\r\nimport { AlignmentMode } from \"../base/AlignmentMode\";\r\nimport { TesselatedFontTable } from \"../text/TesselatedFontTable\";\r\nimport { TextFieldAutoSize } from \"../text/TextFieldAutoSize\";\r\nimport { TextFieldType } from \"../text/TextFieldType\";\r\nimport { TextFormat } from \"../text/TextFormat\";\r\nimport { DisplayObject } from \"./DisplayObject\";\r\nimport { TextShape } from \"../text/TextShape\";\r\n/**\r\n * The TextField class is used to create display objects for text display and\r\n * input. To create a text field dynamically, use the TextField()\r\n * constructor.
The methods of the TextField class let you set, select, and manipulate\r\n * text in a dynamic or input text field that you create during authoring or\r\n * at runtime.
\r\n *\r\n *ActionScript provides several ways to format your text at runtime. The\r\n * TextFormat class lets you set character and paragraph formatting for\r\n * TextField objects. You can apply Cascading Style Sheets(CSS) styles to\r\n * text fields by using the TextField.styleSheet property and the\r\n * StyleSheet class. You can use CSS to style built-in HTML tags, define new\r\n * formatting tags, or apply styles. You can assign HTML formatted text, which\r\n * optionally uses CSS styles, directly to a text field. HTML text that you\r\n * assign to a text field can contain embedded media(movie clips, SWF files,\r\n * GIF files, PNG files, and JPEG files). The text wraps around the embedded\r\n * media in the same way that a web browser wraps text around media embedded\r\n * in an HTML document.
Flash Player supports a subset of HTML tags that you can use to format\r\n * text. See the list of supported HTML tags in the description of the\r\n * htmlText property.
textInput event, which is\r\n * dispatched before the value is modified.\r\n * Unlike the W3C DOM Event Model version of\r\n * the change event, which\r\n * dispatches the event only after the\r\n * control loses focus, the ActionScript 3.0\r\n * version of the change event\r\n * is dispatched any time the control\r\n * changes. For example, if a user types text\r\n * into a text field, a change\r\n * event is dispatched after every keystroke.\r\n * @event link Dispatched when a user clicks a hyperlink\r\n * in an HTML-enabled text field, where the\r\n * URL begins with \"event:\". The remainder of\r\n * the URL after \"event:\" is placed in the\r\n * text property of the LINK event.\r\n *\r\n * Note: The default behavior,\r\n * adding the text to the text field, occurs\r\n * only when Flash Player generates the\r\n * event, which in this case happens when a\r\n * user attempts to input text. You cannot\r\n * put text into a text field by sending it\r\n * textInput events.
textInput event when a user\r\n * enters one or more characters of text.\r\n * Various text input methods can generate\r\n * this event, including standard keyboards,\r\n * input method editors(IMEs), voice or\r\n * speech recognition systems, and even the\r\n * act of pasting plain text with no\r\n * formatting or style information.\r\n * @event textInteractionModeChange Flash Player dispatches the\r\n * textInteractionModeChange\r\n * event when a user changes the interaction\r\n * mode of a text field. for example on\r\n * Android, one can toggle from NORMAL mode\r\n * to SELECTION mode using context menu\r\n * options\r\n */\r\nvar TextField = (function (_super) {\r\n tslib_1.__extends(TextField, _super);\r\n /**\r\n * Creates a new TextField instance. After you create the TextField instance,\r\n * call the addChild() or addChildAt() method of\r\n * the parent DisplayObjectContainer object to add the TextField instance to\r\n * the display list.\r\n *\r\n * The default size for a text field is 100 x 100 pixels.
\r\n */\r\n function TextField() {\r\n var _this = _super.call(this) || this;\r\n _this._line_indices = [];\r\n _this._text = \"\";\r\n _this._textDirty = false; // if text is dirty, the text-content or the text-size has changed, and we need to recalculate word-width\r\n _this._positionsDirty = false; // if formatting is dirty, we need to recalculate text-positions / size\r\n _this._glyphsDirty = false; // if glyphs are dirty, we need to recollect the glyphdata and build the text-graphics. this should ony be done max once a frame\r\n _this.chars_codes = []; // stores charcode per char\r\n _this.chars_width = []; // stores charcode per char\r\n _this.words = []; // stores offset and length and width for each word\r\n _this._textRuns_formats = []; // stores textFormat for each textrun\r\n _this._textRuns_words = []; // stores words-offset, word-count and width for each textrun\r\n _this._maxWidthLine = 0;\r\n _this.textShapes = {};\r\n _this._textColor = -1;\r\n _this._width = 100;\r\n _this._height = 100;\r\n _this._textWidth = 0;\r\n _this._textHeight = 0;\r\n _this.type = TextFieldType.STATIC;\r\n _this._numLines = 0;\r\n _this.multiline = false;\r\n _this.selectable = true;\r\n _this._autoSize = TextFieldAutoSize.NONE;\r\n _this._wordWrap = false;\r\n _this._background = false;\r\n _this._backgroundColor = 0xffffff;\r\n _this._border = false;\r\n _this._borderColor = 0x000000;\r\n _this._graphics = Graphics.getGraphics(_this); //unique graphics object for each TextField\r\n return _this;\r\n }\r\n TextField.getNewTextField = function () {\r\n return (TextField._textFields.length) ? TextField._textFields.pop() : new TextField();\r\n };\r\n TextField.prototype.getTextShapeForIdentifierAndFormat = function (id, format) {\r\n if (this.textShapes.hasOwnProperty(id)) {\r\n return this.textShapes[id];\r\n }\r\n this.textShapes[id] = new TextShape();\r\n this.textShapes[id].format = format;\r\n return this.textShapes[id];\r\n };\r\n Object.defineProperty(TextField.prototype, \"autoSize\", {\r\n get: function () {\r\n return this._autoSize;\r\n },\r\n set: function (value) {\r\n if (this._autoSize == value)\r\n return;\r\n this._autoSize = value;\r\n this._positionsDirty = true;\r\n if (this._autoSize != TextFieldAutoSize.NONE)\r\n this._pInvalidateBounds();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n TextField.prototype._pUpdateBoxBounds = function () {\r\n _super.prototype._pUpdateBoxBounds.call(this);\r\n this.reConstruct();\r\n this._pBoxBounds.x = 0;\r\n this._pBoxBounds.y = 0;\r\n this._pBoxBounds.width = this._width;\r\n this._pBoxBounds.height = this._height;\r\n };\r\n TextField.prototype.getBox = function (targetCoordinateSpace) {\r\n if (targetCoordinateSpace === void 0) { targetCoordinateSpace = null; }\r\n //TODO targetCoordinateSpace\r\n if (this._boxBoundsInvalid)\r\n this._pUpdateBoxBounds();\r\n if (targetCoordinateSpace == null || targetCoordinateSpace == this)\r\n return this._pBoxBounds;\r\n if (targetCoordinateSpace == this._pParent) {\r\n if (this._registrationMatrix3D) {\r\n if (this._tempTransform == null)\r\n this._tempTransform = new Matrix3D();\r\n this._tempTransform.copyFrom(this._transform.matrix3D);\r\n this._tempTransform.prepend(this._registrationMatrix3D);\r\n if (this.alignmentMode != AlignmentMode.REGISTRATION_POINT)\r\n this._tempTransform.appendTranslation(-this._registrationMatrix3D._rawData[12] * this._transform.scale.x, -this._registrationMatrix3D._rawData[13] * this._transform.scale.y, -this._registrationMatrix3D._rawData[14] * this._transform.scale.z);\r\n return this._tempTransform.transformBox(this._pBoxBounds);\r\n }\r\n return this._transform.matrix3D.transformBox(this._pBoxBounds);\r\n }\r\n else\r\n return targetCoordinateSpace.transform.inverseConcatenatedMatrix3D.transformBox(this.transform.concatenatedMatrix3D.transformBox(this._pBoxBounds));\r\n };\r\n Object.defineProperty(TextField.prototype, \"assetType\", {\r\n /**\r\n *\r\n * @returns {string}\r\n */\r\n get: function () {\r\n return TextField.assetType;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TextField.prototype, \"background\", {\r\n get: function () {\r\n return this._background;\r\n },\r\n set: function (value) {\r\n this._background = value;\r\n this._glyphsDirty = true;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TextField.prototype, \"backgroundColor\", {\r\n get: function () {\r\n return this._backgroundColor;\r\n },\r\n set: function (value) {\r\n this._backgroundColor = value;\r\n this._glyphsDirty = true;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TextField.prototype, \"border\", {\r\n get: function () {\r\n return this._border;\r\n },\r\n set: function (value) {\r\n this._border = value;\r\n this._glyphsDirty = true;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TextField.prototype, \"borderColor\", {\r\n get: function () {\r\n return this._borderColor;\r\n },\r\n set: function (value) {\r\n this._borderColor = value;\r\n this._glyphsDirty = true;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TextField.prototype, \"bottomScrollV\", {\r\n /**\r\n * An integer(1-based index) that indicates the bottommost line that is\r\n * currently visible in the specified text field. Think of the text field as\r\n * a window onto a block of text. ThescrollV property is the\r\n * 1-based index of the topmost visible line in the window.\r\n *\r\n * All the text between the lines indicated by scrollV and\r\n * bottomScrollV is currently visible in the text field.
Selection span indexes are zero-based(for example, the first position\r\n * is 0, the second position is 1, and so on).
\r\n */\r\n get: function () {\r\n return this._caretIndex;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TextField.prototype, \"defaultTextFormat\", {\r\n get: function () {\r\n if (this._defaultTextFormat == null) {\r\n this._defaultTextFormat = new TextFormat();\r\n }\r\n return this._defaultTextFormat;\r\n },\r\n set: function (value) {\r\n if (this._defaultTextFormat == value)\r\n return;\r\n this._defaultTextFormat = value;\r\n this._textDirty = true;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TextField.prototype, \"height\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n if (this._autoSize != TextFieldAutoSize.NONE)\r\n this.reConstruct();\r\n return this._height;\r\n },\r\n set: function (val) {\r\n if (this._height == val)\r\n return;\r\n if (this._autoSize != TextFieldAutoSize.NONE)\r\n return;\r\n this._height = val;\r\n this._positionsDirty = true;\r\n this._pInvalidateBounds();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TextField.prototype, \"length\", {\r\n /**\r\n * The number of characters in a text field. A character such as tab\r\n * (\\t) counts as one character.\r\n */\r\n get: function () {\r\n return this._text.length;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * The maximum value of scrollH.\r\n */\r\n TextField.prototype.maxScrollH = function () {\r\n return this._maxScrollH;\r\n };\r\n /**\r\n * The maximum value of scrollV.\r\n */\r\n TextField.prototype.maxScrollV = function () {\r\n return this._maxScrollV;\r\n };\r\n Object.defineProperty(TextField.prototype, \"numLines\", {\r\n /**\r\n * Defines the number of text lines in a multiline text field. If\r\n * wordWrap property is set to true, the number of\r\n * lines increases when text wraps.\r\n */\r\n get: function () {\r\n this.reConstruct();\r\n return this._numLines;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TextField.prototype, \"selectionBeginIndex\", {\r\n /**\r\n * The zero-based character index value of the first character in the current\r\n * selection. For example, the first character is 0, the second character is\r\n * 1, and so on. If no text is selected, this property is the value of\r\n * caretIndex.\r\n */\r\n get: function () {\r\n return this._selectionBeginIndex;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TextField.prototype, \"selectionEndIndex\", {\r\n /**\r\n * The zero-based character index value of the last character in the current\r\n * selection. For example, the first character is 0, the second character is\r\n * 1, and so on. If no text is selected, this property is the value of\r\n * caretIndex.\r\n */\r\n get: function () {\r\n return this._selectionEndIndex;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(TextField.prototype, \"text\", {\r\n /**\r\n * A string that is the current text in the text field. Lines are separated\r\n * by the carriage return character('\\r', ASCII 13). This\r\n * property contains unformatted text in the text field, without HTML tags.\r\n *\r\n * To get the text in HTML form, use the htmlText\r\n * property.
Scaling the local coordinate system changes the x and\r\n * y property values, which are defined in whole pixels.
Scaling the local coordinate system changes the x and\r\n * y property values, which are defined in whole pixels.
newText parameter to the\r\n * end of the text of the text field. This method is more efficient than an\r\n * addition assignment(+=) on a text property\r\n * (such as someTextField.text += moreText), particularly for a\r\n * text field that contains a significant amount of content.\r\n *\r\n * @param newText The string to append to the existing text.\r\n */\r\n TextField.prototype.appendText = function (newText) {\r\n this._text += newText;\r\n this._textDirty = true;\r\n if (this._autoSize != TextFieldAutoSize.NONE)\r\n this._pInvalidateBounds();\r\n };\r\n /**\r\n * *tells the Textfield that a paragraph is defined completly.\r\n * e.g. the textfield will start a new line for future added text.\r\n */\r\n TextField.prototype.closeParagraph = function () {\r\n this._text += \"\\n\";\r\n this._textDirty = true;\r\n //TODO\r\n if (this._autoSize != TextFieldAutoSize.NONE)\r\n this._pInvalidateBounds();\r\n };\r\n /**\r\n * Returns a rectangle that is the bounding box of the character.\r\n *\r\n * @param charIndex The zero-based index value for the character(for\r\n * example, the first position is 0, the second position is\r\n * 1, and so on).\r\n * @return A rectangle with x and y minimum and\r\n * maximum values defining the bounding box of the character.\r\n */\r\n TextField.prototype.getCharBoundaries = function (charIndex) {\r\n return this._charBoundaries;\r\n };\r\n /**\r\n * Returns the zero-based index value of the character at the point specified\r\n * by the x and y parameters.\r\n *\r\n * @param x The x coordinate of the character.\r\n * @param y The y coordinate of the character.\r\n * @return The zero-based index value of the character(for example, the\r\n * first position is 0, the second position is 1, and so on). Returns\r\n * -1 if the point is not over any character.\r\n */\r\n TextField.prototype.getCharIndexAtPoint = function (x, y) {\r\n return this._charIndexAtPoint;\r\n };\r\n /**\r\n * Given a character index, returns the index of the first character in the\r\n * same paragraph.\r\n *\r\n * @param charIndex The zero-based index value of the character(for example,\r\n * the first character is 0, the second character is 1, and\r\n * so on).\r\n * @return The zero-based index value of the first character in the same\r\n * paragraph.\r\n * @throws RangeError The character index specified is out of range.\r\n */\r\n TextField.prototype.getFirstCharInParagraph = function (charIndex /*int*/) {\r\n return this._firstCharInParagraph;\r\n };\r\n /**\r\n * Returns a DisplayObject reference for the given id, for an\r\n * image or SWF file that has been added to an HTML-formatted text field by\r\n * using an ![]()
![]()
id to match(in the id attribute\r\n * of the ![]()
id attribute in the ![]()
![]()
id exists, the method returns\r\n * null.\r\n */\r\n TextField.prototype.getImageReference = function (id) {\r\n return this._imageReference;\r\n };\r\n /**\r\n * Returns the zero-based index value of the line at the point specified by\r\n * the x and y parameters.\r\n *\r\n * @param x The x coordinate of the line.\r\n * @param y The y coordinate of the line.\r\n * @return The zero-based index value of the line(for example, the first\r\n * line is 0, the second line is 1, and so on). Returns -1 if the\r\n * point is not over any line.\r\n */\r\n TextField.prototype.getLineIndexAtPoint = function (x, y) {\r\n return this._lineIndexAtPoint;\r\n };\r\n /**\r\n * Returns the zero-based index value of the line containing the character\r\n * specified by the charIndex parameter.\r\n *\r\n * @param charIndex The zero-based index value of the character(for example,\r\n * the first character is 0, the second character is 1, and\r\n * so on).\r\n * @return The zero-based index value of the line.\r\n * @throws RangeError The character index specified is out of range.\r\n */\r\n TextField.prototype.getLineIndexOfChar = function (charIndex /*int*/) {\r\n return this._lineIndexOfChar;\r\n };\r\n /**\r\n * Returns the number of characters in a specific text line.\r\n *\r\n * @param lineIndex The line number for which you want the length.\r\n * @return The number of characters in the line.\r\n * @throws RangeError The line number specified is out of range.\r\n */\r\n TextField.prototype.getLineLength = function (lineIndex /*int*/) {\r\n return this._lineLength;\r\n };\r\n /**\r\n * Returns metrics information about a given text line.\r\n *\r\n * @param lineIndex The line number for which you want metrics information.\r\n * @return A TextLineMetrics object.\r\n * @throws RangeError The line number specified is out of range.\r\n */\r\n TextField.prototype.getLineMetrics = function (lineIndex /*int*/) {\r\n return this._lineMetrics;\r\n };\r\n /**\r\n * Returns the character index of the first character in the line that the\r\n * lineIndex parameter specifies.\r\n *\r\n * @param lineIndex The zero-based index value of the line(for example, the\r\n * first line is 0, the second line is 1, and so on).\r\n * @return The zero-based index value of the first character in the line.\r\n * @throws RangeError The line number specified is out of range.\r\n */\r\n TextField.prototype.getLineOffset = function (lineIndex /*int*/) {\r\n return this._lineOffset;\r\n };\r\n /**\r\n * Returns the text of the line specified by the lineIndex\r\n * parameter.\r\n *\r\n * @param lineIndex The zero-based index value of the line(for example, the\r\n * first line is 0, the second line is 1, and so on).\r\n * @return The text string contained in the specified line.\r\n * @throws RangeError The line number specified is out of range.\r\n */\r\n TextField.prototype.getLineText = function (lineIndex /*int*/) {\r\n return this._lineText;\r\n };\r\n /**\r\n * Given a character index, returns the length of the paragraph containing\r\n * the given character. The length is relative to the first character in the\r\n * paragraph(as returned by getFirstCharInParagraph()), not to\r\n * the character index passed in.\r\n *\r\n * @param charIndex The zero-based index value of the character(for example,\r\n * the first character is 0, the second character is 1, and\r\n * so on).\r\n * @return Returns the number of characters in the paragraph.\r\n * @throws RangeError The character index specified is out of range.\r\n */\r\n TextField.prototype.getParagraphLength = function (charIndex /*int*/) {\r\n return this._paragraphLength;\r\n };\r\n /**\r\n * Returns a TextFormat object that contains formatting information for the\r\n * range of text that the beginIndex and endIndex\r\n * parameters specify. Only properties that are common to the entire text\r\n * specified are set in the resulting TextFormat object. Any property that is\r\n * mixed, meaning that it has different values at different points in\r\n * the text, has a value of null.\r\n *\r\n * If you do not specify values for these parameters, this method is\r\n * applied to all the text in the text field.
\r\n *\r\n *The following table describes three possible usages:
\r\n *\r\n * @return The TextFormat object that represents the formatting properties\r\n * for the specified text.\r\n * @throws RangeError ThebeginIndex or endIndex\r\n * specified is out of range.\r\n */\r\n TextField.prototype.getTextFormat = function (beginIndex, endIndex) {\r\n if (beginIndex === void 0) { beginIndex = -1; }\r\n if (endIndex === void 0) { endIndex = -1; }\r\n return this._textFormat;\r\n };\r\n /**\r\n * Replaces the current selection with the contents of the value\r\n * parameter. The text is inserted at the position of the current selection,\r\n * using the current default character format and default paragraph format.\r\n * The text is not treated as HTML.\r\n *\r\n * You can use the replaceSelectedText() method to insert and\r\n * delete text without disrupting the character and paragraph formatting of\r\n * the rest of the text.
Note: This method does not work if a style sheet is applied to\r\n * the text field.
\r\n *\r\n * @param value The string to replace the currently selected text.\r\n * @throws Error This method cannot be used on a text field with a style\r\n * sheet.\r\n */\r\n TextField.prototype.replaceSelectedText = function (value) {\r\n };\r\n /**\r\n * Replaces the range of characters that thebeginIndex and\r\n * endIndex parameters specify with the contents of the\r\n * newText parameter. As designed, the text from\r\n * beginIndex to endIndex-1 is replaced.\r\n *\r\n * Note: This method does not work if a style sheet is applied to\r\n * the text field.
\r\n *\r\n * @param beginIndex The zero-based index value for the start position of the\r\n * replacement range.\r\n * @param endIndex The zero-based index position of the first character\r\n * after the desired text span.\r\n * @param newText The text to use to replace the specified range of\r\n * characters.\r\n * @throws Error This method cannot be used on a text field with a style\r\n * sheet.\r\n */\r\n TextField.prototype.replaceText = function (beginIndex /*int*/, endIndex /*int*/, newText) {\r\n };\r\n /**\r\n * Sets as selected the text designated by the index values of the first and\r\n * last characters, which are specified with thebeginIndex and\r\n * endIndex parameters. If the two parameter values are the\r\n * same, this method sets the insertion point, as if you set the\r\n * caretIndex property.\r\n *\r\n * @param beginIndex The zero-based index value of the first character in the\r\n * selection(for example, the first character is 0, the\r\n * second character is 1, and so on).\r\n * @param endIndex The zero-based index value of the last character in the\r\n * selection.\r\n */\r\n TextField.prototype.setSelection = function (beginIndex /*int*/, endIndex /*int*/) {\r\n };\r\n /**\r\n * Applies the text formatting that the format parameter\r\n * specifies to the specified text in a text field. The value of\r\n * format must be a TextFormat object that specifies the desired\r\n * text formatting changes. Only the non-null properties of\r\n * format are applied to the text field. Any property of\r\n * format that is set to null is not applied. By\r\n * default, all of the properties of a newly created TextFormat object are\r\n * set to null.\r\n *\r\n * Note: This method does not work if a style sheet is applied to\r\n * the text field.
\r\n *\r\n *The setTextFormat() method changes the text formatting\r\n * applied to a range of characters or to the entire body of text in a text\r\n * field. To apply the properties of format to all text in the text field, do\r\n * not specify values for beginIndex and endIndex.\r\n * To apply the properties of the format to a range of text, specify values\r\n * for the beginIndex and the endIndex parameters.\r\n * You can use the length property to determine the index\r\n * values.
The two types of formatting information in a TextFormat object are\r\n * character level formatting and paragraph level formatting. Each character\r\n * in a text field can have its own character formatting settings, such as\r\n * font name, font size, bold, and italic.
\r\n *\r\n *For paragraphs, the first character of the paragraph is examined for\r\n * the paragraph formatting settings for the entire paragraph. Examples of\r\n * paragraph formatting settings are left margin, right margin, and\r\n * indentation.
\r\n *\r\n *Any text inserted manually by the user, or replaced by the\r\n * replaceSelectedText() method, receives the default text field\r\n * formatting for new text, and not the formatting specified for the text\r\n * insertion point. To set the default formatting for new text, use\r\n * defaultTextFormat.
beginIndex or endIndex\r\n * specified is out of range.\r\n */\r\n TextField.prototype.setTextFormat = function (format, beginIndex, endIndex) {\r\n if (beginIndex === void 0) { beginIndex = -1; }\r\n if (endIndex === void 0) { endIndex = -1; }\r\n };\r\n /**\r\n * Returns true if an embedded font is available with the specified\r\n * fontName and fontStyle where\r\n * Font.fontType is flash.text.FontType.EMBEDDED.\r\n * Starting with Flash Player 10, two kinds of embedded fonts can appear in a\r\n * SWF file. Normal embedded fonts are only used with TextField objects. CFF\r\n * embedded fonts are only used with the flash.text.engine classes. The two\r\n * types are distinguished by the fontType property of the\r\n * Font class, as returned by the enumerateFonts()\r\n * function.\r\n *\r\n * TextField cannot use a font of type EMBEDDED_CFF. If\r\n * embedFonts is set to true and the only font\r\n * available at run time with the specified name and style is of type\r\n * EMBEDDED_CFF, Flash Player fails to render the text, as if no\r\n * embedded font were available with the specified name and style.
If both EMBEDDED and EMBEDDED_CFF fonts are\r\n * available with the same name and style, the EMBEDDED font is\r\n * selected and text renders with the EMBEDDED font.
flash.text.FontStyle\r\n * @return true if a compatible embedded font is available,\r\n * otherwise false.\r\n * @throws ArgumentError The fontStyle specified is not a member\r\n * of flash.text.FontStyle.\r\n */\r\n TextField.isFontCompatible = function (fontName, fontStyle) {\r\n return false;\r\n };\r\n TextField.prototype.clone = function () {\r\n var newInstance = TextField.getNewTextField();\r\n this.copyTo(newInstance);\r\n return newInstance;\r\n };\r\n TextField.prototype.copyTo = function (newInstance) {\r\n _super.prototype.copyTo.call(this, newInstance);\r\n newInstance.width = this._width;\r\n newInstance.height = this._height;\r\n newInstance.textFormat = this._textFormat;\r\n //newInstance.textColor = this._textColor;\r\n newInstance.text = this._text;\r\n };\r\n return TextField;\r\n}(DisplayObject));\r\nexport { TextField };\r\nTextField._textFields = [];\r\nTextField.assetType = \"[asset TextField]\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/display/TextField.js","import * as tslib_1 from \"tslib\";\r\nimport { AssetEvent } from \"@awayjs/core\";\r\nimport { Timeline } from \"../base/Timeline\";\r\nimport { MouseEvent } from \"../events/MouseEvent\";\r\nimport { FrameScriptManager } from \"../managers/FrameScriptManager\";\r\nimport { Sprite } from \"./Sprite\";\r\nimport { TextField } from \"./TextField\";\r\nvar MovieClip = (function (_super) {\r\n tslib_1.__extends(MovieClip, _super);\r\n function MovieClip(timeline) {\r\n if (timeline === void 0) { timeline = null; }\r\n var _this = _super.call(this) || this;\r\n _this._isButton = false;\r\n _this._time = 0; // the current time inside the animation\r\n _this._currentFrameIndex = -1; // the current frame\r\n _this._isPlaying = true; // false if paused or stopped\r\n _this._isInit = true;\r\n _this._potentialInstances = [];\r\n _this._depth_sessionIDs = {};\r\n _this._sessionID_childs = {};\r\n /**\r\n *\r\n */\r\n _this.loop = true;\r\n /**\r\n * the current index of the current active frame\r\n */\r\n _this.constructedKeyFrameIndex = -1;\r\n _this._enterFrame = new AssetEvent(AssetEvent.ENTER_FRAME, _this);\r\n _this.inheritColorTransform = true;\r\n // todo: allow to set cursor-types for movieclip\r\n _this._onMouseOver = function (event) {\r\n document.body.style.cursor = \"pointer\";\r\n _this.currentFrameIndex = 1;\r\n };\r\n _this._onMouseOut = function (event) {\r\n document.body.style.cursor = \"initial\";\r\n _this.currentFrameIndex = 0;\r\n };\r\n _this._onMouseDown = function (event) {\r\n document.body.style.cursor = \"initial\";\r\n _this.currentFrameIndex = 2;\r\n };\r\n _this._onMouseUp = function (event) {\r\n document.body.style.cursor = \"initial\";\r\n _this.currentFrameIndex = _this.currentFrameIndex == 0 ? 0 : 1;\r\n };\r\n _this._timeline = timeline || new Timeline();\r\n return _this;\r\n }\r\n MovieClip.getNewMovieClip = function (timeline) {\r\n if (timeline === void 0) { timeline = null; }\r\n return (MovieClip._movieClips.length) ? MovieClip._movieClips.pop() : new MovieClip(timeline);\r\n };\r\n MovieClip.prototype.dispose = function () {\r\n this.disposeValues();\r\n MovieClip._movieClips.push(this);\r\n };\r\n MovieClip.prototype.disposeValues = function () {\r\n _super.prototype.disposeValues.call(this);\r\n this._potentialInstances = [];\r\n this._depth_sessionIDs = {};\r\n this._sessionID_childs = {};\r\n };\r\n MovieClip.prototype.reset_textclones = function () {\r\n if (this.timeline) {\r\n var len = this._potentialInstances.length;\r\n for (var i = 0; i < len; i++) {\r\n if (this._potentialInstances[i] != null) {\r\n if (this._potentialInstances[i].isAsset(TextField))\r\n this._potentialInstances[i].text = this.timeline.getPotentialChildPrototype(i).text;\r\n else if (this._potentialInstances[i].isAsset(MovieClip))\r\n this._potentialInstances[i].reset_textclones();\r\n }\r\n }\r\n }\r\n };\r\n Object.defineProperty(MovieClip.prototype, \"isInit\", {\r\n get: function () {\r\n return this._isInit;\r\n },\r\n set: function (value) {\r\n this._isInit = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(MovieClip.prototype, \"timeline\", {\r\n get: function () {\r\n return this._timeline;\r\n },\r\n set: function (value) {\r\n this._timeline = value;\r\n this.reset();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(MovieClip.prototype, \"numFrames\", {\r\n get: function () {\r\n return this._timeline.numFrames;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n MovieClip.prototype.jumpToLabel = function (label) {\r\n // the timeline.jumpTolabel will set currentFrameIndex\r\n this._timeline.jumpToLabel(this, label);\r\n };\r\n MovieClip.prototype.reset = function () {\r\n _super.prototype.reset.call(this);\r\n // time only is relevant for the root mc, as it is the only one that executes the update function\r\n this._time = 0;\r\n if (this._adapter)\r\n this.adapter.freeFromScript();\r\n this.constructedKeyFrameIndex = -1;\r\n for (var i = this.numChildren - 1; i >= 0; i--)\r\n this.removeChildAt(i);\r\n this._skipAdvance = MovieClip._skipAdvance;\r\n var numFrames = this._timeline.keyframe_indices.length;\r\n this._isPlaying = Boolean(numFrames > 1);\r\n if (numFrames) {\r\n this._currentFrameIndex = 0;\r\n this._timeline.constructNextFrame(this, true, true);\r\n }\r\n else {\r\n this._currentFrameIndex = -1;\r\n }\r\n };\r\n MovieClip.prototype.resetSessionIDs = function () {\r\n this._depth_sessionIDs = {};\r\n };\r\n Object.defineProperty(MovieClip.prototype, \"currentFrameIndex\", {\r\n /*\r\n * Setting the currentFrameIndex will move the playhead for this movieclip to the new position\r\n */\r\n get: function () {\r\n return this._currentFrameIndex;\r\n },\r\n set: function (value) {\r\n //if currentFrame is set greater than the available number of\r\n //frames, the playhead is moved to the last frame in the timeline.\r\n //But because the frame specified was not a keyframe, no scripts are\r\n //executed, even if they exist on the last frame.\r\n var skip_script = false;\r\n var numFrames = this._timeline.keyframe_indices.length;\r\n if (!numFrames)\r\n return;\r\n if (value < 0) {\r\n value = 0;\r\n }\r\n else if (value >= numFrames) {\r\n value = numFrames - 1;\r\n skip_script = true;\r\n }\r\n if (this._currentFrameIndex == value)\r\n return;\r\n this._currentFrameIndex = value;\r\n //changing current frame will ignore advance command for that\r\n //update's advanceFrame function, unless advanceFrame has\r\n //already been executed\r\n this._skipAdvance = MovieClip._skipAdvance;\r\n this._timeline.gotoFrame(this, value, skip_script);\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n MovieClip.prototype.addButtonListeners = function () {\r\n this._isButton = true;\r\n this.stop();\r\n this.addEventListener(MouseEvent.MOUSE_OVER, this._onMouseOver);\r\n this.addEventListener(MouseEvent.MOUSE_OUT, this._onMouseOut);\r\n this.addEventListener(MouseEvent.MOUSE_DOWN, this._onMouseDown);\r\n this.addEventListener(MouseEvent.MOUSE_UP, this._onMouseUp);\r\n };\r\n MovieClip.prototype.removeButtonListeners = function () {\r\n this.removeEventListener(MouseEvent.MOUSE_OVER, this._onMouseOver);\r\n this.removeEventListener(MouseEvent.MOUSE_OUT, this._onMouseOut);\r\n this.removeEventListener(MouseEvent.MOUSE_DOWN, this._onMouseDown);\r\n this.removeEventListener(MouseEvent.MOUSE_UP, this._onMouseUp);\r\n };\r\n MovieClip.prototype.getChildAtSessionID = function (sessionID) {\r\n return this._sessionID_childs[sessionID];\r\n };\r\n MovieClip.prototype.getSessionIDDepths = function () {\r\n return this._depth_sessionIDs;\r\n };\r\n MovieClip.prototype.addChildAtDepth = function (child, depth, replace) {\r\n if (replace === void 0) { replace = true; }\r\n child.reset(); // this takes care of transform and visibility\r\n return _super.prototype.addChildAtDepth.call(this, child, depth, replace);\r\n };\r\n MovieClip.prototype._addTimelineChildAt = function (child, depth, sessionID) {\r\n this._depth_sessionIDs[depth] = child._sessionID = sessionID;\r\n this._sessionID_childs[sessionID] = child;\r\n return this.addChildAtDepth(child, depth);\r\n };\r\n MovieClip.prototype.removeChildAtInternal = function (index) {\r\n var child = this._children[index];\r\n if (child._adapter)\r\n child.adapter.freeFromScript();\r\n this.adapter.unregisterScriptObject(child);\r\n //check to make sure _depth_sessionIDs wasn't modified with a new child\r\n if (this._depth_sessionIDs[child._depthID] == child._sessionID)\r\n delete this._depth_sessionIDs[child._depthID];\r\n delete this._sessionID_childs[child._sessionID];\r\n child._sessionID = -1;\r\n return _super.prototype.removeChildAtInternal.call(this, index);\r\n };\r\n Object.defineProperty(MovieClip.prototype, \"assetType\", {\r\n get: function () {\r\n return MovieClip.assetType;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * Starts playback of animation from current position\r\n */\r\n MovieClip.prototype.play = function () {\r\n if (this._timeline.keyframe_indices.length > 1)\r\n this._isPlaying = true;\r\n };\r\n /**\r\n * should be called right before the call to away3d-render.\r\n */\r\n MovieClip.prototype.update = function (events) {\r\n //if events is null, this is as2, if it is not null, this is as3web\r\n if (events === void 0) { events = null; }\r\n MovieClip._skipAdvance = true;\r\n if (events != null) {\r\n this.adapter.dispatchEvent(events[0]);\r\n }\r\n this.advanceFrame();\r\n MovieClip._skipAdvance = false;\r\n // after we advanced the scenegraph, we might have some script that needs executing\r\n FrameScriptManager.execute_queue();\r\n //this.dispatchEvent(this._enterFrame);\r\n // after we executed the onEnter, we might have some script that needs executing\r\n FrameScriptManager.execute_queue();\r\n // now we execute any intervals queued\r\n FrameScriptManager.execute_intervals();\r\n // finally, we execute any scripts that were added from intervals\r\n FrameScriptManager.execute_queue();\r\n //execute any disposes as a result of framescripts\r\n FrameScriptManager.execute_dispose();\r\n if (events != null) {\r\n this.adapter.dispatchEvent(events[1]);\r\n }\r\n };\r\n MovieClip.prototype.getPotentialChildInstance = function (id) {\r\n if (!this._potentialInstances[id])\r\n this._potentialInstances[id] = this._timeline.getPotentialChildInstance(id);\r\n return this._potentialInstances[id];\r\n };\r\n /**\r\n * Stop playback of animation and hold current position\r\n */\r\n MovieClip.prototype.stop = function () {\r\n this._isPlaying = false;\r\n };\r\n MovieClip.prototype.clone = function () {\r\n var newInstance = MovieClip.getNewMovieClip(this._timeline);\r\n this.copyTo(newInstance);\r\n return newInstance;\r\n };\r\n MovieClip.prototype.copyTo = function (newInstance) {\r\n _super.prototype.copyTo.call(this, newInstance);\r\n newInstance.timeline = this._timeline;\r\n newInstance.loop = this.loop;\r\n };\r\n MovieClip.prototype.advanceFrame = function () {\r\n if (this._isPlaying && !this._skipAdvance) {\r\n if (this._currentFrameIndex == this._timeline.keyframe_indices.length - 1) {\r\n if (this.loop)\r\n this.currentFrameIndex = 0;\r\n else\r\n this._isPlaying = false;\r\n }\r\n else {\r\n this._currentFrameIndex++;\r\n this._timeline.constructNextFrame(this);\r\n }\r\n }\r\n var len = this._children.length;\r\n var child;\r\n for (var i = 0; i < len; ++i) {\r\n child = this._children[i];\r\n if (child.isAsset(MovieClip))\r\n child.advanceFrame();\r\n }\r\n this.dispatchEvent(this._enterFrame);\r\n this._skipAdvance = false;\r\n };\r\n // DEBUG CODE:\r\n MovieClip.prototype.logHierarchy = function (depth) {\r\n if (depth === void 0) { depth = 0; }\r\n this.printHierarchyName(depth, this);\r\n var len = this._children.length;\r\n var child;\r\n for (var i = 0; i < len; i++) {\r\n child = this._children[i];\r\n if (child.isAsset(MovieClip))\r\n child.logHierarchy(depth + 1);\r\n else\r\n this.printHierarchyName(depth + 1, child);\r\n }\r\n };\r\n MovieClip.prototype.printHierarchyName = function (depth, target) {\r\n var str = \"\";\r\n for (var i = 0; i < depth; ++i)\r\n str += \"--\";\r\n str += \" \" + target.name + \" = \" + target.id;\r\n console.log(str);\r\n };\r\n MovieClip.prototype.clear = function () {\r\n //clear out potential instances\r\n var len = this._potentialInstances.length;\r\n for (var i = 0; i < len; i++) {\r\n var instance = this._potentialInstances[i];\r\n //only dispose instances that are not used in script ie. do not have an instance name\r\n if (instance && instance.name == \"\") {\r\n FrameScriptManager.add_child_to_dispose(instance);\r\n delete this._potentialInstances[i];\r\n }\r\n }\r\n _super.prototype.clear.call(this);\r\n };\r\n return MovieClip;\r\n}(Sprite));\r\nexport { MovieClip };\r\nMovieClip._movieClips = new Array();\r\nMovieClip.assetType = \"[asset MovieClip]\";\r\nexport default MovieClip;\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/display/MovieClip.js","import * as tslib_1 from \"tslib\";\r\nimport { PerspectiveProjection } from \"@awayjs/core\";\r\nimport { ImageCube, SingleCubeTexture } from \"@awayjs/graphics\";\r\nimport { ShadowMapperBase } from \"./ShadowMapperBase\";\r\nvar CubeMapShadowMapper = (function (_super) {\r\n tslib_1.__extends(CubeMapShadowMapper, _super);\r\n function CubeMapShadowMapper() {\r\n var _this = _super.call(this) || this;\r\n _this._depthMapSize = 512;\r\n _this._needsRender = new Array();\r\n _this.initCameras();\r\n return _this;\r\n }\r\n CubeMapShadowMapper.prototype.initCameras = function () {\r\n this._depthProjections = new Array();\r\n // posX, negX, posY, negY, posZ, negZ\r\n this.addProjection(0, 90, 0);\r\n this.addProjection(0, -90, 0);\r\n this.addProjection(-90, 0, 0);\r\n this.addProjection(90, 0, 0);\r\n this.addProjection(0, 0, 0);\r\n this.addProjection(0, 180, 0);\r\n };\r\n CubeMapShadowMapper.prototype.addProjection = function (rotationX, rotationY, rotationZ) {\r\n var projection = new PerspectiveProjection();\r\n projection.transform.rotateTo(rotationX, rotationY, rotationZ);\r\n projection.near = .01;\r\n projection.fieldOfView = 90;\r\n this._depthProjections.push(projection);\r\n };\r\n /**\r\n *\r\n * @returns {SingleCubeTexture}\r\n * @private\r\n */\r\n CubeMapShadowMapper.prototype._createDepthTexture = function () {\r\n return new SingleCubeTexture(new ImageCube(this._depthMapSize));\r\n };\r\n /**\r\n *\r\n * @param projection\r\n * @private\r\n */\r\n CubeMapShadowMapper.prototype._updateDepthProjection = function (projection) {\r\n var light = (this._light);\r\n var maxDistance = light._pFallOff;\r\n var pos = this._light.scenePosition;\r\n // todo: faces outside frustum which are pointing away from camera need not be rendered!\r\n for (var i = 0; i < 6; ++i) {\r\n this._depthProjections[i].far = maxDistance;\r\n this._depthProjections[i].transform.moveTo(pos.x, pos.y, pos.z);\r\n this._needsRender[i] = true;\r\n }\r\n };\r\n /**\r\n *\r\n * @param view\r\n * @param target\r\n * @param renderer\r\n * @private\r\n */\r\n CubeMapShadowMapper.prototype._drawDepthMap = function (view, target, renderer) {\r\n for (var i = 0; i < 6; ++i)\r\n if (this._needsRender[i])\r\n renderer._iRender(this._depthProjections[i], view, target.imageCube, null, i);\r\n };\r\n return CubeMapShadowMapper;\r\n}(ShadowMapperBase));\r\nexport { CubeMapShadowMapper };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/shadowmappers/CubeMapShadowMapper.js","import * as tslib_1 from \"tslib\";\r\nimport { Matrix3D, Vector3D } from \"@awayjs/core\";\r\nimport { TraverserBase } from \"@awayjs/graphics\";\r\nimport { BoundsType } from \"../bounds/BoundsType\";\r\nimport { CubeMapShadowMapper } from \"../shadowmappers/CubeMapShadowMapper\";\r\nimport { LightBase } from \"./LightBase\";\r\nvar PointLight = (function (_super) {\r\n tslib_1.__extends(PointLight, _super);\r\n function PointLight() {\r\n var _this = _super.call(this) || this;\r\n _this._pRadius = 90000;\r\n _this._pFallOff = 100000;\r\n _this._pIsEntity = true;\r\n _this._pFallOffFactor = 1 / (_this._pFallOff * _this._pFallOff - _this._pRadius * _this._pRadius);\r\n //default bounds type\r\n _this._boundsType = BoundsType.SPHERE;\r\n return _this;\r\n }\r\n Object.defineProperty(PointLight.prototype, \"traverseName\", {\r\n get: function () {\r\n return PointLight.traverseName;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(PointLight.prototype, \"assetType\", {\r\n get: function () {\r\n return PointLight.assetType;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n PointLight.prototype.pCreateShadowMapper = function () {\r\n return new CubeMapShadowMapper();\r\n };\r\n Object.defineProperty(PointLight.prototype, \"radius\", {\r\n get: function () {\r\n return this._pRadius;\r\n },\r\n set: function (value) {\r\n this._pRadius = value;\r\n if (this._pRadius < 0) {\r\n this._pRadius = 0;\r\n }\r\n else if (this._pRadius > this._pFallOff) {\r\n this._pFallOff = this._pRadius;\r\n this._pInvalidateBounds();\r\n }\r\n this._pFallOffFactor = 1 / (this._pFallOff * this._pFallOff - this._pRadius * this._pRadius);\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n PointLight.prototype.iFallOffFactor = function () {\r\n return this._pFallOffFactor;\r\n };\r\n Object.defineProperty(PointLight.prototype, \"fallOff\", {\r\n get: function () {\r\n return this._pFallOff;\r\n },\r\n set: function (value) {\r\n this._pFallOff = value;\r\n if (this._pFallOff < 0)\r\n this._pFallOff = 0;\r\n if (this._pFallOff < this._pRadius)\r\n this._pRadius = this._pFallOff;\r\n this._pFallOffFactor = 1 / (this._pFallOff * this._pFallOff - this._pRadius * this._pRadius);\r\n this._pInvalidateBounds();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n PointLight.prototype._pUpdateSphereBounds = function () {\r\n _super.prototype._pUpdateSphereBounds.call(this);\r\n this._pSphereBounds.radius = this._pFallOff;\r\n };\r\n PointLight.prototype.iGetObjectProjectionMatrix = function (displayObject, cameraTransform, target) {\r\n if (target === void 0) { target = null; }\r\n if (!target)\r\n target = new Matrix3D();\r\n var m = Matrix3D.CALCULATION_MATRIX;\r\n // todo: do not use lookAt on Light\r\n m.copyFrom(displayObject.getRenderSceneTransform(cameraTransform));\r\n m.append(this._pParent.transform.inverseConcatenatedMatrix3D);\r\n this.lookAt(m.position);\r\n m.copyFrom(displayObject.getRenderSceneTransform(cameraTransform));\r\n m.append(this.transform.inverseConcatenatedMatrix3D);\r\n var box = displayObject.getBox();\r\n var v1 = m.deltaTransformVector(new Vector3D(box.left, box.bottom, box.front));\r\n var v2 = m.deltaTransformVector(new Vector3D(box.right, box.top, box.back));\r\n var d1 = v1.x * v1.x + v1.y * v1.y + v1.z * v1.z;\r\n var d2 = v2.x * v2.x + v2.y * v2.y + v2.z * v2.z;\r\n var d = Math.sqrt(d1 > d2 ? d1 : d2);\r\n var zMin;\r\n var zMax;\r\n var z = m._rawData[14];\r\n zMin = z - d;\r\n zMax = z + d;\r\n var targetData = target._rawData;\r\n targetData[5] = targetData[0] = zMin / d;\r\n targetData[10] = zMax / (zMax - zMin);\r\n targetData[11] = 1;\r\n targetData[1] = targetData[2] = targetData[3] = targetData[4] = targetData[6] = targetData[7] = targetData[8] = targetData[9] = targetData[12] = targetData[13] = targetData[15] = 0;\r\n targetData[14] = -zMin * targetData[10];\r\n target.prepend(m);\r\n return target;\r\n };\r\n return PointLight;\r\n}(LightBase));\r\nexport { PointLight };\r\nPointLight.traverseName = TraverserBase.addEntityName(\"applyPointLight\");\r\nPointLight.assetType = \"[light PointLight]\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/display/PointLight.js","import * as tslib_1 from \"tslib\";\r\nimport { AssetEvent } from \"@awayjs/core\";\r\nimport { BlendMode, TraverserBase, RenderableEvent, MaterialEvent, SingleCubeTexture, Style } from \"@awayjs/graphics\";\r\nimport { BoundsType } from \"../bounds/BoundsType\";\r\nimport { DisplayObject } from \"./DisplayObject\";\r\n/**\r\n * A Skybox class is used to render a sky in the scene. It's always considered static and 'at infinity', and as\r\n * such it's always centered at the camera's position and sized to exactly fit within the camera's frustum, ensuring\r\n * the sky box is always as large as possible without being clipped.\r\n */\r\nvar Skybox = (function (_super) {\r\n tslib_1.__extends(Skybox, _super);\r\n /**\r\n * Create a new Skybox object.\r\n *\r\n * @param material\tThe material with which to render the Skybox.\r\n */\r\n function Skybox(image) {\r\n if (image === void 0) { image = null; }\r\n var _this = _super.call(this) || this;\r\n _this._textures = new Array();\r\n _this._pAlphaThreshold = 0;\r\n _this._pBlendMode = BlendMode.NORMAL;\r\n _this._curves = false;\r\n _this._imageRect = false;\r\n _this._onTextureInvalidateDelegate = function (event) { return _this.onTextureInvalidate(event); };\r\n _this._pIsEntity = true;\r\n _this._owners = new Array(_this);\r\n _this.style = new Style();\r\n _this.style.image = image;\r\n _this.texture = new SingleCubeTexture();\r\n //default bounds type\r\n _this._boundsType = BoundsType.NULL;\r\n return _this;\r\n }\r\n Object.defineProperty(Skybox.prototype, \"bothSides\", {\r\n get: function () {\r\n return false;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Skybox.prototype, \"traverseName\", {\r\n get: function () {\r\n return Skybox.traverseName;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Skybox.prototype, \"alphaThreshold\", {\r\n /**\r\n * The minimum alpha value for which pixels should be drawn. This is used for transparency that is either\r\n * invisible or entirely opaque, often used with textures for foliage, etc.\r\n * Recommended values are 0 to disable alpha, or 0.5 to create smooth edges. Default value is 0 (disabled).\r\n */\r\n get: function () {\r\n return this._pAlphaThreshold;\r\n },\r\n set: function (value) {\r\n if (value < 0)\r\n value = 0;\r\n else if (value > 1)\r\n value = 1;\r\n if (this._pAlphaThreshold == value)\r\n return;\r\n this._pAlphaThreshold = value;\r\n this.invalidatePasses();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Skybox.prototype, \"curves\", {\r\n /**\r\n * Indicates whether skybox should use curves. Defaults to false.\r\n */\r\n get: function () {\r\n return this._curves;\r\n },\r\n set: function (value) {\r\n if (this._curves == value)\r\n return;\r\n this._curves = value;\r\n this.invalidatePasses();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Skybox.prototype, \"imageRect\", {\r\n /**\r\n * Indicates whether or not the Skybox texture should use imageRects. Defaults to false.\r\n */\r\n get: function () {\r\n return this._imageRect;\r\n },\r\n set: function (value) {\r\n if (this._imageRect == value)\r\n return;\r\n this._imageRect = value;\r\n this.invalidatePasses();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Skybox.prototype, \"lightPicker\", {\r\n /**\r\n * The light picker used by the material to provide lights to the material if it supports lighting.\r\n *\r\n * @see LightPickerBase\r\n * @see StaticLightPicker\r\n */\r\n get: function () {\r\n return this._pLightPicker;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Skybox.prototype, \"animationSet\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return this._animationSet;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Skybox.prototype, \"blendMode\", {\r\n /**\r\n * The blend mode to use when drawing this renderable. The following blend modes are supported:\r\n * - \r\n *
- BlendMode.NORMAL: No blending, unless the material inherently needs it \r\n *
- BlendMode.LAYER: Force blending. This will draw the object the same as NORMAL, but without writing depth writes. \r\n *
- BlendMode.MULTIPLY \r\n *
- BlendMode.ADD \r\n *
- BlendMode.ALPHA \r\n *
Torus object.\r\n * @param radius The radius of the torus.\r\n * @param tuebRadius The radius of the inner tube of the torus.\r\n * @param segmentsR Defines the number of horizontal segments that make up the torus.\r\n * @param segmentsT Defines the number of vertical segments that make up the torus.\r\n * @param yUp Defines whether the torus poles should lay on the Y-axis (true) or on the Z-axis (false).\r\n */\r\n function PrimitiveTorusPrefab(material, elementsType, radius, tubeRadius, segmentsR, segmentsT, yUp) {\r\n if (material === void 0) { material = null; }\r\n if (elementsType === void 0) { elementsType = \"triangle\"; }\r\n if (radius === void 0) { radius = 50; }\r\n if (tubeRadius === void 0) { tubeRadius = 50; }\r\n if (segmentsR === void 0) { segmentsR = 16; }\r\n if (segmentsT === void 0) { segmentsT = 8; }\r\n if (yUp === void 0) { yUp = true; }\r\n var _this = _super.call(this, material, elementsType) || this;\r\n _this._numVertices = 0;\r\n _this._radius = radius;\r\n _this._tubeRadius = tubeRadius;\r\n _this._segmentsR = segmentsR;\r\n _this._segmentsT = segmentsT;\r\n _this._yUp = yUp;\r\n return _this;\r\n }\r\n Object.defineProperty(PrimitiveTorusPrefab.prototype, \"radius\", {\r\n /**\r\n * The radius of the torus.\r\n */\r\n get: function () {\r\n return this._radius;\r\n },\r\n set: function (value) {\r\n this._radius = value;\r\n this._pInvalidatePrimitive();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(PrimitiveTorusPrefab.prototype, \"tubeRadius\", {\r\n /**\r\n * The radius of the inner tube of the torus.\r\n */\r\n get: function () {\r\n return this._tubeRadius;\r\n },\r\n set: function (value) {\r\n this._tubeRadius = value;\r\n this._pInvalidatePrimitive();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(PrimitiveTorusPrefab.prototype, \"segmentsR\", {\r\n /**\r\n * Defines the number of horizontal segments that make up the torus. Defaults to 16.\r\n */\r\n get: function () {\r\n return this._segmentsR;\r\n },\r\n set: function (value) {\r\n this._segmentsR = value;\r\n this._pInvalidatePrimitive();\r\n this._pInvalidateUVs();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(PrimitiveTorusPrefab.prototype, \"segmentsT\", {\r\n /**\r\n * Defines the number of vertical segments that make up the torus. Defaults to 8.\r\n */\r\n get: function () {\r\n return this._segmentsT;\r\n },\r\n set: function (value) {\r\n this._segmentsT = value;\r\n this._pInvalidatePrimitive();\r\n this._pInvalidateUVs();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(PrimitiveTorusPrefab.prototype, \"yUp\", {\r\n /**\r\n * Defines whether the torus poles should lay on the Y-axis (true) or on the Z-axis (false).\r\n */\r\n get: function () {\r\n return this._yUp;\r\n },\r\n set: function (value) {\r\n this._yUp = value;\r\n this._pInvalidatePrimitive();\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * @inheritDoc\r\n */\r\n PrimitiveTorusPrefab.prototype._pBuildGraphics = function (target, elementsType) {\r\n var indices;\r\n var positions;\r\n var normals;\r\n var tangents;\r\n var stride;\r\n var i, j;\r\n var x, y, z, nx, ny, nz, revolutionAngleR, revolutionAngleT;\r\n var vidx;\r\n var fidx;\r\n var numIndices = 0;\r\n if (elementsType == ElementsType.TRIANGLE) {\r\n var triangleGraphics = target;\r\n // evaluate target number of vertices, triangles and indices\r\n this._numVertices = (this._segmentsT + 1) * (this._segmentsR + 1); // segmentsT + 1 because of closure, segmentsR + 1 because of closure\r\n numIndices = this._segmentsT * this._segmentsR * 6; // each level has segmentR quads, each of 2 triangles\r\n // need to initialize raw arrays or can be reused?\r\n if (this._numVertices == triangleGraphics.numVertices) {\r\n triangleGraphics.invalidateIndices();\r\n triangleGraphics.invalidateVertices(triangleGraphics.positions);\r\n triangleGraphics.invalidateVertices(triangleGraphics.normals);\r\n triangleGraphics.invalidateVertices(triangleGraphics.tangents);\r\n }\r\n else {\r\n triangleGraphics.setIndices(new Uint16Array(numIndices));\r\n triangleGraphics.setPositions(new Float32Array(this._numVertices * 3));\r\n triangleGraphics.setNormals(new Float32Array(this._numVertices * 3));\r\n triangleGraphics.setTangents(new Float32Array(this._numVertices * 3));\r\n this._pInvalidateUVs();\r\n }\r\n indices = triangleGraphics.indices.get(triangleGraphics.numElements);\r\n positions = triangleGraphics.positions.get(this._numVertices);\r\n normals = triangleGraphics.normals.get(this._numVertices);\r\n tangents = triangleGraphics.tangents.get(this._numVertices);\r\n stride = triangleGraphics.concatenatedBuffer.stride / 4;\r\n vidx = 0;\r\n fidx = 0;\r\n // evaluate revolution steps\r\n var revolutionAngleDeltaR = 2 * Math.PI / this._segmentsR;\r\n var revolutionAngleDeltaT = 2 * Math.PI / this._segmentsT;\r\n var comp1, comp2;\r\n var t1, t2, n1, n2;\r\n var startIndex = 0;\r\n var nextVertexIndex = 0;\r\n // surface\r\n var a, b, c, d, length;\r\n for (j = 0; j <= this._segmentsT; ++j) {\r\n startIndex = vidx;\r\n for (i = 0; i <= this._segmentsR; ++i) {\r\n // revolution vertex\r\n revolutionAngleR = i * revolutionAngleDeltaR;\r\n revolutionAngleT = j * revolutionAngleDeltaT;\r\n length = Math.cos(revolutionAngleT);\r\n nx = length * Math.cos(revolutionAngleR);\r\n ny = length * Math.sin(revolutionAngleR);\r\n nz = Math.sin(revolutionAngleT);\r\n x = this._radius * Math.cos(revolutionAngleR) + this._tubeRadius * nx;\r\n y = this._radius * Math.sin(revolutionAngleR) + this._tubeRadius * ny;\r\n z = (j == this._segmentsT) ? 0 : this._tubeRadius * nz;\r\n if (this._yUp) {\r\n n1 = -nz;\r\n n2 = ny;\r\n t1 = 0;\r\n t2 = (length ? nx / length : x / this._radius);\r\n comp1 = -z;\r\n comp2 = y;\r\n }\r\n else {\r\n n1 = ny;\r\n n2 = nz;\r\n t1 = (length ? nx / length : x / this._radius);\r\n t2 = 0;\r\n comp1 = y;\r\n comp2 = z;\r\n }\r\n if (i == this._segmentsR) {\r\n positions[vidx] = x;\r\n positions[vidx + 1] = positions[startIndex + 1];\r\n positions[vidx + 2] = positions[startIndex + 2];\r\n }\r\n else {\r\n positions[vidx] = x;\r\n positions[vidx + 1] = comp1;\r\n positions[vidx + 2] = comp2;\r\n }\r\n normals[vidx] = nx;\r\n normals[vidx + 1] = n1;\r\n normals[vidx + 2] = n2;\r\n tangents[vidx] = -(length ? ny / length : y / this._radius);\r\n tangents[vidx + 1] = t1;\r\n tangents[vidx + 2] = t2;\r\n vidx += stride;\r\n // close triangle\r\n if (i > 0 && j > 0) {\r\n a = nextVertexIndex; // current\r\n b = nextVertexIndex - 1; // previous\r\n c = b - this._segmentsR - 1; // previous of last level\r\n d = a - this._segmentsR - 1; // current of last level\r\n indices[fidx++] = a;\r\n indices[fidx++] = b;\r\n indices[fidx++] = c;\r\n indices[fidx++] = a;\r\n indices[fidx++] = c;\r\n indices[fidx++] = d;\r\n }\r\n nextVertexIndex++;\r\n }\r\n }\r\n }\r\n else if (elementsType == ElementsType.LINE) {\r\n }\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n PrimitiveTorusPrefab.prototype._pBuildUVs = function (target, elementsType) {\r\n var i, j;\r\n var uvs;\r\n var stride;\r\n if (elementsType == ElementsType.TRIANGLE) {\r\n var triangleGraphics = target;\r\n // need to initialize raw array or can be reused?\r\n if (triangleGraphics.uvs && this._numVertices == triangleGraphics.numVertices) {\r\n triangleGraphics.invalidateVertices(triangleGraphics.uvs);\r\n }\r\n else {\r\n triangleGraphics.setUVs(new Float32Array(this._numVertices * 2));\r\n }\r\n uvs = triangleGraphics.uvs.get(this._numVertices);\r\n stride = triangleGraphics.uvs.stride;\r\n // current uv component index\r\n var index = 0;\r\n // surface\r\n for (j = 0; j <= this._segmentsT; ++j) {\r\n for (i = 0; i <= this._segmentsR; ++i) {\r\n // revolution vertex\r\n uvs[index] = (i / this._segmentsR) * this._scaleU;\r\n uvs[index + 1] = (j / this._segmentsT) * this._scaleV;\r\n index += stride;\r\n }\r\n }\r\n }\r\n else if (elementsType == ElementsType.LINE) {\r\n }\r\n };\r\n return PrimitiveTorusPrefab;\r\n}(PrimitivePrefabBase));\r\nexport { PrimitiveTorusPrefab };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/prefabs/PrimitiveTorusPrefab.js","/**\r\n * The AntiAliasType class provides values for anti-aliasing in the\r\n * away.text.TextField class.\r\n */\r\nvar AntiAliasType = (function () {\r\n function AntiAliasType() {\r\n }\r\n return AntiAliasType;\r\n}());\r\nexport { AntiAliasType };\r\n/**\r\n * Sets anti-aliasing to advanced anti-aliasing. Advanced anti-aliasing\r\n * allows font faces to be rendered at very high quality at small sizes. It\r\n * is best used with applications that have a lot of small text. Advanced\r\n * anti-aliasing is not recommended for very large fonts(larger than 48\r\n * points). This constant is used for the antiAliasType property\r\n * in the TextField class. Use the syntax\r\n * AntiAliasType.ADVANCED.\r\n */\r\nAntiAliasType.ADVANCED = \"advanced\";\r\n/**\r\n * Sets anti-aliasing to the anti-aliasing that is used in Flash Player 7 and\r\n * earlier. This setting is recommended for applications that do not have a\r\n * lot of text. This constant is used for the antiAliasType\r\n * property in the TextField class. Use the syntax\r\n * AntiAliasType.NORMAL.\r\n */\r\nAntiAliasType.NORMAL = \"normal\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/text/AntiAliasType.js","/**\r\n * The TextFormat class represents character formatting information. Use the\r\n * TextFormat class to create specific text formatting for text fields. You\r\n * can apply text formatting to both static and dynamic text fields. The\r\n * properties of the TextFormat class apply to device and embedded fonts.\r\n * However, for embedded fonts, bold and italic text actually require specific\r\n * fonts. If you want to display bold or italic text with an embedded font,\r\n * you need to embed the bold and italic variations of that font.\r\n *\r\n * You must use the constructor new TextFormat() to create a\r\n * TextFormat object before setting its properties. When you apply a\r\n * TextFormat object to a text field using the\r\n * TextField.defaultTextFormat property or the\r\n * TextField.setTextFormat() method, only its defined properties\r\n * are applied. Use the TextField.defaultTextFormat property to\r\n * apply formatting BEFORE you add text to the TextField, and the\r\n * setTextFormat() method to add formatting AFTER you add text to\r\n * the TextField. The TextFormat properties are null\r\n * by default because if you don't provide values for the properties, Flash\r\n * Player uses its own default formatting. The default formatting that Flash\r\n * Player uses for each property(if property's value is null) is\r\n * as follows:
The default formatting for each property is also described in each\r\n * property description.
\r\n */\r\nvar BitmapFontChar = (function () {\r\n function BitmapFontChar(id, x, y, width, height, xoff, yoff, xadv, page, channel) {\r\n this.id = id;\r\n this.x = x;\r\n this.y = y;\r\n this.width = width;\r\n this.height = height;\r\n this.x_offset = xoff;\r\n this.y_offset = yoff;\r\n this.x_advance = xadv;\r\n this.page = page;\r\n this.channel = channel;\r\n }\r\n return BitmapFontChar;\r\n}());\r\nexport { BitmapFontChar };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/text/BitmapFontChar.js","import * as tslib_1 from \"tslib\";\r\nimport { AssetBase } from \"@awayjs/core\";\r\nimport { BitmapFontChar } from \"./BitmapFontChar\";\r\n/**\r\n * GraphicBase wraps a TriangleElements as a scene graph instantiation. A GraphicBase is owned by a Sprite object.\r\n *\r\n *\r\n * @see away.base.TriangleElements\r\n * @see away.entities.Sprite\r\n *\r\n * @class away.base.GraphicBase\r\n */\r\nvar BitmapFontTable = (function (_super) {\r\n tslib_1.__extends(BitmapFontTable, _super);\r\n //TODO test shader picking\r\n //\t\tpublic get shaderPickingDetails():boolean\r\n //\t\t{\r\n //\r\n //\t\t\treturn this.sourceEntity.shaderPickingDetails;\r\n //\t\t}\r\n /**\r\n * Creates a new TesselatedFont object\r\n */\r\n function BitmapFontTable() {\r\n var _this = _super.call(this) || this;\r\n _this._font_chars = [];\r\n _this._materials = [];\r\n _this._font_chars_dic = new Object();\r\n _this._ascent = 0;\r\n _this._descent = 0;\r\n _this._current_size = 0;\r\n _this._size_multiply = 0;\r\n _this._init_size = 0;\r\n _this._texture_width = 0;\r\n _this._texture_height = 0;\r\n _this._adjust_size = 0;\r\n return _this;\r\n }\r\n Object.defineProperty(BitmapFontTable.prototype, \"assetType\", {\r\n get: function () {\r\n return BitmapFontTable.assetType;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n BitmapFontTable.prototype.initFontSize = function (font_size) {\r\n if (this.fallbackTable)\r\n this.fallbackTable.initFontSize(font_size);\r\n if (this._adjust_size)\r\n font_size *= this._adjust_size;\r\n if (this._current_size == font_size)\r\n return;\r\n this._current_size = font_size;\r\n this._size_multiply = font_size / this._init_size;\r\n };\r\n BitmapFontTable.prototype.getCharDataCanvas = function (char_code) {\r\n var this_char = this._font_chars_dic[char_code];\r\n if (this_char) {\r\n //console.log(\"this_char found\");\r\n return [this_char.x, this_char.y, this_char.width, this_char.height, this_char.x_offset * this._size_multiply, this_char.y_offset * this._size_multiply];\r\n }\r\n //console.log(\"this_char not found\" + char_code);\r\n return [];\r\n };\r\n BitmapFontTable.prototype.getCharData = function (char_code) {\r\n var this_char = this._font_chars_dic[char_code];\r\n if (this_char) {\r\n var realheight = (this_char.height / this._init_size) * this._current_size;\r\n var realWidth = (this_char.width / this._init_size) * this._current_size;\r\n //console.log(\"this_char found\");\r\n return [this_char.x / this._texture_width, this_char.y / this._texture_height, this_char.width / this._texture_width, this_char.height / this._texture_height, this_char.x_offset * this._size_multiply, this_char.y_offset * this._size_multiply, realheight, realWidth];\r\n }\r\n //console.log(\"this_char not found\" + char_code);\r\n return [];\r\n };\r\n BitmapFontTable.prototype.getCharVertCnt = function (char_code) {\r\n return 6 * 4;\r\n };\r\n Object.defineProperty(BitmapFontTable.prototype, \"texture_width\", {\r\n get: function () {\r\n return this._texture_width;\r\n },\r\n set: function (value) {\r\n this._texture_width = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(BitmapFontTable.prototype, \"texture_height\", {\r\n get: function () {\r\n return this._texture_height;\r\n },\r\n set: function (value) {\r\n this._texture_height = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n BitmapFontTable.prototype.hasChar = function (char_code) {\r\n return this._font_chars_dic[char_code] != null;\r\n };\r\n BitmapFontTable.prototype.getCharWidth = function (char_code) {\r\n var this_char = this._font_chars_dic[char_code];\r\n if (this_char)\r\n return this._size_multiply * (this_char.x_advance);\r\n return 0;\r\n };\r\n BitmapFontTable.prototype.fillTextRun = function (tf, format, startWord, wordCnt) {\r\n };\r\n BitmapFontTable.prototype.getLineHeight = function () {\r\n return this._current_size;\r\n };\r\n /**\r\n *\r\n */\r\n BitmapFontTable.prototype.dispose = function () {\r\n var len = this._materials.length;\r\n for (var i = 0; i < len; ++i) {\r\n this._materials[i].dispose();\r\n }\r\n this._materials.length = 0;\r\n this._font_chars.length = 0;\r\n this._font_chars_dic = null;\r\n };\r\n BitmapFontTable.prototype.addMaterial = function (material) {\r\n this._materials.push(material);\r\n };\r\n BitmapFontTable.prototype.getMaterial = function (idx) {\r\n if (idx === void 0) { idx = 0; }\r\n return this._materials[idx];\r\n };\r\n Object.defineProperty(BitmapFontTable.prototype, \"ascent\", {\r\n get: function () {\r\n return this._ascent;\r\n },\r\n set: function (value) {\r\n this._ascent = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(BitmapFontTable.prototype, \"descent\", {\r\n get: function () {\r\n return this._descent;\r\n },\r\n set: function (value) {\r\n this._descent = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(BitmapFontTable.prototype, \"offset_x\", {\r\n get: function () {\r\n return this._offset_x;\r\n },\r\n set: function (value) {\r\n this._offset_x = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(BitmapFontTable.prototype, \"offset_y\", {\r\n get: function () {\r\n return this._offset_y;\r\n },\r\n set: function (value) {\r\n this._offset_y = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n BitmapFontTable.prototype.get_font_chars = function () {\r\n return this._font_chars;\r\n };\r\n BitmapFontTable.prototype.get_font_em_size = function () {\r\n return this._font_em_size;\r\n };\r\n BitmapFontTable.prototype.set_whitespace_width = function (value) {\r\n this._whitespace_width = value;\r\n };\r\n BitmapFontTable.prototype.get_whitespace_width = function () {\r\n return this._whitespace_width;\r\n };\r\n BitmapFontTable.prototype.set_font_em_size = function (font_em_size) {\r\n this._font_em_size = font_em_size;\r\n };\r\n /**\r\n *\r\n */\r\n BitmapFontTable.prototype.getChar = function (name) {\r\n return this._font_chars_dic[name];\r\n };\r\n /**\r\n *\r\n */\r\n BitmapFontTable.prototype.setChar = function (id, x, y, width, height, xoff, yoff, xadv, page, channel) {\r\n var bitmap_font_char = new BitmapFontChar(id, x, y, width, height, xoff, yoff, xadv, page, channel);\r\n this._font_chars.push(bitmap_font_char);\r\n this._font_chars_dic[id] = bitmap_font_char;\r\n };\r\n return BitmapFontTable;\r\n}(AssetBase));\r\nexport { BitmapFontTable };\r\nBitmapFontTable.assetType = \"[asset BitmapFontTable]\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/text/BitmapFontTable.js","import * as tslib_1 from \"tslib\";\r\nimport { AssetBase } from \"@awayjs/core\";\r\nimport { TesselatedFontTable } from \"./TesselatedFontTable\";\r\nimport { BitmapFontTable } from \"./BitmapFontTable\";\r\n/**\r\n * Font is a container for FontTables.\r\n *\r\n *\r\n *\r\n */\r\nvar Font = (function (_super) {\r\n tslib_1.__extends(Font, _super);\r\n //TODO test shader picking\r\n //\t\tpublic get shaderPickingDetails():boolean\r\n //\t\t{\r\n //\r\n //\t\t\treturn this.sourceEntity.shaderPickingDetails;\r\n //\t\t}\r\n /**\r\n * Creates a new TesselatedFont object\r\n */\r\n function Font() {\r\n var _this = _super.call(this) || this;\r\n _this._font_styles = [];\r\n // ------------ dummys for as3web:\r\n _this.fontName = null;\r\n return _this;\r\n }\r\n Font.registerFont = function (any) {\r\n };\r\n Object.defineProperty(Font.prototype, \"font_styles\", {\r\n // ------------\r\n get: function () {\r\n return this._font_styles;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Font.prototype, \"assetType\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return Font.assetType;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n *\r\n */\r\n Font.prototype.dispose = function () {\r\n var len = this._font_styles.length;\r\n for (var i = 0; i < len; ++i) {\r\n this._font_styles[i].dispose();\r\n }\r\n this._font_styles.length = 0;\r\n };\r\n /**\r\n *Get a font-table for a specific name, or create one if it does not exists.\r\n */\r\n Font.prototype.get_font_table = function (style_name, assetType, openTypeFont) {\r\n if (assetType === void 0) { assetType = TesselatedFontTable.assetType; }\r\n if (openTypeFont === void 0) { openTypeFont = null; }\r\n var len = this._font_styles.length;\r\n //console.log(\"font name\", this.name, style_name);\r\n for (var i = 0; i < len; ++i) {\r\n if ((this._font_styles[i].assetType == assetType) && (this._font_styles[i].name == style_name)) {\r\n // mak\r\n return this._font_styles[i];\r\n }\r\n }\r\n var font_style = null;\r\n if (assetType == TesselatedFontTable.assetType) {\r\n font_style = new TesselatedFontTable(openTypeFont);\r\n }\r\n else if (assetType == BitmapFontTable.assetType) {\r\n font_style = new BitmapFontTable();\r\n }\r\n font_style.name = style_name;\r\n this._font_styles.push(font_style);\r\n return font_style;\r\n };\r\n return Font;\r\n}(AssetBase));\r\nexport { Font };\r\nFont.assetType = \"[asset Font]\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/text/Font.js","/**\r\n * The GridFitType class defines values for grid fitting in the TextField class.\r\n */\r\nvar GridFitType = (function () {\r\n function GridFitType() {\r\n }\r\n return GridFitType;\r\n}());\r\nexport { GridFitType };\r\n/**\r\n * Doesn't set grid fitting. Horizontal and vertical lines in the glyphs are\r\n * not forced to the pixel grid. This constant is used in setting the\r\n *gridFitType property of the TextField class. This is often a\r\n * good setting for animation or for large font sizes. Use the syntax\r\n * GridFitType.NONE.\r\n */\r\nGridFitType.NONE = \"none\";\r\n/**\r\n * Fits strong horizontal and vertical lines to the pixel grid. This constant\r\n * is used in setting the gridFitType property of the TextField\r\n * class. This setting only works for left-justified text fields and acts\r\n * like the GridFitType.SUBPIXEL constant in static text. This\r\n * setting generally provides the best readability for left-aligned text. Use\r\n * the syntax GridFitType.PIXEL.\r\n */\r\nGridFitType.PIXEL = \"pixel\";\r\n/**\r\n * Fits strong horizontal and vertical lines to the sub-pixel grid on LCD\r\n * monitors. (Red, green, and blue are actual pixels on an LCD screen.) This\r\n * is often a good setting for right-aligned or center-aligned dynamic text,\r\n * and it is sometimes a useful tradeoff for animation vs. text quality. This\r\n * constant is used in setting the gridFitType property of the\r\n * TextField class. Use the syntax GridFitType.SUBPIXEL.\r\n */\r\nGridFitType.SUBPIXEL = \"subpixel\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/text/GridFitType.js","/**\r\n * The TextFormatAlign class provides values for text alignment in the\r\n * TextFormat class.\r\n */\r\nvar TextFormatAlign = (function () {\r\n function TextFormatAlign() {\r\n /**\r\n * Constant; centers the text in the text field. Use the syntax\r\n * TextFormatAlign.CENTER.\r\n */\r\n this.CENTER = \"center\";\r\n /**\r\n * Constant; justifies text within the text field. Use the syntax\r\n * TextFormatAlign.JUSTIFY.\r\n */\r\n this.JUSTIFY = \"justify\";\r\n /**\r\n * Constant; aligns text to the left within the text field. Use the syntax\r\n * TextFormatAlign.LEFT.\r\n */\r\n this.LEFT = \"left\";\r\n /**\r\n * Constant; aligns text to the right within the text field. Use the syntax\r\n * TextFormatAlign.RIGHT.\r\n */\r\n this.RIGHT = \"right\";\r\n }\r\n return TextFormatAlign;\r\n}());\r\nexport { TextFormatAlign };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/text/TextFormatAlign.js","/**\r\n * A class that defines the Interactive mode of a text field object.\r\n *\r\n * @see away.entities.TextField#textInteractionMode\r\n */\r\nvar TextInteractionMode = (function () {\r\n function TextInteractionMode() {\r\n }\r\n return TextInteractionMode;\r\n}());\r\nexport { TextInteractionMode };\r\n/**\r\n * The text field's default interaction mode is NORMAL and it varies across\r\n * platform. On Desktop, the normal mode implies that the text field is in\r\n * scrollable + selection mode. On Mobile platforms like Android, normal mode\r\n * implies that the text field can only be scrolled but the text can not be\r\n * selected.\r\n */\r\nTextInteractionMode.NORMAL = \"normal\";\r\n/**\r\n * On mobile platforms like Android, the text field starts in normal mode\r\n * (which implies scroll and non-selectable mode). The user can switch to\r\n * selection mode through the in-built context menu of the text field object.\r\n */\r\nTextInteractionMode.SELECTION = \"selection\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/text/TextInteractionMode.js","/**\r\n * The TextLineMetrics class contains information about the text position and\r\n * measurements of a line of text within a text field. All measurements are in\r\n * pixels. Objects of this class are returned by the\r\n * away.entities.TextField.getLineMetrics() method.\r\n */\r\nvar TextLineMetrics = (function () {\r\n /**\r\n * Creates a TextLineMetrics object. The TextLineMetrics object contains\r\n * information about the text metrics of a line of text in a text field.\r\n * Objects of this class are returned by the\r\n * away.entities.TextField.getLineMetrics() method.\r\n *\r\n * @param x The left position of the first character in pixels.\r\n * @param width The width of the text of the selected lines (not\r\n * necessarily the complete text) in pixels.\r\n * @param height The height of the text of the selected lines (not\r\n * necessarily the complete text) in pixels.\r\n * @param ascent The length from the baseline to the top of the line\r\n * height in pixels.\r\n * @param descent The length from the baseline to the bottom depth of\r\n * the line in pixels.\r\n * @param leading The measurement of the vertical distance between the\r\n * lines of text.\r\n */\r\n function TextLineMetrics(x, width, height, ascent, descent, leading) {\r\n if (x === void 0) { x = NaN; }\r\n if (width === void 0) { width = NaN; }\r\n if (height === void 0) { height = NaN; }\r\n if (ascent === void 0) { ascent = NaN; }\r\n if (descent === void 0) { descent = NaN; }\r\n if (leading === void 0) { leading = NaN; }\r\n }\r\n return TextLineMetrics;\r\n}());\r\nexport { TextLineMetrics };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/text/TextLineMetrics.js","import { AttributesBuffer } from \"@awayjs/core\";\r\nimport { Shape, TriangleElements } from \"@awayjs/graphics\";\r\nimport { Sprite } from \"../display/Sprite\";\r\n/**\r\n * Class Merge merges two or more static sprites into one.Merge\r\n */\r\nvar Merge = (function () {\r\n /**\r\n * @param keepMaterial [optional] Determines if the merged object uses the recevier sprite material information or keeps its source material(s). Defaults to false.\r\n * If false and receiver object has multiple materials, the last material found in receiver subsprites is applied to the merged subsprite(es).\r\n * @param disposeSources [optional] Determines if the sprite and geometry source(s) used for the merging are disposed. Defaults to false.\r\n * If true, only receiver geometry and resulting sprite are kept in memory.\r\n * @param objectSpace [optional] Determines if source sprite(es) is/are merged using objectSpace or worldspace. Defaults to false.\r\n */\r\n function Merge(keepMaterial, disposeSources, objectSpace) {\r\n if (keepMaterial === void 0) { keepMaterial = false; }\r\n if (disposeSources === void 0) { disposeSources = false; }\r\n if (objectSpace === void 0) { objectSpace = false; }\r\n this._keepMaterial = keepMaterial;\r\n this._disposeSources = disposeSources;\r\n this._objectSpace = objectSpace;\r\n }\r\n Object.defineProperty(Merge.prototype, \"disposeSources\", {\r\n get: function () {\r\n return this._disposeSources;\r\n },\r\n /**\r\n * Determines if the sprite and geometry source(s) used for the merging are disposed. Defaults to false.\r\n */\r\n set: function (b) {\r\n this._disposeSources = b;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Merge.prototype, \"keepMaterial\", {\r\n get: function () {\r\n return this._keepMaterial;\r\n },\r\n /**\r\n * Determines if the material source(s) used for the merging are disposed. Defaults to false.\r\n */\r\n set: function (b) {\r\n this._keepMaterial = b;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Merge.prototype, \"objectSpace\", {\r\n get: function () {\r\n return this._objectSpace;\r\n },\r\n /**\r\n * Determines if source sprite(es) is/are merged using objectSpace or worldspace. Defaults to false.\r\n */\r\n set: function (b) {\r\n this._objectSpace = b;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * Merges all the children of a container into a single Sprite. If no Sprite object is found, method returns the receiver without modification.\r\n *\r\n * @param receiver The Sprite to receive the merged contents of the container.\r\n * @param objectContainer The DisplayObjectContainer holding the sprites to be mergd.\r\n *\r\n * @return The merged Sprite instance.\r\n */\r\n Merge.prototype.applyToContainer = function (receiver, objectContainer) {\r\n this.reset();\r\n //collect container sprites\r\n this.parseContainer(receiver, objectContainer);\r\n //collect receiver\r\n this.collect(receiver, false);\r\n //merge to receiver\r\n this.merge(receiver, this._disposeSources);\r\n };\r\n /**\r\n * Merges all the sprites found in the Array<Sprite> into a single Sprite.\r\n *\r\n * @param receiver The Sprite to receive the merged contents of the sprites.\r\n * @param sprites A series of Sprites to be merged with the reciever sprite.\r\n */\r\n Merge.prototype.applyToSprites = function (receiver, sprites) {\r\n this.reset();\r\n if (!sprites.length)\r\n return;\r\n //collect sprites in vector\r\n for (var i = 0; i < sprites.length; i++)\r\n if (sprites[i] != receiver)\r\n this.collect(sprites[i], this._disposeSources);\r\n //collect receiver\r\n this.collect(receiver, false);\r\n //merge to receiver\r\n this.merge(receiver, this._disposeSources);\r\n };\r\n /**\r\n * Merges 2 sprites into one. It is recommand to use apply when 2 sprites are to be merged. If more need to be merged, use either applyToSprites or applyToContainer methods.\r\n *\r\n * @param receiver The Sprite to receive the merged contents of both sprites.\r\n * @param sprite The Sprite to be merged with the receiver sprite\r\n */\r\n Merge.prototype.apply = function (receiver, sprite) {\r\n this.reset();\r\n //collect sprite\r\n this.collect(sprite, this._disposeSources);\r\n //collect receiver\r\n this.collect(receiver, false);\r\n //merge to receiver\r\n this.merge(receiver, this._disposeSources);\r\n };\r\n Merge.prototype.reset = function () {\r\n this._toDispose = new Array();\r\n this._shapeVOs = new Array();\r\n };\r\n Merge.prototype.merge = function (destSprite, dispose) {\r\n var i;\r\n //var oldGraphics:Graphics;\r\n var destGraphics;\r\n var useSubMaterials;\r\n //oldGraphics = destSprite.graphics.clone();\r\n destGraphics = destSprite.graphics;\r\n // Only apply materials directly to sub-sprites if necessary,\r\n // i.e. if there is more than one material available.\r\n useSubMaterials = (this._shapeVOs.length > 1);\r\n for (i = 0; i < this._shapeVOs.length; i++) {\r\n var elements = new TriangleElements(new AttributesBuffer());\r\n elements.autoDeriveNormals = false;\r\n elements.autoDeriveTangents = false;\r\n var data = this._shapeVOs[i];\r\n elements.setIndices(data.indices);\r\n elements.setPositions(data.vertices);\r\n elements.setNormals(data.normals);\r\n elements.setTangents(data.tangents);\r\n elements.setUVs(data.uvs);\r\n if (this._keepMaterial && useSubMaterials)\r\n destGraphics.addShape(Shape.getShape(elements, data.material));\r\n else\r\n destGraphics.addShape(Shape.getShape(elements));\r\n }\r\n if (this._keepMaterial && !useSubMaterials && this._shapeVOs.length)\r\n destSprite.material = this._shapeVOs[0].material;\r\n if (dispose) {\r\n var len = this._toDispose.length;\r\n for (var i; i < len; i++)\r\n this._toDispose[i].dispose();\r\n }\r\n this._toDispose = null;\r\n };\r\n Merge.prototype.collect = function (sprite, dispose) {\r\n var subIdx;\r\n var calc;\r\n for (subIdx = 0; subIdx < sprite.graphics.count; subIdx++) {\r\n var i;\r\n var len;\r\n var iIdx, vIdx, nIdx, tIdx, uIdx;\r\n var indexOffset;\r\n var elements;\r\n var vo;\r\n var vertices;\r\n var normals;\r\n var tangents;\r\n var ind;\r\n elements = sprite.graphics.getShapeAt(subIdx).elements;\r\n // Get (or create) a VO for this material\r\n vo = this.getShapeData(sprite.graphics.getShapeAt(subIdx).material);\r\n // Vertices and normals are copied to temporary vectors, to be transformed\r\n // before concatenated onto those of the data. This is unnecessary if no\r\n // transformation will be performed, i.e. for object space merging.\r\n vertices = (this._objectSpace) ? vo.vertices : new Array();\r\n normals = (this._objectSpace) ? vo.normals : new Array();\r\n tangents = (this._objectSpace) ? vo.tangents : new Array();\r\n // Copy over vertex attributes\r\n vIdx = vertices.length;\r\n nIdx = normals.length;\r\n tIdx = tangents.length;\r\n uIdx = vo.uvs.length;\r\n this.copyAttributes(elements.positions, vertices, elements.numVertices, vIdx);\r\n this.copyAttributes(elements.normals, normals, elements.numVertices, nIdx);\r\n this.copyAttributes(elements.tangents, tangents, elements.numVertices, tIdx);\r\n this.copyAttributes(elements.uvs, vo.uvs, elements.numVertices, uIdx);\r\n // Copy over triangle indices\r\n indexOffset = (!this._objectSpace) ? vo.vertices.length / 3 : 0;\r\n iIdx = vo.indices.length;\r\n len = elements.numElements;\r\n ind = elements.indices.get(len);\r\n for (i = 0; i < len; i++) {\r\n calc = i * 3;\r\n vo.indices[iIdx++] = ind[calc] + indexOffset;\r\n vo.indices[iIdx++] = ind[calc + 1] + indexOffset;\r\n vo.indices[iIdx++] = ind[calc + 2] + indexOffset;\r\n }\r\n if (!this._objectSpace) {\r\n sprite.transform.concatenatedMatrix3D.transformVectors(vertices, vertices);\r\n sprite.transform.concatenatedMatrix3D.deltaTransformVectors(normals, normals);\r\n sprite.transform.concatenatedMatrix3D.deltaTransformVectors(tangents, tangents);\r\n // Copy vertex data from temporary (transformed) vectors\r\n vIdx = vo.vertices.length;\r\n nIdx = vo.normals.length;\r\n tIdx = vo.tangents.length;\r\n len = vertices.length;\r\n for (i = 0; i < len; i++) {\r\n vo.vertices[vIdx++] = vertices[i];\r\n vo.normals[nIdx++] = normals[i];\r\n vo.tangents[tIdx++] = tangents[i];\r\n }\r\n }\r\n }\r\n if (dispose)\r\n this._toDispose.push(sprite);\r\n };\r\n Merge.prototype.copyAttributes = function (attributes, array, count, startIndex) {\r\n var vertices = attributes.get(count);\r\n var dim = attributes.dimensions;\r\n var stride = attributes.stride;\r\n var len = count * stride;\r\n for (var i = 0; i < len; i += stride)\r\n for (var j = 0; j < dim; j++)\r\n array[startIndex++] = vertices[i + j];\r\n };\r\n Merge.prototype.getShapeData = function (material) {\r\n var data;\r\n if (this._keepMaterial) {\r\n var i;\r\n var len;\r\n len = this._shapeVOs.length;\r\n for (i = 0; i < len; i++) {\r\n if (this._shapeVOs[i].material == material) {\r\n data = this._shapeVOs[i];\r\n break;\r\n }\r\n }\r\n }\r\n else if (this._shapeVOs.length) {\r\n // If materials are not to be kept, all data can be\r\n // put into a single VO, so return that one.\r\n data = this._shapeVOs[0];\r\n }\r\n // No data (for this material) found, create new.\r\n if (!data) {\r\n data = new ShapeVO();\r\n data.vertices = new Array();\r\n data.normals = new Array();\r\n data.tangents = new Array();\r\n data.uvs = new Array();\r\n data.indices = new Array();\r\n data.material = material;\r\n this._shapeVOs.push(data);\r\n }\r\n return data;\r\n };\r\n Merge.prototype.parseContainer = function (receiver, object) {\r\n var child;\r\n var i;\r\n if (object instanceof Sprite && object != receiver)\r\n this.collect(object, this._disposeSources);\r\n for (i = 0; i < object.numChildren; ++i) {\r\n child = object.getChildAt(i);\r\n this.parseContainer(receiver, child);\r\n }\r\n };\r\n return Merge;\r\n}());\r\nexport { Merge };\r\nvar ShapeVO = (function () {\r\n function ShapeVO() {\r\n }\r\n return ShapeVO;\r\n}());\r\nexport { ShapeVO };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/tools/Merge.js","import { ByteArray } from \"@awayjs/core\";\r\nimport { Image2D, Single2DTexture } from \"@awayjs/graphics\";\r\nimport { CastError } from \"../errors/CastError\";\r\n/**\r\n * Helper class for casting assets to usable objects\r\n */\r\nvar Cast = (function () {\r\n function Cast() {\r\n }\r\n Cast.string = function (data) {\r\n if (typeof (data) == 'function')\r\n data = new data;\r\n if (typeof (data) == 'string')\r\n return data;\r\n return data;\r\n };\r\n Cast.byteArray = function (data) {\r\n if (typeof (data) == 'function')\r\n data = new data;\r\n if (data instanceof ByteArray)\r\n return data;\r\n return data;\r\n };\r\n // public static xml(data:any):XML\r\n // {\r\n // if (typeof(data) == 'function')\r\n // data = new data;\r\n //\r\n // if (data is XML)\r\n // return data;\r\n //\r\n // return XML(data);\r\n // }\r\n Cast.isHex = function (str) {\r\n var length = str.length;\r\n for (var i = 0; i < length; ++i) {\r\n if (this._hexChars.indexOf(str.charAt(i)) == -1)\r\n return false;\r\n }\r\n return true;\r\n };\r\n Cast.tryColor = function (data) {\r\n if (typeof (data) == 'number' /*uint*/)\r\n return Math.floor(data);\r\n if (typeof (data) == 'string') {\r\n if (data == \"random\")\r\n return Math.floor(Math.random() * 0x1000000);\r\n if (this._colorNames == null) {\r\n this._colorNames = new Object();\r\n this._colorNames[\"steelblue\"] = 0x4682B4;\r\n this._colorNames[\"royalblue\"] = 0x041690;\r\n this._colorNames[\"cornflowerblue\"] = 0x6495ED;\r\n this._colorNames[\"lightsteelblue\"] = 0xB0C4DE;\r\n this._colorNames[\"mediumslateblue\"] = 0x7B68EE;\r\n this._colorNames[\"slateblue\"] = 0x6A5ACD;\r\n this._colorNames[\"darkslateblue\"] = 0x483D8B;\r\n this._colorNames[\"midnightblue\"] = 0x191970;\r\n this._colorNames[\"navy\"] = 0x000080;\r\n this._colorNames[\"darkblue\"] = 0x00008B;\r\n this._colorNames[\"mediumblue\"] = 0x0000CD;\r\n this._colorNames[\"blue\"] = 0x0000FF;\r\n this._colorNames[\"dodgerblue\"] = 0x1E90FF;\r\n this._colorNames[\"deepskyblue\"] = 0x00BFFF;\r\n this._colorNames[\"lightskyblue\"] = 0x87CEFA;\r\n this._colorNames[\"skyblue\"] = 0x87CEEB;\r\n this._colorNames[\"lightblue\"] = 0xADD8E6;\r\n this._colorNames[\"powderblue\"] = 0xB0E0E6;\r\n this._colorNames[\"azure\"] = 0xF0FFFF;\r\n this._colorNames[\"lightcyan\"] = 0xE0FFFF;\r\n this._colorNames[\"paleturquoise\"] = 0xAFEEEE;\r\n this._colorNames[\"mediumturquoise\"] = 0x48D1CC;\r\n this._colorNames[\"lightseagreen\"] = 0x20B2AA;\r\n this._colorNames[\"darkcyan\"] = 0x008B8B;\r\n this._colorNames[\"teal\"] = 0x008080;\r\n this._colorNames[\"cadetblue\"] = 0x5F9EA0;\r\n this._colorNames[\"darkturquoise\"] = 0x00CED1;\r\n this._colorNames[\"aqua\"] = 0x00FFFF;\r\n this._colorNames[\"cyan\"] = 0x00FFFF;\r\n this._colorNames[\"turquoise\"] = 0x40E0D0;\r\n this._colorNames[\"aquamarine\"] = 0x7FFFD4;\r\n this._colorNames[\"mediumaquamarine\"] = 0x66CDAA;\r\n this._colorNames[\"darkseagreen\"] = 0x8FBC8F;\r\n this._colorNames[\"mediumseagreen\"] = 0x3CB371;\r\n this._colorNames[\"seagreen\"] = 0x2E8B57;\r\n this._colorNames[\"darkgreen\"] = 0x006400;\r\n this._colorNames[\"green\"] = 0x008000;\r\n this._colorNames[\"forestgreen\"] = 0x228B22;\r\n this._colorNames[\"limegreen\"] = 0x32CD32;\r\n this._colorNames[\"lime\"] = 0x00FF00;\r\n this._colorNames[\"chartreuse\"] = 0x7FFF00;\r\n this._colorNames[\"lawngreen\"] = 0x7CFC00;\r\n this._colorNames[\"greenyellow\"] = 0xADFF2F;\r\n this._colorNames[\"yellowgreen\"] = 0x9ACD32;\r\n this._colorNames[\"palegreen\"] = 0x98FB98;\r\n this._colorNames[\"lightgreen\"] = 0x90EE90;\r\n this._colorNames[\"springgreen\"] = 0x00FF7F;\r\n this._colorNames[\"mediumspringgreen\"] = 0x00FA9A;\r\n this._colorNames[\"darkolivegreen\"] = 0x556B2F;\r\n this._colorNames[\"olivedrab\"] = 0x6B8E23;\r\n this._colorNames[\"olive\"] = 0x808000;\r\n this._colorNames[\"darkkhaki\"] = 0xBDB76B;\r\n this._colorNames[\"darkgoldenrod\"] = 0xB8860B;\r\n this._colorNames[\"goldenrod\"] = 0xDAA520;\r\n this._colorNames[\"gold\"] = 0xFFD700;\r\n this._colorNames[\"yellow\"] = 0xFFFF00;\r\n this._colorNames[\"khaki\"] = 0xF0E68C;\r\n this._colorNames[\"palegoldenrod\"] = 0xEEE8AA;\r\n this._colorNames[\"blanchedalmond\"] = 0xFFEBCD;\r\n this._colorNames[\"moccasin\"] = 0xFFE4B5;\r\n this._colorNames[\"wheat\"] = 0xF5DEB3;\r\n this._colorNames[\"navajowhite\"] = 0xFFDEAD;\r\n this._colorNames[\"burlywood\"] = 0xDEB887;\r\n this._colorNames[\"tan\"] = 0xD2B48C;\r\n this._colorNames[\"rosybrown\"] = 0xBC8F8F;\r\n this._colorNames[\"sienna\"] = 0xA0522D;\r\n this._colorNames[\"saddlebrown\"] = 0x8B4513;\r\n this._colorNames[\"chocolate\"] = 0xD2691E;\r\n this._colorNames[\"peru\"] = 0xCD853F;\r\n this._colorNames[\"sandybrown\"] = 0xF4A460;\r\n this._colorNames[\"darkred\"] = 0x8B0000;\r\n this._colorNames[\"maroon\"] = 0x800000;\r\n this._colorNames[\"brown\"] = 0xA52A2A;\r\n this._colorNames[\"firebrick\"] = 0xB22222;\r\n this._colorNames[\"indianred\"] = 0xCD5C5C;\r\n this._colorNames[\"lightcoral\"] = 0xF08080;\r\n this._colorNames[\"salmon\"] = 0xFA8072;\r\n this._colorNames[\"darksalmon\"] = 0xE9967A;\r\n this._colorNames[\"lightsalmon\"] = 0xFFA07A;\r\n this._colorNames[\"coral\"] = 0xFF7F50;\r\n this._colorNames[\"tomato\"] = 0xFF6347;\r\n this._colorNames[\"darkorange\"] = 0xFF8C00;\r\n this._colorNames[\"orange\"] = 0xFFA500;\r\n this._colorNames[\"orangered\"] = 0xFF4500;\r\n this._colorNames[\"crimson\"] = 0xDC143C;\r\n this._colorNames[\"red\"] = 0xFF0000;\r\n this._colorNames[\"deeppink\"] = 0xFF1493;\r\n this._colorNames[\"fuchsia\"] = 0xFF00FF;\r\n this._colorNames[\"magenta\"] = 0xFF00FF;\r\n this._colorNames[\"hotpink\"] = 0xFF69B4;\r\n this._colorNames[\"lightpink\"] = 0xFFB6C1;\r\n this._colorNames[\"pink\"] = 0xFFC0CB;\r\n this._colorNames[\"palevioletred\"] = 0xDB7093;\r\n this._colorNames[\"mediumvioletred\"] = 0xC71585;\r\n this._colorNames[\"purple\"] = 0x800080;\r\n this._colorNames[\"darkmagenta\"] = 0x8B008B;\r\n this._colorNames[\"mediumpurple\"] = 0x9370DB;\r\n this._colorNames[\"blueviolet\"] = 0x8A2BE2;\r\n this._colorNames[\"indigo\"] = 0x4B0082;\r\n this._colorNames[\"darkviolet\"] = 0x9400D3;\r\n this._colorNames[\"darkorchid\"] = 0x9932CC;\r\n this._colorNames[\"mediumorchid\"] = 0xBA55D3;\r\n this._colorNames[\"orchid\"] = 0xDA70D6;\r\n this._colorNames[\"violet\"] = 0xEE82EE;\r\n this._colorNames[\"plum\"] = 0xDDA0DD;\r\n this._colorNames[\"thistle\"] = 0xD8BFD8;\r\n this._colorNames[\"lavender\"] = 0xE6E6FA;\r\n this._colorNames[\"ghostwhite\"] = 0xF8F8FF;\r\n this._colorNames[\"aliceblue\"] = 0xF0F8FF;\r\n this._colorNames[\"mintcream\"] = 0xF5FFFA;\r\n this._colorNames[\"honeydew\"] = 0xF0FFF0;\r\n this._colorNames[\"lightgoldenrodyellow\"] = 0xFAFAD2;\r\n this._colorNames[\"lemonchiffon\"] = 0xFFFACD;\r\n this._colorNames[\"cornsilk\"] = 0xFFF8DC;\r\n this._colorNames[\"lightyellow\"] = 0xFFFFE0;\r\n this._colorNames[\"ivory\"] = 0xFFFFF0;\r\n this._colorNames[\"floralwhite\"] = 0xFFFAF0;\r\n this._colorNames[\"linen\"] = 0xFAF0E6;\r\n this._colorNames[\"oldlace\"] = 0xFDF5E6;\r\n this._colorNames[\"antiquewhite\"] = 0xFAEBD7;\r\n this._colorNames[\"bisque\"] = 0xFFE4C4;\r\n this._colorNames[\"peachpuff\"] = 0xFFDAB9;\r\n this._colorNames[\"papayawhip\"] = 0xFFEFD5;\r\n this._colorNames[\"beige\"] = 0xF5F5DC;\r\n this._colorNames[\"seashell\"] = 0xFFF5EE;\r\n this._colorNames[\"lavenderblush\"] = 0xFFF0F5;\r\n this._colorNames[\"mistyrose\"] = 0xFFE4E1;\r\n this._colorNames[\"snow\"] = 0xFFFAFA;\r\n this._colorNames[\"white\"] = 0xFFFFFF;\r\n this._colorNames[\"whitesmoke\"] = 0xF5F5F5;\r\n this._colorNames[\"gainsboro\"] = 0xDCDCDC;\r\n this._colorNames[\"lightgrey\"] = 0xD3D3D3;\r\n this._colorNames[\"silver\"] = 0xC0C0C0;\r\n this._colorNames[\"darkgrey\"] = 0xA9A9A9;\r\n this._colorNames[\"grey\"] = 0x808080;\r\n this._colorNames[\"lightslategrey\"] = 0x778899;\r\n this._colorNames[\"slategrey\"] = 0x708090;\r\n this._colorNames[\"dimgrey\"] = 0x696969;\r\n this._colorNames[\"darkslategrey\"] = 0x2F4F4F;\r\n this._colorNames[\"black\"] = 0x000000;\r\n this._colorNames[\"transparent\"] = 0xFF000000;\r\n }\r\n if (this._colorNames[data] != null)\r\n return this._colorNames[data];\r\n if ((data.length == 6) && this.isHex(data))\r\n return parseInt(\"0x\" + data);\r\n }\r\n return null;\r\n };\r\n Cast.color = function (data) {\r\n var result = this.tryColor(data);\r\n if (result == null)\r\n throw new CastError(\"Can't cast to color: \" + data);\r\n return result;\r\n };\r\n Cast.tryClass = function (name) {\r\n if (this._notClasses[name])\r\n return name;\r\n var result = this._classes[name];\r\n if (result != null)\r\n return result;\r\n try {\r\n result = window[name];\r\n this._classes[name] = result;\r\n return result;\r\n }\r\n catch (e /*ReferenceError*/) {\r\n }\r\n this._notClasses[name] = true;\r\n return name;\r\n };\r\n Cast.image2D = function (data) {\r\n if (data == null)\r\n return null;\r\n if (typeof (data) == 'string')\r\n data = this.tryClass(data);\r\n if (typeof (data) == 'function') {\r\n try {\r\n data = new data();\r\n }\r\n catch (e /*ArgumentError*/) {\r\n data = new data(0, 0);\r\n }\r\n }\r\n if (data instanceof Image2D)\r\n return data;\r\n if (data instanceof Single2DTexture)\r\n data = data.image2D;\r\n throw new CastError(\"Can't cast to BitmapImage2D: \" + data);\r\n };\r\n Cast.bitmapTexture = function (data) {\r\n if (data == null)\r\n return null;\r\n if (typeof (data) == 'string')\r\n data = this.tryClass(data);\r\n if (typeof (data) == 'function') {\r\n try {\r\n data = new data();\r\n }\r\n catch (e /*ArgumentError*/) {\r\n data = new data(0, 0);\r\n }\r\n }\r\n if (data instanceof Single2DTexture)\r\n return data;\r\n try {\r\n var bmd = Cast.image2D(data);\r\n return new Single2DTexture(bmd);\r\n }\r\n catch (e /*CastError*/) {\r\n }\r\n throw new CastError(\"Can't cast to Single2DTexture: \" + data);\r\n };\r\n return Cast;\r\n}());\r\nexport { Cast };\r\nCast._hexChars = \"0123456789abcdefABCDEF\";\r\nCast._notClasses = new Object();\r\nCast._classes = new Object();\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/utils/Cast.js","import * as tslib_1 from \"tslib\";\r\nimport { DisplayObjectContainer } from \"./display/DisplayObjectContainer\";\r\nvar Scene = (function (_super) {\r\n tslib_1.__extends(Scene, _super);\r\n function Scene() {\r\n var _this = _super.call(this) || this;\r\n _this._objects = new Object();\r\n _this._views = new Array();\r\n _this._iCollectionMark = 0;\r\n _this.mouseEnabled = false;\r\n _this._iIsRoot = true;\r\n _this._iIsPartition = true;\r\n _this._pScene = _this;\r\n _this._pPartition = _this;\r\n return _this;\r\n }\r\n Object.defineProperty(Scene.prototype, \"assetType\", {\r\n /**\r\n *\r\n */\r\n get: function () {\r\n return Scene.assetType;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * @internal\r\n */\r\n Scene.prototype._iRegisterObject = function (displayObject) {\r\n this._objects[displayObject.id] = displayObject;\r\n var len = this._views.length;\r\n for (var i = 0; i < len; i++)\r\n this._views[i].registerObject(displayObject);\r\n };\r\n /**\r\n * @internal\r\n */\r\n Scene.prototype._iUnregisterObject = function (displayObject) {\r\n delete this._objects[displayObject.id];\r\n var len = this._views.length;\r\n for (var i = 0; i < len; i++)\r\n this._views[i].unRegisterObject(displayObject);\r\n };\r\n /**\r\n * @internal\r\n */\r\n Scene.prototype._iRegisterView = function (view) {\r\n this._views.push(view);\r\n for (var key in this._objects)\r\n view.registerObject(this._objects[key]);\r\n };\r\n /**\r\n * @internal\r\n */\r\n Scene.prototype._iUnregisterView = function (view) {\r\n this._views.splice(this._views.indexOf(view), 1);\r\n for (var key in this._objects)\r\n view.unRegisterObject(this._objects[key]);\r\n };\r\n return Scene;\r\n}(DisplayObjectContainer));\r\nexport { Scene };\r\nScene.assetType = \"[asset Scene]\";\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/Scene.js","export * from \"@awayjs/materials\";\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./node_modules/awayjs-full/dist/lib/materials.js\n// module id = 10\n// module chunks = 9","var Flags = (function () {\n function Flags() {\n }\n return Flags;\n}());\nexport { Flags };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/aglsl/assembler/Flags.js","var FS = (function () {\n function FS() {\n }\n return FS;\n}());\nexport { FS };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/aglsl/assembler/FS.js","import { Flags } from \"../../aglsl/assembler/Flags\";\nimport { FS } from \"../../aglsl/assembler/FS\";\n/**\n *\n */\nvar Opcode = (function () {\n function Opcode(dest, aformat, asize, bformat, bsize, opcode, simple, horizontal, fragonly, matrix) {\n this.a = new FS();\n this.b = new FS();\n this.flags = new Flags();\n this.dest = dest;\n this.a.format = aformat;\n this.a.size = asize;\n this.b.format = bformat;\n this.b.size = bsize;\n this.opcode = opcode;\n this.flags.simple = simple;\n this.flags.horizontal = horizontal;\n this.flags.fragonly = fragonly;\n this.flags.matrix = matrix;\n }\n return Opcode;\n}());\nexport { Opcode };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/aglsl/assembler/Opcode.js","import { Opcode } from \"../../aglsl/assembler/Opcode\";\nvar OpcodeMap = (function () {\n function OpcodeMap() {\n }\n Object.defineProperty(OpcodeMap, \"map\", {\n get: function () {\n if (!OpcodeMap._map) {\n OpcodeMap._map = new Array();\n OpcodeMap._map['mov'] = new Opcode(\"vector\", \"vector\", 4, \"none\", 0, 0x00, true, null, null, null); //0\n OpcodeMap._map['add'] = new Opcode(\"vector\", \"vector\", 4, \"vector\", 4, 0x01, true, null, null, null); //1\n OpcodeMap._map['sub'] = new Opcode(\"vector\", \"vector\", 4, \"vector\", 4, 0x02, true, null, null, null); //2\n OpcodeMap._map['mul'] = new Opcode(\"vector\", \"vector\", 4, \"vector\", 4, 0x03, true, null, null, null); //3\n OpcodeMap._map['div'] = new Opcode(\"vector\", \"vector\", 4, \"vector\", 4, 0x04, true, null, null, null); //4\n OpcodeMap._map['rcp'] = new Opcode(\"vector\", \"vector\", 4, \"none\", 0, 0x05, true, null, null, null); //5\n OpcodeMap._map['min'] = new Opcode(\"vector\", \"vector\", 4, \"vector\", 4, 0x06, true, null, null, null); //6\n OpcodeMap._map['max'] = new Opcode(\"vector\", \"vector\", 4, \"vector\", 4, 0x07, true, null, null, null); //7\n OpcodeMap._map['frc'] = new Opcode(\"vector\", \"vector\", 4, \"none\", 0, 0x08, true, null, null, null); //8\n OpcodeMap._map['sqt'] = new Opcode(\"vector\", \"vector\", 4, \"none\", 0, 0x09, true, null, null, null); //9\n OpcodeMap._map['rsq'] = new Opcode(\"vector\", \"vector\", 4, \"none\", 0, 0x0a, true, null, null, null); //10\n OpcodeMap._map['pow'] = new Opcode(\"vector\", \"vector\", 4, \"vector\", 4, 0x0b, true, null, null, null); //11\n OpcodeMap._map['log'] = new Opcode(\"vector\", \"vector\", 4, \"none\", 0, 0x0c, true, null, null, null); //12\n OpcodeMap._map['exp'] = new Opcode(\"vector\", \"vector\", 4, \"none\", 0, 0x0d, true, null, null, null); //13\n OpcodeMap._map['nrm'] = new Opcode(\"vector\", \"vector\", 4, \"none\", 0, 0x0e, true, null, null, null); //14\n OpcodeMap._map['sin'] = new Opcode(\"vector\", \"vector\", 4, \"none\", 0, 0x0f, true, null, null, null); //15\n OpcodeMap._map['cos'] = new Opcode(\"vector\", \"vector\", 4, \"none\", 0, 0x10, true, null, null, null); //16\n OpcodeMap._map['crs'] = new Opcode(\"vector\", \"vector\", 4, \"vector\", 4, 0x11, true, true, null, null); //17\n OpcodeMap._map['dp3'] = new Opcode(\"vector\", \"vector\", 4, \"vector\", 4, 0x12, true, true, null, null); //18\n OpcodeMap._map['dp4'] = new Opcode(\"vector\", \"vector\", 4, \"vector\", 4, 0x13, true, true, null, null); //19\n OpcodeMap._map['abs'] = new Opcode(\"vector\", \"vector\", 4, \"none\", 0, 0x14, true, null, null, null); //20\n OpcodeMap._map['neg'] = new Opcode(\"vector\", \"vector\", 4, \"none\", 0, 0x15, true, null, null, null); //21\n OpcodeMap._map['sat'] = new Opcode(\"vector\", \"vector\", 4, \"none\", 0, 0x16, true, null, null, null); //22\n OpcodeMap._map['ted'] = new Opcode(\"vector\", \"vector\", 4, \"sampler\", 1, 0x26, true, null, true, null); //38\n OpcodeMap._map['kil'] = new Opcode(\"none\", \"scalar\", 1, \"none\", 0, 0x27, true, null, true, null); //39\n OpcodeMap._map['tex'] = new Opcode(\"vector\", \"vector\", 4, \"sampler\", 1, 0x28, true, null, true, null); //40\n OpcodeMap._map['m33'] = new Opcode(\"vector\", \"matrix\", 3, \"vector\", 3, 0x17, true, null, null, true); //23\n OpcodeMap._map['m44'] = new Opcode(\"vector\", \"matrix\", 4, \"vector\", 4, 0x18, true, null, null, true); //24\n OpcodeMap._map['m43'] = new Opcode(\"vector\", \"matrix\", 3, \"vector\", 4, 0x19, true, null, null, true); //25\n OpcodeMap._map['ddx'] = new Opcode(\"vector\", \"vector\", 4, \"none\", 0, 0x1a, true, null, true, null); //26\n OpcodeMap._map['ddy'] = new Opcode(\"vector\", \"vector\", 4, \"none\", 0, 0x1b, true, null, true, null); //27\n OpcodeMap._map['sge'] = new Opcode(\"vector\", \"vector\", 4, \"vector\", 4, 0x29, true, null, null, null); //41\n OpcodeMap._map['slt'] = new Opcode(\"vector\", \"vector\", 4, \"vector\", 4, 0x2a, true, null, null, null); //42\n OpcodeMap._map['sgn'] = new Opcode(\"vector\", \"vector\", 4, \"vector\", 4, 0x2b, true, null, null, null); //43\n OpcodeMap._map['seq'] = new Opcode(\"vector\", \"vector\", 4, \"vector\", 4, 0x2c, true, null, null, null); //44\n OpcodeMap._map['sne'] = new Opcode(\"vector\", \"vector\", 4, \"vector\", 4, 0x2d, true, null, null, null); //45\n }\n return OpcodeMap._map;\n },\n enumerable: true,\n configurable: true\n });\n return OpcodeMap;\n}());\nexport { OpcodeMap };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/aglsl/assembler/OpcodeMap.js","import { ByteArray } from \"@awayjs/core\";\nvar Part = (function () {\n function Part(name, version) {\n if (name === void 0) { name = null; }\n if (version === void 0) { version = null; }\n this.name = \"\";\n this.version = 0;\n this.name = name;\n this.version = version;\n this.data = new ByteArray();\n }\n return Part;\n}());\nexport { Part };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/aglsl/assembler/Part.js","var Reg = (function () {\n function Reg(code, desc) {\n this.code = code;\n this.desc = desc;\n }\n return Reg;\n}());\nvar RegMap = (function () {\n /*\n public static va:Reg = new Reg( 0x00, \"vertex attribute\" );\n public static fc:Reg = new Reg( 0x01, \"fragment constant\" );\n public static vc:Reg = new Reg( 0x01, \"vertex constant\" );\n public static ft:Reg = new Reg( 0x02, \"fragment temporary\" );\n public static vt:Reg = new Reg( 0x02, \"vertex temporary\" );\n public static vo:Reg = new Reg( 0x03, \"vertex output\" );\n public static op:Reg = new Reg( 0x03, \"vertex output\" );\n public static fd:Reg = new Reg( 0x03, \"fragment depth output\" );\n public static fo:Reg = new Reg( 0x03, \"fragment output\" );\n public static oc:Reg = new Reg( 0x03, \"fragment output\" );\n public static v: Reg = new Reg( 0x04, \"varying\" );\n public static vi:Reg = new Reg( 0x04, \"varying output\" );\n public static fi:Reg = new Reg( 0x04, \"varying input\" );\n public static fs:Reg = new Reg( 0x05, \"sampler\" );\n */\n function RegMap() {\n }\n Object.defineProperty(RegMap, \"map\", {\n get: function () {\n if (!RegMap._map) {\n RegMap._map = new Array();\n RegMap._map['va'] = new Reg(0x00, \"vertex attribute\");\n RegMap._map['fc'] = new Reg(0x01, \"fragment constant\");\n RegMap._map['vc'] = new Reg(0x01, \"vertex constant\");\n RegMap._map['ft'] = new Reg(0x02, \"fragment temporary\");\n RegMap._map['vt'] = new Reg(0x02, \"vertex temporary\");\n RegMap._map['vo'] = new Reg(0x03, \"vertex output\");\n RegMap._map['op'] = new Reg(0x03, \"vertex output\");\n RegMap._map['fd'] = new Reg(0x03, \"fragment depth output\");\n RegMap._map['fo'] = new Reg(0x03, \"fragment output\");\n RegMap._map['oc'] = new Reg(0x03, \"fragment output\");\n RegMap._map['v'] = new Reg(0x04, \"varying\");\n RegMap._map['vi'] = new Reg(0x04, \"varying output\");\n RegMap._map['fi'] = new Reg(0x04, \"varying input\");\n RegMap._map['fs'] = new Reg(0x05, \"sampler\");\n }\n return RegMap._map;\n },\n enumerable: true,\n configurable: true\n });\n return RegMap;\n}());\nexport { RegMap };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/aglsl/assembler/RegMap.js","var Sampler = (function () {\n function Sampler(shift, mask, value) {\n this.shift = shift;\n this.mask = mask;\n this.value = value;\n }\n return Sampler;\n}());\nexport { Sampler };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/aglsl/assembler/Sampler.js","import { Sampler } from \"../../aglsl/assembler/Sampler\";\nvar SamplerMap = (function () {\n /*\n public static map = [ new Sampler( 8, 0xf, 0 ),\n new Sampler( 8, 0xf, 5 ),\n new Sampler( 8, 0xf, 4 ),\n new Sampler( 8, 0xf, 1 ),\n new Sampler( 8, 0xf, 2 ),\n new Sampler( 8, 0xf, 1 ),\n new Sampler( 8, 0xf, 2 ),\n\n // dimension\n new Sampler( 12, 0xf, 0 ),\n new Sampler( 12, 0xf, 1 ),\n new Sampler( 12, 0xf, 2 ),\n\n // special\n new Sampler( 16, 1, 1 ),\n new Sampler( 16, 4, 4 ),\n\n // repeat\n new Sampler( 20, 0xf, 0 ),\n new Sampler( 20, 0xf, 1 ),\n new Sampler( 20, 0xf, 1 ),\n\n // mip\n new Sampler( 24, 0xf, 0 ),\n new Sampler( 24, 0xf, 0 ),\n new Sampler( 24, 0xf, 1 ),\n new Sampler( 24, 0xf, 2 ),\n\n // filter\n new Sampler( 28, 0xf, 0 ),\n new Sampler( 28, 0xf, 1 ) ]\n */\n /*\n public static rgba: Sampler = new Sampler( 8, 0xf, 0 );\n public static rg: Sampler = new Sampler( 8, 0xf, 5 );\n public static r: Sampler = new Sampler( 8, 0xf, 4 );\n public static compressed: Sampler = new Sampler( 8, 0xf, 1 );\n public static compressed_alpha: Sampler = new Sampler( 8, 0xf, 2 );\n public static dxt1: Sampler = new Sampler( 8, 0xf, 1 );\n public static dxt5: Sampler = new Sampler( 8, 0xf, 2 );\n\n // dimension\n public static sampler2d: Sampler = new Sampler( 12, 0xf, 0 );\n public static cube: Sampler = new Sampler( 12, 0xf, 1 );\n public static sampler3d: Sampler = new Sampler( 12, 0xf, 2 );\n\n // special\n public static centroid: Sampler = new Sampler( 16, 1, 1 );\n public static ignoresampler: Sampler = new Sampler( 16, 4, 4 );\n\n // repeat\n public static clamp: Sampler = new Sampler( 20, 0xf, 0 );\n public static repeat: Sampler = new Sampler( 20, 0xf, 1 );\n public static wrap: Sampler = new Sampler( 20, 0xf, 1 );\n\n // mip\n public static nomip: Sampler = new Sampler( 24, 0xf, 0 );\n public static mipnone: Sampler = new Sampler( 24, 0xf, 0 );\n public static mipnearest: Sampler = new Sampler( 24, 0xf, 1 );\n public static miplinear: Sampler = new Sampler( 24, 0xf, 2 );\n\n // filter\n public static nearest: Sampler = new Sampler( 28, 0xf, 0 );\n public static linear: Sampler = new Sampler( 28, 0xf, 1 );\n */\n function SamplerMap() {\n }\n Object.defineProperty(SamplerMap, \"map\", {\n get: function () {\n if (!SamplerMap._map) {\n SamplerMap._map = new Array();\n SamplerMap._map['rgba'] = new Sampler(8, 0xf, 0);\n SamplerMap._map['rg'] = new Sampler(8, 0xf, 5);\n SamplerMap._map['r'] = new Sampler(8, 0xf, 4);\n SamplerMap._map['compressed'] = new Sampler(8, 0xf, 1);\n SamplerMap._map['compressed_alpha'] = new Sampler(8, 0xf, 2);\n SamplerMap._map['dxt1'] = new Sampler(8, 0xf, 1);\n SamplerMap._map['dxt5'] = new Sampler(8, 0xf, 2);\n // dimension\n SamplerMap._map['2d'] = new Sampler(12, 0xf, 0);\n SamplerMap._map['cube'] = new Sampler(12, 0xf, 1);\n SamplerMap._map['3d'] = new Sampler(12, 0xf, 2);\n // special\n SamplerMap._map['centroid'] = new Sampler(16, 1, 1);\n SamplerMap._map['ignoresampler'] = new Sampler(16, 4, 4);\n // repeat\n SamplerMap._map['clamp'] = new Sampler(20, 0xf, 0);\n SamplerMap._map['repeat'] = new Sampler(20, 0xf, 1);\n SamplerMap._map['wrap'] = new Sampler(20, 0xf, 1);\n // mip\n SamplerMap._map['nomip'] = new Sampler(24, 0xf, 0);\n SamplerMap._map['mipnone'] = new Sampler(24, 0xf, 0);\n SamplerMap._map['mipnearest'] = new Sampler(24, 0xf, 1);\n SamplerMap._map['miplinear'] = new Sampler(24, 0xf, 2);\n // filter\n SamplerMap._map['nearest'] = new Sampler(28, 0xf, 0);\n SamplerMap._map['linear'] = new Sampler(28, 0xf, 1);\n }\n return SamplerMap._map;\n },\n enumerable: true,\n configurable: true\n });\n return SamplerMap;\n}());\nexport { SamplerMap };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/aglsl/assembler/SamplerMap.js","import { OpcodeMap } from \"../../aglsl/assembler/OpcodeMap\";\nimport { Part } from \"../../aglsl/assembler/Part\";\nimport { RegMap } from \"../../aglsl/assembler/RegMap\";\nimport { SamplerMap } from \"../../aglsl/assembler/SamplerMap\";\nvar AGALMiniAssembler = (function () {\n function AGALMiniAssembler() {\n this.r = {};\n this.cur = new Part();\n }\n AGALMiniAssembler.prototype.assemble = function (source, ext_part, ext_version) {\n if (ext_part === void 0) { ext_part = null; }\n if (ext_version === void 0) { ext_version = null; }\n if (!ext_version) {\n ext_version = 1;\n }\n if (ext_part) {\n this.addHeader(ext_part, ext_version);\n }\n var lines = source.replace(/[\\f\\n\\r\\v]+/g, \"\\n\").split(\"\\n\"); // handle breaks, then split into lines\n for (var i in lines) {\n this.processLine(lines[i], i);\n }\n return this.r;\n };\n AGALMiniAssembler.prototype.processLine = function (line, linenr) {\n var startcomment = line.search(\"//\"); // remove comments\n if (startcomment != -1) {\n line = line.slice(0, startcomment);\n }\n line = line.replace(/^\\s+|\\s+$/g, \"\"); // remove outer space\n if (!(line.length > 0)) {\n return;\n }\n var optsi = line.search(/<.*>/g); // split of options part <*> if there\n var opts = null;\n if (optsi != -1) {\n opts = line.slice(optsi).match(/([\\w\\.\\-\\+]+)/gi);\n line = line.slice(0, optsi);\n }\n // get opcode/command\t\t\t\t \n var tokens = line.match(/([\\w\\.\\+\\[\\]]+)/gi); // get tokens in line\n if (!tokens || tokens.length < 1) {\n if (line.length >= 3) {\n console.log(\"Warning: bad line \" + linenr + \": \" + line);\n }\n return;\n }\n //console.log ( linenr, line, cur, tokens ); \n switch (tokens[0]) {\n case \"part\":\n this.addHeader(tokens[1], Number(tokens[2]));\n break;\n case \"endpart\":\n if (!this.cur) {\n throw \"Unexpected endpart\";\n }\n this.cur.data.position = 0;\n this.cur = null;\n return;\n default:\n if (!this.cur) {\n console.log(\"Warning: bad line \" + linenr + \": \" + line + \" (Outside of any part definition)\");\n return;\n }\n if (this.cur.name == \"comment\") {\n return;\n }\n var op = OpcodeMap.map[tokens[0]];\n if (!op) {\n throw \"Bad opcode \" + tokens[0] + \" \" + linenr + \": \" + line;\n }\n // console.log( 'AGALMiniAssembler' , 'op' , op );\n this.emitOpcode(this.cur, op.opcode);\n var ti = 1;\n if (op.dest && op.dest != \"none\") {\n if (!this.emitDest(this.cur, tokens[ti++], op.dest)) {\n throw \"Bad destination register \" + tokens[ti - 1] + \" \" + linenr + \": \" + line;\n }\n }\n else {\n this.emitZeroDword(this.cur);\n }\n if (op.a && op.a.format != \"none\") {\n if (!this.emitSource(this.cur, tokens[ti++], op.a))\n throw \"Bad source register \" + tokens[ti - 1] + \" \" + linenr + \": \" + line;\n }\n else {\n this.emitZeroQword(this.cur);\n }\n if (op.b && op.b.format != \"none\") {\n if (op.b.format == \"sampler\") {\n if (!this.emitSampler(this.cur, tokens[ti++], op.b, opts)) {\n throw \"Bad sampler register \" + tokens[ti - 1] + \" \" + linenr + \": \" + line;\n }\n }\n else {\n if (!this.emitSource(this.cur, tokens[ti++], op.b)) {\n throw \"Bad source register \" + tokens[ti - 1] + \" \" + linenr + \": \" + line;\n }\n }\n }\n else {\n this.emitZeroQword(this.cur);\n }\n break;\n }\n };\n AGALMiniAssembler.prototype.emitHeader = function (pr) {\n pr.data.writeUnsignedByte(0xa0); // tag version\n pr.data.writeUnsignedInt(pr.version);\n if (pr.version >= 0x10) {\n pr.data.writeUnsignedByte(0); // align, for higher versions\n }\n pr.data.writeUnsignedByte(0xa1); // tag program id\n switch (pr.name) {\n case \"fragment\":\n pr.data.writeUnsignedByte(1);\n break;\n case \"vertex\":\n pr.data.writeUnsignedByte(0);\n break;\n case \"cpu\":\n pr.data.writeUnsignedByte(2);\n break;\n default:\n pr.data.writeUnsignedByte(0xff);\n break; // unknown/comment\n }\n };\n AGALMiniAssembler.prototype.emitOpcode = function (pr, opcode) {\n pr.data.writeUnsignedInt(opcode);\n //console.log ( \"Emit opcode: \", opcode ); \n };\n AGALMiniAssembler.prototype.emitZeroDword = function (pr) {\n pr.data.writeUnsignedInt(0);\n };\n AGALMiniAssembler.prototype.emitZeroQword = function (pr) {\n pr.data.writeUnsignedInt(0);\n pr.data.writeUnsignedInt(0);\n };\n AGALMiniAssembler.prototype.emitDest = function (pr, token, opdest) {\n //console.log( 'AGALMiniAssembler' , 'emitDest' , 'RegMap.map' , RegMap.map);\n var reg = token.match(/([fov]?[tpocidavs])(\\d*)(\\.[xyzw]{1,4})?/i); // g1: regname, g2:regnum, g3:mask\n // console.log( 'AGALMiniAssembler' , 'emitDest' , 'reg' , reg , reg[1] , RegMap.map[reg[1]] );\n // console.log( 'AGALMiniAssembler' , 'emitDest' , 'RegMap.map[reg[1]]' , RegMap.map[reg[1]] , 'bool' , !RegMap.map[reg[1]] ) ;\n if (!RegMap.map[reg[1]])\n return false;\n var em = { num: reg[2] ? reg[2] : 0, code: RegMap.map[reg[1]].code, mask: this.stringToMask(reg[3]) };\n pr.data.writeUnsignedShort(em.num);\n pr.data.writeUnsignedByte(em.mask);\n pr.data.writeUnsignedByte(em.code);\n //console.log ( \" Emit dest: \", em );\n return true;\n };\n AGALMiniAssembler.prototype.stringToMask = function (s) {\n if (!s)\n return 0xf;\n var r = 0;\n if (s.indexOf(\"x\") != -1)\n r |= 1;\n if (s.indexOf(\"y\") != -1)\n r |= 2;\n if (s.indexOf(\"z\") != -1)\n r |= 4;\n if (s.indexOf(\"w\") != -1)\n r |= 8;\n return r;\n };\n AGALMiniAssembler.prototype.stringToSwizzle = function (s) {\n if (!s) {\n return 0xe4;\n }\n var chartoindex = { x: 0, y: 1, z: 2, w: 3 };\n var sw = 0;\n if (s.charAt(0) != \".\") {\n throw \"Missing . for swizzle\";\n }\n if (s.length > 1) {\n sw |= chartoindex[s.charAt(1)];\n }\n if (s.length > 2) {\n sw |= chartoindex[s.charAt(2)] << 2;\n }\n else {\n sw |= (sw & 3) << 2;\n }\n if (s.length > 3) {\n sw |= chartoindex[s.charAt(3)] << 4;\n }\n else {\n sw |= (sw & (3 << 2)) << 2;\n }\n if (s.length > 4) {\n sw |= chartoindex[s.charAt(4)] << 6;\n }\n else {\n sw |= (sw & (3 << 4)) << 2;\n }\n return sw;\n };\n AGALMiniAssembler.prototype.emitSampler = function (pr, token, opsrc, opts) {\n var reg = token.match(/fs(\\d*)/i); // g1:regnum\n if (!reg || !reg[1]) {\n return false;\n }\n pr.data.writeUnsignedShort(parseInt(reg[1]));\n pr.data.writeUnsignedByte(0); // bias\n pr.data.writeUnsignedByte(0);\n /*\n pr.data.writeUnsignedByte ( 0x5 );\n pr.data.writeUnsignedByte ( 0 ); // readmode, dim\n pr.data.writeUnsignedByte ( 0 ); // special, wrap\n pr.data.writeUnsignedByte ( 0 ); // mip, filter\n */\n var samplerbits = 0x5;\n var sampleroptset = 0;\n for (var i = 0; i < opts.length; i++) {\n var o = SamplerMap.map[opts[i].toLowerCase()];\n //console.log( 'AGALMiniAssembler' , 'emitSampler' , 'SampleMap opt:' , o , '<-------- WATCH FOR THIS');\n if (o) {\n if (((sampleroptset >> o.shift) & o.mask) != 0) {\n console.log(\"Warning, duplicate sampler option\");\n }\n sampleroptset |= o.mask << o.shift;\n samplerbits &= ~(o.mask << o.shift);\n samplerbits |= o.value << o.shift;\n }\n else {\n console.log(\"Warning, unknown sampler option: \", opts[i]);\n }\n }\n pr.data.writeUnsignedInt(samplerbits);\n return true;\n };\n AGALMiniAssembler.prototype.emitSource = function (pr, token, opsrc) {\n var indexed = token.match(/vc\\[(v[tcai])(\\d+)\\.([xyzw])([\\+\\-]\\d+)?\\](\\.[xyzw]{1,4})?/i); // g1: indexregname, g2:indexregnum, g3:select, [g4:offset], [g5:swizzle]\n var reg;\n if (indexed) {\n if (!RegMap.map[indexed[1]]) {\n return false;\n }\n var selindex = { x: 0, y: 1, z: 2, w: 3 };\n var em = { num: indexed[2] | 0, code: RegMap.map[indexed[1]].code, swizzle: this.stringToSwizzle(indexed[5]), select: selindex[indexed[3]], offset: indexed[4] | 0 };\n pr.data.writeUnsignedShort(em.num);\n pr.data.writeByte(em.offset);\n pr.data.writeUnsignedByte(em.swizzle);\n pr.data.writeUnsignedByte(0x1); // constant reg\n pr.data.writeUnsignedByte(em.code);\n pr.data.writeUnsignedByte(em.select);\n pr.data.writeUnsignedByte(1 << 7);\n }\n else {\n reg = token.match(/([fov]?[tpocidavs])(\\d*)(\\.[xyzw]{1,4})?/i); // g1: regname, g2:regnum, g3:swizzle\n if (!RegMap.map[reg[1]]) {\n return false;\n }\n var em = { num: reg[2] | 0, code: RegMap.map[reg[1]].code, swizzle: this.stringToSwizzle(reg[3]) };\n pr.data.writeUnsignedShort(em.num);\n pr.data.writeUnsignedByte(0);\n pr.data.writeUnsignedByte(em.swizzle);\n pr.data.writeUnsignedByte(em.code);\n pr.data.writeUnsignedByte(0);\n pr.data.writeUnsignedByte(0);\n pr.data.writeUnsignedByte(0);\n }\n return true;\n };\n AGALMiniAssembler.prototype.addHeader = function (partname, version) {\n if (!version) {\n version = 1;\n }\n if (this.r[partname] == undefined) {\n this.r[partname] = new Part(partname, version);\n this.emitHeader(this.r[partname]);\n }\n else if (this.r[partname].version != version) {\n throw \"Multiple versions for part \" + partname;\n }\n this.cur = this.r[partname];\n };\n return AGALMiniAssembler;\n}());\nexport { AGALMiniAssembler };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/aglsl/assembler/AGALMiniAssembler.js","var Header = (function () {\n function Header() {\n this.progid = 0;\n this.version = 0;\n this.type = \"\";\n }\n return Header;\n}());\nexport { Header };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/aglsl/Header.js","import { Header } from \"../aglsl/Header\";\nvar Description = (function () {\n function Description() {\n this.regread = [\n [],\n [],\n [],\n [],\n [],\n [],\n []\n ];\n this.regwrite = [\n [],\n [],\n [],\n [],\n [],\n [],\n []\n ];\n this.hasindirect = false;\n this.writedepth = false;\n this.hasmatrix = false;\n this.samplers = [];\n // added due to dynamic assignment 3*0xFFFFFFuuuu\n this.tokens = [];\n this.header = new Header();\n }\n return Description;\n}());\nexport { Description };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/aglsl/Description.js","var OpLUT = (function () {\n function OpLUT(s, flags, dest, a, b, matrixwidth, matrixheight, ndwm, scaler, dm, lod) {\n this.s = s;\n this.flags = flags;\n this.dest = dest;\n this.a = a;\n this.b = b;\n this.matrixwidth = matrixwidth;\n this.matrixheight = matrixheight;\n this.ndwm = ndwm;\n this.scalar = scaler;\n this.dm = dm;\n this.lod = lod;\n }\n return OpLUT;\n}());\nexport { OpLUT };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/aglsl/OpLUT.js","import { OpLUT } from \"../aglsl/OpLUT\";\nvar Mapping = (function () {\n //TODO: get rid of hack that fixes including definition file\n function Mapping(include) {\n }\n return Mapping;\n}());\nexport { Mapping };\nMapping.agal2glsllut = [\n // s \t\t\t\t\t\t\t\t\t\t\t\tflags dest a b \t mw \t mh ndwm scale dm\t lod\n new OpLUT(\"%dest = %cast(%a);\\n\", 0, true, true, false, null, null, null, null, null, null),\n new OpLUT(\"%dest = %cast(%a + %b);\\n\", 0, true, true, true, null, null, null, null, null, null),\n new OpLUT(\"%dest = %cast(%a - %b);\\n\", 0, true, true, true, null, null, null, null, null, null),\n new OpLUT(\"%dest = %cast(%a * %b);\\n\", 0, true, true, true, null, null, null, null, null, null),\n new OpLUT(\"%dest = %cast(%a / %b);\\n\", 0, true, true, true, null, null, null, null, null, null),\n new OpLUT(\"%dest = %cast(1.0) / %a;\\n\", 0, true, true, false, null, null, null, null, null, null),\n new OpLUT(\"%dest = %cast(min(%a,%b));\\n\", 0, true, true, true, null, null, null, null, null, null),\n new OpLUT(\"%dest = %cast(max(%a,%b));\\n\", 0, true, true, true, null, null, null, null, null, null),\n new OpLUT(\"%dest = %cast(fract(%a));\\n\", 0, true, true, false, null, null, null, null, null, null),\n new OpLUT(\"%dest = %cast(sqrt(abs(%a)));\\n\", 0, true, true, false, null, null, null, null, null, null),\n new OpLUT(\"%dest = %cast(inversesqrt(abs(%a)));\\n\", 0, true, true, false, null, null, null, null, null, null),\n new OpLUT(\"%dest = %cast(pow(abs(%a),%b));\\n\", 0, true, true, true, null, null, null, null, null, null),\n new OpLUT(\"%dest = %cast(log2(abs(%a)));\\n\", 0, true, true, false, null, null, null, null, null, null),\n new OpLUT(\"%dest = %cast(exp2(%a));\\n\", 0, true, true, false, null, null, null, null, null, null),\n // s \t\t\t\t\t\t\t\t\t\t\t\tflags \tdest a b \t mw \t mh ndwm scale dm\t lod\n new OpLUT(\"%dest = %cast(normalize(vec3( %a ) ));\\n\", 0, true, true, false, null, null, true, null, null, null),\n new OpLUT(\"%dest = %cast(sin(%a));\\n\", 0, true, true, false, null, null, null, null, null, null),\n new OpLUT(\"%dest = %cast(cos(%a));\\n\", 0, true, true, false, null, null, null, null, null, null),\n new OpLUT(\"%dest = %cast(cross(vec3(%a),vec3(%b)));\\n\", 0, true, true, true, null, null, true, null, null, null),\n new OpLUT(\"%dest = %cast(dot(vec3(%a),vec3(%b)));\\n\", 0, true, true, true, null, null, true, null, null, null),\n new OpLUT(\"%dest = %cast(dot(vec4(%a),vec4(%b)));\\n\", 0, true, true, true, null, null, true, null, null, null),\n new OpLUT(\"%dest = %cast(abs(%a));\\n\", 0, true, true, false, null, null, null, null, null, null),\n new OpLUT(\"%dest = %cast(%a * -1.0);\\n\", 0, true, true, false, null, null, null, null, null, null),\n new OpLUT(\"%dest = %cast(clamp(%a,0.0,1.0));\\n\", 0, true, true, false, null, null, null, null, null, null),\n new OpLUT(\"%dest = %cast(dot(vec3(%a),vec3(%b)));\\n\", null, true, true, true, 3, 3, true, null, null, null),\n new OpLUT(\"%dest = %cast(dot(vec4(%a),vec4(%b)));\\n\", null, true, true, true, 4, 4, true, null, null, null),\n new OpLUT(\"%dest = %cast(dot(vec4(%a),vec4(%b)));\\n\", null, true, true, true, 4, 3, true, null, null, null),\n //s:string, flags:number, dest:boolean, a:boolean, b:boolean, matrixwidth:number, matrixheight:number, ndwm:boolean, scaler:boolean, dm:boolean, lod:boolean\n new OpLUT(\"%dest = %cast(dFdx(%a));\\n\", 0, true, true, false, null, null, null, null, null, null),\n new OpLUT(\"%dest = %cast(dFdy(%a));\\n\", 0, true, true, false, null, null, null, null, null, null),\n new OpLUT(\"if (float(%a)==float(%b)) {;\\n\", 0, false, true, true, null, null, null, true, null, null), new OpLUT(\"if (float(%a)!=float(%b)) {;\\n\", 0, false, true, true, null, null, null, true, null, null), new OpLUT(\"if (float(%a)>=float(%b)) {;\\n\", 0, false, true, true, null, null, null, true, null, null), new OpLUT(\"if (float(%a)AnimatorEvent object.\n *\n * @param type The event type.\n * @param animator The animator object that is the subject of this event.\n */\n function AnimatorEvent(type, animator) {\n var _this = _super.call(this, type) || this;\n _this._animator = animator;\n return _this;\n }\n Object.defineProperty(AnimatorEvent.prototype, \"animator\", {\n get: function () {\n return this._animator;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * Clones the event.\n *\n * @return An exact duplicate of the current event object.\n */\n AnimatorEvent.prototype.clone = function () {\n return new AnimatorEvent(this.type, this._animator);\n };\n return AnimatorEvent;\n}(EventBase));\nexport { AnimatorEvent };\n/**\n * Defines the value of the type property of a start event object.\n */\nAnimatorEvent.START = \"animatorStart\";\n/**\n * Defines the value of the type property of a stop event object.\n */\nAnimatorEvent.STOP = \"animatorStop\";\n/**\n * Defines the value of the type property of a cycle complete event object.\n */\nAnimatorEvent.CYCLE_COMPLETE = \"animatorCycleComplete\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/events/AnimatorEvent.js","import * as tslib_1 from \"tslib\";\nimport { AssetBase, AbstractMethodError, RequestAnimationFrame, getTimer } from \"@awayjs/core\";\nimport { AnimatorEvent } from \"../events/AnimatorEvent\";\n/**\n * Dispatched when playback of an animation inside the animator object starts.\n *\n * @eventType away3d.events.AnimatorEvent\n */\n//[Event(name=\"start\", type=\"away3d.events.AnimatorEvent\")]\n/**\n * Dispatched when playback of an animation inside the animator object stops.\n *\n * @eventType away3d.events.AnimatorEvent\n */\n//[Event(name=\"stop\", type=\"away3d.events.AnimatorEvent\")]\n/**\n * Dispatched when playback of an animation reaches the end of an animation.\n *\n * @eventType away3d.events.AnimatorEvent\n */\n//[Event(name=\"cycle_complete\", type=\"away3d.events.AnimatorEvent\")]\n/**\n * Provides an abstract base class for animator classes that control animation output from a data set subtype of AnimationSetBase.\n *\n * @see away.animators.AnimationSetBase\n */\nvar AnimatorBase = (function (_super) {\n tslib_1.__extends(AnimatorBase, _super);\n /**\n * Creates a new AnimatorBase object.\n *\n * @param animationSet The animation data set to be used by the animator object.\n */\n function AnimatorBase(animationSet) {\n var _this = _super.call(this) || this;\n _this._autoUpdate = true;\n _this._time = 0;\n _this._playbackSpeed = 1;\n _this._pOwners = new Array();\n _this._pAbsoluteTime = 0;\n _this._animationStates = new Object();\n /**\n * Enables translation of the animated graphics from data returned per frame via the positionDelta property of the active animation node. Defaults to true.\n *\n * @see away.animators.IAnimationState#positionDelta\n */\n _this.updatePosition = true;\n _this._pAnimationSet = animationSet;\n _this._broadcaster = new RequestAnimationFrame(_this.onEnterFrame, _this);\n return _this;\n }\n AnimatorBase.prototype.getAnimationState = function (node) {\n var className = node.stateClass;\n var uID = node.id;\n if (this._animationStates[uID] == null)\n this._animationStates[uID] = new className(this, node);\n return this._animationStates[uID];\n };\n AnimatorBase.prototype.getAnimationStateByName = function (name) {\n return this.getAnimationState(this._pAnimationSet.getAnimation(name));\n };\n Object.defineProperty(AnimatorBase.prototype, \"absoluteTime\", {\n /**\n * Returns the internal absolute time of the animator, calculated by the current time and the playback speed.\n *\n * @see #time\n * @see #playbackSpeed\n */\n get: function () {\n return this._pAbsoluteTime;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AnimatorBase.prototype, \"animationSet\", {\n /**\n * Returns the animation data set in use by the animator.\n */\n get: function () {\n return this._pAnimationSet;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AnimatorBase.prototype, \"activeState\", {\n /**\n * Returns the current active animation state.\n */\n get: function () {\n return this._pActiveState;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AnimatorBase.prototype, \"activeAnimation\", {\n /**\n * Returns the current active animation node.\n */\n get: function () {\n return this._pAnimationSet.getAnimation(this._pActiveAnimationName);\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AnimatorBase.prototype, \"activeAnimationName\", {\n /**\n * Returns the current active animation node.\n */\n get: function () {\n return this._pActiveAnimationName;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AnimatorBase.prototype, \"autoUpdate\", {\n /**\n * Determines whether the animators internal update mechanisms are active. Used in cases\n * where manual updates are required either via the time property or update() method.\n * Defaults to true.\n *\n * @see #time\n * @see #update()\n */\n get: function () {\n return this._autoUpdate;\n },\n set: function (value) {\n if (this._autoUpdate == value)\n return;\n this._autoUpdate = value;\n if (this._autoUpdate)\n this.start();\n else\n this.stop();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AnimatorBase.prototype, \"time\", {\n /**\n * Gets and sets the internal time clock of the animator.\n */\n get: function () {\n return this._time;\n },\n set: function (value) {\n if (this._time == value)\n return;\n this.update(value);\n },\n enumerable: true,\n configurable: true\n });\n /**\n * Sets the animation phase of the current active state's animation clip(s).\n *\n * @param value The phase value to use. 0 represents the beginning of an animation clip, 1 represents the end.\n */\n AnimatorBase.prototype.phase = function (value) {\n this._pActiveState.phase(value);\n };\n Object.defineProperty(AnimatorBase.prototype, \"playbackSpeed\", {\n /**\n * The amount by which passed time should be scaled. Used to slow down or speed up animations. Defaults to 1.\n */\n get: function () {\n return this._playbackSpeed;\n },\n set: function (value) {\n this._playbackSpeed = value;\n },\n enumerable: true,\n configurable: true\n });\n AnimatorBase.prototype.setRenderState = function (shader, renderable, stage, projection) {\n throw new AbstractMethodError();\n };\n /**\n * Resumes the automatic playback clock controling the active state of the animator.\n */\n AnimatorBase.prototype.start = function () {\n if (this._isPlaying || !this._autoUpdate)\n return;\n this._time = this._pAbsoluteTime = getTimer();\n this._isPlaying = true;\n this._broadcaster.start();\n if (!this.hasEventListener(AnimatorEvent.START))\n return;\n if (this._startEvent == null)\n this._startEvent = new AnimatorEvent(AnimatorEvent.START, this);\n this.dispatchEvent(this._startEvent);\n };\n /**\n * Pauses the automatic playback clock of the animator, in case manual updates are required via the\n * time property or update() method.\n *\n * @see #time\n * @see #update()\n */\n AnimatorBase.prototype.stop = function () {\n if (!this._isPlaying)\n return;\n this._isPlaying = false;\n this._broadcaster.stop();\n if (!this.hasEventListener(AnimatorEvent.STOP))\n return;\n if (this._stopEvent == null)\n this._stopEvent = new AnimatorEvent(AnimatorEvent.STOP, this);\n this.dispatchEvent(this._stopEvent);\n };\n /**\n * Provides a way to manually update the active state of the animator when automatic\n * updates are disabled.\n *\n * @see #stop()\n * @see #autoUpdate\n */\n AnimatorBase.prototype.update = function (time) {\n var dt = (time - this._time) * this.playbackSpeed;\n this._pUpdateDeltaTime(dt);\n this._time = time;\n };\n AnimatorBase.prototype.reset = function (name, offset) {\n if (offset === void 0) { offset = 0; }\n this.getAnimationState(this._pAnimationSet.getAnimation(name)).offset(offset + this._pAbsoluteTime);\n };\n /**\n * Used by the graphics object to which the animator is applied, registers the owner for internal use.\n *\n * @private\n */\n AnimatorBase.prototype.addOwner = function (entity) {\n this._pOwners.push(entity);\n };\n /**\n * Used by the graphics object from which the animator is removed, unregisters the owner for internal use.\n *\n * @private\n */\n AnimatorBase.prototype.removeOwner = function (entity) {\n this._pOwners.splice(this._pOwners.indexOf(entity), 1);\n };\n /**\n * Internal abstract method called when the time delta property of the animator's contents requires updating.\n *\n * @private\n */\n AnimatorBase.prototype._pUpdateDeltaTime = function (dt) {\n this._pAbsoluteTime += dt;\n this._pActiveState.update(this._pAbsoluteTime);\n if (this.updatePosition)\n this.applyPositionDelta();\n };\n /**\n * Enter frame event handler for automatically updating the active state of the animator.\n */\n AnimatorBase.prototype.onEnterFrame = function (event) {\n if (event === void 0) { event = null; }\n this.update(getTimer());\n };\n AnimatorBase.prototype.applyPositionDelta = function () {\n var delta = this._pActiveState.positionDelta;\n var dist = delta.length;\n var len;\n if (dist > 0) {\n len = this._pOwners.length;\n for (var i = 0; i < len; ++i)\n this._pOwners[i].transform.translateLocal(delta, dist);\n }\n };\n /**\n * for internal use.\n *\n * @private\n */\n AnimatorBase.prototype.dispatchCycleEvent = function () {\n if (this.hasEventListener(AnimatorEvent.CYCLE_COMPLETE)) {\n if (this._cycleEvent == null)\n this._cycleEvent = new AnimatorEvent(AnimatorEvent.CYCLE_COMPLETE, this);\n this.dispatchEvent(this._cycleEvent);\n }\n };\n /**\n * @inheritDoc\n */\n AnimatorBase.prototype.clone = function () {\n throw new AbstractMethodError();\n };\n /**\n * @inheritDoc\n */\n AnimatorBase.prototype.dispose = function () {\n };\n AnimatorBase.prototype.invalidateElements = function () {\n var entity;\n var len = this._pOwners.length;\n for (var i = 0; i < len; i++) {\n entity = this._pOwners[i];\n entity.invalidateElements();\n }\n };\n /**\n * @inheritDoc\n */\n AnimatorBase.prototype.testGPUCompatibility = function (shader) {\n throw new AbstractMethodError();\n };\n Object.defineProperty(AnimatorBase.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return AnimatorBase.assetType;\n },\n enumerable: true,\n configurable: true\n });\n AnimatorBase.prototype.getRenderableElements = function (renderable, sourceElements) {\n //nothing to do here\n return sourceElements;\n };\n return AnimatorBase;\n}(AssetBase));\nexport { AnimatorBase };\nAnimatorBase.assetType = \"[asset Animator]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/AnimatorBase.js","import * as tslib_1 from \"tslib\";\nimport { AbstractionBase } from \"@awayjs/core\";\n/**\n *\n * @class away.pool.GL_AttributesBuffer\n */\nvar GL_AttributesBuffer = (function (_super) {\n tslib_1.__extends(GL_AttributesBuffer, _super);\n function GL_AttributesBuffer(attributesBuffer, stage) {\n var _this = _super.call(this, attributesBuffer, stage) || this;\n _this._stage = stage;\n _this._attributesBuffer = attributesBuffer;\n return _this;\n }\n /**\n *\n */\n GL_AttributesBuffer.prototype.onClear = function (event) {\n _super.prototype.onClear.call(this, event);\n this._attributesBuffer = null;\n if (this._indexBuffer) {\n this._indexBuffer.dispose();\n this._indexBuffer = null;\n }\n if (this._vertexBuffer) {\n this._vertexBuffer.dispose();\n this._vertexBuffer = null;\n }\n };\n GL_AttributesBuffer.prototype.activate = function (index, size, dimensions, offset, unsigned) {\n if (unsigned === void 0) { unsigned = false; }\n this._stage.setVertexBuffer(index, this._getVertexBuffer(), size, dimensions, offset, unsigned);\n };\n GL_AttributesBuffer.prototype.draw = function (mode, firstIndex, numIndices) {\n this._stage.context.drawIndices(mode, this._getIndexBuffer(), firstIndex, numIndices);\n };\n GL_AttributesBuffer.prototype._getIndexBuffer = function () {\n if (!this._indexBuffer) {\n this._invalid = true;\n this._indexBuffer = this._stage.context.createIndexBuffer(this._attributesBuffer.count * this._attributesBuffer.stride / 2); //hardcoded assuming UintArray\n }\n if (this._invalid) {\n this._invalid = false;\n this._indexBuffer.uploadFromByteArray(this._attributesBuffer.buffer, 0, this._attributesBuffer.length);\n }\n return this._indexBuffer;\n };\n GL_AttributesBuffer.prototype._getVertexBuffer = function () {\n if (!this._vertexBuffer) {\n this._invalid = true;\n this._vertexBuffer = this._stage.context.createVertexBuffer(this._attributesBuffer.count, this._attributesBuffer.stride);\n }\n if (this._invalid) {\n this._invalid = false;\n this._vertexBuffer.uploadFromByteArray(this._attributesBuffer.buffer, 0, this._attributesBuffer.count);\n }\n return this._vertexBuffer;\n };\n return GL_AttributesBuffer;\n}(AbstractionBase));\nexport { GL_AttributesBuffer };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/attributes/GL_AttributesBuffer.js","export var ContextGLBlendFactor;\n(function (ContextGLBlendFactor) {\n ContextGLBlendFactor[ContextGLBlendFactor[\"DESTINATION_ALPHA\"] = 0] = \"DESTINATION_ALPHA\";\n ContextGLBlendFactor[ContextGLBlendFactor[\"DESTINATION_COLOR\"] = 1] = \"DESTINATION_COLOR\";\n ContextGLBlendFactor[ContextGLBlendFactor[\"ONE\"] = 2] = \"ONE\";\n ContextGLBlendFactor[ContextGLBlendFactor[\"ONE_MINUS_DESTINATION_ALPHA\"] = 3] = \"ONE_MINUS_DESTINATION_ALPHA\";\n ContextGLBlendFactor[ContextGLBlendFactor[\"ONE_MINUS_DESTINATION_COLOR\"] = 4] = \"ONE_MINUS_DESTINATION_COLOR\";\n ContextGLBlendFactor[ContextGLBlendFactor[\"ONE_MINUS_SOURCE_ALPHA\"] = 5] = \"ONE_MINUS_SOURCE_ALPHA\";\n ContextGLBlendFactor[ContextGLBlendFactor[\"ONE_MINUS_SOURCE_COLOR\"] = 6] = \"ONE_MINUS_SOURCE_COLOR\";\n ContextGLBlendFactor[ContextGLBlendFactor[\"SOURCE_ALPHA\"] = 7] = \"SOURCE_ALPHA\";\n ContextGLBlendFactor[ContextGLBlendFactor[\"SOURCE_COLOR\"] = 8] = \"SOURCE_COLOR\";\n ContextGLBlendFactor[ContextGLBlendFactor[\"ZERO\"] = 9] = \"ZERO\";\n})(ContextGLBlendFactor || (ContextGLBlendFactor = {}));\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/base/ContextGLBlendFactor.js","export var ContextGLClearMask;\n(function (ContextGLClearMask) {\n ContextGLClearMask[ContextGLClearMask[\"COLOR\"] = 1] = \"COLOR\";\n ContextGLClearMask[ContextGLClearMask[\"DEPTH\"] = 2] = \"DEPTH\";\n ContextGLClearMask[ContextGLClearMask[\"STENCIL\"] = 4] = \"STENCIL\";\n ContextGLClearMask[ContextGLClearMask[\"ALL\"] = 7] = \"ALL\";\n})(ContextGLClearMask || (ContextGLClearMask = {}));\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/base/ContextGLClearMask.js","export var ContextGLCompareMode;\n(function (ContextGLCompareMode) {\n ContextGLCompareMode[ContextGLCompareMode[\"ALWAYS\"] = 0] = \"ALWAYS\";\n ContextGLCompareMode[ContextGLCompareMode[\"EQUAL\"] = 1] = \"EQUAL\";\n ContextGLCompareMode[ContextGLCompareMode[\"GREATER\"] = 2] = \"GREATER\";\n ContextGLCompareMode[ContextGLCompareMode[\"GREATER_EQUAL\"] = 3] = \"GREATER_EQUAL\";\n ContextGLCompareMode[ContextGLCompareMode[\"LESS\"] = 4] = \"LESS\";\n ContextGLCompareMode[ContextGLCompareMode[\"LESS_EQUAL\"] = 5] = \"LESS_EQUAL\";\n ContextGLCompareMode[ContextGLCompareMode[\"NEVER\"] = 6] = \"NEVER\";\n ContextGLCompareMode[ContextGLCompareMode[\"NOT_EQUAL\"] = 7] = \"NOT_EQUAL\";\n})(ContextGLCompareMode || (ContextGLCompareMode = {}));\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/base/ContextGLCompareMode.js","export var ContextGLDrawMode;\n(function (ContextGLDrawMode) {\n ContextGLDrawMode[ContextGLDrawMode[\"TRIANGLES\"] = 0] = \"TRIANGLES\";\n ContextGLDrawMode[ContextGLDrawMode[\"LINES\"] = 1] = \"LINES\";\n})(ContextGLDrawMode || (ContextGLDrawMode = {}));\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/base/ContextGLDrawMode.js","export var ContextGLMipFilter;\n(function (ContextGLMipFilter) {\n ContextGLMipFilter[ContextGLMipFilter[\"MIPLINEAR\"] = 0] = \"MIPLINEAR\";\n ContextGLMipFilter[ContextGLMipFilter[\"MIPNEAREST\"] = 1] = \"MIPNEAREST\";\n ContextGLMipFilter[ContextGLMipFilter[\"MIPNONE\"] = 2] = \"MIPNONE\";\n})(ContextGLMipFilter || (ContextGLMipFilter = {}));\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/base/ContextGLMipFilter.js","export var ContextGLProfile;\n(function (ContextGLProfile) {\n ContextGLProfile[ContextGLProfile[\"BASELINE\"] = 0] = \"BASELINE\";\n ContextGLProfile[ContextGLProfile[\"BASELINE_CONSTRAINED\"] = 1] = \"BASELINE_CONSTRAINED\";\n ContextGLProfile[ContextGLProfile[\"BASELINE_EXTENDED\"] = 2] = \"BASELINE_EXTENDED\";\n})(ContextGLProfile || (ContextGLProfile = {}));\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/base/ContextGLProfile.js","export var ContextGLProgramType;\n(function (ContextGLProgramType) {\n ContextGLProgramType[ContextGLProgramType[\"FRAGMENT\"] = 0] = \"FRAGMENT\";\n ContextGLProgramType[ContextGLProgramType[\"SAMPLER\"] = 1] = \"SAMPLER\";\n ContextGLProgramType[ContextGLProgramType[\"VERTEX\"] = 2] = \"VERTEX\";\n})(ContextGLProgramType || (ContextGLProgramType = {}));\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/base/ContextGLProgramType.js","export var ContextGLStencilAction;\n(function (ContextGLStencilAction) {\n ContextGLStencilAction[ContextGLStencilAction[\"DECREMENT_SATURATE\"] = 0] = \"DECREMENT_SATURATE\";\n ContextGLStencilAction[ContextGLStencilAction[\"DECREMENT_WRAP\"] = 1] = \"DECREMENT_WRAP\";\n ContextGLStencilAction[ContextGLStencilAction[\"INCREMENT_SATURATE\"] = 2] = \"INCREMENT_SATURATE\";\n ContextGLStencilAction[ContextGLStencilAction[\"INCREMENT_WRAP\"] = 3] = \"INCREMENT_WRAP\";\n ContextGLStencilAction[ContextGLStencilAction[\"INVERT\"] = 4] = \"INVERT\";\n ContextGLStencilAction[ContextGLStencilAction[\"KEEP\"] = 5] = \"KEEP\";\n ContextGLStencilAction[ContextGLStencilAction[\"SET\"] = 6] = \"SET\";\n ContextGLStencilAction[ContextGLStencilAction[\"ZERO\"] = 7] = \"ZERO\";\n})(ContextGLStencilAction || (ContextGLStencilAction = {}));\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/base/ContextGLStencilAction.js","export var ContextGLTextureFilter;\n(function (ContextGLTextureFilter) {\n ContextGLTextureFilter[ContextGLTextureFilter[\"LINEAR\"] = 0] = \"LINEAR\";\n ContextGLTextureFilter[ContextGLTextureFilter[\"NEAREST\"] = 1] = \"NEAREST\";\n})(ContextGLTextureFilter || (ContextGLTextureFilter = {}));\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/base/ContextGLTextureFilter.js","export var ContextGLTextureFormat;\n(function (ContextGLTextureFormat) {\n ContextGLTextureFormat[ContextGLTextureFormat[\"BGRA\"] = 0] = \"BGRA\";\n ContextGLTextureFormat[ContextGLTextureFormat[\"BGRA_PACKED\"] = 1] = \"BGRA_PACKED\";\n ContextGLTextureFormat[ContextGLTextureFormat[\"BGR_PACKED\"] = 2] = \"BGR_PACKED\";\n ContextGLTextureFormat[ContextGLTextureFormat[\"COMPRESSED\"] = 3] = \"COMPRESSED\";\n ContextGLTextureFormat[ContextGLTextureFormat[\"COMPRESSED_ALPHA\"] = 4] = \"COMPRESSED_ALPHA\";\n})(ContextGLTextureFormat || (ContextGLTextureFormat = {}));\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/base/ContextGLTextureFormat.js","export var ContextGLTriangleFace;\n(function (ContextGLTriangleFace) {\n ContextGLTriangleFace[ContextGLTriangleFace[\"BACK\"] = 0] = \"BACK\";\n ContextGLTriangleFace[ContextGLTriangleFace[\"FRONT\"] = 1] = \"FRONT\";\n ContextGLTriangleFace[ContextGLTriangleFace[\"FRONT_AND_BACK\"] = 2] = \"FRONT_AND_BACK\";\n ContextGLTriangleFace[ContextGLTriangleFace[\"NONE\"] = 3] = \"NONE\";\n})(ContextGLTriangleFace || (ContextGLTriangleFace = {}));\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/base/ContextGLTriangleFace.js","export var ContextGLVertexBufferFormat;\n(function (ContextGLVertexBufferFormat) {\n ContextGLVertexBufferFormat[ContextGLVertexBufferFormat[\"FLOAT_1\"] = 0] = \"FLOAT_1\";\n ContextGLVertexBufferFormat[ContextGLVertexBufferFormat[\"FLOAT_2\"] = 1] = \"FLOAT_2\";\n ContextGLVertexBufferFormat[ContextGLVertexBufferFormat[\"FLOAT_3\"] = 2] = \"FLOAT_3\";\n ContextGLVertexBufferFormat[ContextGLVertexBufferFormat[\"FLOAT_4\"] = 3] = \"FLOAT_4\";\n ContextGLVertexBufferFormat[ContextGLVertexBufferFormat[\"BYTE_1\"] = 4] = \"BYTE_1\";\n ContextGLVertexBufferFormat[ContextGLVertexBufferFormat[\"BYTE_2\"] = 5] = \"BYTE_2\";\n ContextGLVertexBufferFormat[ContextGLVertexBufferFormat[\"BYTE_3\"] = 6] = \"BYTE_3\";\n ContextGLVertexBufferFormat[ContextGLVertexBufferFormat[\"BYTE_4\"] = 7] = \"BYTE_4\";\n ContextGLVertexBufferFormat[ContextGLVertexBufferFormat[\"UNSIGNED_BYTE_1\"] = 8] = \"UNSIGNED_BYTE_1\";\n ContextGLVertexBufferFormat[ContextGLVertexBufferFormat[\"UNSIGNED_BYTE_2\"] = 9] = \"UNSIGNED_BYTE_2\";\n ContextGLVertexBufferFormat[ContextGLVertexBufferFormat[\"UNSIGNED_BYTE_3\"] = 10] = \"UNSIGNED_BYTE_3\";\n ContextGLVertexBufferFormat[ContextGLVertexBufferFormat[\"UNSIGNED_BYTE_4\"] = 11] = \"UNSIGNED_BYTE_4\";\n ContextGLVertexBufferFormat[ContextGLVertexBufferFormat[\"SHORT_1\"] = 12] = \"SHORT_1\";\n ContextGLVertexBufferFormat[ContextGLVertexBufferFormat[\"SHORT_2\"] = 13] = \"SHORT_2\";\n ContextGLVertexBufferFormat[ContextGLVertexBufferFormat[\"SHORT_3\"] = 14] = \"SHORT_3\";\n ContextGLVertexBufferFormat[ContextGLVertexBufferFormat[\"SHORT_4\"] = 15] = \"SHORT_4\";\n ContextGLVertexBufferFormat[ContextGLVertexBufferFormat[\"UNSIGNED_SHORT_1\"] = 16] = \"UNSIGNED_SHORT_1\";\n ContextGLVertexBufferFormat[ContextGLVertexBufferFormat[\"UNSIGNED_SHORT_2\"] = 17] = \"UNSIGNED_SHORT_2\";\n ContextGLVertexBufferFormat[ContextGLVertexBufferFormat[\"UNSIGNED_SHORT_3\"] = 18] = \"UNSIGNED_SHORT_3\";\n ContextGLVertexBufferFormat[ContextGLVertexBufferFormat[\"UNSIGNED_SHORT_4\"] = 19] = \"UNSIGNED_SHORT_4\";\n})(ContextGLVertexBufferFormat || (ContextGLVertexBufferFormat = {}));\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/base/ContextGLVertexBufferFormat.js","export var ContextGLWrapMode;\n(function (ContextGLWrapMode) {\n ContextGLWrapMode[ContextGLWrapMode[\"CLAMP\"] = 0] = \"CLAMP\";\n ContextGLWrapMode[ContextGLWrapMode[\"REPEAT\"] = 1] = \"REPEAT\";\n})(ContextGLWrapMode || (ContextGLWrapMode = {}));\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/base/ContextGLWrapMode.js","export var ContextMode;\n(function (ContextMode) {\n ContextMode[ContextMode[\"AUTO\"] = 0] = \"AUTO\";\n ContextMode[ContextMode[\"WEBGL\"] = 1] = \"WEBGL\";\n ContextMode[ContextMode[\"FLASH\"] = 2] = \"FLASH\";\n ContextMode[ContextMode[\"GLES\"] = 3] = \"GLES\";\n ContextMode[ContextMode[\"NATIVE\"] = 4] = \"NATIVE\";\n ContextMode[ContextMode[\"SOFTWARE\"] = 5] = \"SOFTWARE\";\n})(ContextMode || (ContextMode = {}));\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/base/ContextMode.js","var SamplerState = (function () {\n function SamplerState() {\n }\n return SamplerState;\n}());\nexport { SamplerState };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/base/SamplerState.js","import * as tslib_1 from \"tslib\";\nimport { AbstractionBase, AbstractMethodError, AssetEvent } from \"@awayjs/core\";\nimport { ElementsEvent, ElementsUtils } from \"@awayjs/graphics\";\n/**\n *\n * @class away.pool.GL_ElementsBaseBase\n */\nvar GL_ElementsBase = (function (_super) {\n tslib_1.__extends(GL_ElementsBase, _super);\n function GL_ElementsBase(elements, stage) {\n var _this = _super.call(this, elements, stage) || this;\n _this.usages = 0;\n _this._vertices = new Object();\n _this._verticesUpdated = new Object();\n _this._indexMappings = Array();\n _this._numIndices = 0;\n _this._elements = elements;\n _this._stage = stage;\n _this._onInvalidateIndicesDelegate = function (event) { return _this._onInvalidateIndices(event); };\n _this._onClearIndicesDelegate = function (event) { return _this._onClearIndices(event); };\n _this._onInvalidateVerticesDelegate = function (event) { return _this._onInvalidateVertices(event); };\n _this._onClearVerticesDelegate = function (event) { return _this._onClearVertices(event); };\n _this._elements.addEventListener(ElementsEvent.CLEAR_INDICES, _this._onClearIndicesDelegate);\n _this._elements.addEventListener(ElementsEvent.INVALIDATE_INDICES, _this._onInvalidateIndicesDelegate);\n _this._elements.addEventListener(ElementsEvent.CLEAR_VERTICES, _this._onClearVerticesDelegate);\n _this._elements.addEventListener(ElementsEvent.INVALIDATE_VERTICES, _this._onInvalidateVerticesDelegate);\n return _this;\n }\n Object.defineProperty(GL_ElementsBase.prototype, \"elementsType\", {\n get: function () {\n throw new AbstractMethodError();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(GL_ElementsBase.prototype, \"elementsClass\", {\n get: function () {\n throw new AbstractMethodError();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(GL_ElementsBase.prototype, \"elements\", {\n get: function () {\n return this._elements;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(GL_ElementsBase.prototype, \"numIndices\", {\n /**\n *\n */\n get: function () {\n return this._numIndices;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(GL_ElementsBase.prototype, \"numVertices\", {\n /**\n *\n */\n get: function () {\n return this._numVertices;\n },\n enumerable: true,\n configurable: true\n });\n /**\n *\n */\n GL_ElementsBase.prototype.getIndexMappings = function () {\n if (!this._indicesUpdated)\n this._updateIndices();\n return this._indexMappings;\n };\n /**\n *\n */\n GL_ElementsBase.prototype.getIndexBufferGL = function () {\n if (!this._indicesUpdated)\n this._updateIndices();\n return this._indices;\n };\n /**\n *\n */\n GL_ElementsBase.prototype.getVertexBufferGL = function (attributesView) {\n //first check if indices need updating which may affect vertices\n if (!this._indicesUpdated)\n this._updateIndices();\n var bufferId = attributesView.attributesBuffer.id;\n if (!this._verticesUpdated[bufferId])\n this._updateVertices(attributesView);\n return this._vertices[bufferId];\n };\n /**\n *\n */\n GL_ElementsBase.prototype.activateVertexBufferVO = function (index, attributesView, dimensions, offset) {\n if (dimensions === void 0) { dimensions = 0; }\n if (offset === void 0) { offset = 0; }\n this.getVertexBufferGL(attributesView).activate(index, attributesView.size, dimensions || attributesView.dimensions, attributesView.offset + offset, attributesView.unsigned);\n };\n /**\n *\n */\n GL_ElementsBase.prototype.onClear = function (event) {\n _super.prototype.onClear.call(this, event);\n this._elements.removeEventListener(ElementsEvent.CLEAR_INDICES, this._onClearIndicesDelegate);\n this._elements.removeEventListener(ElementsEvent.INVALIDATE_INDICES, this._onInvalidateIndicesDelegate);\n this._elements.removeEventListener(ElementsEvent.CLEAR_VERTICES, this._onClearVerticesDelegate);\n this._elements.removeEventListener(ElementsEvent.INVALIDATE_VERTICES, this._onInvalidateVerticesDelegate);\n this._elements = null;\n if (this._overflow) {\n this._overflow.onClear(event);\n this._overflow = null;\n }\n };\n GL_ElementsBase.prototype._setRenderState = function (renderable, shader, projection) {\n if (!this._verticesUpdated)\n this._updateIndices();\n //TODO replace overflow system with something sensible\n //this._render(renderable, camera, viewProjection);\n //\n // if (this._overflow)\n // \tthis._overflow._iRender(renderable, camera, viewProjection);\n };\n GL_ElementsBase.prototype.draw = function (renderable, shader, projection, count, offset) {\n throw new AbstractMethodError();\n };\n /**\n * //TODO\n *\n * @private\n */\n GL_ElementsBase.prototype._updateIndices = function (indexOffset) {\n if (indexOffset === void 0) { indexOffset = 0; }\n var indices = this._elements.indices;\n if (indices) {\n this._indices = this._stage.getAbstraction(ElementsUtils.getSubIndices(indices, this._elements.numVertices, this._indexMappings, indexOffset));\n this._numIndices = this._indices._attributesBuffer.count * indices.dimensions;\n }\n else {\n this._indices = null;\n this._numIndices = 0;\n this._indexMappings = Array();\n }\n indexOffset += this._numIndices;\n //check if there is more to split\n if (indices && indexOffset < indices.count * this._elements.indices.dimensions) {\n if (!this._overflow)\n this._overflow = this._pGetOverflowElements();\n this._overflow._updateIndices(indexOffset);\n }\n else if (this._overflow) {\n this._overflow.onClear(new AssetEvent(AssetEvent.CLEAR, this._elements));\n this._overflow = null;\n }\n this._indicesUpdated = true;\n //invalidate vertices if index mappings exist\n if (this._indexMappings.length)\n for (var key in this._verticesUpdated)\n this._verticesUpdated[key] = false;\n };\n /**\n * //TODO\n *\n * @param attributesView\n * @private\n */\n GL_ElementsBase.prototype._updateVertices = function (attributesView) {\n this._numVertices = this._elements.numVertices;\n var bufferId = attributesView.attributesBuffer.id;\n this._vertices[bufferId] = this._stage.getAbstraction(ElementsUtils.getSubVertices(attributesView.attributesBuffer, this._indexMappings));\n this._verticesUpdated[bufferId] = true;\n };\n /**\n * //TODO\n *\n * @param event\n * @private\n */\n GL_ElementsBase.prototype._onInvalidateIndices = function (event) {\n if (!event.attributesView)\n return;\n this._indicesUpdated = false;\n };\n /**\n * //TODO\n *\n * @param event\n * @private\n */\n GL_ElementsBase.prototype._onClearIndices = function (event) {\n if (!event.attributesView)\n return;\n this._indices.onClear(new AssetEvent(AssetEvent.CLEAR, event.attributesView));\n this._indices = null;\n };\n /**\n * //TODO\n *\n * @param event\n * @private\n */\n GL_ElementsBase.prototype._onInvalidateVertices = function (event) {\n if (!event.attributesView)\n return;\n var bufferId = event.attributesView.attributesBuffer.id;\n this._verticesUpdated[bufferId] = false;\n };\n /**\n * //TODO\n *\n * @param event\n * @private\n */\n GL_ElementsBase.prototype._onClearVertices = function (event) {\n if (!event.attributesView)\n return;\n var bufferId = event.attributesView.attributesBuffer.id;\n if (this._vertices[bufferId]) {\n this._vertices[bufferId].onClear(new AssetEvent(AssetEvent.CLEAR, event.attributesView));\n delete this._vertices[bufferId];\n delete this._verticesUpdated[bufferId];\n }\n };\n /**\n * //TODO\n *\n * @param pool\n * @param renderable\n * @param level\n * @param indexOffset\n * @returns {away.pool.GL_ShapeRenderable}\n * @protected\n */\n GL_ElementsBase.prototype._pGetOverflowElements = function () {\n throw new AbstractMethodError();\n };\n return GL_ElementsBase;\n}(AbstractionBase));\nexport { GL_ElementsBase };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/elements/GL_ElementsBase.js","import * as tslib_1 from \"tslib\";\nimport { Matrix3D } from \"@awayjs/core\";\nimport { ContextGLDrawMode } from \"../base/ContextGLDrawMode\";\nimport { ContextGLProgramType } from \"../base/ContextGLProgramType\";\nimport { GL_ElementsBase } from \"./GL_ElementsBase\";\n/**\n *\n * @class away.pool.GL_TriangleElements\n */\nvar GL_TriangleElements = (function (_super) {\n tslib_1.__extends(GL_TriangleElements, _super);\n function GL_TriangleElements(triangleElements, stage) {\n var _this = _super.call(this, triangleElements, stage) || this;\n _this._triangleElements = triangleElements;\n return _this;\n }\n Object.defineProperty(GL_TriangleElements.prototype, \"elementsType\", {\n get: function () {\n return GL_TriangleElements.elementsType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(GL_TriangleElements.prototype, \"elementsClass\", {\n get: function () {\n return GL_TriangleElements;\n },\n enumerable: true,\n configurable: true\n });\n GL_TriangleElements._includeDependencies = function (shader) {\n };\n GL_TriangleElements._getVertexCode = function (shader, registerCache, sharedRegisters) {\n var code = \"\";\n //get the projection coordinates\n var position = (shader.globalPosDependencies > 0) ? sharedRegisters.globalPositionVertex : sharedRegisters.animatedPosition;\n //reserving vertex constants for projection matrix\n var viewMatrixReg = registerCache.getFreeVertexConstant();\n registerCache.getFreeVertexConstant();\n registerCache.getFreeVertexConstant();\n registerCache.getFreeVertexConstant();\n shader.viewMatrixIndex = viewMatrixReg.index * 4;\n if (shader.projectionDependencies > 0) {\n sharedRegisters.projectionFragment = registerCache.getFreeVarying();\n var temp = registerCache.getFreeVertexVectorTemp();\n code += \"m44 \" + temp + \", \" + position + \", \" + viewMatrixReg + \"\\n\" +\n \"mov \" + sharedRegisters.projectionFragment + \", \" + temp + \"\\n\" +\n \"mov op, \" + temp + \"\\n\";\n }\n else {\n code += \"m44 op, \" + position + \", \" + viewMatrixReg + \"\\n\";\n }\n return code;\n };\n GL_TriangleElements._getFragmentCode = function (shader, registerCache, sharedRegisters) {\n return \"\";\n };\n GL_TriangleElements.prototype.onClear = function (event) {\n _super.prototype.onClear.call(this, event);\n this._triangleElements = null;\n };\n GL_TriangleElements.prototype._setRenderState = function (renderable, shader, projection) {\n _super.prototype._setRenderState.call(this, renderable, shader, projection);\n //set buffers\n //TODO: find a better way to update a concatenated buffer when autoderiving\n if (shader.normalIndex >= 0 && this._triangleElements.autoDeriveNormals)\n this._triangleElements.normals;\n if (shader.tangentIndex >= 0 && this._triangleElements.autoDeriveTangents)\n this._triangleElements.tangents;\n if (shader.curvesIndex >= 0)\n this.activateVertexBufferVO(shader.curvesIndex, this._triangleElements.getCustomAtributes(\"curves\"));\n if (shader.uvIndex >= 0)\n this.activateVertexBufferVO(shader.uvIndex, this._triangleElements.uvs || this._triangleElements.positions);\n if (shader.secondaryUVIndex >= 0)\n this.activateVertexBufferVO(shader.secondaryUVIndex, this._triangleElements.getCustomAtributes(\"secondaryUVs\") || this._triangleElements.uvs || this._triangleElements.positions);\n if (shader.normalIndex >= 0)\n this.activateVertexBufferVO(shader.normalIndex, this._triangleElements.normals);\n if (shader.tangentIndex >= 0)\n this.activateVertexBufferVO(shader.tangentIndex, this._triangleElements.tangents);\n if (shader.jointIndexIndex >= 0)\n this.activateVertexBufferVO(shader.jointIndexIndex, this._triangleElements.jointIndices);\n if (shader.jointWeightIndex >= 0)\n this.activateVertexBufferVO(shader.jointIndexIndex, this._triangleElements.jointWeights);\n this.activateVertexBufferVO(0, this._triangleElements.positions);\n };\n GL_TriangleElements.prototype.draw = function (renderable, shader, projection, count, offset) {\n //set constants\n if (shader.sceneMatrixIndex >= 0) {\n shader.sceneMatrix.copyFrom(renderable.renderSceneTransform, true);\n shader.viewMatrix.copyFrom(projection.viewMatrix3D, true);\n }\n else {\n var matrix3D = Matrix3D.CALCULATION_MATRIX;\n matrix3D.copyFrom(renderable.renderSceneTransform);\n matrix3D.append(projection.viewMatrix3D);\n shader.viewMatrix.copyFrom(matrix3D, true);\n }\n var context = this._stage.context;\n context.setProgramConstantsFromArray(ContextGLProgramType.VERTEX, shader.vertexConstantData);\n context.setProgramConstantsFromArray(ContextGLProgramType.FRAGMENT, shader.fragmentConstantData);\n if (this._indices)\n this.getIndexBufferGL().draw(ContextGLDrawMode.TRIANGLES, offset * 3, count * 3 || this.numIndices);\n else\n this._stage.context.drawVertices(ContextGLDrawMode.TRIANGLES, offset, count || this.numVertices);\n };\n /**\n * //TODO\n *\n * @param pool\n * @param renderable\n * @param level\n * @param indexOffset\n * @returns {away.pool.GL_ShapeRenderable}\n * @protected\n */\n GL_TriangleElements.prototype._pGetOverflowElements = function () {\n return new GL_TriangleElements(this._triangleElements, this._stage);\n };\n return GL_TriangleElements;\n}(GL_ElementsBase));\nexport { GL_TriangleElements };\nGL_TriangleElements.elementsType = \"[elements Triangle]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/elements/GL_TriangleElements.js","import * as tslib_1 from \"tslib\";\nimport { EventBase } from \"@awayjs/core\";\nvar StageEvent = (function (_super) {\n tslib_1.__extends(StageEvent, _super);\n function StageEvent(type, stage) {\n var _this = _super.call(this, type) || this;\n _this._stage = stage;\n return _this;\n }\n Object.defineProperty(StageEvent.prototype, \"stage\", {\n /**\n *\n */\n get: function () {\n return this._stage;\n },\n enumerable: true,\n configurable: true\n });\n /**\n *\n */\n StageEvent.prototype.clone = function () {\n return new StageEvent(this.type, this._stage);\n };\n return StageEvent;\n}(EventBase));\nexport { StageEvent };\n/**\n *\n */\nStageEvent.STAGE_ERROR = \"stageError\";\n/**\n *\n */\nStageEvent.CONTEXT_CREATED = \"contextCreated\";\n/**\n *\n */\nStageEvent.CONTEXT_DISPOSED = \"contextDisposed\";\n/**\n *\n */\nStageEvent.CONTEXT_RECREATED = \"contextRecreated\";\n/**\n *\n */\nStageEvent.VIEWPORT_UPDATED = \"viewportUpdated\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/events/StageEvent.js","import * as tslib_1 from \"tslib\";\nimport { EventBase } from \"@awayjs/core\";\nvar PassEvent = (function (_super) {\n tslib_1.__extends(PassEvent, _super);\n function PassEvent(type, pass) {\n var _this = _super.call(this, type) || this;\n _this._pass = pass;\n return _this;\n }\n Object.defineProperty(PassEvent.prototype, \"pass\", {\n /**\n *\n */\n get: function () {\n return this._pass;\n },\n enumerable: true,\n configurable: true\n });\n /**\n *\n */\n PassEvent.prototype.clone = function () {\n return new PassEvent(this.type, this._pass);\n };\n return PassEvent;\n}(EventBase));\nexport { PassEvent };\n/**\n *\n */\nPassEvent.INVALIDATE = \"invalidatePass\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/events/PassEvent.js","var OpCodes = (function () {\n function OpCodes() {\n }\n return OpCodes;\n}());\nexport { OpCodes };\nOpCodes.trueValue = 32;\nOpCodes.falseValue = 33;\nOpCodes.intMask = 63;\nOpCodes.drawTriangles = 41;\nOpCodes.setProgramConstant = 42;\nOpCodes.setProgram = 43;\nOpCodes.present = 44;\nOpCodes.clear = 45;\nOpCodes.initProgram = 46;\nOpCodes.initVertexBuffer = 47;\nOpCodes.initIndexBuffer = 48;\nOpCodes.configureBackBuffer = 49;\nOpCodes.uploadArrayIndexBuffer = 50;\nOpCodes.uploadArrayVertexBuffer = 51;\nOpCodes.uploadAGALBytesProgram = 52;\nOpCodes.setVertexBufferAt = 53;\nOpCodes.uploadBytesIndexBuffer = 54;\nOpCodes.uploadBytesVertexBuffer = 55;\nOpCodes.setColorMask = 56;\nOpCodes.setDepthTest = 57;\nOpCodes.disposeProgram = 58;\nOpCodes.disposeContext = 59;\n// must skip 60 '<' as it will invalidate xml being passed over the bridge\nOpCodes.disposeVertexBuffer = 61;\n// must skip 62 '>' as it will invalidate xml being passed over the bridge\nOpCodes.disposeIndexBuffer = 63;\nOpCodes.initTexture = 64;\nOpCodes.setTextureAt = 65;\nOpCodes.uploadBytesTexture = 66;\nOpCodes.disposeTexture = 67;\nOpCodes.setCulling = 68;\nOpCodes.setScissorRect = 69;\nOpCodes.clearScissorRect = 70;\nOpCodes.setBlendFactors = 71;\nOpCodes.setRenderToTexture = 72;\nOpCodes.clearTextureAt = 73;\nOpCodes.clearVertexBufferAt = 74;\nOpCodes.setStencilActions = 75;\nOpCodes.setStencilReferenceValue = 76;\nOpCodes.initCubeTexture = 77;\nOpCodes.disposeCubeTexture = 78;\nOpCodes.uploadBytesCubeTexture = 79;\nOpCodes.clearRenderToTexture = 80;\nOpCodes.enableErrorChecking = 81;\n// added for gles context:\nOpCodes.drawVertices = 82;\nOpCodes.getFrameBufferForTexture = 83;\nOpCodes.uploadProgram = 84;\nOpCodes.disableCulling = 85;\nOpCodes.disableBlending = 86;\nOpCodes.setSamplerStateAt = 87;\nOpCodes.enableStencil = 88;\nOpCodes.disableStencil = 89;\nOpCodes.setStencilActionsMasks = 90;\n//public static passBitmapToCpp:number = 91; //reserved for java message\nOpCodes.uploadTextureFromURL = 92;\nOpCodes.startSound = 101;\nOpCodes.stopSound = 102;\nOpCodes.updateSound = 103;\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/flash/OpCodes.js","var ResourceBaseFlash = (function () {\n function ResourceBaseFlash() {\n }\n Object.defineProperty(ResourceBaseFlash.prototype, \"id\", {\n get: function () {\n return this._pId;\n },\n enumerable: true,\n configurable: true\n });\n ResourceBaseFlash.prototype.dispose = function () {\n };\n ResourceBaseFlash.prototype.generateMipmaps = function () {\n //TODO\n };\n return ResourceBaseFlash;\n}());\nexport { ResourceBaseFlash };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/flash/ResourceBaseFlash.js","import * as tslib_1 from \"tslib\";\nimport { ByteArrayBase } from \"@awayjs/core\";\nimport { OpCodes } from \"./OpCodes\";\nimport { ResourceBaseFlash } from \"./ResourceBaseFlash\";\nvar CubeTextureFlash = (function (_super) {\n tslib_1.__extends(CubeTextureFlash, _super);\n function CubeTextureFlash(context, size, format, forRTT, streaming) {\n if (streaming === void 0) { streaming = false; }\n var _this = _super.call(this) || this;\n _this._context = context;\n _this._size = size;\n _this._context.addStream(String.fromCharCode(OpCodes.initCubeTexture, (forRTT ? OpCodes.trueValue : OpCodes.falseValue)) + size + \",\" + streaming + \",\" + format + \"$\");\n _this._pId = _this._context.execute();\n _this._context._iAddResource(_this);\n return _this;\n }\n Object.defineProperty(CubeTextureFlash.prototype, \"size\", {\n get: function () {\n return this._size;\n },\n enumerable: true,\n configurable: true\n });\n CubeTextureFlash.prototype.dispose = function () {\n this._context.addStream(String.fromCharCode(OpCodes.disposeCubeTexture) + this._pId.toString() + \",\");\n this._context.execute();\n this._context._iRemoveResource(this);\n this._context = null;\n };\n CubeTextureFlash.prototype.uploadFromImage = function (imageCube, side, miplevel) {\n if (miplevel === void 0) { miplevel = 0; }\n var data = imageCube.getImageData(side).data;\n var pos = 0;\n var bytes = ByteArrayBase.internalGetBase64String(data.length, function () {\n return data[pos++];\n }, null);\n this._context.addStream(String.fromCharCode(OpCodes.uploadBytesCubeTexture) + this._pId + \",\" + miplevel + \",\" + side + \",\" + (this.size >> miplevel) + \",\" + bytes + \"%\");\n this._context.execute();\n };\n CubeTextureFlash.prototype.uploadCompressedTextureFromByteArray = function (data, byteArrayOffset /*uint*/, async) {\n if (async === void 0) { async = false; }\n };\n return CubeTextureFlash;\n}(ResourceBaseFlash));\nexport { CubeTextureFlash };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/flash/CubeTextureFlash.js","import * as tslib_1 from \"tslib\";\nimport { OpCodes } from \"./OpCodes\";\nimport { ResourceBaseFlash } from \"./ResourceBaseFlash\";\nvar IndexBufferFlash = (function (_super) {\n tslib_1.__extends(IndexBufferFlash, _super);\n function IndexBufferFlash(context, numIndices) {\n var _this = _super.call(this) || this;\n _this._context = context;\n _this._numIndices = numIndices;\n _this._context.addStream(String.fromCharCode(OpCodes.initIndexBuffer, numIndices + OpCodes.intMask));\n _this._pId = _this._context.execute();\n _this._context._iAddResource(_this);\n return _this;\n }\n IndexBufferFlash.prototype.uploadFromArray = function (data, startOffset, count) {\n this._context.addStream(String.fromCharCode(OpCodes.uploadArrayIndexBuffer, this._pId + OpCodes.intMask) + data.join() + \"#\" + startOffset + \",\" + count + \",\");\n this._context.execute();\n };\n IndexBufferFlash.prototype.uploadFromByteArray = function (data, startOffset, count) {\n };\n IndexBufferFlash.prototype.dispose = function () {\n this._context.addStream(String.fromCharCode(OpCodes.disposeIndexBuffer, this._pId + OpCodes.intMask));\n this._context.execute();\n this._context._iRemoveResource(this);\n this._context = null;\n };\n Object.defineProperty(IndexBufferFlash.prototype, \"numIndices\", {\n get: function () {\n return this._numIndices;\n },\n enumerable: true,\n configurable: true\n });\n return IndexBufferFlash;\n}(ResourceBaseFlash));\nexport { IndexBufferFlash };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/flash/IndexBufferFlash.js","import * as tslib_1 from \"tslib\";\nimport { ContextFlash } from \"./ContextFlash\";\nimport { OpCodes } from \"./OpCodes\";\nimport { ResourceBaseFlash } from \"./ResourceBaseFlash\";\nvar ProgramFlash = (function (_super) {\n tslib_1.__extends(ProgramFlash, _super);\n function ProgramFlash(context) {\n var _this = _super.call(this) || this;\n _this._context = context;\n _this._context.addStream(String.fromCharCode(OpCodes.initProgram));\n _this._pId = _this._context.execute();\n _this._context._iAddResource(_this);\n return _this;\n }\n ProgramFlash.prototype.upload = function (vertexProgram, fragmentProgram) {\n this._context.addStream(String.fromCharCode(OpCodes.uploadAGALBytesProgram, this._pId + OpCodes.intMask) + vertexProgram.readBase64String(vertexProgram.length) + \"%\" + fragmentProgram.readBase64String(fragmentProgram.length) + \"%\");\n if (ContextFlash.debug)\n this._context.execute();\n };\n ProgramFlash.prototype.dispose = function () {\n this._context.addStream(String.fromCharCode(OpCodes.disposeProgram, this._pId + OpCodes.intMask));\n this._context.execute();\n this._context._iRemoveResource(this);\n this._context = null;\n };\n return ProgramFlash;\n}(ResourceBaseFlash));\nexport { ProgramFlash };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/flash/ProgramFlash.js","import * as tslib_1 from \"tslib\";\nimport { ByteArrayBase } from \"@awayjs/core\";\nimport { OpCodes } from \"./OpCodes\";\nimport { ResourceBaseFlash } from \"./ResourceBaseFlash\";\nvar TextureFlash = (function (_super) {\n tslib_1.__extends(TextureFlash, _super);\n function TextureFlash(context, width, height, format, forRTT, streaming) {\n if (streaming === void 0) { streaming = false; }\n var _this = _super.call(this) || this;\n _this._context = context;\n _this._width = width;\n _this._height = height;\n _this._context.addStream(String.fromCharCode(OpCodes.initTexture, (forRTT ? OpCodes.trueValue : OpCodes.falseValue)) + width + \",\" + height + \",\" + streaming + \",\" + format + \"$\");\n _this._pId = _this._context.execute();\n _this._context._iAddResource(_this);\n return _this;\n }\n Object.defineProperty(TextureFlash.prototype, \"width\", {\n get: function () {\n return this._width;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(TextureFlash.prototype, \"height\", {\n get: function () {\n return this._height;\n },\n enumerable: true,\n configurable: true\n });\n TextureFlash.prototype.dispose = function () {\n this._context.addStream(String.fromCharCode(OpCodes.disposeTexture) + this._pId.toString() + \",\");\n this._context.execute();\n this._context._iRemoveResource(this);\n this._context = null;\n };\n TextureFlash.prototype.uploadFromImage = function (image2D, miplevel) {\n if (miplevel === void 0) { miplevel = 0; }\n var data = image2D.getImageData().data;\n var pos = 0;\n var bytes = ByteArrayBase.internalGetBase64String(data.length, function () {\n return data[pos++];\n }, null);\n this._context.addStream(String.fromCharCode(OpCodes.uploadBytesTexture) + this._pId + \",\" + miplevel + \",\" + (this._width >> miplevel) + \",\" + (this._height >> miplevel) + \",\" + bytes + \"%\");\n this._context.execute();\n };\n TextureFlash.prototype.uploadFromURL = function (urlRequest, miplevel) {\n if (miplevel === void 0) { miplevel = 0; }\n };\n return TextureFlash;\n}(ResourceBaseFlash));\nexport { TextureFlash };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/flash/TextureFlash.js","import * as tslib_1 from \"tslib\";\nimport { OpCodes } from \"./OpCodes\";\nimport { ResourceBaseFlash } from \"./ResourceBaseFlash\";\nvar VertexBufferFlash = (function (_super) {\n tslib_1.__extends(VertexBufferFlash, _super);\n function VertexBufferFlash(context, numVertices, dataPerVertex) {\n var _this = _super.call(this) || this;\n _this._context = context;\n _this._numVertices = numVertices;\n _this._dataPerVertex = dataPerVertex;\n _this._context.addStream(String.fromCharCode(OpCodes.initVertexBuffer, dataPerVertex + OpCodes.intMask) + numVertices.toString() + \",\");\n _this._pId = _this._context.execute();\n _this._context._iAddResource(_this);\n return _this;\n }\n VertexBufferFlash.prototype.uploadFromArray = function (data, startVertex, numVertices) {\n this._context.addStream(String.fromCharCode(OpCodes.uploadArrayVertexBuffer, this._pId + OpCodes.intMask) + data.join() + \"#\" + [startVertex, numVertices].join() + \",\");\n this._context.execute();\n };\n VertexBufferFlash.prototype.uploadFromByteArray = function (data, startVertex, numVertices) {\n };\n Object.defineProperty(VertexBufferFlash.prototype, \"numVertices\", {\n get: function () {\n return this._numVertices;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(VertexBufferFlash.prototype, \"dataPerVertex\", {\n get: function () {\n return this._dataPerVertex;\n },\n enumerable: true,\n configurable: true\n });\n VertexBufferFlash.prototype.dispose = function () {\n this._context.addStream(String.fromCharCode(OpCodes.disposeVertexBuffer, this._pId + OpCodes.intMask));\n this._context.execute();\n this._context._iRemoveResource(this);\n this._context = null;\n };\n return VertexBufferFlash;\n}(ResourceBaseFlash));\nexport { VertexBufferFlash };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/flash/VertexBufferFlash.js","import { CoordinateSystem } from \"@awayjs/core\";\nimport { ContextGLClearMask } from \"../base/ContextGLClearMask\";\nimport { ContextGLProgramType } from \"../base/ContextGLProgramType\";\nimport { ContextGLTriangleFace } from \"../base/ContextGLTriangleFace\";\nimport { ContextGLCompareMode } from \"../base/ContextGLCompareMode\";\nimport { ContextGLStencilAction } from \"../base/ContextGLStencilAction\";\nimport { CubeTextureFlash } from \"./CubeTextureFlash\";\nimport { IndexBufferFlash } from \"./IndexBufferFlash\";\nimport { OpCodes } from \"./OpCodes\";\nimport { ProgramFlash } from \"./ProgramFlash\";\nimport { TextureFlash } from \"./TextureFlash\";\nimport { VertexBufferFlash } from \"./VertexBufferFlash\";\nvar ContextFlash = (function () {\n //TODO: get rid of hack that fixes including definition file\n function ContextFlash(container, callback) {\n this._cmdStream = \"\";\n this._resources = new Array();\n var swfVersionStr = \"11.0.0\";\n // To use express install, set to playerProductInstall.swf, otherwise the empty string.\n var flashvars = {\n id: container.id\n };\n var params = {\n quality: \"high\",\n bgcolor: \"#ffffff\",\n allowscriptaccess: \"sameDomain\",\n allowfullscreen: \"true\",\n wmode: \"direct\"\n };\n this._errorCheckingEnabled = false;\n this._iDriverInfo = \"Unknown\";\n var attributes = {\n salign: \"tl\",\n id: container.id,\n name: container[\"name\"] //TODO: needed?\n };\n this._oldCanvas = container.cloneNode(); // keep the old one to restore on dispose\n this._oldParent = container.parentNode;\n var context3dObj = this;\n ContextFlash.contexts[container.id] = this;\n function callbackSWFObject(callbackInfo) {\n if (!callbackInfo.success)\n return;\n context3dObj._container = callbackInfo.ref;\n context3dObj._iCallback = callback;\n }\n //swfobject.embedSWF(\"libs/molehill_js_flashbridge.swf\", container.id, String(container.width), String(container.height), swfVersionStr, \"\", flashvars, params, attributes, callbackSWFObject);\n }\n ContextFlash.prototype.enableStencil = function () {\n };\n ContextFlash.prototype.disableStencil = function () {\n };\n Object.defineProperty(ContextFlash.prototype, \"container\", {\n get: function () {\n return this._container;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ContextFlash.prototype, \"driverInfo\", {\n get: function () {\n return this._iDriverInfo;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ContextFlash.prototype, \"errorCheckingEnabled\", {\n get: function () {\n return this._errorCheckingEnabled;\n },\n set: function (value) {\n if (this._errorCheckingEnabled == value)\n return;\n this._errorCheckingEnabled = value;\n this.addStream(String.fromCharCode(OpCodes.enableErrorChecking, value ? OpCodes.trueValue : OpCodes.falseValue));\n this.execute();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ContextFlash.prototype, \"pixelRatio\", {\n get: function () {\n return 1;\n },\n enumerable: true,\n configurable: true\n });\n ContextFlash.prototype._iAddResource = function (resource) {\n this._resources.push(resource);\n };\n ContextFlash.prototype._iRemoveResource = function (resource) {\n this._resources.splice(this._resources.indexOf(resource));\n };\n ContextFlash.prototype.createTexture = function (width, height, format, optimizeForRenderToTexture, streamingLevels) {\n if (streamingLevels === void 0) { streamingLevels = 0; }\n //TODO:streaming\n return new TextureFlash(this, width, height, format, optimizeForRenderToTexture);\n };\n ContextFlash.prototype.createCubeTexture = function (size, format, optimizeForRenderToTexture, streamingLevels) {\n if (streamingLevels === void 0) { streamingLevels = 0; }\n //TODO:streaming\n return new CubeTextureFlash(this, size, format, optimizeForRenderToTexture);\n };\n ContextFlash.prototype.setTextureAt = function (sampler, texture) {\n if (texture) {\n this.addStream(String.fromCharCode(OpCodes.setTextureAt) + sampler + \",\" + texture.id + \",\");\n }\n else {\n this.addStream(String.fromCharCode(OpCodes.clearTextureAt) + sampler.toString() + \",\");\n }\n if (ContextFlash.debug)\n this.execute();\n };\n ContextFlash.prototype.setSamplerStateAt = function (sampler, wrap, filter, mipfilter) {\n //nothing to do here\n };\n ContextFlash.prototype.setStencilActions = function (triangleFace, compareMode, actionOnBothPass, actionOnDepthFail, actionOnDepthPassStencilFail, coordinateSystem) {\n if (triangleFace === void 0) { triangleFace = ContextGLTriangleFace.FRONT_AND_BACK; }\n if (compareMode === void 0) { compareMode = ContextGLCompareMode.ALWAYS; }\n if (actionOnBothPass === void 0) { actionOnBothPass = ContextGLStencilAction.KEEP; }\n if (actionOnDepthFail === void 0) { actionOnDepthFail = ContextGLStencilAction.KEEP; }\n if (actionOnDepthPassStencilFail === void 0) { actionOnDepthPassStencilFail = ContextGLStencilAction.KEEP; }\n if (coordinateSystem === void 0) { coordinateSystem = CoordinateSystem.LEFT_HANDED; }\n this.addStream(String.fromCharCode(OpCodes.setStencilActions) + triangleFace + \"$\" + compareMode + \"$\" + actionOnBothPass + \"$\" + actionOnDepthFail + \"$\" + actionOnDepthPassStencilFail + \"$\");\n if (ContextFlash.debug)\n this.execute();\n };\n ContextFlash.prototype.setStencilReferenceValue = function (referenceValue, readMask, writeMask) {\n if (readMask === void 0) { readMask = 0xFF; }\n if (writeMask === void 0) { writeMask = 0xFF; }\n this.addStream(String.fromCharCode(OpCodes.setStencilReferenceValue, referenceValue + OpCodes.intMask, readMask + OpCodes.intMask, writeMask + OpCodes.intMask));\n if (ContextFlash.debug)\n this.execute();\n };\n ContextFlash.prototype.setCulling = function (triangleFaceToCull, coordinateSystem) {\n if (coordinateSystem === void 0) { coordinateSystem = CoordinateSystem.LEFT_HANDED; }\n //TODO implement coordinateSystem option\n this.addStream(String.fromCharCode(OpCodes.setCulling) + triangleFaceToCull + \"$\");\n if (ContextFlash.debug)\n this.execute();\n };\n ContextFlash.prototype.drawIndices = function (mode, indexBuffer, firstIndex, numIndices) {\n if (firstIndex === void 0) { firstIndex = 0; }\n if (numIndices === void 0) { numIndices = -1; }\n firstIndex = firstIndex || 0;\n if (!numIndices || numIndices < 0)\n numIndices = indexBuffer.numIndices;\n //assume triangles\n this.addStream(String.fromCharCode(OpCodes.drawTriangles, indexBuffer.id + OpCodes.intMask) + firstIndex + \",\" + numIndices + \",\");\n if (ContextFlash.debug)\n this.execute();\n };\n ContextFlash.prototype.drawVertices = function (mode, firstVertex, numVertices) {\n if (firstVertex === void 0) { firstVertex = 0; }\n if (numVertices === void 0) { numVertices = -1; }\n //can't be done in Stage3D\n };\n ContextFlash.prototype.setProgramConstantsFromArray = function (programType, data) {\n var startIndex;\n var numRegisters = data.length / 4;\n var target = (programType == ContextGLProgramType.VERTEX) ? OpCodes.trueValue : OpCodes.falseValue;\n for (var i = 0; i < numRegisters; i++) {\n startIndex = i * 4;\n this.addStream(String.fromCharCode(OpCodes.setProgramConstant, target, i + OpCodes.intMask) + data[startIndex] + \",\" + data[startIndex + 1] + \",\" + data[startIndex + 2] + \",\" + data[startIndex + 3] + \",\");\n if (ContextFlash.debug)\n this.execute();\n }\n };\n ContextFlash.prototype.setProgram = function (program) {\n this.addStream(String.fromCharCode(OpCodes.setProgram, program.id + OpCodes.intMask));\n if (ContextFlash.debug)\n this.execute();\n };\n ContextFlash.prototype.present = function () {\n this.addStream(String.fromCharCode(OpCodes.present));\n this.execute();\n };\n ContextFlash.prototype.clear = function (red, green, blue, alpha, depth, stencil, mask) {\n if (red === void 0) { red = 0; }\n if (green === void 0) { green = 0; }\n if (blue === void 0) { blue = 0; }\n if (alpha === void 0) { alpha = 1; }\n if (depth === void 0) { depth = 1; }\n if (stencil === void 0) { stencil = 0; }\n if (mask === void 0) { mask = ContextGLClearMask.ALL; }\n this.addStream(String.fromCharCode(OpCodes.clear) + red + \",\" + green + \",\" + blue + \",\" + alpha + \",\" + depth + \",\" + stencil + \",\" + mask + \",\");\n if (ContextFlash.debug)\n this.execute();\n };\n ContextFlash.prototype.createProgram = function () {\n return new ProgramFlash(this);\n };\n ContextFlash.prototype.createVertexBuffer = function (numVertices, data32PerVertex) {\n return new VertexBufferFlash(this, numVertices, data32PerVertex);\n };\n ContextFlash.prototype.createIndexBuffer = function (numIndices) {\n return new IndexBufferFlash(this, numIndices);\n };\n ContextFlash.prototype.configureBackBuffer = function (width, height, antiAlias, enableDepthAndStencil) {\n if (enableDepthAndStencil === void 0) { enableDepthAndStencil = true; }\n this._width = width;\n this._height = height;\n //TODO: add Anitalias setting\n this.addStream(String.fromCharCode(OpCodes.configureBackBuffer) + width + \",\" + height + \",\");\n };\n ContextFlash.prototype.drawToBitmapImage2D = function (destination) {\n //TODO\n };\n ContextFlash.prototype.setVertexBufferAt = function (index, buffer, bufferOffset, format) {\n if (bufferOffset === void 0) { bufferOffset = 0; }\n if (format === void 0) { format = null; }\n if (buffer) {\n this.addStream(String.fromCharCode(OpCodes.setVertexBufferAt, index + OpCodes.intMask) + buffer.id + \",\" + bufferOffset + \",\" + format + \"$\");\n }\n else {\n this.addStream(String.fromCharCode(OpCodes.clearVertexBufferAt, index + OpCodes.intMask));\n }\n if (ContextFlash.debug)\n this.execute();\n };\n ContextFlash.prototype.setColorMask = function (red, green, blue, alpha) {\n this.addStream(String.fromCharCode(OpCodes.setColorMask, red ? OpCodes.trueValue : OpCodes.falseValue, green ? OpCodes.trueValue : OpCodes.falseValue, blue ? OpCodes.trueValue : OpCodes.falseValue, alpha ? OpCodes.trueValue : OpCodes.falseValue));\n if (ContextFlash.debug)\n this.execute();\n };\n ContextFlash.prototype.setBlendFactors = function (sourceFactor, destinationFactor) {\n this.addStream(String.fromCharCode(OpCodes.setBlendFactors) + sourceFactor + \"$\" + destinationFactor + \"$\");\n if (ContextFlash.debug)\n this.execute();\n };\n ContextFlash.prototype.setRenderToTexture = function (target, enableDepthAndStencil, antiAlias, surfaceSelector) {\n if (enableDepthAndStencil === void 0) { enableDepthAndStencil = false; }\n if (antiAlias === void 0) { antiAlias = 0; }\n if (surfaceSelector === void 0) { surfaceSelector = 0; }\n if (target === null || target === undefined) {\n this.addStream(String.fromCharCode(OpCodes.clearRenderToTexture));\n }\n else {\n this.addStream(String.fromCharCode(OpCodes.setRenderToTexture, enableDepthAndStencil ? OpCodes.trueValue : OpCodes.falseValue) + target.id + \",\" + (antiAlias || 0) + \",\");\n }\n if (ContextFlash.debug)\n this.execute();\n };\n ContextFlash.prototype.setRenderToBackBuffer = function () {\n this.addStream(String.fromCharCode(OpCodes.clearRenderToTexture));\n if (ContextFlash.debug)\n this.execute();\n };\n ContextFlash.prototype.setScissorRectangle = function (rectangle) {\n if (rectangle) {\n this.addStream(String.fromCharCode(OpCodes.setScissorRect) + rectangle.x + \",\" + rectangle.y + \",\" + rectangle.width + \",\" + rectangle.height + \",\");\n }\n else {\n this.addStream(String.fromCharCode(OpCodes.clearScissorRect));\n }\n if (ContextFlash.debug)\n this.execute();\n };\n ContextFlash.prototype.setDepthTest = function (depthMask, passCompareMode) {\n this.addStream(String.fromCharCode(OpCodes.setDepthTest, depthMask ? OpCodes.trueValue : OpCodes.falseValue) + passCompareMode + \"$\");\n if (ContextFlash.debug)\n this.execute();\n };\n ContextFlash.prototype.dispose = function () {\n if (this._container == null)\n return;\n console.log(\"Context3D dispose, releasing \" + this._resources.length + \" resources.\");\n while (this._resources.length)\n this._resources[0].dispose();\n if (this._container) {\n // encode command\n this.addStream(String.fromCharCode(OpCodes.disposeContext));\n this.execute();\n //swfobject.removeSWF(this._oldCanvas.id);\n if (this._oldCanvas && this._oldParent) {\n this._oldParent.appendChild(this._oldCanvas);\n this._oldParent = null;\n }\n this._container = null;\n }\n this._oldCanvas = null;\n };\n ContextFlash.prototype.addStream = function (stream) {\n this._cmdStream += stream;\n };\n ContextFlash.prototype.execute = function () {\n if (ContextFlash.logStream)\n console.log(this._cmdStream);\n var result = this._container[\"CallFunction\"](\"- \n *
- BlendMode.NORMAL: No blending, unless the material inherently needs it \n *
- BlendMode.LAYER: Force blending. This will draw the object the same as NORMAL, but without writing depth writes. \n *
- BlendMode.MULTIPLY \n *
- BlendMode.ADD \n *
- BlendMode.ALPHA \n *
Skeleton object\n */\n function Skeleton() {\n var _this = _super.call(this) || this;\n // in the long run, it might be a better idea to not store Joint objects, but keep all data in Vectors, that we can upload easily?\n _this.joints = new Array();\n return _this;\n }\n Object.defineProperty(Skeleton.prototype, \"numJoints\", {\n /**\n * The total number of joints in the skeleton.\n */\n get: function () {\n return this.joints.length;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * Returns the joint object in the skeleton with the given name, otherwise returns a null object.\n *\n * @param jointName The name of the joint object to be found.\n * @return The joint object with the given name.\n *\n * @see #joints\n */\n Skeleton.prototype.jointFromName = function (jointName) {\n var jointIndex = this.jointIndexFromName(jointName);\n if (jointIndex != -1)\n return this.joints[jointIndex];\n else\n return null;\n };\n /**\n * Returns the joint index, given the joint name. -1 is returned if the joint name is not found.\n *\n * @param jointName The name of the joint object to be found.\n * @return The index of the joint object in the joints Array\n *\n * @see #joints\n */\n Skeleton.prototype.jointIndexFromName = function (jointName) {\n // this is implemented as a linear search, rather than a possibly\n // more optimal method (Dictionary lookup, for example) because:\n // a) it is assumed that it will be called once for each joint\n // b) it is assumed that it will be called only during load, and not during main loop\n // c) maintaining a dictionary (for safety) would dictate an interface to access SkeletonJoints,\n // rather than direct array access. this would be sub-optimal.\n var jointIndex;\n var joint;\n for (var i; i < this.joints.length; i++) {\n joint = this.joints[i];\n if (joint.name == jointName)\n return jointIndex;\n jointIndex++;\n }\n return -1;\n };\n /**\n * @inheritDoc\n */\n Skeleton.prototype.dispose = function () {\n this.joints.length = 0;\n };\n Object.defineProperty(Skeleton.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return Skeleton.assetType;\n },\n enumerable: true,\n configurable: true\n });\n return Skeleton;\n}(AssetBase));\nexport { Skeleton };\nSkeleton.assetType = \"[asset Skeleton]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/data/Skeleton.js","/**\n * A value obect representing a single joint in a skeleton object.\n *\n * @see away.animators.Skeleton\n */\nvar SkeletonJoint = (function () {\n /**\n * Creates a new SkeletonJoint object\n */\n function SkeletonJoint() {\n /**\n * The index of the parent joint in the skeleton's joints vector.\n *\n * @see away.animators.Skeleton#joints\n */\n this.parentIndex = -1;\n }\n return SkeletonJoint;\n}());\nexport { SkeletonJoint };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/data/SkeletonJoint.js","import * as tslib_1 from \"tslib\";\nimport { AssetBase } from \"@awayjs/core\";\nimport { JointPose } from \"./JointPose\";\n/**\n * A collection of pose objects, determining the pose for an entire skeleton.\n * The jointPoses vector object corresponds to a skeleton's joints vector object, however, there is no\n * reference to a skeleton's instance, since several skeletons can be influenced by the same pose (eg: animation\n * clips are added to any animator with a valid skeleton)\n *\n * @see away.animators.Skeleton\n * @see away.animators.JointPose\n */\nvar SkeletonPose = (function (_super) {\n tslib_1.__extends(SkeletonPose, _super);\n /**\n * Creates a new SkeletonPose object.\n */\n function SkeletonPose() {\n var _this = _super.call(this) || this;\n _this.jointPoses = new Array();\n return _this;\n }\n Object.defineProperty(SkeletonPose.prototype, \"numJointPoses\", {\n /**\n * The total number of joint poses in the skeleton pose.\n */\n get: function () {\n return this.jointPoses.length;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(SkeletonPose.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return SkeletonPose.assetType;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * Returns the joint pose object with the given joint name, otherwise returns a null object.\n *\n * @param jointName The name of the joint object whose pose is to be found.\n * @return The pose object with the given joint name.\n */\n SkeletonPose.prototype.jointPoseFromName = function (jointName) {\n var jointPoseIndex = this.jointPoseIndexFromName(jointName);\n if (jointPoseIndex != -1)\n return this.jointPoses[jointPoseIndex];\n else\n return null;\n };\n /**\n * Returns the pose index, given the joint name. -1 is returned if the joint name is not found in the pose.\n *\n * @param The name of the joint object whose pose is to be found.\n * @return The index of the pose object in the jointPoses Array\n *\n * @see #jointPoses\n */\n SkeletonPose.prototype.jointPoseIndexFromName = function (jointName) {\n // this is implemented as a linear search, rather than a possibly\n // more optimal method (Dictionary lookup, for example) because:\n // a) it is assumed that it will be called once for each joint\n // b) it is assumed that it will be called only during load, and not during main loop\n // c) maintaining a dictionary (for safety) would dictate an interface to access JointPoses,\n // rather than direct array access. this would be sub-optimal.\n var jointPoseIndex;\n var jointPose;\n for (var i; i < this.jointPoses.length; i++) {\n jointPose = this.jointPoses[i];\n if (jointPose.name == jointName)\n return jointPoseIndex;\n jointPoseIndex++;\n }\n return -1;\n };\n /**\n * Creates a copy of the SkeletonPose object, with a dulpicate of its component joint poses.\n *\n * @return SkeletonPose\n */\n SkeletonPose.prototype.clone = function () {\n var clone = new SkeletonPose();\n var numJointPoses = this.jointPoses.length;\n for (var i = 0; i < numJointPoses; i++) {\n var cloneJointPose = new JointPose();\n var thisJointPose = this.jointPoses[i];\n cloneJointPose.name = thisJointPose.name;\n cloneJointPose.copyFrom(thisJointPose);\n clone.jointPoses[i] = cloneJointPose;\n }\n return clone;\n };\n /**\n * @inheritDoc\n */\n SkeletonPose.prototype.dispose = function () {\n this.jointPoses.length = 0;\n };\n return SkeletonPose;\n}(AssetBase));\nexport { SkeletonPose };\nSkeletonPose.assetType = \"[asset SkeletonPose]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/data/SkeletonPose.js","/**\n * Options for setting the animation mode of a vertex animator object.\n *\n * @see away.animators.VertexAnimator\n */\nvar VertexAnimationMode = (function () {\n function VertexAnimationMode() {\n }\n return VertexAnimationMode;\n}());\nexport { VertexAnimationMode };\n/**\n * Animation mode that adds all outputs from active vertex animation state to form the current vertex animation pose.\n */\nVertexAnimationMode.ADDITIVE = \"additive\";\n/**\n * Animation mode that picks the output from a single vertex animation state to form the current vertex animation pose.\n */\nVertexAnimationMode.ABSOLUTE = \"absolute\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/data/VertexAnimationMode.js","import * as tslib_1 from \"tslib\";\nimport { Vector3D } from \"@awayjs/core\";\nimport { AnimationNodeBase } from \"@awayjs/graphics\";\n/**\n * Provides an abstract base class for nodes with time-based animation data in an animation blend tree.\n */\nvar AnimationClipNodeBase = (function (_super) {\n tslib_1.__extends(AnimationClipNodeBase, _super);\n /**\n * Creates a new AnimationClipNodeBase object.\n */\n function AnimationClipNodeBase() {\n var _this = _super.call(this) || this;\n _this._pLooping = true;\n _this._pTotalDuration = 0;\n _this._pStitchDirty = true;\n _this._pStitchFinalFrame = false;\n _this._pNumFrames = 0;\n _this._pDurations = new Array();\n /*uint*/\n _this._pTotalDelta = new Vector3D();\n _this.fixedFrameRate = true;\n return _this;\n }\n Object.defineProperty(AnimationClipNodeBase.prototype, \"looping\", {\n /**\n * Determines whether the contents of the animation node have looping characteristics enabled.\n */\n get: function () {\n return this._pLooping;\n },\n set: function (value) {\n if (this._pLooping == value)\n return;\n this._pLooping = value;\n this._pStitchDirty = true;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AnimationClipNodeBase.prototype, \"stitchFinalFrame\", {\n /**\n * Defines if looping content blends the final frame of animation data with the first (true) or works on the\n * assumption that both first and last frames are identical (false). Defaults to false.\n */\n get: function () {\n return this._pStitchFinalFrame;\n },\n set: function (value) {\n if (this._pStitchFinalFrame == value)\n return;\n this._pStitchFinalFrame = value;\n this._pStitchDirty = true;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AnimationClipNodeBase.prototype, \"totalDuration\", {\n get: function () {\n if (this._pStitchDirty)\n this._pUpdateStitch();\n return this._pTotalDuration;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AnimationClipNodeBase.prototype, \"totalDelta\", {\n get: function () {\n if (this._pStitchDirty)\n this._pUpdateStitch();\n return this._pTotalDelta;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AnimationClipNodeBase.prototype, \"lastFrame\", {\n get: function () {\n if (this._pStitchDirty)\n this._pUpdateStitch();\n return this._pLastFrame;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AnimationClipNodeBase.prototype, \"durations\", {\n /**\n * Returns a vector of time values representing the duration (in milliseconds) of each animation frame in the clip.\n */\n get: function () {\n return this._pDurations;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * Updates the node's final frame stitch state.\n *\n * @see #stitchFinalFrame\n */\n AnimationClipNodeBase.prototype._pUpdateStitch = function () {\n this._pStitchDirty = false;\n this._pLastFrame = (this._pStitchFinalFrame) ? this._pNumFrames : this._pNumFrames - 1;\n this._pTotalDuration = 0;\n this._pTotalDelta.x = 0;\n this._pTotalDelta.y = 0;\n this._pTotalDelta.z = 0;\n };\n return AnimationClipNodeBase;\n}(AnimationNodeBase));\nexport { AnimationClipNodeBase };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/AnimationClipNodeBase.js","import { Vector3D } from \"@awayjs/core\";\n/**\n *\n */\nvar AnimationStateBase = (function () {\n function AnimationStateBase(animator, animationNode) {\n this._pRootDelta = new Vector3D();\n this._pPositionDeltaDirty = true;\n this._pStartTime = 0;\n this._pAnimator = animator;\n this._pAnimationNode = animationNode;\n }\n Object.defineProperty(AnimationStateBase.prototype, \"positionDelta\", {\n /**\n * Returns a 3d vector representing the translation delta of the animating entity for the current timestep of animation\n */\n get: function () {\n if (this._pPositionDeltaDirty) {\n this._pUpdatePositionDelta();\n }\n return this._pRootDelta;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * Resets the start time of the node to a new value.\n *\n * @param startTime The absolute start time (in milliseconds) of the node's starting time.\n */\n AnimationStateBase.prototype.offset = function (startTime) {\n this._pStartTime = startTime;\n this._pPositionDeltaDirty = true;\n };\n /**\n * Updates the configuration of the node to its current state.\n *\n * @param time The absolute time (in milliseconds) of the animator's play head position.\n *\n * @see AnimatorBase#update()\n */\n AnimationStateBase.prototype.update = function (time) {\n if (this._pTime == time - this._pStartTime) {\n return;\n }\n this._pUpdateTime(time);\n };\n /**\n * Sets the animation phase of the node.\n *\n * @param value The phase value to use. 0 represents the beginning of an animation clip, 1 represents the end.\n */\n AnimationStateBase.prototype.phase = function (value) {\n };\n /**\n * Updates the node's internal playhead position.\n *\n * @param time The local time (in milliseconds) of the node's playhead position.\n */\n AnimationStateBase.prototype._pUpdateTime = function (time) {\n this._pTime = time - this._pStartTime;\n this._pPositionDeltaDirty = true;\n };\n /**\n * Updates the node's root delta position\n */\n AnimationStateBase.prototype._pUpdatePositionDelta = function () {\n };\n return AnimationStateBase;\n}());\nexport { AnimationStateBase };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/AnimationStateBase.js","import * as tslib_1 from \"tslib\";\nimport { AnimationStateBase } from \"./AnimationStateBase\";\n/**\n * ...\n */\nvar ParticleStateBase = (function (_super) {\n tslib_1.__extends(ParticleStateBase, _super);\n function ParticleStateBase(animator, particleNode, needUpdateTime) {\n if (needUpdateTime === void 0) { needUpdateTime = false; }\n var _this = _super.call(this, animator, particleNode) || this;\n _this._pDynamicProperties = new Array();\n _this._pDynamicPropertiesDirty = new Object();\n _this._pParticleAnimator = animator;\n _this._particleNode = particleNode;\n _this._pNeedUpdateTime = needUpdateTime;\n return _this;\n }\n Object.defineProperty(ParticleStateBase.prototype, \"needUpdateTime\", {\n get: function () {\n return this._pNeedUpdateTime;\n },\n enumerable: true,\n configurable: true\n });\n ParticleStateBase.prototype.setRenderState = function (shader, renderable, animationElements, animationRegisterData, projection, stage) {\n };\n ParticleStateBase.prototype._pUpdateDynamicProperties = function (animationElements) {\n this._pDynamicPropertiesDirty[animationElements._iUniqueId] = true;\n var animationParticles = animationElements.animationParticles;\n var vertexData = animationElements.vertexData;\n var totalLenOfOneVertex = animationElements.totalLenOfOneVertex;\n var dataLength = this._particleNode.dataLength;\n var dataOffset = this._particleNode._iDataOffset;\n var vertexLength;\n //\t\t\tvar particleOffset:number;\n var startingOffset;\n var vertexOffset;\n var data;\n var animationParticle;\n //\t\t\tvar numParticles:number = _positions.length/dataLength;\n var numParticles = this._pDynamicProperties.length;\n var i = 0;\n var j = 0;\n var k = 0;\n //loop through all particles\n while (i < numParticles) {\n //loop through each particle data for the current particle\n while (j < numParticles && (animationParticle = animationParticles[j]).index == i) {\n data = this._pDynamicProperties[i];\n vertexLength = animationParticle.numVertices * totalLenOfOneVertex;\n startingOffset = animationParticle.startVertexIndex * totalLenOfOneVertex + dataOffset;\n //loop through each vertex in the particle data\n for (k = 0; k < vertexLength; k += totalLenOfOneVertex) {\n vertexOffset = startingOffset + k;\n //\t\t\t\t\t\tparticleOffset = i * dataLength;\n //loop through all vertex data for the current particle data\n for (k = 0; k < vertexLength; k += totalLenOfOneVertex) {\n vertexOffset = startingOffset + k;\n vertexData[vertexOffset++] = data.x;\n vertexData[vertexOffset++] = data.y;\n vertexData[vertexOffset++] = data.z;\n if (dataLength == 4)\n vertexData[vertexOffset++] = data.w;\n }\n }\n j++;\n }\n i++;\n }\n animationElements.invalidateBuffer();\n };\n return ParticleStateBase;\n}(AnimationStateBase));\nexport { ParticleStateBase };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/ParticleStateBase.js","import * as tslib_1 from \"tslib\";\nimport { Vector3D } from \"@awayjs/core\";\nimport { ContextGLVertexBufferFormat } from \"@awayjs/stage\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleStateBase } from \"./ParticleStateBase\";\n/**\n * ...\n */\nvar ParticleAccelerationState = (function (_super) {\n tslib_1.__extends(ParticleAccelerationState, _super);\n function ParticleAccelerationState(animator, particleAccelerationNode) {\n var _this = _super.call(this, animator, particleAccelerationNode) || this;\n _this._particleAccelerationNode = particleAccelerationNode;\n _this._acceleration = _this._particleAccelerationNode._acceleration;\n _this.updateAccelerationData();\n return _this;\n }\n Object.defineProperty(ParticleAccelerationState.prototype, \"acceleration\", {\n /**\n * Defines the acceleration vector of the state, used when in global mode.\n */\n get: function () {\n return this._acceleration;\n },\n set: function (value) {\n this._acceleration.x = value.x;\n this._acceleration.y = value.y;\n this._acceleration.z = value.z;\n this.updateAccelerationData();\n },\n enumerable: true,\n configurable: true\n });\n /**\n * @inheritDoc\n */\n ParticleAccelerationState.prototype.setRenderState = function (shader, renderable, animationElements, animationRegisterData, projection, stage) {\n var index = animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleAccelerationState.ACCELERATION_INDEX);\n if (this._particleAccelerationNode.mode == ParticlePropertiesMode.LOCAL_STATIC)\n animationElements.activateVertexBuffer(index, this._particleAccelerationNode._iDataOffset, stage, ContextGLVertexBufferFormat.FLOAT_3);\n else\n shader.setVertexConst(index, this._halfAcceleration.x, this._halfAcceleration.y, this._halfAcceleration.z);\n };\n ParticleAccelerationState.prototype.updateAccelerationData = function () {\n if (this._particleAccelerationNode.mode == ParticlePropertiesMode.GLOBAL)\n this._halfAcceleration = new Vector3D(this._acceleration.x / 2, this._acceleration.y / 2, this._acceleration.z / 2);\n };\n return ParticleAccelerationState;\n}(ParticleStateBase));\nexport { ParticleAccelerationState };\n/** @private */\nParticleAccelerationState.ACCELERATION_INDEX = 0;\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/ParticleAccelerationState.js","import * as tslib_1 from \"tslib\";\nimport { AnimationNodeBase } from \"@awayjs/graphics\";\n/**\n * Provides an abstract base class for particle animation nodes.\n */\nvar ParticleNodeBase = (function (_super) {\n tslib_1.__extends(ParticleNodeBase, _super);\n /**\n * Creates a new ParticleNodeBase object.\n *\n * @param name Defines the generic name of the particle animation node.\n * @param mode Defines whether the mode of operation acts on local properties of a particle or global properties of the node.\n * @param dataLength Defines the length of the data used by the node when in LOCAL_STATIC mode.\n * @param [optional] priority the priority of the particle animation node, used to order the agal generated in a particle animation set. Defaults to 1.\n */\n function ParticleNodeBase(name, mode, dataLength, priority) {\n if (priority === void 0) { priority = 1; }\n var _this = _super.call(this) || this;\n _this._pDataLength = 3;\n name = name + ParticleNodeBase.MODES[mode];\n _this.name = name;\n _this._pMode = mode;\n _this._priority = priority;\n _this._pDataLength = dataLength;\n _this._pOneData = new Array(_this._pDataLength);\n return _this;\n }\n Object.defineProperty(ParticleNodeBase.prototype, \"mode\", {\n /**\n * Returns the property mode of the particle animation node. Typically set in the node constructor\n *\n * @see away.animators.ParticlePropertiesMode\n */\n get: function () {\n return this._pMode;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleNodeBase.prototype, \"priority\", {\n /**\n * Returns the priority of the particle animation node, used to order the agal generated in a particle animation set. Set automatically on instantiation.\n *\n * @see away.animators.ParticleAnimationSet\n * @see #getAGALVertexCode\n */\n get: function () {\n return this._priority;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleNodeBase.prototype, \"dataLength\", {\n /**\n * Returns the length of the data used by the node when in LOCAL_STATIC mode. Used to generate the local static data of the particle animation set.\n *\n * @see away.animators.ParticleAnimationSet\n * @see #getAGALVertexCode\n */\n get: function () {\n return this._pDataLength;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleNodeBase.prototype, \"oneData\", {\n /**\n * Returns the generated data vector of the node after one particle pass during the generation of all local static data of the particle animation set.\n *\n * @see away.animators.ParticleAnimationSet\n * @see #generatePropertyOfOneParticle\n */\n get: function () {\n return this._pOneData;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * Returns the AGAL code of the particle animation node for use in the vertex shader.\n */\n ParticleNodeBase.prototype.getAGALVertexCode = function (shader, animationSet, registerCache, animationRegisterData) {\n return \"\";\n };\n /**\n * Returns the AGAL code of the particle animation node for use in the fragment shader.\n */\n ParticleNodeBase.prototype.getAGALFragmentCode = function (shader, animationSet, registerCache, animationRegisterData) {\n return \"\";\n };\n /**\n * Returns the AGAL code of the particle animation node for use in the fragment shader when UV coordinates are required.\n */\n ParticleNodeBase.prototype.getAGALUVCode = function (shader, animationSet, registerCache, animationRegisterData) {\n return \"\";\n };\n /**\n * Called internally by the particle animation set when assigning the set of static properties originally defined by the initParticleFunc of the set.\n *\n * @see away.animators.ParticleAnimationSet#initParticleFunc\n */\n ParticleNodeBase.prototype._iGeneratePropertyOfOneParticle = function (param) {\n };\n /**\n * Called internally by the particle animation set when determining the requirements of the particle animation node AGAL.\n */\n ParticleNodeBase.prototype._iProcessAnimationSetting = function (particleAnimationSet) {\n };\n return ParticleNodeBase;\n}(AnimationNodeBase));\nexport { ParticleNodeBase };\n//modes alias\nParticleNodeBase.GLOBAL = 'Global';\nParticleNodeBase.LOCAL_STATIC = 'LocalStatic';\nParticleNodeBase.LOCAL_DYNAMIC = 'LocalDynamic';\n//modes list\nParticleNodeBase.MODES = {\n 0: ParticleNodeBase.GLOBAL,\n 1: ParticleNodeBase.LOCAL_STATIC,\n 2: ParticleNodeBase.LOCAL_DYNAMIC\n};\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/ParticleNodeBase.js","import * as tslib_1 from \"tslib\";\nimport { Vector3D } from \"@awayjs/core\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleAccelerationState } from \"../states/ParticleAccelerationState\";\nimport { ParticleNodeBase } from \"./ParticleNodeBase\";\n/**\n * A particle animation node used to apply a constant acceleration vector to the motion of a particle.\n */\nvar ParticleAccelerationNode = (function (_super) {\n tslib_1.__extends(ParticleAccelerationNode, _super);\n /**\n * Creates a new ParticleAccelerationNode\n *\n * @param mode Defines whether the mode of operation acts on local properties of a particle or global properties of the node.\n * @param [optional] acceleration Defines the default acceleration vector of the node, used when in global mode.\n */\n function ParticleAccelerationNode(mode, acceleration) {\n if (acceleration === void 0) { acceleration = null; }\n var _this = _super.call(this, \"ParticleAcceleration\", mode, 3) || this;\n _this._pStateClass = ParticleAccelerationState;\n _this._acceleration = acceleration || new Vector3D();\n return _this;\n }\n /**\n * @inheritDoc\n */\n ParticleAccelerationNode.prototype.getAGALVertexCode = function (shader, animationSet, registerCache, animationRegisterData) {\n var accelerationValue = (this._pMode == ParticlePropertiesMode.GLOBAL) ? registerCache.getFreeVertexConstant() : registerCache.getFreeVertexAttribute();\n animationRegisterData.setRegisterIndex(this, ParticleAccelerationState.ACCELERATION_INDEX, accelerationValue.index);\n var temp = registerCache.getFreeVertexVectorTemp();\n registerCache.addVertexTempUsages(temp, 1);\n var code = \"mul \" + temp + \",\" + animationRegisterData.vertexTime + \",\" + accelerationValue + \"\\n\";\n if (animationSet.needVelocity) {\n var temp2 = registerCache.getFreeVertexVectorTemp();\n code += \"mul \" + temp2 + \",\" + temp + \",\" + animationRegisterData.vertexTwoConst + \"\\n\";\n code += \"add \" + animationRegisterData.velocityTarget + \".xyz,\" + temp2 + \".xyz,\" + animationRegisterData.velocityTarget + \".xyz\\n\";\n }\n registerCache.removeVertexTempUsage(temp);\n code += \"mul \" + temp + \",\" + temp + \",\" + animationRegisterData.vertexTime + \"\\n\";\n code += \"add \" + animationRegisterData.positionTarget + \".xyz,\" + temp + \",\" + animationRegisterData.positionTarget + \".xyz\\n\";\n return code;\n };\n /**\n * @inheritDoc\n */\n ParticleAccelerationNode.prototype.getAnimationState = function (animator) {\n return animator.getAnimationState(this);\n };\n /**\n * @inheritDoc\n */\n ParticleAccelerationNode.prototype._iGeneratePropertyOfOneParticle = function (param) {\n var tempAcceleration = param[ParticleAccelerationNode.ACCELERATION_VECTOR3D];\n if (!tempAcceleration)\n throw new Error(\"there is no \" + ParticleAccelerationNode.ACCELERATION_VECTOR3D + \" in param!\");\n this._pOneData[0] = tempAcceleration.x / 2;\n this._pOneData[1] = tempAcceleration.y / 2;\n this._pOneData[2] = tempAcceleration.z / 2;\n };\n return ParticleAccelerationNode;\n}(ParticleNodeBase));\nexport { ParticleAccelerationNode };\n/**\n * Reference for acceleration node properties on a single particle (when in local property mode).\n * Expects a Vector3D object representing the direction of acceleration on the particle.\n */\nParticleAccelerationNode.ACCELERATION_VECTOR3D = \"AccelerationVector3D\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/ParticleAccelerationNode.js","import * as tslib_1 from \"tslib\";\nimport { ContextGLVertexBufferFormat } from \"@awayjs/stage\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleStateBase } from \"./ParticleStateBase\";\n/**\n * ...\n */\nvar ParticleBezierCurveState = (function (_super) {\n tslib_1.__extends(ParticleBezierCurveState, _super);\n function ParticleBezierCurveState(animator, particleBezierCurveNode) {\n var _this = _super.call(this, animator, particleBezierCurveNode) || this;\n _this._particleBezierCurveNode = particleBezierCurveNode;\n _this._controlPoint = _this._particleBezierCurveNode._iControlPoint;\n _this._endPoint = _this._particleBezierCurveNode._iEndPoint;\n return _this;\n }\n Object.defineProperty(ParticleBezierCurveState.prototype, \"controlPoint\", {\n /**\n * Defines the default control point of the node, used when in global mode.\n */\n get: function () {\n return this._controlPoint;\n },\n set: function (value) {\n this._controlPoint = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleBezierCurveState.prototype, \"endPoint\", {\n /**\n * Defines the default end point of the node, used when in global mode.\n */\n get: function () {\n return this._endPoint;\n },\n set: function (value) {\n this._endPoint = value;\n },\n enumerable: true,\n configurable: true\n });\n ParticleBezierCurveState.prototype.setRenderState = function (shader, renderable, animationElements, animationRegisterData, projection, stage) {\n var controlIndex = animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleBezierCurveState.BEZIER_CONTROL_INDEX);\n var endIndex = animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleBezierCurveState.BEZIER_END_INDEX);\n if (this._particleBezierCurveNode.mode == ParticlePropertiesMode.LOCAL_STATIC) {\n animationElements.activateVertexBuffer(controlIndex, this._particleBezierCurveNode._iDataOffset, stage, ContextGLVertexBufferFormat.FLOAT_3);\n animationElements.activateVertexBuffer(endIndex, this._particleBezierCurveNode._iDataOffset + 3, stage, ContextGLVertexBufferFormat.FLOAT_3);\n }\n else {\n shader.setVertexConst(controlIndex, this._controlPoint.x, this._controlPoint.y, this._controlPoint.z);\n shader.setVertexConst(endIndex, this._endPoint.x, this._endPoint.y, this._endPoint.z);\n }\n };\n return ParticleBezierCurveState;\n}(ParticleStateBase));\nexport { ParticleBezierCurveState };\n/** @private */\nParticleBezierCurveState.BEZIER_CONTROL_INDEX = 0;\n/** @private */\nParticleBezierCurveState.BEZIER_END_INDEX = 1;\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/ParticleBezierCurveState.js","import * as tslib_1 from \"tslib\";\nimport { Vector3D } from \"@awayjs/core\";\nimport { ShaderRegisterElement } from \"@awayjs/stage\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleBezierCurveState } from \"../states/ParticleBezierCurveState\";\nimport { ParticleNodeBase } from \"./ParticleNodeBase\";\n/**\n * A particle animation node used to control the position of a particle over time along a bezier curve.\n */\nvar ParticleBezierCurveNode = (function (_super) {\n tslib_1.__extends(ParticleBezierCurveNode, _super);\n /**\n * Creates a new ParticleBezierCurveNode\n *\n * @param mode Defines whether the mode of operation acts on local properties of a particle or global properties of the node.\n * @param [optional] controlPoint Defines the default control point of the node, used when in global mode.\n * @param [optional] endPoint Defines the default end point of the node, used when in global mode.\n */\n function ParticleBezierCurveNode(mode, controlPoint, endPoint) {\n if (controlPoint === void 0) { controlPoint = null; }\n if (endPoint === void 0) { endPoint = null; }\n var _this = _super.call(this, \"ParticleBezierCurve\", mode, 6) || this;\n _this._pStateClass = ParticleBezierCurveState;\n _this._iControlPoint = controlPoint || new Vector3D();\n _this._iEndPoint = endPoint || new Vector3D();\n return _this;\n }\n /**\n * @inheritDoc\n */\n ParticleBezierCurveNode.prototype.getAGALVertexCode = function (shader, animationSet, registerCache, animationRegisterData) {\n var controlValue = (this._pMode == ParticlePropertiesMode.GLOBAL) ? registerCache.getFreeVertexConstant() : registerCache.getFreeVertexAttribute();\n animationRegisterData.setRegisterIndex(this, ParticleBezierCurveState.BEZIER_CONTROL_INDEX, controlValue.index);\n var endValue = (this._pMode == ParticlePropertiesMode.GLOBAL) ? registerCache.getFreeVertexConstant() : registerCache.getFreeVertexAttribute();\n animationRegisterData.setRegisterIndex(this, ParticleBezierCurveState.BEZIER_END_INDEX, endValue.index);\n var temp = registerCache.getFreeVertexVectorTemp();\n var rev_time = new ShaderRegisterElement(temp.regName, temp.index, 0);\n var time_2 = new ShaderRegisterElement(temp.regName, temp.index, 1);\n var time_temp = new ShaderRegisterElement(temp.regName, temp.index, 2);\n registerCache.addVertexTempUsages(temp, 1);\n var temp2 = registerCache.getFreeVertexVectorTemp();\n var distance = new ShaderRegisterElement(temp2.regName, temp2.index);\n registerCache.removeVertexTempUsage(temp);\n var code = \"\";\n code += \"sub \" + rev_time + \",\" + animationRegisterData.vertexOneConst + \",\" + animationRegisterData.vertexLife + \"\\n\";\n code += \"mul \" + time_2 + \",\" + animationRegisterData.vertexLife + \",\" + animationRegisterData.vertexLife + \"\\n\";\n code += \"mul \" + time_temp + \",\" + animationRegisterData.vertexLife + \",\" + rev_time + \"\\n\";\n code += \"mul \" + time_temp + \",\" + time_temp + \",\" + animationRegisterData.vertexTwoConst + \"\\n\";\n code += \"mul \" + distance + \".xyz,\" + time_temp + \",\" + controlValue + \"\\n\";\n code += \"add \" + animationRegisterData.positionTarget + \".xyz,\" + distance + \".xyz,\" + animationRegisterData.positionTarget + \".xyz\\n\";\n code += \"mul \" + distance + \".xyz,\" + time_2 + \",\" + endValue + \"\\n\";\n code += \"add \" + animationRegisterData.positionTarget + \".xyz,\" + distance + \".xyz,\" + animationRegisterData.positionTarget + \".xyz\\n\";\n if (animationSet.needVelocity) {\n code += \"mul \" + time_2 + \",\" + animationRegisterData.vertexLife + \",\" + animationRegisterData.vertexTwoConst + \"\\n\";\n code += \"sub \" + time_temp + \",\" + animationRegisterData.vertexOneConst + \",\" + time_2 + \"\\n\";\n code += \"mul \" + time_temp + \",\" + animationRegisterData.vertexTwoConst + \",\" + time_temp + \"\\n\";\n code += \"mul \" + distance + \".xyz,\" + controlValue + \",\" + time_temp + \"\\n\";\n code += \"add \" + animationRegisterData.velocityTarget + \".xyz,\" + distance + \".xyz,\" + animationRegisterData.velocityTarget + \".xyz\\n\";\n code += \"mul \" + distance + \".xyz,\" + endValue + \",\" + time_2 + \"\\n\";\n code += \"add \" + animationRegisterData.velocityTarget + \".xyz,\" + distance + \".xyz,\" + animationRegisterData.velocityTarget + \".xyz\\n\";\n }\n return code;\n };\n /**\n * @inheritDoc\n */\n ParticleBezierCurveNode.prototype.getAnimationState = function (animator) {\n return animator.getAnimationState(this);\n };\n /**\n * @inheritDoc\n */\n ParticleBezierCurveNode.prototype._iGeneratePropertyOfOneParticle = function (param) {\n var bezierControl = param[ParticleBezierCurveNode.BEZIER_CONTROL_VECTOR3D];\n if (!bezierControl)\n throw new Error(\"there is no \" + ParticleBezierCurveNode.BEZIER_CONTROL_VECTOR3D + \" in param!\");\n var bezierEnd = param[ParticleBezierCurveNode.BEZIER_END_VECTOR3D];\n if (!bezierEnd)\n throw new Error(\"there is no \" + ParticleBezierCurveNode.BEZIER_END_VECTOR3D + \" in param!\");\n this._pOneData[0] = bezierControl.x;\n this._pOneData[1] = bezierControl.y;\n this._pOneData[2] = bezierControl.z;\n this._pOneData[3] = bezierEnd.x;\n this._pOneData[4] = bezierEnd.y;\n this._pOneData[5] = bezierEnd.z;\n };\n return ParticleBezierCurveNode;\n}(ParticleNodeBase));\nexport { ParticleBezierCurveNode };\n/**\n * Reference for bezier curve node properties on a single particle (when in local property mode).\n * Expects a Vector3D object representing the control point position (0, 1, 2) of the curve.\n */\nParticleBezierCurveNode.BEZIER_CONTROL_VECTOR3D = \"BezierControlVector3D\";\n/**\n * Reference for bezier curve node properties on a single particle (when in local property mode).\n * Expects a Vector3D object representing the end point position (0, 1, 2) of the curve.\n */\nParticleBezierCurveNode.BEZIER_END_VECTOR3D = \"BezierEndVector3D\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/ParticleBezierCurveNode.js","import * as tslib_1 from \"tslib\";\nimport { Matrix3D, Orientation3D, MathConsts } from \"@awayjs/core\";\nimport { ParticleStateBase } from \"./ParticleStateBase\";\n/**\n * ...\n */\nvar ParticleBillboardState = (function (_super) {\n tslib_1.__extends(ParticleBillboardState, _super);\n /**\n *\n */\n function ParticleBillboardState(animator, particleNode) {\n var _this = _super.call(this, animator, particleNode) || this;\n _this._matrix = new Matrix3D;\n _this._billboardAxis = particleNode._iBillboardAxis;\n return _this;\n }\n ParticleBillboardState.prototype.setRenderState = function (shader, renderable, animationElements, animationRegisterData, projection, stage) {\n var comps;\n if (this._billboardAxis) {\n var pos = renderable.sourceEntity.transform.concatenatedMatrix3D.position;\n var look = projection.transform.concatenatedMatrix3D.position.subtract(pos);\n var right = look.crossProduct(this._billboardAxis);\n right.normalize();\n look = this.billboardAxis.crossProduct(right);\n look.normalize();\n //create a quick inverse projection matrix\n this._matrix.copyFrom(renderable.sourceEntity.transform.concatenatedMatrix3D);\n comps = this._matrix.decompose(Orientation3D.AXIS_ANGLE);\n this._matrix.copyColumnFrom(0, right);\n this._matrix.copyColumnFrom(1, this.billboardAxis);\n this._matrix.copyColumnFrom(2, look);\n this._matrix.copyColumnFrom(3, pos);\n this._matrix.appendRotation(-comps[1].w * MathConsts.RADIANS_TO_DEGREES, comps[1]);\n }\n else {\n //create a quick inverse projection matrix\n this._matrix.copyFrom(renderable.sourceEntity.transform.concatenatedMatrix3D);\n this._matrix.append(projection.transform.inverseConcatenatedMatrix3D);\n //decompose using axis angle rotations\n comps = this._matrix.decompose(Orientation3D.AXIS_ANGLE);\n //recreate the matrix with just the rotation data\n this._matrix.identity();\n this._matrix.appendRotation(-comps[1].w * MathConsts.RADIANS_TO_DEGREES, comps[1]);\n }\n //set a new matrix transform constant\n shader.setVertexConstFromMatrix(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleBillboardState.MATRIX_INDEX), this._matrix);\n };\n Object.defineProperty(ParticleBillboardState.prototype, \"billboardAxis\", {\n /**\n * Defines the billboard axis.\n */\n get: function () {\n return this.billboardAxis;\n },\n set: function (value) {\n this.billboardAxis = value ? value.clone() : null;\n if (this.billboardAxis)\n this.billboardAxis.normalize();\n },\n enumerable: true,\n configurable: true\n });\n return ParticleBillboardState;\n}(ParticleStateBase));\nexport { ParticleBillboardState };\n/** @private */\nParticleBillboardState.MATRIX_INDEX = 0;\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/ParticleBillboardState.js","import * as tslib_1 from \"tslib\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleBillboardState } from \"../states/ParticleBillboardState\";\nimport { ParticleNodeBase } from \"./ParticleNodeBase\";\n/**\n * A particle animation node that controls the rotation of a particle to always face the camera.\n */\nvar ParticleBillboardNode = (function (_super) {\n tslib_1.__extends(ParticleBillboardNode, _super);\n /**\n * Creates a new ParticleBillboardNode\n */\n function ParticleBillboardNode(billboardAxis) {\n if (billboardAxis === void 0) { billboardAxis = null; }\n var _this = _super.call(this, \"ParticleBillboard\", ParticlePropertiesMode.GLOBAL, 0, 4) || this;\n _this._pStateClass = ParticleBillboardState;\n _this._iBillboardAxis = billboardAxis;\n return _this;\n }\n /**\n * @inheritDoc\n */\n ParticleBillboardNode.prototype.getAGALVertexCode = function (shader, animationSet, registerCache, animationRegisterData) {\n var rotationMatrixRegister = registerCache.getFreeVertexConstant();\n animationRegisterData.setRegisterIndex(this, ParticleBillboardState.MATRIX_INDEX, rotationMatrixRegister.index);\n registerCache.getFreeVertexConstant();\n registerCache.getFreeVertexConstant();\n registerCache.getFreeVertexConstant();\n var temp = registerCache.getFreeVertexVectorTemp();\n var code = \"m33 \" + temp + \".xyz,\" + animationRegisterData.scaleAndRotateTarget + \",\" + rotationMatrixRegister + \"\\n\" +\n \"mov \" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + temp + \"\\n\";\n var shaderRegisterElement;\n for (var i = 0; i < animationRegisterData.rotationRegisters.length; i++) {\n shaderRegisterElement = animationRegisterData.rotationRegisters[i];\n code += \"m33 \" + temp + \".xyz,\" + shaderRegisterElement + \",\" + rotationMatrixRegister + \"\\n\" +\n \"mov \" + shaderRegisterElement + \".xyz,\" + shaderRegisterElement + \"\\n\";\n }\n return code;\n };\n /**\n * @inheritDoc\n */\n ParticleBillboardNode.prototype.getAnimationState = function (animator) {\n return animator.getAnimationState(this);\n };\n /**\n * @inheritDoc\n */\n ParticleBillboardNode.prototype._iProcessAnimationSetting = function (particleAnimationSet) {\n particleAnimationSet.hasBillboard = true;\n };\n return ParticleBillboardNode;\n}(ParticleNodeBase));\nexport { ParticleBillboardNode };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/ParticleBillboardNode.js","import * as tslib_1 from \"tslib\";\nimport { Vector3D } from \"@awayjs/core\";\nimport { ContextGLVertexBufferFormat } from \"@awayjs/stage\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleStateBase } from \"./ParticleStateBase\";\n/**\n * ...\n * @author ...\n */\nvar ParticleColorState = (function (_super) {\n tslib_1.__extends(ParticleColorState, _super);\n function ParticleColorState(animator, particleColorNode) {\n var _this = _super.call(this, animator, particleColorNode) || this;\n _this._particleColorNode = particleColorNode;\n _this._usesMultiplier = _this._particleColorNode._iUsesMultiplier;\n _this._usesOffset = _this._particleColorNode._iUsesOffset;\n _this._usesCycle = _this._particleColorNode._iUsesCycle;\n _this._usesPhase = _this._particleColorNode._iUsesPhase;\n _this._startColor = _this._particleColorNode._iStartColor;\n _this._endColor = _this._particleColorNode._iEndColor;\n _this._cycleDuration = _this._particleColorNode._iCycleDuration;\n _this._cyclePhase = _this._particleColorNode._iCyclePhase;\n _this.updateColorData();\n return _this;\n }\n Object.defineProperty(ParticleColorState.prototype, \"startColor\", {\n /**\n * Defines the start color transform of the state, when in global mode.\n */\n get: function () {\n return this._startColor;\n },\n set: function (value) {\n this._startColor = value;\n this.updateColorData();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleColorState.prototype, \"endColor\", {\n /**\n * Defines the end color transform of the state, when in global mode.\n */\n get: function () {\n return this._endColor;\n },\n set: function (value) {\n this._endColor = value;\n this.updateColorData();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleColorState.prototype, \"cycleDuration\", {\n /**\n * Defines the duration of the animation in seconds, used as a period independent of particle duration when in global mode. Defaults to 1.\n */\n get: function () {\n return this._cycleDuration;\n },\n set: function (value) {\n this._cycleDuration = value;\n this.updateColorData();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleColorState.prototype, \"cyclePhase\", {\n /**\n * Defines the phase of the cycle in degrees, used as the starting offset of the cycle when in global mode. Defaults to 0.\n */\n get: function () {\n return this._cyclePhase;\n },\n set: function (value) {\n this._cyclePhase = value;\n this.updateColorData();\n },\n enumerable: true,\n configurable: true\n });\n ParticleColorState.prototype.setRenderState = function (shader, renderable, animationElements, animationRegisterData, projection, stage) {\n if (shader.usesFragmentAnimation) {\n var dataOffset = this._particleColorNode._iDataOffset;\n var index;\n if (this._usesCycle)\n shader.setVertexConst(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleColorState.CYCLE_INDEX), this._cycleData.x, this._cycleData.y, this._cycleData.z, this._cycleData.w);\n if (this._usesMultiplier) {\n if (this._particleColorNode.mode == ParticlePropertiesMode.LOCAL_STATIC) {\n animationElements.activateVertexBuffer(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleColorState.START_MULTIPLIER_INDEX), dataOffset, stage, ContextGLVertexBufferFormat.FLOAT_4);\n dataOffset += 4;\n animationElements.activateVertexBuffer(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleColorState.DELTA_MULTIPLIER_INDEX), dataOffset, stage, ContextGLVertexBufferFormat.FLOAT_4);\n dataOffset += 4;\n }\n else {\n shader.setVertexConst(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleColorState.START_MULTIPLIER_INDEX), this._startMultiplierData.x, this._startMultiplierData.y, this._startMultiplierData.z, this._startMultiplierData.w);\n shader.setVertexConst(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleColorState.DELTA_MULTIPLIER_INDEX), this._deltaMultiplierData.x, this._deltaMultiplierData.y, this._deltaMultiplierData.z, this._deltaMultiplierData.w);\n }\n }\n if (this._usesOffset) {\n if (this._particleColorNode.mode == ParticlePropertiesMode.LOCAL_STATIC) {\n animationElements.activateVertexBuffer(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleColorState.START_OFFSET_INDEX), dataOffset, stage, ContextGLVertexBufferFormat.FLOAT_4);\n dataOffset += 4;\n animationElements.activateVertexBuffer(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleColorState.DELTA_OFFSET_INDEX), dataOffset, stage, ContextGLVertexBufferFormat.FLOAT_4);\n }\n else {\n shader.setVertexConst(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleColorState.START_OFFSET_INDEX), this._startOffsetData.x, this._startOffsetData.y, this._startOffsetData.z, this._startOffsetData.w);\n shader.setVertexConst(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleColorState.DELTA_OFFSET_INDEX), this._deltaOffsetData.x, this._deltaOffsetData.y, this._deltaOffsetData.z, this._deltaOffsetData.w);\n }\n }\n }\n };\n ParticleColorState.prototype.updateColorData = function () {\n if (this._usesCycle) {\n if (this._cycleDuration <= 0)\n throw (new Error(\"the cycle duration must be greater than zero\"));\n this._cycleData = new Vector3D(Math.PI * 2 / this._cycleDuration, this._cyclePhase * Math.PI / 180, 0, 0);\n }\n if (this._particleColorNode.mode == ParticlePropertiesMode.GLOBAL) {\n if (this._usesCycle) {\n if (this._usesMultiplier) {\n this._startMultiplierData = new Vector3D((this._startColor.redMultiplier + this._endColor.redMultiplier) / 2, (this._startColor.greenMultiplier + this._endColor.greenMultiplier) / 2, (this._startColor.blueMultiplier + this._endColor.blueMultiplier) / 2, (this._startColor.alphaMultiplier + this._endColor.alphaMultiplier) / 2);\n this._deltaMultiplierData = new Vector3D((this._endColor.redMultiplier - this._startColor.redMultiplier) / 2, (this._endColor.greenMultiplier - this._startColor.greenMultiplier) / 2, (this._endColor.blueMultiplier - this._startColor.blueMultiplier) / 2, (this._endColor.alphaMultiplier - this._startColor.alphaMultiplier) / 2);\n }\n if (this._usesOffset) {\n this._startOffsetData = new Vector3D((this._startColor.redOffset + this._endColor.redOffset) / (255 * 2), (this._startColor.greenOffset + this._endColor.greenOffset) / (255 * 2), (this._startColor.blueOffset + this._endColor.blueOffset) / (255 * 2), (this._startColor.alphaOffset + this._endColor.alphaOffset) / (255 * 2));\n this._deltaOffsetData = new Vector3D((this._endColor.redOffset - this._startColor.redOffset) / (255 * 2), (this._endColor.greenOffset - this._startColor.greenOffset) / (255 * 2), (this._endColor.blueOffset - this._startColor.blueOffset) / (255 * 2), (this._endColor.alphaOffset - this._startColor.alphaOffset) / (255 * 2));\n }\n }\n else {\n if (this._usesMultiplier) {\n this._startMultiplierData = new Vector3D(this._startColor.redMultiplier, this._startColor.greenMultiplier, this._startColor.blueMultiplier, this._startColor.alphaMultiplier);\n this._deltaMultiplierData = new Vector3D((this._endColor.redMultiplier - this._startColor.redMultiplier), (this._endColor.greenMultiplier - this._startColor.greenMultiplier), (this._endColor.blueMultiplier - this._startColor.blueMultiplier), (this._endColor.alphaMultiplier - this._startColor.alphaMultiplier));\n }\n if (this._usesOffset) {\n this._startOffsetData = new Vector3D(this._startColor.redOffset / 255, this._startColor.greenOffset / 255, this._startColor.blueOffset / 255, this._startColor.alphaOffset / 255);\n this._deltaOffsetData = new Vector3D((this._endColor.redOffset - this._startColor.redOffset) / 255, (this._endColor.greenOffset - this._startColor.greenOffset) / 255, (this._endColor.blueOffset - this._startColor.blueOffset) / 255, (this._endColor.alphaOffset - this._startColor.alphaOffset) / 255);\n }\n }\n }\n };\n return ParticleColorState;\n}(ParticleStateBase));\nexport { ParticleColorState };\n/** @private */\nParticleColorState.START_MULTIPLIER_INDEX = 0;\n/** @private */\nParticleColorState.DELTA_MULTIPLIER_INDEX = 1;\n/** @private */\nParticleColorState.START_OFFSET_INDEX = 2;\n/** @private */\nParticleColorState.DELTA_OFFSET_INDEX = 3;\n/** @private */\nParticleColorState.CYCLE_INDEX = 4;\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/ParticleColorState.js","import * as tslib_1 from \"tslib\";\nimport { ContextGLVertexBufferFormat } from \"@awayjs/stage\";\nimport { ParticleStateBase } from \"./ParticleStateBase\";\n/**\n * ...\n */\nvar ParticleTimeState = (function (_super) {\n tslib_1.__extends(ParticleTimeState, _super);\n function ParticleTimeState(animator, particleTimeNode) {\n var _this = _super.call(this, animator, particleTimeNode, true) || this;\n _this._particleTimeNode = particleTimeNode;\n return _this;\n }\n ParticleTimeState.prototype.setRenderState = function (shader, renderable, animationElements, animationRegisterData, projection, stage) {\n animationElements.activateVertexBuffer(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleTimeState.TIME_STREAM_INDEX), this._particleTimeNode._iDataOffset, stage, ContextGLVertexBufferFormat.FLOAT_4);\n var particleTime = this._pTime / 1000;\n shader.setVertexConst(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleTimeState.TIME_CONSTANT_INDEX), particleTime, particleTime, particleTime, particleTime);\n };\n return ParticleTimeState;\n}(ParticleStateBase));\nexport { ParticleTimeState };\n/** @private */\nParticleTimeState.TIME_STREAM_INDEX = 0;\n/** @private */\nParticleTimeState.TIME_CONSTANT_INDEX = 1;\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/ParticleTimeState.js","import * as tslib_1 from \"tslib\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleTimeState } from \"../states/ParticleTimeState\";\nimport { ParticleNodeBase } from \"./ParticleNodeBase\";\n/**\n * A particle animation node used as the base node for timekeeping inside a particle. Automatically added to a particle animation set on instatiation.\n */\nvar ParticleTimeNode = (function (_super) {\n tslib_1.__extends(ParticleTimeNode, _super);\n /**\n * Creates a new ParticleTimeNode\n *\n * @param [optional] usesDuration Defines whether the node uses the duration data in the static properties to determine how long a particle is visible for. Defaults to false.\n * @param [optional] usesDelay Defines whether the node uses the delay data in the static properties to determine how long a particle is hidden for. Defaults to false. Requires usesDuration to be true.\n * @param [optional] usesLooping Defines whether the node creates a looping timeframe for each particle determined by the startTime, duration and delay data in the static properties function. Defaults to false. Requires usesLooping to be true.\n */\n function ParticleTimeNode(usesDuration, usesLooping, usesDelay) {\n if (usesDuration === void 0) { usesDuration = false; }\n if (usesLooping === void 0) { usesLooping = false; }\n if (usesDelay === void 0) { usesDelay = false; }\n var _this = _super.call(this, \"ParticleTime\", ParticlePropertiesMode.LOCAL_STATIC, 4, 0) || this;\n _this._pStateClass = ParticleTimeState;\n _this._iUsesDuration = usesDuration;\n _this._iUsesLooping = usesLooping;\n _this._iUsesDelay = usesDelay;\n return _this;\n }\n /**\n * @inheritDoc\n */\n ParticleTimeNode.prototype.getAGALVertexCode = function (shader, animationSet, registerCache, animationRegisterData) {\n var timeStreamRegister = registerCache.getFreeVertexAttribute(); //timeStreamRegister.x is start，timeStreamRegister.y is during time\n animationRegisterData.setRegisterIndex(this, ParticleTimeState.TIME_STREAM_INDEX, timeStreamRegister.index);\n var timeConst = registerCache.getFreeVertexConstant();\n animationRegisterData.setRegisterIndex(this, ParticleTimeState.TIME_CONSTANT_INDEX, timeConst.index);\n var code = \"\";\n code += \"sub \" + animationRegisterData.vertexTime + \",\" + timeConst + \",\" + timeStreamRegister + \".x\\n\";\n //if time=0,set the position to zero.\n var temp = registerCache.getFreeVertexSingleTemp();\n code += \"sge \" + temp + \",\" + animationRegisterData.vertexTime + \",\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"mul \" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + temp + \"\\n\";\n if (this._iUsesDuration) {\n if (this._iUsesLooping) {\n var div = registerCache.getFreeVertexSingleTemp();\n if (this._iUsesDelay) {\n code += \"div \" + div + \",\" + animationRegisterData.vertexTime + \",\" + timeStreamRegister + \".z\\n\";\n code += \"frc \" + div + \",\" + div + \"\\n\";\n code += \"mul \" + animationRegisterData.vertexTime + \",\" + div + \",\" + timeStreamRegister + \".z\\n\";\n code += \"slt \" + div + \",\" + animationRegisterData.vertexTime + \",\" + timeStreamRegister + \".y\\n\";\n code += \"mul \" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + div + \"\\n\";\n }\n else {\n code += \"mul \" + div + \",\" + animationRegisterData.vertexTime + \",\" + timeStreamRegister + \".w\\n\";\n code += \"frc \" + div + \",\" + div + \"\\n\";\n code += \"mul \" + animationRegisterData.vertexTime + \",\" + div + \",\" + timeStreamRegister + \".y\\n\";\n }\n }\n else {\n var sge = registerCache.getFreeVertexSingleTemp();\n code += \"sge \" + sge + \",\" + timeStreamRegister + \".y,\" + animationRegisterData.vertexTime + \"\\n\";\n code += \"mul \" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + sge + \"\\n\";\n }\n }\n code += \"mul \" + animationRegisterData.vertexLife + \",\" + animationRegisterData.vertexTime + \",\" + timeStreamRegister + \".w\\n\";\n return code;\n };\n /**\n * @inheritDoc\n */\n ParticleTimeNode.prototype.getAnimationState = function (animator) {\n return animator.getAnimationState(this);\n };\n /**\n * @inheritDoc\n */\n ParticleTimeNode.prototype._iGeneratePropertyOfOneParticle = function (param) {\n this._pOneData[0] = param.startTime;\n this._pOneData[1] = param.duration;\n this._pOneData[2] = param.delay + param.duration;\n this._pOneData[3] = 1 / param.duration;\n };\n return ParticleTimeNode;\n}(ParticleNodeBase));\nexport { ParticleTimeNode };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/ParticleTimeNode.js","import * as tslib_1 from \"tslib\";\nimport { AnimationRegisterData, AnimationSetBase } from \"@awayjs/stage\";\nimport { AnimationElements } from \"./data/AnimationElements\";\nimport { ParticleAnimationData } from \"./data/ParticleAnimationData\";\nimport { ParticleProperties } from \"./data/ParticleProperties\";\nimport { ParticlePropertiesMode } from \"./data/ParticlePropertiesMode\";\nimport { ParticleTimeNode } from \"./nodes/ParticleTimeNode\";\n/**\n * The animation data set used by particle-based animators, containing particle animation data.\n *\n * @see away.animators.ParticleAnimator\n */\nvar ParticleAnimationSet = (function (_super) {\n tslib_1.__extends(ParticleAnimationSet, _super);\n /**\n * Creates a new ParticleAnimationSet\n *\n * @param [optional] usesDuration Defines whether the animation set uses the duration data in its static properties to determine how long a particle is visible for. Defaults to false.\n * @param [optional] usesLooping Defines whether the animation set uses a looping timeframe for each particle determined by the startTime, duration and delay data in its static properties function. Defaults to false. Requires usesDuration to be true.\n * @param [optional] usesDelay Defines whether the animation set uses the delay data in its static properties to determine how long a particle is hidden for. Defaults to false. Requires usesLooping to be true.\n */\n function ParticleAnimationSet(usesDuration, usesLooping, usesDelay) {\n if (usesDuration === void 0) { usesDuration = false; }\n if (usesLooping === void 0) { usesLooping = false; }\n if (usesDelay === void 0) { usesDelay = false; }\n var _this = _super.call(this) || this;\n _this._animationElements = new Object();\n _this._particleNodes = new Array();\n _this._localDynamicNodes = new Array();\n _this._localStaticNodes = new Array();\n _this._totalLenOfOneVertex = 0;\n /**\n *\n */\n _this.shareAnimationGraphics = true;\n //automatically add a particle time node to the set\n _this.addAnimation(_this._timeNode = new ParticleTimeNode(usesDuration, usesLooping, usesDelay));\n return _this;\n }\n Object.defineProperty(ParticleAnimationSet.prototype, \"particleNodes\", {\n /**\n * Returns a vector of the particle animation nodes contained within the set.\n */\n get: function () {\n return this._particleNodes;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * @inheritDoc\n */\n ParticleAnimationSet.prototype.addAnimation = function (node) {\n var i;\n var n = node;\n n._iProcessAnimationSetting(this);\n if (n.mode == ParticlePropertiesMode.LOCAL_STATIC) {\n n._iDataOffset = this._totalLenOfOneVertex;\n this._totalLenOfOneVertex += n.dataLength;\n this._localStaticNodes.push(n);\n }\n else if (n.mode == ParticlePropertiesMode.LOCAL_DYNAMIC)\n this._localDynamicNodes.push(n);\n for (i = this._particleNodes.length - 1; i >= 0; i--) {\n if (this._particleNodes[i].priority <= n.priority)\n break;\n }\n this._particleNodes.splice(i + 1, 0, n);\n _super.prototype.addAnimation.call(this, node);\n };\n /**\n * @inheritDoc\n */\n ParticleAnimationSet.prototype.getAGALVertexCode = function (shader, registerCache, sharedRegisters) {\n //grab animationRegisterData from the materialpassbase or create a new one if the first time\n this._iAnimationRegisterData = shader.animationRegisterData;\n if (this._iAnimationRegisterData == null)\n this._iAnimationRegisterData = shader.animationRegisterData = new AnimationRegisterData();\n //reset animationRegisterData\n this._iAnimationRegisterData.reset(registerCache, sharedRegisters, this.needVelocity);\n var code = \"\";\n var len = sharedRegisters.animatableAttributes.length;\n for (var i = 0; i < len; i++)\n code += \"mov \" + sharedRegisters.animationTargetRegisters[i] + \",\" + sharedRegisters.animatableAttributes[i] + \"\\n\";\n code += \"mov \" + this._iAnimationRegisterData.positionTarget + \".xyz,\" + this._iAnimationRegisterData.vertexZeroConst + \"\\n\";\n if (this.needVelocity)\n code += \"mov \" + this._iAnimationRegisterData.velocityTarget + \".xyz,\" + this._iAnimationRegisterData.vertexZeroConst + \"\\n\";\n var node;\n var i;\n for (i = 0; i < this._particleNodes.length; i++) {\n node = this._particleNodes[i];\n if (node.priority < ParticleAnimationSet.POST_PRIORITY)\n code += node.getAGALVertexCode(shader, this, registerCache, this._iAnimationRegisterData);\n }\n code += \"add \" + this._iAnimationRegisterData.scaleAndRotateTarget + \".xyz,\" + this._iAnimationRegisterData.scaleAndRotateTarget + \".xyz,\" + this._iAnimationRegisterData.positionTarget + \".xyz\\n\";\n for (i = 0; i < this._particleNodes.length; i++) {\n node = this._particleNodes[i];\n if (node.priority >= ParticleAnimationSet.POST_PRIORITY && node.priority < ParticleAnimationSet.COLOR_PRIORITY)\n code += node.getAGALVertexCode(shader, this, registerCache, this._iAnimationRegisterData);\n }\n if (this.hasColorMulNode) {\n this._iAnimationRegisterData.colorMulTarget = registerCache.getFreeVertexVectorTemp();\n registerCache.addVertexTempUsages(this._iAnimationRegisterData.colorMulTarget, 1);\n this._iAnimationRegisterData.colorMulVary = registerCache.getFreeVarying();\n code += \"mov \" + this._iAnimationRegisterData.colorMulTarget + \",\" + this._iAnimationRegisterData.vertexOneConst + \"\\n\";\n }\n if (this.hasColorAddNode) {\n this._iAnimationRegisterData.colorAddTarget = registerCache.getFreeVertexVectorTemp();\n registerCache.addVertexTempUsages(this._iAnimationRegisterData.colorAddTarget, 1);\n this._iAnimationRegisterData.colorAddVary = registerCache.getFreeVarying();\n code += \"mov \" + this._iAnimationRegisterData.colorAddTarget + \",\" + this._iAnimationRegisterData.vertexZeroConst + \"\\n\";\n }\n for (i = 0; i < this._particleNodes.length; i++) {\n node = this._particleNodes[i];\n if (node.priority >= ParticleAnimationSet.COLOR_PRIORITY)\n code += node.getAGALVertexCode(shader, this, registerCache, this._iAnimationRegisterData);\n }\n if (shader.usesFragmentAnimation && (this.hasColorAddNode || this.hasColorMulNode)) {\n if (this.hasColorMulNode)\n code += \"mov \" + this._iAnimationRegisterData.colorMulVary + \",\" + this._iAnimationRegisterData.colorMulTarget + \"\\n\";\n if (this.hasColorAddNode)\n code += \"mov \" + this._iAnimationRegisterData.colorAddVary + \",\" + this._iAnimationRegisterData.colorAddTarget + \"\\n\";\n }\n return code;\n };\n /**\n * @inheritDoc\n */\n ParticleAnimationSet.prototype.getAGALUVCode = function (shader, registerCache, sharedRegisters) {\n var code = \"\";\n if (this.hasUVNode) {\n this._iAnimationRegisterData.setUVSourceAndTarget(sharedRegisters);\n code += \"mov \" + this._iAnimationRegisterData.uvTarget + \".xy,\" + this._iAnimationRegisterData.uvAttribute.toString() + \"\\n\";\n var node;\n for (var i = 0; i < this._particleNodes.length; i++)\n node = this._particleNodes[i];\n code += node.getAGALUVCode(shader, this, registerCache, this._iAnimationRegisterData);\n code += \"mov \" + this._iAnimationRegisterData.uvVar + \",\" + this._iAnimationRegisterData.uvTarget + \".xy\\n\";\n }\n else\n code += \"mov \" + sharedRegisters.uvTarget + \",\" + sharedRegisters.uvSource + \"\\n\";\n return code;\n };\n /**\n * @inheritDoc\n */\n ParticleAnimationSet.prototype.getAGALFragmentCode = function (shader, registerCache, shadedTarget) {\n var code = \"\";\n if (shader.usesFragmentAnimation && (this.hasColorAddNode || this.hasColorMulNode)) {\n if (this.hasColorMulNode)\n code += \"mul \" + shadedTarget + \",\" + shadedTarget + \",\" + this._iAnimationRegisterData.colorMulVary + \"\\n\";\n if (this.hasColorAddNode)\n code += \"add \" + shadedTarget + \",\" + shadedTarget + \",\" + this._iAnimationRegisterData.colorAddVary + \"\\n\";\n }\n return code;\n };\n /**\n * @inheritDoc\n */\n ParticleAnimationSet.prototype.doneAGALCode = function (shader) {\n //set vertexZeroConst,vertexOneConst,vertexTwoConst\n shader.setVertexConst(this._iAnimationRegisterData.vertexZeroConst.index, 0, 1, 2, 0);\n };\n Object.defineProperty(ParticleAnimationSet.prototype, \"usesCPU\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return false;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * @inheritDoc\n */\n ParticleAnimationSet.prototype.cancelGPUCompatibility = function () {\n };\n ParticleAnimationSet.prototype.dispose = function () {\n for (var key in this._animationElements)\n this._animationElements[key].dispose();\n _super.prototype.dispose.call(this);\n };\n ParticleAnimationSet.prototype.getAnimationElements = function (graphics, shape) {\n var animationElements = (this.shareAnimationGraphics) ? this._animationElements[shape.elements.id] : this._animationElements[shape.id];\n if (animationElements)\n return animationElements;\n this._iGenerateAnimationElements(graphics);\n return (this.shareAnimationGraphics) ? this._animationElements[shape.elements.id] : this._animationElements[shape.id];\n };\n /** @private */\n ParticleAnimationSet.prototype._iGenerateAnimationElements = function (graphics) {\n if (this.initParticleFunc == null)\n throw (new Error(\"no initParticleFunc set\"));\n var i, j, k;\n var animationElements;\n var newAnimationElements = false;\n var elements;\n var shape;\n var localNode;\n for (i = 0; i < graphics.count; i++) {\n shape = graphics.getShapeAt(i);\n elements = shape.elements;\n if (this.shareAnimationGraphics) {\n animationElements = this._animationElements[elements.id];\n if (animationElements)\n continue;\n }\n animationElements = new AnimationElements();\n if (this.shareAnimationGraphics)\n this._animationElements[elements.id] = animationElements;\n else\n this._animationElements[shape.id] = animationElements;\n newAnimationElements = true;\n //create the vertexData vector that will be used for local node data\n animationElements.createVertexData(elements.numVertices, this._totalLenOfOneVertex);\n }\n if (!newAnimationElements)\n return;\n var particles = graphics.particles;\n var particlesLength = particles.length;\n var numParticles = graphics.numParticles;\n var particleProperties = new ParticleProperties();\n var particle;\n var oneDataLen;\n var oneDataOffset;\n var counterForVertex;\n var counterForOneData;\n var oneData;\n var numVertices;\n var vertexData;\n var vertexLength;\n var startingOffset;\n var vertexOffset;\n //default values for particle param\n particleProperties.total = numParticles;\n particleProperties.startTime = 0;\n particleProperties.duration = 1000;\n particleProperties.delay = 0.1;\n i = 0;\n j = 0;\n while (i < numParticles) {\n particleProperties.index = i;\n //call the init on the particle parameters\n this.initParticleFunc.call(this.initParticleScope, particleProperties);\n //create the next set of node properties for the particle\n for (k = 0; k < this._localStaticNodes.length; k++)\n this._localStaticNodes[k]._iGeneratePropertyOfOneParticle(particleProperties);\n //loop through all particle data for the curent particle\n while (j < particlesLength && (particle = particles[j]).particleIndex == i) {\n //find the target animationElements\n for (k = 0; k < graphics.count; k++) {\n shape = graphics.getShapeAt(k);\n if (shape.elements == particle.elements) {\n animationElements = (this.shareAnimationGraphics) ? this._animationElements[shape.elements.id] : this._animationElements[shape.id];\n break;\n }\n }\n numVertices = particle.numVertices;\n vertexData = animationElements.vertexData;\n vertexLength = numVertices * this._totalLenOfOneVertex;\n startingOffset = animationElements.numProcessedVertices * this._totalLenOfOneVertex;\n //loop through each static local node in the animation set\n for (k = 0; k < this._localStaticNodes.length; k++) {\n localNode = this._localStaticNodes[k];\n oneData = localNode.oneData;\n oneDataLen = localNode.dataLength;\n oneDataOffset = startingOffset + localNode._iDataOffset;\n //loop through each vertex set in the vertex data\n for (counterForVertex = 0; counterForVertex < vertexLength; counterForVertex += this._totalLenOfOneVertex) {\n vertexOffset = oneDataOffset + counterForVertex;\n //add the data for the local node to the vertex data\n for (counterForOneData = 0; counterForOneData < oneDataLen; counterForOneData++)\n vertexData[vertexOffset + counterForOneData] = oneData[counterForOneData];\n }\n }\n //store particle properties if they need to be retreived for dynamic local nodes\n if (this._localDynamicNodes.length)\n animationElements.animationParticles.push(new ParticleAnimationData(i, particleProperties.startTime, particleProperties.duration, particleProperties.delay, particle));\n animationElements.numProcessedVertices += numVertices;\n //next index\n j++;\n }\n //next particle\n i++;\n }\n };\n return ParticleAnimationSet;\n}(AnimationSetBase));\nexport { ParticleAnimationSet };\n/**\n * Property used by particle nodes that require compilers at the end of the shader\n */\nParticleAnimationSet.POST_PRIORITY = 9;\n/**\n * Property used by particle nodes that require color compilers\n */\nParticleAnimationSet.COLOR_PRIORITY = 18;\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/ParticleAnimationSet.js","import * as tslib_1 from \"tslib\";\nimport { ColorTransform } from \"@awayjs/core\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleColorState } from \"../states/ParticleColorState\";\nimport { ParticleAnimationSet } from \"../ParticleAnimationSet\";\nimport { ParticleNodeBase } from \"./ParticleNodeBase\";\n/**\n * A particle animation node used to control the color variation of a particle over time.\n */\nvar ParticleColorNode = (function (_super) {\n tslib_1.__extends(ParticleColorNode, _super);\n /**\n * Creates a new ParticleColorNode\n *\n * @param mode Defines whether the mode of operation acts on local properties of a particle or global properties of the node.\n * @param [optional] usesMultiplier Defines whether the node uses multiplier data in the shader for its color transformations. Defaults to true.\n * @param [optional] usesOffset Defines whether the node uses offset data in the shader for its color transformations. Defaults to true.\n * @param [optional] usesCycle Defines whether the node uses the cycleDuration property in the shader to calculate the period of the animation independent of particle duration. Defaults to false.\n * @param [optional] usesPhase Defines whether the node uses the cyclePhase property in the shader to calculate a starting offset to the cycle rotation of the particle. Defaults to false.\n * @param [optional] startColor Defines the default start color transform of the node, when in global mode.\n * @param [optional] endColor Defines the default end color transform of the node, when in global mode.\n * @param [optional] cycleDuration Defines the duration of the animation in seconds, used as a period independent of particle duration when in global mode. Defaults to 1.\n * @param [optional] cyclePhase Defines the phase of the cycle in degrees, used as the starting offset of the cycle when in global mode. Defaults to 0.\n */\n function ParticleColorNode(mode, usesMultiplier, usesOffset, usesCycle, usesPhase, startColor, endColor, cycleDuration, cyclePhase) {\n if (usesMultiplier === void 0) { usesMultiplier = true; }\n if (usesOffset === void 0) { usesOffset = true; }\n if (usesCycle === void 0) { usesCycle = false; }\n if (usesPhase === void 0) { usesPhase = false; }\n if (startColor === void 0) { startColor = null; }\n if (endColor === void 0) { endColor = null; }\n if (cycleDuration === void 0) { cycleDuration = 1; }\n if (cyclePhase === void 0) { cyclePhase = 0; }\n var _this = _super.call(this, \"ParticleColor\", mode, (usesMultiplier && usesOffset) ? 16 : 8, ParticleAnimationSet.COLOR_PRIORITY) || this;\n _this._pStateClass = ParticleColorState;\n _this._iUsesMultiplier = usesMultiplier;\n _this._iUsesOffset = usesOffset;\n _this._iUsesCycle = usesCycle;\n _this._iUsesPhase = usesPhase;\n _this._iStartColor = startColor || new ColorTransform();\n _this._iEndColor = endColor || new ColorTransform();\n _this._iCycleDuration = cycleDuration;\n _this._iCyclePhase = cyclePhase;\n return _this;\n }\n /**\n * @inheritDoc\n */\n ParticleColorNode.prototype.getAGALVertexCode = function (shader, animationSet, registerCache, animationRegisterData) {\n var code = \"\";\n if (shader.usesFragmentAnimation) {\n var temp = registerCache.getFreeVertexVectorTemp();\n if (this._iUsesCycle) {\n var cycleConst = registerCache.getFreeVertexConstant();\n animationRegisterData.setRegisterIndex(this, ParticleColorState.CYCLE_INDEX, cycleConst.index);\n registerCache.addVertexTempUsages(temp, 1);\n var sin = registerCache.getFreeVertexSingleTemp();\n registerCache.removeVertexTempUsage(temp);\n code += \"mul \" + sin + \",\" + animationRegisterData.vertexTime + \",\" + cycleConst + \".x\\n\";\n if (this._iUsesPhase)\n code += \"add \" + sin + \",\" + sin + \",\" + cycleConst + \".y\\n\";\n code += \"sin \" + sin + \",\" + sin + \"\\n\";\n }\n if (this._iUsesMultiplier) {\n var startMultiplierValue = (this._pMode == ParticlePropertiesMode.GLOBAL) ? registerCache.getFreeVertexConstant() : registerCache.getFreeVertexAttribute();\n var deltaMultiplierValue = (this._pMode == ParticlePropertiesMode.GLOBAL) ? registerCache.getFreeVertexConstant() : registerCache.getFreeVertexAttribute();\n animationRegisterData.setRegisterIndex(this, ParticleColorState.START_MULTIPLIER_INDEX, startMultiplierValue.index);\n animationRegisterData.setRegisterIndex(this, ParticleColorState.DELTA_MULTIPLIER_INDEX, deltaMultiplierValue.index);\n code += \"mul \" + temp + \",\" + deltaMultiplierValue + \",\" + (this._iUsesCycle ? sin : animationRegisterData.vertexLife) + \"\\n\";\n code += \"add \" + temp + \",\" + temp + \",\" + startMultiplierValue + \"\\n\";\n code += \"mul \" + animationRegisterData.colorMulTarget + \",\" + temp + \",\" + animationRegisterData.colorMulTarget + \"\\n\";\n }\n if (this._iUsesOffset) {\n var startOffsetValue = (this._pMode == ParticlePropertiesMode.LOCAL_STATIC) ? registerCache.getFreeVertexAttribute() : registerCache.getFreeVertexConstant();\n var deltaOffsetValue = (this._pMode == ParticlePropertiesMode.LOCAL_STATIC) ? registerCache.getFreeVertexAttribute() : registerCache.getFreeVertexConstant();\n animationRegisterData.setRegisterIndex(this, ParticleColorState.START_OFFSET_INDEX, startOffsetValue.index);\n animationRegisterData.setRegisterIndex(this, ParticleColorState.DELTA_OFFSET_INDEX, deltaOffsetValue.index);\n code += \"mul \" + temp + \",\" + deltaOffsetValue + \",\" + (this._iUsesCycle ? sin : animationRegisterData.vertexLife) + \"\\n\";\n code += \"add \" + temp + \",\" + temp + \",\" + startOffsetValue + \"\\n\";\n code += \"add \" + animationRegisterData.colorAddTarget + \",\" + temp + \",\" + animationRegisterData.colorAddTarget + \"\\n\";\n }\n }\n return code;\n };\n /**\n * @inheritDoc\n */\n ParticleColorNode.prototype.getAnimationState = function (animator) {\n return animator.getAnimationState(this);\n };\n /**\n * @inheritDoc\n */\n ParticleColorNode.prototype._iProcessAnimationSetting = function (particleAnimationSet) {\n if (this._iUsesMultiplier)\n particleAnimationSet.hasColorMulNode = true;\n if (this._iUsesOffset)\n particleAnimationSet.hasColorAddNode = true;\n };\n /**\n * @inheritDoc\n */\n ParticleColorNode.prototype._iGeneratePropertyOfOneParticle = function (param) {\n var startColor = param[ParticleColorNode.COLOR_START_COLORTRANSFORM];\n if (!startColor)\n throw (new Error(\"there is no \" + ParticleColorNode.COLOR_START_COLORTRANSFORM + \" in param!\"));\n var endColor = param[ParticleColorNode.COLOR_END_COLORTRANSFORM];\n if (!endColor)\n throw (new Error(\"there is no \" + ParticleColorNode.COLOR_END_COLORTRANSFORM + \" in param!\"));\n var i = 0;\n if (!this._iUsesCycle) {\n //multiplier\n if (this._iUsesMultiplier) {\n this._pOneData[i++] = startColor.redMultiplier;\n this._pOneData[i++] = startColor.greenMultiplier;\n this._pOneData[i++] = startColor.blueMultiplier;\n this._pOneData[i++] = startColor.alphaMultiplier;\n this._pOneData[i++] = endColor.redMultiplier - startColor.redMultiplier;\n this._pOneData[i++] = endColor.greenMultiplier - startColor.greenMultiplier;\n this._pOneData[i++] = endColor.blueMultiplier - startColor.blueMultiplier;\n this._pOneData[i++] = endColor.alphaMultiplier - startColor.alphaMultiplier;\n }\n //offset\n if (this._iUsesOffset) {\n this._pOneData[i++] = startColor.redOffset / 255;\n this._pOneData[i++] = startColor.greenOffset / 255;\n this._pOneData[i++] = startColor.blueOffset / 255;\n this._pOneData[i++] = startColor.alphaOffset / 255;\n this._pOneData[i++] = (endColor.redOffset - startColor.redOffset) / 255;\n this._pOneData[i++] = (endColor.greenOffset - startColor.greenOffset) / 255;\n this._pOneData[i++] = (endColor.blueOffset - startColor.blueOffset) / 255;\n this._pOneData[i++] = (endColor.alphaOffset - startColor.alphaOffset) / 255;\n }\n }\n else {\n //multiplier\n if (this._iUsesMultiplier) {\n this._pOneData[i++] = (startColor.redMultiplier + endColor.redMultiplier) / 2;\n this._pOneData[i++] = (startColor.greenMultiplier + endColor.greenMultiplier) / 2;\n this._pOneData[i++] = (startColor.blueMultiplier + endColor.blueMultiplier) / 2;\n this._pOneData[i++] = (startColor.alphaMultiplier + endColor.alphaMultiplier) / 2;\n this._pOneData[i++] = (startColor.redMultiplier - endColor.redMultiplier) / 2;\n this._pOneData[i++] = (startColor.greenMultiplier - endColor.greenMultiplier) / 2;\n this._pOneData[i++] = (startColor.blueMultiplier - endColor.blueMultiplier) / 2;\n this._pOneData[i++] = (startColor.alphaMultiplier - endColor.alphaMultiplier) / 2;\n }\n //offset\n if (this._iUsesOffset) {\n this._pOneData[i++] = (startColor.redOffset + endColor.redOffset) / (255 * 2);\n this._pOneData[i++] = (startColor.greenOffset + endColor.greenOffset) / (255 * 2);\n this._pOneData[i++] = (startColor.blueOffset + endColor.blueOffset) / (255 * 2);\n this._pOneData[i++] = (startColor.alphaOffset + endColor.alphaOffset) / (255 * 2);\n this._pOneData[i++] = (startColor.redOffset - endColor.redOffset) / (255 * 2);\n this._pOneData[i++] = (startColor.greenOffset - endColor.greenOffset) / (255 * 2);\n this._pOneData[i++] = (startColor.blueOffset - endColor.blueOffset) / (255 * 2);\n this._pOneData[i++] = (startColor.alphaOffset - endColor.alphaOffset) / (255 * 2);\n }\n }\n };\n return ParticleColorNode;\n}(ParticleNodeBase));\nexport { ParticleColorNode };\n/**\n * Reference for color node properties on a single particle (when in local property mode).\n * Expects a ColorTransform object representing the start color transform applied to the particle.\n */\nParticleColorNode.COLOR_START_COLORTRANSFORM = \"ColorStartColorTransform\";\n/**\n * Reference for color node properties on a single particle (when in local property mode).\n * Expects a ColorTransform object representing the end color transform applied to the particle.\n */\nParticleColorNode.COLOR_END_COLORTRANSFORM = \"ColorEndColorTransform\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/ParticleColorNode.js","import * as tslib_1 from \"tslib\";\nimport { Vector3D, MathConsts } from \"@awayjs/core\";\nimport { ContextGLVertexBufferFormat } from \"@awayjs/stage\";\nimport { ParticleStateBase } from \"./ParticleStateBase\";\n/**\n * ...\n */\nvar ParticleFollowState = (function (_super) {\n tslib_1.__extends(ParticleFollowState, _super);\n function ParticleFollowState(animator, particleFollowNode) {\n var _this = _super.call(this, animator, particleFollowNode, true) || this;\n _this._targetPos = new Vector3D();\n _this._targetEuler = new Vector3D();\n //temporary vector3D for calculation\n _this._temp = new Vector3D();\n _this._particleFollowNode = particleFollowNode;\n _this._smooth = particleFollowNode._iSmooth;\n return _this;\n }\n Object.defineProperty(ParticleFollowState.prototype, \"followTarget\", {\n get: function () {\n return this._followTarget;\n },\n set: function (value) {\n this._followTarget = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleFollowState.prototype, \"smooth\", {\n get: function () {\n return this._smooth;\n },\n set: function (value) {\n this._smooth = value;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * @inheritDoc\n */\n ParticleFollowState.prototype.setRenderState = function (shader, renderable, animationElements, animationRegisterData, projection, stage) {\n if (this._followTarget) {\n if (this._particleFollowNode._iUsesPosition) {\n this._targetPos.x = this._followTarget.transform.position.x / renderable.sourceEntity.transform.scale.x;\n this._targetPos.y = this._followTarget.transform.position.y / renderable.sourceEntity.transform.scale.y;\n this._targetPos.z = this._followTarget.transform.position.z / renderable.sourceEntity.transform.scale.z;\n }\n if (this._particleFollowNode._iUsesRotation) {\n this._targetEuler.x = this._followTarget.rotationX;\n this._targetEuler.y = this._followTarget.rotationY;\n this._targetEuler.z = this._followTarget.rotationZ;\n this._targetEuler.scaleBy(MathConsts.DEGREES_TO_RADIANS);\n }\n }\n //initialization\n if (!this._prePos)\n this._prePos = this._targetPos.clone();\n if (!this._preEuler)\n this._preEuler = this._targetEuler.clone();\n var currentTime = this._pTime / 1000;\n var previousTime = animationElements.previousTime;\n var deltaTime = currentTime - previousTime;\n var needProcess = previousTime != currentTime;\n if (this._particleFollowNode._iUsesPosition && this._particleFollowNode._iUsesRotation) {\n if (needProcess)\n this.processPositionAndRotation(currentTime, deltaTime, animationElements);\n animationElements.activateVertexBuffer(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleFollowState.FOLLOW_POSITION_INDEX), this._particleFollowNode._iDataOffset, stage, ContextGLVertexBufferFormat.FLOAT_3);\n animationElements.activateVertexBuffer(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleFollowState.FOLLOW_ROTATION_INDEX), this._particleFollowNode._iDataOffset + 3, stage, ContextGLVertexBufferFormat.FLOAT_3);\n }\n else if (this._particleFollowNode._iUsesPosition) {\n if (needProcess)\n this.processPosition(currentTime, deltaTime, animationElements);\n animationElements.activateVertexBuffer(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleFollowState.FOLLOW_POSITION_INDEX), this._particleFollowNode._iDataOffset, stage, ContextGLVertexBufferFormat.FLOAT_3);\n }\n else if (this._particleFollowNode._iUsesRotation) {\n if (needProcess)\n this.precessRotation(currentTime, deltaTime, animationElements);\n animationElements.activateVertexBuffer(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleFollowState.FOLLOW_ROTATION_INDEX), this._particleFollowNode._iDataOffset, stage, ContextGLVertexBufferFormat.FLOAT_3);\n }\n this._prePos.copyFrom(this._targetPos);\n this._targetEuler.copyFrom(this._targetEuler);\n animationElements.previousTime = currentTime;\n };\n ParticleFollowState.prototype.processPosition = function (currentTime, deltaTime, animationElements) {\n var data = animationElements.animationParticles;\n var vertexData = animationElements.vertexData;\n var changed = false;\n var len = data.length;\n var interpolatedPos;\n var posVelocity;\n if (this._smooth) {\n posVelocity = this._prePos.subtract(this._targetPos);\n posVelocity.scaleBy(1 / deltaTime);\n }\n else\n interpolatedPos = this._targetPos;\n for (var i = 0; i < len; i++) {\n var k = (currentTime - data[i].startTime) / data[i].totalTime;\n var t = (k - Math.floor(k)) * data[i].totalTime;\n if (t - deltaTime <= 0) {\n var inc = data[i].startVertexIndex * animationElements.totalLenOfOneVertex + this._particleFollowNode._iDataOffset;\n if (this._smooth) {\n this._temp.copyFrom(posVelocity);\n this._temp.scaleBy(t);\n interpolatedPos = this._targetPos.add(this._temp);\n }\n if (vertexData[inc] != interpolatedPos.x || vertexData[inc + 1] != interpolatedPos.y || vertexData[inc + 2] != interpolatedPos.z) {\n changed = true;\n for (var j = 0; j < data[i].numVertices; j++) {\n vertexData[inc++] = interpolatedPos.x;\n vertexData[inc++] = interpolatedPos.y;\n vertexData[inc++] = interpolatedPos.z;\n }\n }\n }\n }\n if (changed)\n animationElements.invalidateBuffer();\n };\n ParticleFollowState.prototype.precessRotation = function (currentTime, deltaTime, animationElements) {\n var data = animationElements.animationParticles;\n var vertexData = animationElements.vertexData;\n var changed = false;\n var len = data.length;\n var interpolatedRotation;\n var rotationVelocity;\n if (this._smooth) {\n rotationVelocity = this._preEuler.subtract(this._targetEuler);\n rotationVelocity.scaleBy(1 / deltaTime);\n }\n else\n interpolatedRotation = this._targetEuler;\n for (var i = 0; i < len; i++) {\n var k = (currentTime - data[i].startTime) / data[i].totalTime;\n var t = (k - Math.floor(k)) * data[i].totalTime;\n if (t - deltaTime <= 0) {\n var inc = data[i].startVertexIndex * animationElements.totalLenOfOneVertex + this._particleFollowNode._iDataOffset;\n if (this._smooth) {\n this._temp.copyFrom(rotationVelocity);\n this._temp.scaleBy(t);\n interpolatedRotation = this._targetEuler.add(this._temp);\n }\n if (vertexData[inc] != interpolatedRotation.x || vertexData[inc + 1] != interpolatedRotation.y || vertexData[inc + 2] != interpolatedRotation.z) {\n changed = true;\n for (var j = 0; j < data[i].numVertices; j++) {\n vertexData[inc++] = interpolatedRotation.x;\n vertexData[inc++] = interpolatedRotation.y;\n vertexData[inc++] = interpolatedRotation.z;\n }\n }\n }\n }\n if (changed)\n animationElements.invalidateBuffer();\n };\n ParticleFollowState.prototype.processPositionAndRotation = function (currentTime, deltaTime, animationElements) {\n var data = animationElements.animationParticles;\n var vertexData = animationElements.vertexData;\n var changed = false;\n var len = data.length;\n var interpolatedPos;\n var interpolatedRotation;\n var posVelocity;\n var rotationVelocity;\n if (this._smooth) {\n posVelocity = this._prePos.subtract(this._targetPos);\n posVelocity.scaleBy(1 / deltaTime);\n rotationVelocity = this._preEuler.subtract(this._targetEuler);\n rotationVelocity.scaleBy(1 / deltaTime);\n }\n else {\n interpolatedPos = this._targetPos;\n interpolatedRotation = this._targetEuler;\n }\n for (var i = 0; i < len; i++) {\n var k = (currentTime - data[i].startTime) / data[i].totalTime;\n var t = (k - Math.floor(k)) * data[i].totalTime;\n if (t - deltaTime <= 0) {\n var inc = data[i].startVertexIndex * animationElements.totalLenOfOneVertex + this._particleFollowNode._iDataOffset;\n if (this._smooth) {\n this._temp.copyFrom(posVelocity);\n this._temp.scaleBy(t);\n interpolatedPos = this._targetPos.add(this._temp);\n this._temp.copyFrom(rotationVelocity);\n this._temp.scaleBy(t);\n interpolatedRotation = this._targetEuler.add(this._temp);\n }\n if (vertexData[inc] != interpolatedPos.x || vertexData[inc + 1] != interpolatedPos.y || vertexData[inc + 2] != interpolatedPos.z || vertexData[inc + 3] != interpolatedRotation.x || vertexData[inc + 4] != interpolatedRotation.y || vertexData[inc + 5] != interpolatedRotation.z) {\n changed = true;\n for (var j = 0; j < data[i].numVertices; j++) {\n vertexData[inc++] = interpolatedPos.x;\n vertexData[inc++] = interpolatedPos.y;\n vertexData[inc++] = interpolatedPos.z;\n vertexData[inc++] = interpolatedRotation.x;\n vertexData[inc++] = interpolatedRotation.y;\n vertexData[inc++] = interpolatedRotation.z;\n }\n }\n }\n }\n if (changed)\n animationElements.invalidateBuffer();\n };\n return ParticleFollowState;\n}(ParticleStateBase));\nexport { ParticleFollowState };\n/** @private */\nParticleFollowState.FOLLOW_POSITION_INDEX = 0;\n/** @private */\nParticleFollowState.FOLLOW_ROTATION_INDEX = 1;\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/ParticleFollowState.js","import * as tslib_1 from \"tslib\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleFollowState } from \"../states/ParticleFollowState\";\nimport { ParticleAnimationSet } from \"../ParticleAnimationSet\";\nimport { ParticleNodeBase } from \"./ParticleNodeBase\";\n/**\n * A particle animation node used to create a follow behaviour on a particle system.\n */\nvar ParticleFollowNode = (function (_super) {\n tslib_1.__extends(ParticleFollowNode, _super);\n /**\n * Creates a new ParticleFollowNode\n *\n * @param [optional] usesPosition Defines wehether the individual particle reacts to the position of the target.\n * @param [optional] usesRotation Defines wehether the individual particle reacts to the rotation of the target.\n * @param [optional] smooth Defines wehether the state calculate the interpolated value.\n */\n function ParticleFollowNode(usesPosition, usesRotation, smooth) {\n if (usesPosition === void 0) { usesPosition = true; }\n if (usesRotation === void 0) { usesRotation = true; }\n if (smooth === void 0) { smooth = false; }\n var _this = _super.call(this, \"ParticleFollow\", ParticlePropertiesMode.LOCAL_DYNAMIC, (usesPosition && usesRotation) ? 6 : 3, ParticleAnimationSet.POST_PRIORITY) || this;\n _this._pStateClass = ParticleFollowState;\n _this._iUsesPosition = usesPosition;\n _this._iUsesRotation = usesRotation;\n _this._iSmooth = smooth;\n return _this;\n }\n /**\n * @inheritDoc\n */\n ParticleFollowNode.prototype.getAGALVertexCode = function (shader, animationSet, registerCache, animationRegisterData) {\n //TODO: use Quaternion to implement this function\n var code = \"\";\n if (this._iUsesRotation) {\n var rotationAttribute = registerCache.getFreeVertexAttribute();\n animationRegisterData.setRegisterIndex(this, ParticleFollowState.FOLLOW_ROTATION_INDEX, rotationAttribute.index);\n var temp1 = registerCache.getFreeVertexVectorTemp();\n registerCache.addVertexTempUsages(temp1, 1);\n var temp2 = registerCache.getFreeVertexVectorTemp();\n registerCache.addVertexTempUsages(temp2, 1);\n var temp3 = registerCache.getFreeVertexVectorTemp();\n var temp4;\n if (animationSet.hasBillboard) {\n registerCache.addVertexTempUsages(temp3, 1);\n temp4 = registerCache.getFreeVertexVectorTemp();\n }\n registerCache.removeVertexTempUsage(temp1);\n registerCache.removeVertexTempUsage(temp2);\n if (animationSet.hasBillboard)\n registerCache.removeVertexTempUsage(temp3);\n var len = animationRegisterData.rotationRegisters.length;\n var i;\n //x axis\n code += \"mov \" + temp1 + \",\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"mov \" + temp1 + \".x,\" + animationRegisterData.vertexOneConst + \"\\n\";\n code += \"mov \" + temp3 + \",\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"sin \" + temp3 + \".y,\" + rotationAttribute + \".x\\n\";\n code += \"cos \" + temp3 + \".z,\" + rotationAttribute + \".x\\n\";\n code += \"mov \" + temp2 + \".x,\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"mov \" + temp2 + \".y,\" + temp3 + \".z\\n\";\n code += \"neg \" + temp2 + \".z,\" + temp3 + \".y\\n\";\n if (animationSet.hasBillboard)\n code += \"m33 \" + temp4 + \".xyz,\" + animationRegisterData.positionTarget + \".xyz,\" + temp1 + \"\\n\";\n else {\n code += \"m33 \" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + temp1 + \"\\n\";\n for (i = 0; i < len; i++)\n code += \"m33 \" + animationRegisterData.rotationRegisters[i] + \".xyz,\" + animationRegisterData.rotationRegisters[i] + \",\" + temp1 + \"\\n\";\n }\n //y axis\n code += \"mov \" + temp1 + \",\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"cos \" + temp1 + \".x,\" + rotationAttribute + \".y\\n\";\n code += \"sin \" + temp1 + \".z,\" + rotationAttribute + \".y\\n\";\n code += \"mov \" + temp2 + \",\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"mov \" + temp2 + \".y,\" + animationRegisterData.vertexOneConst + \"\\n\";\n code += \"mov \" + temp3 + \",\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"neg \" + temp3 + \".x,\" + temp1 + \".z\\n\";\n code += \"mov \" + temp3 + \".z,\" + temp1 + \".x\\n\";\n if (animationSet.hasBillboard)\n code += \"m33 \" + temp4 + \".xyz,\" + temp4 + \".xyz,\" + temp1 + \"\\n\";\n else {\n code += \"m33 \" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + temp1 + \"\\n\";\n for (i = 0; i < len; i++)\n code += \"m33 \" + animationRegisterData.rotationRegisters[i] + \".xyz,\" + animationRegisterData.rotationRegisters[i] + \",\" + temp1 + \"\\n\";\n }\n //z axis\n code += \"mov \" + temp2 + \",\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"sin \" + temp2 + \".x,\" + rotationAttribute + \".z\\n\";\n code += \"cos \" + temp2 + \".y,\" + rotationAttribute + \".z\\n\";\n code += \"mov \" + temp1 + \",\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"mov \" + temp1 + \".x,\" + temp2 + \".y\\n\";\n code += \"neg \" + temp1 + \".y,\" + temp2 + \".x\\n\";\n code += \"mov \" + temp3 + \",\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"mov \" + temp3 + \".z,\" + animationRegisterData.vertexOneConst + \"\\n\";\n if (animationSet.hasBillboard) {\n code += \"m33 \" + temp4 + \".xyz,\" + temp4 + \".xyz,\" + temp1 + \"\\n\";\n code += \"sub \" + temp4 + \".xyz,\" + temp4 + \".xyz,\" + animationRegisterData.positionTarget + \".xyz\\n\";\n code += \"add \" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + temp4 + \".xyz,\" + animationRegisterData.scaleAndRotateTarget + \".xyz\\n\";\n }\n else {\n code += \"m33 \" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + temp1 + \"\\n\";\n for (i = 0; i < len; i++)\n code += \"m33 \" + animationRegisterData.rotationRegisters[i] + \".xyz,\" + animationRegisterData.rotationRegisters[i] + \",\" + temp1 + \"\\n\";\n }\n }\n if (this._iUsesPosition) {\n var positionAttribute = registerCache.getFreeVertexAttribute();\n animationRegisterData.setRegisterIndex(this, ParticleFollowState.FOLLOW_POSITION_INDEX, positionAttribute.index);\n code += \"add \" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + positionAttribute + \",\" + animationRegisterData.scaleAndRotateTarget + \".xyz\\n\";\n }\n return code;\n };\n /**\n * @inheritDoc\n */\n ParticleFollowNode.prototype.getAnimationState = function (animator) {\n return animator.getAnimationState(this);\n };\n return ParticleFollowNode;\n}(ParticleNodeBase));\nexport { ParticleFollowNode };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/ParticleFollowNode.js","import * as tslib_1 from \"tslib\";\nimport { Vector3D } from \"@awayjs/core\";\nimport { ContextGLVertexBufferFormat } from \"@awayjs/stage\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleStateBase } from \"./ParticleStateBase\";\n/**\n*\n*/\nvar ParticleInitialColorState = (function (_super) {\n tslib_1.__extends(ParticleInitialColorState, _super);\n function ParticleInitialColorState(animator, particleInitialColorNode) {\n var _this = _super.call(this, animator, particleInitialColorNode) || this;\n _this._particleInitialColorNode = particleInitialColorNode;\n _this._usesMultiplier = particleInitialColorNode._iUsesMultiplier;\n _this._usesOffset = particleInitialColorNode._iUsesOffset;\n _this._initialColor = particleInitialColorNode._iInitialColor;\n _this.updateColorData();\n return _this;\n }\n Object.defineProperty(ParticleInitialColorState.prototype, \"initialColor\", {\n /**\n * Defines the initial color transform of the state, when in global mode.\n */\n get: function () {\n return this._initialColor;\n },\n set: function (value) {\n this._initialColor = value;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * @inheritDoc\n */\n ParticleInitialColorState.prototype.setRenderState = function (shader, renderable, animationElements, animationRegisterData, projection, stage) {\n if (shader.usesFragmentAnimation) {\n var index;\n if (this._particleInitialColorNode.mode == ParticlePropertiesMode.LOCAL_STATIC) {\n var dataOffset = this._particleInitialColorNode._iDataOffset;\n if (this._usesMultiplier) {\n animationElements.activateVertexBuffer(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleInitialColorState.MULTIPLIER_INDEX), dataOffset, stage, ContextGLVertexBufferFormat.FLOAT_4);\n dataOffset += 4;\n }\n if (this._usesOffset)\n animationElements.activateVertexBuffer(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleInitialColorState.OFFSET_INDEX), dataOffset, stage, ContextGLVertexBufferFormat.FLOAT_4);\n }\n else {\n if (this._usesMultiplier)\n shader.setVertexConst(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleInitialColorState.MULTIPLIER_INDEX), this._multiplierData.x, this._multiplierData.y, this._multiplierData.z, this._multiplierData.w);\n if (this._usesOffset)\n shader.setVertexConst(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleInitialColorState.OFFSET_INDEX), this._offsetData.x, this._offsetData.y, this._offsetData.z, this._offsetData.w);\n }\n }\n };\n ParticleInitialColorState.prototype.updateColorData = function () {\n if (this._particleInitialColorNode.mode == ParticlePropertiesMode.GLOBAL) {\n if (this._usesMultiplier)\n this._multiplierData = new Vector3D(this._initialColor.redMultiplier, this._initialColor.greenMultiplier, this._initialColor.blueMultiplier, this._initialColor.alphaMultiplier);\n if (this._usesOffset)\n this._offsetData = new Vector3D(this._initialColor.redOffset / 255, this._initialColor.greenOffset / 255, this._initialColor.blueOffset / 255, this._initialColor.alphaOffset / 255);\n }\n };\n return ParticleInitialColorState;\n}(ParticleStateBase));\nexport { ParticleInitialColorState };\n/** @private */\nParticleInitialColorState.MULTIPLIER_INDEX = 0;\n/** @private */\nParticleInitialColorState.OFFSET_INDEX = 1;\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/ParticleInitialColorState.js","import * as tslib_1 from \"tslib\";\nimport { ColorTransform } from \"@awayjs/core\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleInitialColorState } from \"../states/ParticleInitialColorState\";\nimport { ParticleAnimationSet } from \"../ParticleAnimationSet\";\nimport { ParticleNodeBase } from \"./ParticleNodeBase\";\n/**\n *\n */\nvar ParticleInitialColorNode = (function (_super) {\n tslib_1.__extends(ParticleInitialColorNode, _super);\n function ParticleInitialColorNode(mode, usesMultiplier, usesOffset, initialColor) {\n if (usesMultiplier === void 0) { usesMultiplier = true; }\n if (usesOffset === void 0) { usesOffset = false; }\n if (initialColor === void 0) { initialColor = null; }\n var _this = _super.call(this, \"ParticleInitialColor\", mode, (usesMultiplier && usesOffset) ? 8 : 4, ParticleAnimationSet.COLOR_PRIORITY) || this;\n _this._pStateClass = ParticleInitialColorState;\n _this._iUsesMultiplier = usesMultiplier;\n _this._iUsesOffset = usesOffset;\n _this._iInitialColor = initialColor || new ColorTransform();\n return _this;\n }\n /**\n * @inheritDoc\n */\n ParticleInitialColorNode.prototype.getAGALVertexCode = function (shader, animationSet, registerCache, animationRegisterData) {\n var code = \"\";\n if (shader.usesFragmentAnimation) {\n if (this._iUsesMultiplier) {\n var multiplierValue = (this._pMode == ParticlePropertiesMode.GLOBAL) ? registerCache.getFreeVertexConstant() : registerCache.getFreeVertexAttribute();\n animationRegisterData.setRegisterIndex(this, ParticleInitialColorState.MULTIPLIER_INDEX, multiplierValue.index);\n code += \"mul \" + animationRegisterData.colorMulTarget + \",\" + multiplierValue + \",\" + animationRegisterData.colorMulTarget + \"\\n\";\n }\n if (this._iUsesOffset) {\n var offsetValue = (this._pMode == ParticlePropertiesMode.LOCAL_STATIC) ? registerCache.getFreeVertexAttribute() : registerCache.getFreeVertexConstant();\n animationRegisterData.setRegisterIndex(this, ParticleInitialColorState.OFFSET_INDEX, offsetValue.index);\n code += \"add \" + animationRegisterData.colorAddTarget + \",\" + offsetValue + \",\" + animationRegisterData.colorAddTarget + \"\\n\";\n }\n }\n return code;\n };\n /**\n * @inheritDoc\n */\n ParticleInitialColorNode.prototype._iProcessAnimationSetting = function (particleAnimationSet) {\n if (this._iUsesMultiplier)\n particleAnimationSet.hasColorMulNode = true;\n if (this._iUsesOffset)\n particleAnimationSet.hasColorAddNode = true;\n };\n /**\n * @inheritDoc\n */\n ParticleInitialColorNode.prototype._iGeneratePropertyOfOneParticle = function (param) {\n var initialColor = param[ParticleInitialColorNode.COLOR_INITIAL_COLORTRANSFORM];\n if (!initialColor)\n throw (new Error(\"there is no \" + ParticleInitialColorNode.COLOR_INITIAL_COLORTRANSFORM + \" in param!\"));\n var i = 0;\n //multiplier\n if (this._iUsesMultiplier) {\n this._pOneData[i++] = initialColor.redMultiplier;\n this._pOneData[i++] = initialColor.greenMultiplier;\n this._pOneData[i++] = initialColor.blueMultiplier;\n this._pOneData[i++] = initialColor.alphaMultiplier;\n }\n //offset\n if (this._iUsesOffset) {\n this._pOneData[i++] = initialColor.redOffset / 255;\n this._pOneData[i++] = initialColor.greenOffset / 255;\n this._pOneData[i++] = initialColor.blueOffset / 255;\n this._pOneData[i++] = initialColor.alphaOffset / 255;\n }\n };\n return ParticleInitialColorNode;\n}(ParticleNodeBase));\nexport { ParticleInitialColorNode };\n/**\n * Reference for color node properties on a single particle (when in local property mode).\n * Expects a ColorTransform object representing the color transform applied to the particle.\n */\nParticleInitialColorNode.COLOR_INITIAL_COLORTRANSFORM = \"ColorInitialColorTransform\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/ParticleInitialColorNode.js","import * as tslib_1 from \"tslib\";\nimport { Matrix3D, Vector3D } from \"@awayjs/core\";\nimport { ContextGLVertexBufferFormat } from \"@awayjs/stage\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleStateBase } from \"./ParticleStateBase\";\n/**\n * ...\n */\nvar ParticleOrbitState = (function (_super) {\n tslib_1.__extends(ParticleOrbitState, _super);\n function ParticleOrbitState(animator, particleOrbitNode) {\n var _this = _super.call(this, animator, particleOrbitNode) || this;\n _this._particleOrbitNode = particleOrbitNode;\n _this._usesEulers = _this._particleOrbitNode._iUsesEulers;\n _this._usesCycle = _this._particleOrbitNode._iUsesCycle;\n _this._usesPhase = _this._particleOrbitNode._iUsesPhase;\n _this._eulers = _this._particleOrbitNode._iEulers;\n _this._radius = _this._particleOrbitNode._iRadius;\n _this._cycleDuration = _this._particleOrbitNode._iCycleDuration;\n _this._cyclePhase = _this._particleOrbitNode._iCyclePhase;\n _this.updateOrbitData();\n return _this;\n }\n Object.defineProperty(ParticleOrbitState.prototype, \"radius\", {\n /**\n * Defines the radius of the orbit when in global mode. Defaults to 100.\n */\n get: function () {\n return this._radius;\n },\n set: function (value) {\n this._radius = value;\n this.updateOrbitData();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleOrbitState.prototype, \"cycleDuration\", {\n /**\n * Defines the duration of the orbit in seconds, used as a period independent of particle duration when in global mode. Defaults to 1.\n */\n get: function () {\n return this._cycleDuration;\n },\n set: function (value) {\n this._cycleDuration = value;\n this.updateOrbitData();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleOrbitState.prototype, \"cyclePhase\", {\n /**\n * Defines the phase of the orbit in degrees, used as the starting offset of the cycle when in global mode. Defaults to 0.\n */\n get: function () {\n return this._cyclePhase;\n },\n set: function (value) {\n this._cyclePhase = value;\n this.updateOrbitData();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleOrbitState.prototype, \"eulers\", {\n /**\n * Defines the euler rotation in degrees, applied to the orientation of the orbit when in global mode.\n */\n get: function () {\n return this._eulers;\n },\n set: function (value) {\n this._eulers = value;\n this.updateOrbitData();\n },\n enumerable: true,\n configurable: true\n });\n ParticleOrbitState.prototype.setRenderState = function (shader, renderable, animationElements, animationRegisterData, projection, stage) {\n var index = animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleOrbitState.ORBIT_INDEX);\n if (this._particleOrbitNode.mode == ParticlePropertiesMode.LOCAL_STATIC) {\n if (this._usesPhase)\n animationElements.activateVertexBuffer(index, this._particleOrbitNode._iDataOffset, stage, ContextGLVertexBufferFormat.FLOAT_4);\n else\n animationElements.activateVertexBuffer(index, this._particleOrbitNode._iDataOffset, stage, ContextGLVertexBufferFormat.FLOAT_3);\n }\n else\n shader.setVertexConst(index, this._orbitData.x, this._orbitData.y, this._orbitData.z, this._orbitData.w);\n if (this._usesEulers)\n shader.setVertexConstFromMatrix(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleOrbitState.EULERS_INDEX), this._eulersMatrix);\n };\n ParticleOrbitState.prototype.updateOrbitData = function () {\n if (this._usesEulers) {\n this._eulersMatrix = new Matrix3D();\n this._eulersMatrix.appendRotation(this._eulers.x, Vector3D.X_AXIS);\n this._eulersMatrix.appendRotation(this._eulers.y, Vector3D.Y_AXIS);\n this._eulersMatrix.appendRotation(this._eulers.z, Vector3D.Z_AXIS);\n }\n if (this._particleOrbitNode.mode == ParticlePropertiesMode.GLOBAL) {\n this._orbitData = new Vector3D(this._radius, 0, this._radius * Math.PI * 2, this._cyclePhase * Math.PI / 180);\n if (this._usesCycle) {\n if (this._cycleDuration <= 0)\n throw (new Error(\"the cycle duration must be greater than zero\"));\n this._orbitData.y = Math.PI * 2 / this._cycleDuration;\n }\n else\n this._orbitData.y = Math.PI * 2;\n }\n };\n return ParticleOrbitState;\n}(ParticleStateBase));\nexport { ParticleOrbitState };\n/** @private */\nParticleOrbitState.ORBIT_INDEX = 0;\n/** @private */\nParticleOrbitState.EULERS_INDEX = 1;\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/ParticleOrbitState.js","import * as tslib_1 from \"tslib\";\nimport { Vector3D } from \"@awayjs/core\";\nimport { ShaderRegisterElement } from \"@awayjs/stage\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleOrbitState } from \"../states/ParticleOrbitState\";\nimport { ParticleNodeBase } from \"./ParticleNodeBase\";\n/**\n * A particle animation node used to control the position of a particle over time around a circular orbit.\n */\nvar ParticleOrbitNode = (function (_super) {\n tslib_1.__extends(ParticleOrbitNode, _super);\n /**\n * Creates a new ParticleOrbitNode object.\n *\n * @param mode Defines whether the mode of operation acts on local properties of a particle or global properties of the node.\n * @param [optional] usesEulers Defines whether the node uses the eulers property in the shader to calculate a rotation on the orbit. Defaults to true.\n * @param [optional] usesCycle Defines whether the node uses the cycleDuration property in the shader to calculate the period of the orbit independent of particle duration. Defaults to false.\n * @param [optional] usesPhase Defines whether the node uses the cyclePhase property in the shader to calculate a starting offset to the cycle rotation of the particle. Defaults to false.\n * @param [optional] radius Defines the radius of the orbit when in global mode. Defaults to 100.\n * @param [optional] cycleDuration Defines the duration of the orbit in seconds, used as a period independent of particle duration when in global mode. Defaults to 1.\n * @param [optional] cyclePhase Defines the phase of the orbit in degrees, used as the starting offset of the cycle when in global mode. Defaults to 0.\n * @param [optional] eulers Defines the euler rotation in degrees, applied to the orientation of the orbit when in global mode.\n */\n function ParticleOrbitNode(mode, usesEulers, usesCycle, usesPhase, radius, cycleDuration, cyclePhase, eulers) {\n if (usesEulers === void 0) { usesEulers = true; }\n if (usesCycle === void 0) { usesCycle = false; }\n if (usesPhase === void 0) { usesPhase = false; }\n if (radius === void 0) { radius = 100; }\n if (cycleDuration === void 0) { cycleDuration = 1; }\n if (cyclePhase === void 0) { cyclePhase = 0; }\n if (eulers === void 0) { eulers = null; }\n var _this;\n var len = 3;\n if (usesPhase)\n len++;\n _this = _super.call(this, \"ParticleOrbit\", mode, len) || this;\n _this._pStateClass = ParticleOrbitState;\n _this._iUsesEulers = usesEulers;\n _this._iUsesCycle = usesCycle;\n _this._iUsesPhase = usesPhase;\n _this._iRadius = radius;\n _this._iCycleDuration = cycleDuration;\n _this._iCyclePhase = cyclePhase;\n _this._iEulers = eulers || new Vector3D();\n return _this;\n }\n /**\n * @inheritDoc\n */\n ParticleOrbitNode.prototype.getAGALVertexCode = function (shader, animationSet, registerCache, animationRegisterData) {\n var orbitRegister = (this._pMode == ParticlePropertiesMode.GLOBAL) ? registerCache.getFreeVertexConstant() : registerCache.getFreeVertexAttribute();\n animationRegisterData.setRegisterIndex(this, ParticleOrbitState.ORBIT_INDEX, orbitRegister.index);\n var eulersMatrixRegister = registerCache.getFreeVertexConstant();\n animationRegisterData.setRegisterIndex(this, ParticleOrbitState.EULERS_INDEX, eulersMatrixRegister.index);\n registerCache.getFreeVertexConstant();\n registerCache.getFreeVertexConstant();\n registerCache.getFreeVertexConstant();\n var temp1 = registerCache.getFreeVertexVectorTemp();\n registerCache.addVertexTempUsages(temp1, 1);\n var distance = new ShaderRegisterElement(temp1.regName, temp1.index);\n var temp2 = registerCache.getFreeVertexVectorTemp();\n var cos = new ShaderRegisterElement(temp2.regName, temp2.index, 0);\n var sin = new ShaderRegisterElement(temp2.regName, temp2.index, 1);\n var degree = new ShaderRegisterElement(temp2.regName, temp2.index, 2);\n registerCache.removeVertexTempUsage(temp1);\n var code = \"\";\n if (this._iUsesCycle) {\n code += \"mul \" + degree + \",\" + animationRegisterData.vertexTime + \",\" + orbitRegister + \".y\\n\";\n if (this._iUsesPhase)\n code += \"add \" + degree + \",\" + degree + \",\" + orbitRegister + \".w\\n\";\n }\n else\n code += \"mul \" + degree + \",\" + animationRegisterData.vertexLife + \",\" + orbitRegister + \".y\\n\";\n code += \"cos \" + cos + \",\" + degree + \"\\n\";\n code += \"sin \" + sin + \",\" + degree + \"\\n\";\n code += \"mul \" + distance + \".x,\" + cos + \",\" + orbitRegister + \".x\\n\";\n code += \"mul \" + distance + \".y,\" + sin + \",\" + orbitRegister + \".x\\n\";\n code += \"mov \" + distance + \".wz\" + animationRegisterData.vertexZeroConst + \"\\n\";\n if (this._iUsesEulers)\n code += \"m44 \" + distance + \",\" + distance + \",\" + eulersMatrixRegister + \"\\n\";\n code += \"add \" + animationRegisterData.positionTarget + \".xyz,\" + distance + \".xyz,\" + animationRegisterData.positionTarget + \".xyz\\n\";\n if (animationSet.needVelocity) {\n code += \"neg \" + distance + \".x,\" + sin + \"\\n\";\n code += \"mov \" + distance + \".y,\" + cos + \"\\n\";\n code += \"mov \" + distance + \".zw,\" + animationRegisterData.vertexZeroConst + \"\\n\";\n if (this._iUsesEulers)\n code += \"m44 \" + distance + \",\" + distance + \",\" + eulersMatrixRegister + \"\\n\";\n code += \"mul \" + distance + \",\" + distance + \",\" + orbitRegister + \".z\\n\";\n code += \"div \" + distance + \",\" + distance + \",\" + orbitRegister + \".y\\n\";\n if (!this._iUsesCycle)\n code += \"div \" + distance + \",\" + distance + \",\" + animationRegisterData.vertexLife + \"\\n\";\n code += \"add \" + animationRegisterData.velocityTarget + \".xyz,\" + animationRegisterData.velocityTarget + \".xyz,\" + distance + \".xyz\\n\";\n }\n return code;\n };\n /**\n * @inheritDoc\n */\n ParticleOrbitNode.prototype.getAnimationState = function (animator) {\n return animator.getAnimationState(this);\n };\n /**\n * @inheritDoc\n */\n ParticleOrbitNode.prototype._iGeneratePropertyOfOneParticle = function (param) {\n //Vector3D.x is radius, Vector3D.y is cycle duration, Vector3D.z is phase\n var orbit = param[ParticleOrbitNode.ORBIT_VECTOR3D];\n if (!orbit)\n throw new Error(\"there is no \" + ParticleOrbitNode.ORBIT_VECTOR3D + \" in param!\");\n this._pOneData[0] = orbit.x;\n if (this._iUsesCycle && orbit.y <= 0)\n throw (new Error(\"the cycle duration must be greater than zero\"));\n this._pOneData[1] = Math.PI * 2 / (!this._iUsesCycle ? 1 : orbit.y);\n this._pOneData[2] = orbit.x * Math.PI * 2;\n if (this._iUsesPhase)\n this._pOneData[3] = orbit.z * Math.PI / 180;\n };\n return ParticleOrbitNode;\n}(ParticleNodeBase));\nexport { ParticleOrbitNode };\n/**\n * Reference for orbit node properties on a single particle (when in local property mode).\n * Expects a Vector3D object representing the radius (x), cycle speed (y) and cycle phase (z) of the motion on the particle.\n */\nParticleOrbitNode.ORBIT_VECTOR3D = \"OrbitVector3D\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/ParticleOrbitNode.js","import * as tslib_1 from \"tslib\";\nimport { Vector3D } from \"@awayjs/core\";\nimport { ContextGLVertexBufferFormat } from \"@awayjs/stage\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleStateBase } from \"./ParticleStateBase\";\n/**\n * ...\n */\nvar ParticleOscillatorState = (function (_super) {\n tslib_1.__extends(ParticleOscillatorState, _super);\n function ParticleOscillatorState(animator, particleOscillatorNode) {\n var _this = _super.call(this, animator, particleOscillatorNode) || this;\n _this._particleOscillatorNode = particleOscillatorNode;\n _this._oscillator = _this._particleOscillatorNode._iOscillator;\n _this.updateOscillatorData();\n return _this;\n }\n Object.defineProperty(ParticleOscillatorState.prototype, \"oscillator\", {\n /**\n * Defines the default oscillator axis (x, y, z) and cycleDuration (w) of the state, used when in global mode.\n */\n get: function () {\n return this._oscillator;\n },\n set: function (value) {\n this._oscillator = value;\n this.updateOscillatorData();\n },\n enumerable: true,\n configurable: true\n });\n /**\n * @inheritDoc\n */\n ParticleOscillatorState.prototype.setRenderState = function (shader, renderable, animationElements, animationRegisterData, projection, stage) {\n var index = animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleOscillatorState.OSCILLATOR_INDEX);\n if (this._particleOscillatorNode.mode == ParticlePropertiesMode.LOCAL_STATIC)\n animationElements.activateVertexBuffer(index, this._particleOscillatorNode._iDataOffset, stage, ContextGLVertexBufferFormat.FLOAT_4);\n else\n shader.setVertexConst(index, this._oscillatorData.x, this._oscillatorData.y, this._oscillatorData.z, this._oscillatorData.w);\n };\n ParticleOscillatorState.prototype.updateOscillatorData = function () {\n if (this._particleOscillatorNode.mode == ParticlePropertiesMode.GLOBAL) {\n if (this._oscillator.w <= 0)\n throw (new Error(\"the cycle duration must greater than zero\"));\n if (this._oscillatorData == null)\n this._oscillatorData = new Vector3D();\n this._oscillatorData.x = this._oscillator.x;\n this._oscillatorData.y = this._oscillator.y;\n this._oscillatorData.z = this._oscillator.z;\n this._oscillatorData.w = Math.PI * 2 / this._oscillator.w;\n }\n };\n return ParticleOscillatorState;\n}(ParticleStateBase));\nexport { ParticleOscillatorState };\n/** @private */\nParticleOscillatorState.OSCILLATOR_INDEX = 0;\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/ParticleOscillatorState.js","import * as tslib_1 from \"tslib\";\nimport { Vector3D } from \"@awayjs/core\";\nimport { ShaderRegisterElement } from \"@awayjs/stage\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleOscillatorState } from \"../states/ParticleOscillatorState\";\nimport { ParticleNodeBase } from \"./ParticleNodeBase\";\n/**\n * A particle animation node used to control the position of a particle over time using simple harmonic motion.\n */\nvar ParticleOscillatorNode = (function (_super) {\n tslib_1.__extends(ParticleOscillatorNode, _super);\n /**\n * Creates a new ParticleOscillatorNode\n *\n * @param mode Defines whether the mode of operation acts on local properties of a particle or global properties of the node.\n * @param [optional] oscillator Defines the default oscillator axis (x, y, z) and cycleDuration (w) of the node, used when in global mode.\n */\n function ParticleOscillatorNode(mode, oscillator) {\n if (oscillator === void 0) { oscillator = null; }\n var _this = _super.call(this, \"ParticleOscillator\", mode, 4) || this;\n _this._pStateClass = ParticleOscillatorState;\n _this._iOscillator = oscillator || new Vector3D();\n return _this;\n }\n /**\n * @inheritDoc\n */\n ParticleOscillatorNode.prototype.getAGALVertexCode = function (shader, animationSet, registerCache, animationRegisterData) {\n var oscillatorRegister = (this._pMode == ParticlePropertiesMode.GLOBAL) ? registerCache.getFreeVertexConstant() : registerCache.getFreeVertexAttribute();\n animationRegisterData.setRegisterIndex(this, ParticleOscillatorState.OSCILLATOR_INDEX, oscillatorRegister.index);\n var temp = registerCache.getFreeVertexVectorTemp();\n var dgree = new ShaderRegisterElement(temp.regName, temp.index, 0);\n var sin = new ShaderRegisterElement(temp.regName, temp.index, 1);\n var cos = new ShaderRegisterElement(temp.regName, temp.index, 2);\n registerCache.addVertexTempUsages(temp, 1);\n var temp2 = registerCache.getFreeVertexVectorTemp();\n var distance = new ShaderRegisterElement(temp2.regName, temp2.index);\n registerCache.removeVertexTempUsage(temp);\n var code = \"\";\n code += \"mul \" + dgree + \",\" + animationRegisterData.vertexTime + \",\" + oscillatorRegister + \".w\\n\";\n code += \"sin \" + sin + \",\" + dgree + \"\\n\";\n code += \"mul \" + distance + \".xyz,\" + sin + \",\" + oscillatorRegister + \".xyz\\n\";\n code += \"add \" + animationRegisterData.positionTarget + \".xyz,\" + distance + \".xyz,\" + animationRegisterData.positionTarget + \".xyz\\n\";\n if (animationSet.needVelocity) {\n code += \"cos \" + cos + \",\" + dgree + \"\\n\";\n code += \"mul \" + distance + \".xyz,\" + cos + \",\" + oscillatorRegister + \".xyz\\n\";\n code += \"add \" + animationRegisterData.velocityTarget + \".xyz,\" + distance + \".xyz,\" + animationRegisterData.velocityTarget + \".xyz\\n\";\n }\n return code;\n };\n /**\n * @inheritDoc\n */\n ParticleOscillatorNode.prototype.getAnimationState = function (animator) {\n return animator.getAnimationState(this);\n };\n /**\n * @inheritDoc\n */\n ParticleOscillatorNode.prototype._iGeneratePropertyOfOneParticle = function (param) {\n //(Vector3D.x,Vector3D.y,Vector3D.z) is oscillator axis, Vector3D.w is oscillator cycle duration\n var drift = param[ParticleOscillatorNode.OSCILLATOR_VECTOR3D];\n if (!drift)\n throw (new Error(\"there is no \" + ParticleOscillatorNode.OSCILLATOR_VECTOR3D + \" in param!\"));\n this._pOneData[0] = drift.x;\n this._pOneData[1] = drift.y;\n this._pOneData[2] = drift.z;\n if (drift.w <= 0)\n throw (new Error(\"the cycle duration must greater than zero\"));\n this._pOneData[3] = Math.PI * 2 / drift.w;\n };\n return ParticleOscillatorNode;\n}(ParticleNodeBase));\nexport { ParticleOscillatorNode };\n/**\n * Reference for ocsillator node properties on a single particle (when in local property mode).\n * Expects a Vector3D object representing the axis (x,y,z) and cycle speed (w) of the motion on the particle.\n */\nParticleOscillatorNode.OSCILLATOR_VECTOR3D = \"OscillatorVector3D\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/ParticleOscillatorNode.js","import * as tslib_1 from \"tslib\";\nimport { ContextGLVertexBufferFormat } from \"@awayjs/stage\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleStateBase } from \"./ParticleStateBase\";\n/**\n * ...\n * @author ...\n */\nvar ParticlePositionState = (function (_super) {\n tslib_1.__extends(ParticlePositionState, _super);\n function ParticlePositionState(animator, particlePositionNode) {\n var _this = _super.call(this, animator, particlePositionNode) || this;\n _this._particlePositionNode = particlePositionNode;\n _this._position = _this._particlePositionNode._iPosition;\n return _this;\n }\n Object.defineProperty(ParticlePositionState.prototype, \"position\", {\n /**\n * Defines the position of the particle when in global mode. Defaults to 0,0,0.\n */\n get: function () {\n return this._position;\n },\n set: function (value) {\n this._position = value;\n },\n enumerable: true,\n configurable: true\n });\n /**\n *\n */\n ParticlePositionState.prototype.getPositions = function () {\n return this._pDynamicProperties;\n };\n ParticlePositionState.prototype.setPositions = function (value) {\n this._pDynamicProperties = value;\n this._pDynamicPropertiesDirty = new Object();\n };\n /**\n * @inheritDoc\n */\n ParticlePositionState.prototype.setRenderState = function (shader, renderable, animationElements, animationRegisterData, projection, stage) {\n if (this._particlePositionNode.mode == ParticlePropertiesMode.LOCAL_DYNAMIC && !this._pDynamicPropertiesDirty[animationElements._iUniqueId])\n this._pUpdateDynamicProperties(animationElements);\n var index = animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticlePositionState.POSITION_INDEX);\n if (this._particlePositionNode.mode == ParticlePropertiesMode.GLOBAL)\n shader.setVertexConst(index, this._position.x, this._position.y, this._position.z);\n else\n animationElements.activateVertexBuffer(index, this._particlePositionNode._iDataOffset, stage, ContextGLVertexBufferFormat.FLOAT_3);\n };\n return ParticlePositionState;\n}(ParticleStateBase));\nexport { ParticlePositionState };\n/** @private */\nParticlePositionState.POSITION_INDEX = 0;\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/ParticlePositionState.js","import * as tslib_1 from \"tslib\";\nimport { Vector3D } from \"@awayjs/core\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticlePositionState } from \"../states/ParticlePositionState\";\nimport { ParticleNodeBase } from \"./ParticleNodeBase\";\n/**\n * A particle animation node used to set the starting position of a particle.\n */\nvar ParticlePositionNode = (function (_super) {\n tslib_1.__extends(ParticlePositionNode, _super);\n /**\n * Creates a new ParticlePositionNode\n *\n * @param mode Defines whether the mode of operation acts on local properties of a particle or global properties of the node.\n * @param [optional] position Defines the default position of the particle when in global mode. Defaults to 0,0,0.\n */\n function ParticlePositionNode(mode, position) {\n if (position === void 0) { position = null; }\n var _this = _super.call(this, \"ParticlePosition\", mode, 3) || this;\n _this._pStateClass = ParticlePositionState;\n _this._iPosition = position || new Vector3D();\n return _this;\n }\n /**\n * @inheritDoc\n */\n ParticlePositionNode.prototype.getAGALVertexCode = function (shader, animationSet, registerCache, animationRegisterData) {\n var positionAttribute = (this._pMode == ParticlePropertiesMode.GLOBAL) ? registerCache.getFreeVertexConstant() : registerCache.getFreeVertexAttribute();\n animationRegisterData.setRegisterIndex(this, ParticlePositionState.POSITION_INDEX, positionAttribute.index);\n return \"add \" + animationRegisterData.positionTarget + \".xyz,\" + positionAttribute + \".xyz,\" + animationRegisterData.positionTarget + \".xyz\\n\";\n };\n /**\n * @inheritDoc\n */\n ParticlePositionNode.prototype.getAnimationState = function (animator) {\n return animator.getAnimationState(this);\n };\n /**\n * @inheritDoc\n */\n ParticlePositionNode.prototype._iGeneratePropertyOfOneParticle = function (param) {\n var offset = param[ParticlePositionNode.POSITION_VECTOR3D];\n if (!offset)\n throw (new Error(\"there is no \" + ParticlePositionNode.POSITION_VECTOR3D + \" in param!\"));\n this._pOneData[0] = offset.x;\n this._pOneData[1] = offset.y;\n this._pOneData[2] = offset.z;\n };\n return ParticlePositionNode;\n}(ParticleNodeBase));\nexport { ParticlePositionNode };\n/**\n * Reference for position node properties on a single particle (when in local property mode).\n * Expects a Vector3D object representing position of the particle.\n */\nParticlePositionNode.POSITION_VECTOR3D = \"PositionVector3D\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/ParticlePositionNode.js","import * as tslib_1 from \"tslib\";\nimport { Matrix3D } from \"@awayjs/core\";\nimport { ParticleStateBase } from \"./ParticleStateBase\";\n/**\n * ...\n */\nvar ParticleRotateToHeadingState = (function (_super) {\n tslib_1.__extends(ParticleRotateToHeadingState, _super);\n function ParticleRotateToHeadingState(animator, particleNode) {\n var _this = _super.call(this, animator, particleNode) || this;\n _this._matrix = new Matrix3D();\n return _this;\n }\n ParticleRotateToHeadingState.prototype.setRenderState = function (shader, renderable, animationElements, animationRegisterData, projection, stage) {\n if (this._pParticleAnimator.animationSet.hasBillboard) {\n this._matrix.copyFrom(renderable.sourceEntity.transform.concatenatedMatrix3D);\n this._matrix.append(projection.transform.inverseConcatenatedMatrix3D);\n shader.setVertexConstFromMatrix(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleRotateToHeadingState.MATRIX_INDEX), this._matrix);\n }\n };\n return ParticleRotateToHeadingState;\n}(ParticleStateBase));\nexport { ParticleRotateToHeadingState };\n/** @private */\nParticleRotateToHeadingState.MATRIX_INDEX = 0;\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/ParticleRotateToHeadingState.js","import * as tslib_1 from \"tslib\";\nimport { ShaderRegisterElement } from \"@awayjs/stage\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleRotateToHeadingState } from \"../states/ParticleRotateToHeadingState\";\nimport { ParticleNodeBase } from \"./ParticleNodeBase\";\n/**\n * A particle animation node used to control the rotation of a particle to match its heading vector.\n */\nvar ParticleRotateToHeadingNode = (function (_super) {\n tslib_1.__extends(ParticleRotateToHeadingNode, _super);\n /**\n * Creates a new ParticleBillboardNode\n */\n function ParticleRotateToHeadingNode() {\n var _this = _super.call(this, \"ParticleRotateToHeading\", ParticlePropertiesMode.GLOBAL, 0, 3) || this;\n _this._pStateClass = ParticleRotateToHeadingState;\n return _this;\n }\n /**\n * @inheritDoc\n */\n ParticleRotateToHeadingNode.prototype.getAGALVertexCode = function (shader, animationSet, registerCache, animationRegisterData) {\n var code = \"\";\n var len = animationRegisterData.rotationRegisters.length;\n var i;\n if (animationSet.hasBillboard) {\n var temp1 = registerCache.getFreeVertexVectorTemp();\n registerCache.addVertexTempUsages(temp1, 1);\n var temp2 = registerCache.getFreeVertexVectorTemp();\n registerCache.addVertexTempUsages(temp2, 1);\n var temp3 = registerCache.getFreeVertexVectorTemp();\n var rotationMatrixRegister = registerCache.getFreeVertexConstant();\n animationRegisterData.setRegisterIndex(this, ParticleRotateToHeadingState.MATRIX_INDEX, rotationMatrixRegister.index);\n registerCache.getFreeVertexConstant();\n registerCache.getFreeVertexConstant();\n registerCache.getFreeVertexConstant();\n registerCache.removeVertexTempUsage(temp1);\n registerCache.removeVertexTempUsage(temp2);\n //process the velocity\n code += \"m33 \" + temp1 + \".xyz,\" + animationRegisterData.velocityTarget + \".xyz,\" + rotationMatrixRegister + \"\\n\";\n code += \"mov \" + temp3 + \",\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"mov \" + temp3 + \".xy,\" + temp1 + \".xy\\n\";\n code += \"nrm \" + temp3 + \".xyz,\" + temp3 + \".xyz\\n\";\n //temp3.x=cos,temp3.y=sin\n //only process z axis\n code += \"mov \" + temp2 + \",\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"mov \" + temp2 + \".x,\" + temp3 + \".y\\n\";\n code += \"mov \" + temp2 + \".y,\" + temp3 + \".x\\n\";\n code += \"mov \" + temp1 + \",\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"mov \" + temp1 + \".x,\" + temp3 + \".x\\n\";\n code += \"neg \" + temp1 + \".y,\" + temp3 + \".y\\n\";\n code += \"mov \" + temp3 + \",\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"mov \" + temp3 + \".z,\" + animationRegisterData.vertexOneConst + \"\\n\";\n code += \"m33 \" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + temp1 + \"\\n\";\n for (i = 0; i < len; i++)\n code += \"m33 \" + animationRegisterData.rotationRegisters[i] + \".xyz,\" + animationRegisterData.rotationRegisters[i] + \",\" + temp1 + \"\\n\";\n }\n else {\n var nrmVel = registerCache.getFreeVertexVectorTemp();\n registerCache.addVertexTempUsages(nrmVel, 1);\n var xAxis = registerCache.getFreeVertexVectorTemp();\n registerCache.addVertexTempUsages(xAxis, 1);\n var R = registerCache.getFreeVertexVectorTemp();\n registerCache.addVertexTempUsages(R, 1);\n var R_rev = registerCache.getFreeVertexVectorTemp();\n var cos = new ShaderRegisterElement(R.regName, R.index, 3);\n var sin = new ShaderRegisterElement(R_rev.regName, R_rev.index, 3);\n var cos2 = new ShaderRegisterElement(nrmVel.regName, nrmVel.index, 3);\n var tempSingle = sin;\n registerCache.removeVertexTempUsage(nrmVel);\n registerCache.removeVertexTempUsage(xAxis);\n registerCache.removeVertexTempUsage(R);\n code += \"mov \" + xAxis + \".x,\" + animationRegisterData.vertexOneConst + \"\\n\";\n code += \"mov \" + xAxis + \".yz,\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"nrm \" + nrmVel + \".xyz,\" + animationRegisterData.velocityTarget + \".xyz\\n\";\n code += \"dp3 \" + cos2 + \",\" + nrmVel + \".xyz,\" + xAxis + \".xyz\\n\";\n code += \"crs \" + nrmVel + \".xyz,\" + xAxis + \".xyz,\" + nrmVel + \".xyz\\n\";\n code += \"nrm \" + nrmVel + \".xyz,\" + nrmVel + \".xyz\\n\";\n //use R as temp to judge if nrm is (0,0,0).\n //if nrm is (0,0,0) ,change it to (0,0,1).\n code += \"dp3 \" + R + \".x,\" + nrmVel + \".xyz,\" + nrmVel + \".xyz\\n\";\n code += \"sge \" + R + \".x,\" + animationRegisterData.vertexZeroConst + \",\" + R + \".x\\n\";\n code += \"add \" + nrmVel + \".z,\" + R + \".x,\" + nrmVel + \".z\\n\";\n code += \"add \" + tempSingle + \",\" + cos2 + \",\" + animationRegisterData.vertexOneConst + \"\\n\";\n code += \"div \" + tempSingle + \",\" + tempSingle + \",\" + animationRegisterData.vertexTwoConst + \"\\n\";\n code += \"sqt \" + cos + \",\" + tempSingle + \"\\n\";\n code += \"sub \" + tempSingle + \",\" + animationRegisterData.vertexOneConst + \",\" + cos2 + \"\\n\";\n code += \"div \" + tempSingle + \",\" + tempSingle + \",\" + animationRegisterData.vertexTwoConst + \"\\n\";\n code += \"sqt \" + sin + \",\" + tempSingle + \"\\n\";\n code += \"mul \" + R + \".xyz,\" + sin + \",\" + nrmVel + \".xyz\\n\";\n //use cos as R.w\n code += \"mul \" + R_rev + \".xyz,\" + sin + \",\" + nrmVel + \".xyz\\n\";\n code += \"neg \" + R_rev + \".xyz,\" + R_rev + \".xyz\\n\";\n //use cos as R_rev.w\n //nrmVel and xAxis are used as temp register\n code += \"crs \" + nrmVel + \".xyz,\" + R + \".xyz,\" + animationRegisterData.scaleAndRotateTarget + \".xyz\\n\";\n //use cos as R.w\n code += \"mul \" + xAxis + \".xyz,\" + cos + \",\" + animationRegisterData.scaleAndRotateTarget + \".xyz\\n\";\n code += \"add \" + nrmVel + \".xyz,\" + nrmVel + \".xyz,\" + xAxis + \".xyz\\n\";\n code += \"dp3 \" + xAxis + \".w,\" + R + \".xyz,\" + animationRegisterData.scaleAndRotateTarget + \".xyz\\n\";\n code += \"neg \" + nrmVel + \".w,\" + xAxis + \".w\\n\";\n code += \"crs \" + R + \".xyz,\" + nrmVel + \".xyz,\" + R_rev + \".xyz\\n\";\n //code += \"mul \" + xAxis + \".xyzw,\" + nrmVel + \".xyzw,\" +R_rev + \".w\\n\";\n code += \"mul \" + xAxis + \".xyzw,\" + nrmVel + \".xyzw,\" + cos + \"\\n\";\n code += \"add \" + R + \".xyz,\" + R + \".xyz,\" + xAxis + \".xyz\\n\";\n code += \"mul \" + xAxis + \".xyz,\" + nrmVel + \".w,\" + R_rev + \".xyz\\n\";\n code += \"add \" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + R + \".xyz,\" + xAxis + \".xyz\\n\";\n for (i = 0; i < len; i++) {\n //just repeat the calculate above\n //because of the limited registers, no need to optimise\n code += \"mov \" + xAxis + \".x,\" + animationRegisterData.vertexOneConst + \"\\n\";\n code += \"mov \" + xAxis + \".yz,\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"nrm \" + nrmVel + \".xyz,\" + animationRegisterData.velocityTarget + \".xyz\\n\";\n code += \"dp3 \" + cos2 + \",\" + nrmVel + \".xyz,\" + xAxis + \".xyz\\n\";\n code += \"crs \" + nrmVel + \".xyz,\" + xAxis + \".xyz,\" + nrmVel + \".xyz\\n\";\n code += \"nrm \" + nrmVel + \".xyz,\" + nrmVel + \".xyz\\n\";\n code += \"dp3 \" + R + \".x,\" + nrmVel + \".xyz,\" + nrmVel + \".xyz\\n\";\n code += \"sge \" + R + \".x,\" + animationRegisterData.vertexZeroConst + \",\" + R + \".x\\n\";\n code += \"add \" + nrmVel + \".z,\" + R + \".x,\" + nrmVel + \".z\\n\";\n code += \"add \" + tempSingle + \",\" + cos2 + \",\" + animationRegisterData.vertexOneConst + \"\\n\";\n code += \"div \" + tempSingle + \",\" + tempSingle + \",\" + animationRegisterData.vertexTwoConst + \"\\n\";\n code += \"sqt \" + cos + \",\" + tempSingle + \"\\n\";\n code += \"sub \" + tempSingle + \",\" + animationRegisterData.vertexOneConst + \",\" + cos2 + \"\\n\";\n code += \"div \" + tempSingle + \",\" + tempSingle + \",\" + animationRegisterData.vertexTwoConst + \"\\n\";\n code += \"sqt \" + sin + \",\" + tempSingle + \"\\n\";\n code += \"mul \" + R + \".xyz,\" + sin + \",\" + nrmVel + \".xyz\\n\";\n code += \"mul \" + R_rev + \".xyz,\" + sin + \",\" + nrmVel + \".xyz\\n\";\n code += \"neg \" + R_rev + \".xyz,\" + R_rev + \".xyz\\n\";\n code += \"crs \" + nrmVel + \".xyz,\" + R + \".xyz,\" + animationRegisterData.rotationRegisters[i] + \".xyz\\n\";\n code += \"mul \" + xAxis + \".xyz,\" + cos + \",\" + animationRegisterData.rotationRegisters[i] + \".xyz\\n\";\n code += \"add \" + nrmVel + \".xyz,\" + nrmVel + \".xyz,\" + xAxis + \".xyz\\n\";\n code += \"dp3 \" + xAxis + \".w,\" + R + \".xyz,\" + animationRegisterData.rotationRegisters[i] + \".xyz\\n\";\n code += \"neg \" + nrmVel + \".w,\" + xAxis + \".w\\n\";\n code += \"crs \" + R + \".xyz,\" + nrmVel + \".xyz,\" + R_rev + \".xyz\\n\";\n code += \"mul \" + xAxis + \".xyzw,\" + nrmVel + \".xyzw,\" + cos + \"\\n\";\n code += \"add \" + R + \".xyz,\" + R + \".xyz,\" + xAxis + \".xyz\\n\";\n code += \"mul \" + xAxis + \".xyz,\" + nrmVel + \".w,\" + R_rev + \".xyz\\n\";\n code += \"add \" + animationRegisterData.rotationRegisters[i] + \".xyz,\" + R + \".xyz,\" + xAxis + \".xyz\\n\";\n }\n }\n return code;\n };\n /**\n * @inheritDoc\n */\n ParticleRotateToHeadingNode.prototype.getAnimationState = function (animator) {\n return animator.getAnimationState(this);\n };\n /**\n * @inheritDoc\n */\n ParticleRotateToHeadingNode.prototype._iProcessAnimationSetting = function (particleAnimationSet) {\n particleAnimationSet.needVelocity = true;\n };\n return ParticleRotateToHeadingNode;\n}(ParticleNodeBase));\nexport { ParticleRotateToHeadingNode };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/ParticleRotateToHeadingNode.js","import * as tslib_1 from \"tslib\";\nimport { Matrix3D } from \"@awayjs/core\";\nimport { ContextGLVertexBufferFormat } from \"@awayjs/stage\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleStateBase } from \"./ParticleStateBase\";\n/**\n * ...\n */\nvar ParticleRotateToPositionState = (function (_super) {\n tslib_1.__extends(ParticleRotateToPositionState, _super);\n function ParticleRotateToPositionState(animator, particleRotateToPositionNode) {\n var _this = _super.call(this, animator, particleRotateToPositionNode) || this;\n _this._matrix = new Matrix3D();\n _this._particleRotateToPositionNode = particleRotateToPositionNode;\n _this._position = _this._particleRotateToPositionNode._iPosition;\n return _this;\n }\n Object.defineProperty(ParticleRotateToPositionState.prototype, \"position\", {\n /**\n * Defines the position of the point the particle will rotate to face when in global mode. Defaults to 0,0,0.\n */\n get: function () {\n return this._position;\n },\n set: function (value) {\n this._position = value;\n },\n enumerable: true,\n configurable: true\n });\n ParticleRotateToPositionState.prototype.setRenderState = function (shader, renderable, animationElements, animationRegisterData, projection, stage) {\n var index = animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleRotateToPositionState.POSITION_INDEX);\n if (this._pParticleAnimator.animationSet.hasBillboard) {\n this._matrix.copyFrom(renderable.sourceEntity.transform.concatenatedMatrix3D);\n this._matrix.append(projection.transform.inverseConcatenatedMatrix3D);\n shader.setVertexConstFromMatrix(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleRotateToPositionState.MATRIX_INDEX), this._matrix);\n }\n if (this._particleRotateToPositionNode.mode == ParticlePropertiesMode.GLOBAL) {\n this._offset = renderable.sourceEntity.transform.inverseConcatenatedMatrix3D.transformVector(this._position);\n shader.setVertexConst(index, this._offset.x, this._offset.y, this._offset.z);\n }\n else\n animationElements.activateVertexBuffer(index, this._particleRotateToPositionNode._iDataOffset, stage, ContextGLVertexBufferFormat.FLOAT_3);\n };\n return ParticleRotateToPositionState;\n}(ParticleStateBase));\nexport { ParticleRotateToPositionState };\n/** @private */\nParticleRotateToPositionState.MATRIX_INDEX = 0;\n/** @private */\nParticleRotateToPositionState.POSITION_INDEX = 1;\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/ParticleRotateToPositionState.js","import * as tslib_1 from \"tslib\";\nimport { Vector3D } from \"@awayjs/core\";\nimport { ShaderRegisterElement } from \"@awayjs/stage\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleRotateToPositionState } from \"../states/ParticleRotateToPositionState\";\nimport { ParticleNodeBase } from \"./ParticleNodeBase\";\n/**\n * A particle animation node used to control the rotation of a particle to face to a position\n */\nvar ParticleRotateToPositionNode = (function (_super) {\n tslib_1.__extends(ParticleRotateToPositionNode, _super);\n /**\n * Creates a new ParticleRotateToPositionNode\n */\n function ParticleRotateToPositionNode(mode, position) {\n if (position === void 0) { position = null; }\n var _this = _super.call(this, \"ParticleRotateToPosition\", mode, 3, 3) || this;\n _this._pStateClass = ParticleRotateToPositionState;\n _this._iPosition = position || new Vector3D();\n return _this;\n }\n /**\n * @inheritDoc\n */\n ParticleRotateToPositionNode.prototype.getAGALVertexCode = function (shader, animationSet, registerCache, animationRegisterData) {\n var positionAttribute = (this._pMode == ParticlePropertiesMode.GLOBAL) ? registerCache.getFreeVertexConstant() : registerCache.getFreeVertexAttribute();\n animationRegisterData.setRegisterIndex(this, ParticleRotateToPositionState.POSITION_INDEX, positionAttribute.index);\n var code = \"\";\n var len = animationRegisterData.rotationRegisters.length;\n var i;\n if (animationSet.hasBillboard) {\n var temp1 = registerCache.getFreeVertexVectorTemp();\n registerCache.addVertexTempUsages(temp1, 1);\n var temp2 = registerCache.getFreeVertexVectorTemp();\n registerCache.addVertexTempUsages(temp2, 1);\n var temp3 = registerCache.getFreeVertexVectorTemp();\n var rotationMatrixRegister = registerCache.getFreeVertexConstant();\n animationRegisterData.setRegisterIndex(this, ParticleRotateToPositionState.MATRIX_INDEX, rotationMatrixRegister.index);\n registerCache.getFreeVertexConstant();\n registerCache.getFreeVertexConstant();\n registerCache.getFreeVertexConstant();\n registerCache.removeVertexTempUsage(temp1);\n registerCache.removeVertexTempUsage(temp2);\n //process the position\n code += \"sub \" + temp1 + \".xyz,\" + positionAttribute + \".xyz,\" + animationRegisterData.positionTarget + \".xyz\\n\";\n code += \"m33 \" + temp1 + \".xyz,\" + temp1 + \".xyz,\" + rotationMatrixRegister + \"\\n\";\n code += \"mov \" + temp3 + \",\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"mov \" + temp3 + \".xy,\" + temp1 + \".xy\\n\";\n code += \"nrm \" + temp3 + \".xyz,\" + temp3 + \".xyz\\n\";\n //temp3.x=cos,temp3.y=sin\n //only process z axis\n code += \"mov \" + temp2 + \",\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"mov \" + temp2 + \".x,\" + temp3 + \".y\\n\";\n code += \"mov \" + temp2 + \".y,\" + temp3 + \".x\\n\";\n code += \"mov \" + temp1 + \",\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"mov \" + temp1 + \".x,\" + temp3 + \".x\\n\";\n code += \"neg \" + temp1 + \".y,\" + temp3 + \".y\\n\";\n code += \"mov \" + temp3 + \",\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"mov \" + temp3 + \".z,\" + animationRegisterData.vertexOneConst + \"\\n\";\n code += \"m33 \" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + temp1 + \"\\n\";\n for (i = 0; i < len; i++)\n code += \"m33 \" + animationRegisterData.rotationRegisters[i] + \".xyz,\" + animationRegisterData.rotationRegisters[i] + \",\" + temp1 + \"\\n\";\n }\n else {\n var nrmDirection = registerCache.getFreeVertexVectorTemp();\n registerCache.addVertexTempUsages(nrmDirection, 1);\n var temp = registerCache.getFreeVertexVectorTemp();\n registerCache.addVertexTempUsages(temp, 1);\n var cos = new ShaderRegisterElement(temp.regName, temp.index, 0);\n var sin = new ShaderRegisterElement(temp.regName, temp.index, 1);\n var o_temp = new ShaderRegisterElement(temp.regName, temp.index, 2);\n var tempSingle = new ShaderRegisterElement(temp.regName, temp.index, 3);\n var R = registerCache.getFreeVertexVectorTemp();\n registerCache.addVertexTempUsages(R, 1);\n registerCache.removeVertexTempUsage(nrmDirection);\n registerCache.removeVertexTempUsage(temp);\n registerCache.removeVertexTempUsage(R);\n code += \"sub \" + nrmDirection + \".xyz,\" + positionAttribute + \".xyz,\" + animationRegisterData.positionTarget + \".xyz\\n\";\n code += \"nrm \" + nrmDirection + \".xyz,\" + nrmDirection + \".xyz\\n\";\n code += \"mov \" + sin + \",\" + nrmDirection + \".y\\n\";\n code += \"mul \" + cos + \",\" + sin + \",\" + sin + \"\\n\";\n code += \"sub \" + cos + \",\" + animationRegisterData.vertexOneConst + \",\" + cos + \"\\n\";\n code += \"sqt \" + cos + \",\" + cos + \"\\n\";\n code += \"mul \" + R + \".x,\" + cos + \",\" + animationRegisterData.scaleAndRotateTarget + \".y\\n\";\n code += \"mul \" + R + \".y,\" + sin + \",\" + animationRegisterData.scaleAndRotateTarget + \".z\\n\";\n code += \"mul \" + R + \".z,\" + sin + \",\" + animationRegisterData.scaleAndRotateTarget + \".y\\n\";\n code += \"mul \" + R + \".w,\" + cos + \",\" + animationRegisterData.scaleAndRotateTarget + \".z\\n\";\n code += \"sub \" + animationRegisterData.scaleAndRotateTarget + \".y,\" + R + \".x,\" + R + \".y\\n\";\n code += \"add \" + animationRegisterData.scaleAndRotateTarget + \".z,\" + R + \".z,\" + R + \".w\\n\";\n code += \"abs \" + R + \".y,\" + nrmDirection + \".y\\n\";\n code += \"sge \" + R + \".z,\" + R + \".y,\" + animationRegisterData.vertexOneConst + \"\\n\";\n code += \"mul \" + R + \".x,\" + R + \".y,\" + nrmDirection + \".y\\n\";\n //judgu if nrmDirection=(0,1,0);\n code += \"mov \" + nrmDirection + \".y,\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"dp3 \" + sin + \",\" + nrmDirection + \".xyz,\" + nrmDirection + \".xyz\\n\";\n code += \"sge \" + tempSingle + \",\" + animationRegisterData.vertexZeroConst + \",\" + sin + \"\\n\";\n code += \"mov \" + nrmDirection + \".y,\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"nrm \" + nrmDirection + \".xyz,\" + nrmDirection + \".xyz\\n\";\n code += \"sub \" + sin + \",\" + animationRegisterData.vertexOneConst + \",\" + tempSingle + \"\\n\";\n code += \"mul \" + sin + \",\" + sin + \",\" + nrmDirection + \".x\\n\";\n code += \"mov \" + cos + \",\" + nrmDirection + \".z\\n\";\n code += \"neg \" + cos + \",\" + cos + \"\\n\";\n code += \"sub \" + o_temp + \",\" + animationRegisterData.vertexOneConst + \",\" + cos + \"\\n\";\n code += \"mul \" + o_temp + \",\" + R + \".x,\" + tempSingle + \"\\n\";\n code += \"add \" + cos + \",\" + cos + \",\" + o_temp + \"\\n\";\n code += \"mul \" + R + \".x,\" + cos + \",\" + animationRegisterData.scaleAndRotateTarget + \".x\\n\";\n code += \"mul \" + R + \".y,\" + sin + \",\" + animationRegisterData.scaleAndRotateTarget + \".z\\n\";\n code += \"mul \" + R + \".z,\" + sin + \",\" + animationRegisterData.scaleAndRotateTarget + \".x\\n\";\n code += \"mul \" + R + \".w,\" + cos + \",\" + animationRegisterData.scaleAndRotateTarget + \".z\\n\";\n code += \"sub \" + animationRegisterData.scaleAndRotateTarget + \".x,\" + R + \".x,\" + R + \".y\\n\";\n code += \"add \" + animationRegisterData.scaleAndRotateTarget + \".z,\" + R + \".z,\" + R + \".w\\n\";\n for (i = 0; i < len; i++) {\n //just repeat the calculate above\n //because of the limited registers, no need to optimise\n code += \"sub \" + nrmDirection + \".xyz,\" + positionAttribute + \".xyz,\" + animationRegisterData.positionTarget + \".xyz\\n\";\n code += \"nrm \" + nrmDirection + \".xyz,\" + nrmDirection + \".xyz\\n\";\n code += \"mov \" + sin + \",\" + nrmDirection + \".y\\n\";\n code += \"mul \" + cos + \",\" + sin + \",\" + sin + \"\\n\";\n code += \"sub \" + cos + \",\" + animationRegisterData.vertexOneConst + \",\" + cos + \"\\n\";\n code += \"sqt \" + cos + \",\" + cos + \"\\n\";\n code += \"mul \" + R + \".x,\" + cos + \",\" + animationRegisterData.rotationRegisters[i] + \".y\\n\";\n code += \"mul \" + R + \".y,\" + sin + \",\" + animationRegisterData.rotationRegisters[i] + \".z\\n\";\n code += \"mul \" + R + \".z,\" + sin + \",\" + animationRegisterData.rotationRegisters[i] + \".y\\n\";\n code += \"mul \" + R + \".w,\" + cos + \",\" + animationRegisterData.rotationRegisters[i] + \".z\\n\";\n code += \"sub \" + animationRegisterData.rotationRegisters[i] + \".y,\" + R + \".x,\" + R + \".y\\n\";\n code += \"add \" + animationRegisterData.rotationRegisters[i] + \".z,\" + R + \".z,\" + R + \".w\\n\";\n code += \"abs \" + R + \".y,\" + nrmDirection + \".y\\n\";\n code += \"sge \" + R + \".z,\" + R + \".y,\" + animationRegisterData.vertexOneConst + \"\\n\";\n code += \"mul \" + R + \".x,\" + R + \".y,\" + nrmDirection + \".y\\n\";\n code += \"mov \" + nrmDirection + \".y,\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"dp3 \" + sin + \",\" + nrmDirection + \".xyz,\" + nrmDirection + \".xyz\\n\";\n code += \"sge \" + tempSingle + \",\" + animationRegisterData.vertexZeroConst + \",\" + sin + \"\\n\";\n code += \"mov \" + nrmDirection + \".y,\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"nrm \" + nrmDirection + \".xyz,\" + nrmDirection + \".xyz\\n\";\n code += \"sub \" + sin + \",\" + animationRegisterData.vertexOneConst + \",\" + tempSingle + \"\\n\";\n code += \"mul \" + sin + \",\" + sin + \",\" + nrmDirection + \".x\\n\";\n code += \"mov \" + cos + \",\" + nrmDirection + \".z\\n\";\n code += \"neg \" + cos + \",\" + cos + \"\\n\";\n code += \"sub \" + o_temp + \",\" + animationRegisterData.vertexOneConst + \",\" + cos + \"\\n\";\n code += \"mul \" + o_temp + \",\" + R + \".x,\" + tempSingle + \"\\n\";\n code += \"add \" + cos + \",\" + cos + \",\" + o_temp + \"\\n\";\n code += \"mul \" + R + \".x,\" + cos + \",\" + animationRegisterData.rotationRegisters[i] + \".x\\n\";\n code += \"mul \" + R + \".y,\" + sin + \",\" + animationRegisterData.rotationRegisters[i] + \".z\\n\";\n code += \"mul \" + R + \".z,\" + sin + \",\" + animationRegisterData.rotationRegisters[i] + \".x\\n\";\n code += \"mul \" + R + \".w,\" + cos + \",\" + animationRegisterData.rotationRegisters[i] + \".z\\n\";\n code += \"sub \" + animationRegisterData.rotationRegisters[i] + \".x,\" + R + \".x,\" + R + \".y\\n\";\n code += \"add \" + animationRegisterData.rotationRegisters[i] + \".z,\" + R + \".z,\" + R + \".w\\n\";\n }\n }\n return code;\n };\n /**\n * @inheritDoc\n */\n ParticleRotateToPositionNode.prototype.getAnimationState = function (animator) {\n return animator.getAnimationState(this);\n };\n /**\n * @inheritDoc\n */\n ParticleRotateToPositionNode.prototype._iGeneratePropertyOfOneParticle = function (param) {\n var offset = param[ParticleRotateToPositionNode.POSITION_VECTOR3D];\n if (!offset)\n throw (new Error(\"there is no \" + ParticleRotateToPositionNode.POSITION_VECTOR3D + \" in param!\"));\n this._pOneData[0] = offset.x;\n this._pOneData[1] = offset.y;\n this._pOneData[2] = offset.z;\n };\n return ParticleRotateToPositionNode;\n}(ParticleNodeBase));\nexport { ParticleRotateToPositionNode };\n/**\n * Reference for the position the particle will rotate to face for a single particle (when in local property mode).\n * Expects a Vector3D object representing the position that the particle must face.\n */\nParticleRotateToPositionNode.POSITION_VECTOR3D = \"RotateToPositionVector3D\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/ParticleRotateToPositionNode.js","import * as tslib_1 from \"tslib\";\nimport { Vector3D } from \"@awayjs/core\";\nimport { ContextGLVertexBufferFormat } from \"@awayjs/stage\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleStateBase } from \"./ParticleStateBase\";\n/**\n * ...\n */\nvar ParticleRotationalVelocityState = (function (_super) {\n tslib_1.__extends(ParticleRotationalVelocityState, _super);\n function ParticleRotationalVelocityState(animator, particleRotationNode) {\n var _this = _super.call(this, animator, particleRotationNode) || this;\n _this._particleRotationalVelocityNode = particleRotationNode;\n _this._rotationalVelocity = _this._particleRotationalVelocityNode._iRotationalVelocity;\n _this.updateRotationalVelocityData();\n return _this;\n }\n Object.defineProperty(ParticleRotationalVelocityState.prototype, \"rotationalVelocity\", {\n /**\n * Defines the default rotationalVelocity of the state, used when in global mode.\n */\n get: function () {\n return this._rotationalVelocity;\n },\n set: function (value) {\n this._rotationalVelocity = value;\n this.updateRotationalVelocityData();\n },\n enumerable: true,\n configurable: true\n });\n /**\n *\n */\n ParticleRotationalVelocityState.prototype.getRotationalVelocities = function () {\n return this._pDynamicProperties;\n };\n ParticleRotationalVelocityState.prototype.setRotationalVelocities = function (value) {\n this._pDynamicProperties = value;\n this._pDynamicPropertiesDirty = new Object();\n };\n /**\n * @inheritDoc\n */\n ParticleRotationalVelocityState.prototype.setRenderState = function (shader, renderable, animationElements, animationRegisterData, projection, stage) {\n if (this._particleRotationalVelocityNode.mode == ParticlePropertiesMode.LOCAL_DYNAMIC && !this._pDynamicPropertiesDirty[animationElements._iUniqueId])\n this._pUpdateDynamicProperties(animationElements);\n var index = animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleRotationalVelocityState.ROTATIONALVELOCITY_INDEX);\n if (this._particleRotationalVelocityNode.mode == ParticlePropertiesMode.GLOBAL)\n shader.setVertexConst(index, this._rotationalVelocityData.x, this._rotationalVelocityData.y, this._rotationalVelocityData.z, this._rotationalVelocityData.w);\n else\n animationElements.activateVertexBuffer(index, this._particleRotationalVelocityNode._iDataOffset, stage, ContextGLVertexBufferFormat.FLOAT_4);\n };\n ParticleRotationalVelocityState.prototype.updateRotationalVelocityData = function () {\n if (this._particleRotationalVelocityNode.mode == ParticlePropertiesMode.GLOBAL) {\n if (this._rotationalVelocity.w <= 0)\n throw (new Error(\"the cycle duration must greater than zero\"));\n var rotation = this._rotationalVelocity.clone();\n if (rotation.length <= 0)\n rotation.z = 1; //set the default direction\n else\n rotation.normalize();\n // w is used as angle/2 in agal\n this._rotationalVelocityData = new Vector3D(rotation.x, rotation.y, rotation.z, Math.PI / rotation.w);\n }\n };\n return ParticleRotationalVelocityState;\n}(ParticleStateBase));\nexport { ParticleRotationalVelocityState };\n/** @private */\nParticleRotationalVelocityState.ROTATIONALVELOCITY_INDEX = 0;\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/ParticleRotationalVelocityState.js","import * as tslib_1 from \"tslib\";\nimport { Vector3D } from \"@awayjs/core\";\nimport { ShaderRegisterElement } from \"@awayjs/stage\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleRotationalVelocityState } from \"../states/ParticleRotationalVelocityState\";\nimport { ParticleNodeBase } from \"./ParticleNodeBase\";\n/**\n * A particle animation node used to set the starting rotational velocity of a particle.\n */\nvar ParticleRotationalVelocityNode = (function (_super) {\n tslib_1.__extends(ParticleRotationalVelocityNode, _super);\n /**\n * Creates a new ParticleRotationalVelocityNode\n *\n * @param mode Defines whether the mode of operation acts on local properties of a particle or global properties of the node.\n */\n function ParticleRotationalVelocityNode(mode, rotationalVelocity) {\n if (rotationalVelocity === void 0) { rotationalVelocity = null; }\n var _this = _super.call(this, \"ParticleRotationalVelocity\", mode, 4) || this;\n _this._pStateClass = ParticleRotationalVelocityState;\n _this._iRotationalVelocity = rotationalVelocity || new Vector3D();\n return _this;\n }\n /**\n * @inheritDoc\n */\n ParticleRotationalVelocityNode.prototype.getAGALVertexCode = function (shader, animationSet, registerCache, animationRegisterData) {\n var rotationRegister = (this._pMode == ParticlePropertiesMode.GLOBAL) ? registerCache.getFreeVertexConstant() : registerCache.getFreeVertexAttribute();\n animationRegisterData.setRegisterIndex(this, ParticleRotationalVelocityState.ROTATIONALVELOCITY_INDEX, rotationRegister.index);\n var nrmVel = registerCache.getFreeVertexVectorTemp();\n registerCache.addVertexTempUsages(nrmVel, 1);\n var xAxis = registerCache.getFreeVertexVectorTemp();\n registerCache.addVertexTempUsages(xAxis, 1);\n var temp = registerCache.getFreeVertexVectorTemp();\n registerCache.addVertexTempUsages(temp, 1);\n var Rtemp = new ShaderRegisterElement(temp.regName, temp.index);\n var R_rev = registerCache.getFreeVertexVectorTemp();\n R_rev = new ShaderRegisterElement(R_rev.regName, R_rev.index);\n var cos = new ShaderRegisterElement(Rtemp.regName, Rtemp.index, 3);\n var sin = new ShaderRegisterElement(R_rev.regName, R_rev.index, 3);\n registerCache.removeVertexTempUsage(nrmVel);\n registerCache.removeVertexTempUsage(xAxis);\n registerCache.removeVertexTempUsage(temp);\n var code = \"\";\n code += \"mov \" + nrmVel + \".xyz,\" + rotationRegister + \".xyz\\n\";\n code += \"mov \" + nrmVel + \".w,\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"mul \" + cos + \",\" + animationRegisterData.vertexTime + \",\" + rotationRegister + \".w\\n\";\n code += \"sin \" + sin + \",\" + cos + \"\\n\";\n code += \"cos \" + cos + \",\" + cos + \"\\n\";\n code += \"mul \" + Rtemp + \".xyz,\" + sin + \",\" + nrmVel + \".xyz\\n\";\n code += \"mul \" + R_rev + \".xyz,\" + sin + \",\" + nrmVel + \".xyz\\n\";\n code += \"neg \" + R_rev + \".xyz,\" + R_rev + \".xyz\\n\";\n //nrmVel and xAxis are used as temp register\n code += \"crs \" + nrmVel + \".xyz,\" + Rtemp + \".xyz,\" + animationRegisterData.scaleAndRotateTarget + \".xyz\\n\";\n code += \"mul \" + xAxis + \".xyz,\" + cos + \",\" + animationRegisterData.scaleAndRotateTarget + \".xyz\\n\";\n code += \"add \" + nrmVel + \".xyz,\" + nrmVel + \".xyz,\" + xAxis + \".xyz\\n\";\n code += \"dp3 \" + xAxis + \".w,\" + Rtemp + \".xyz,\" + animationRegisterData.scaleAndRotateTarget + \".xyz\\n\";\n code += \"neg \" + nrmVel + \".w,\" + xAxis + \".w\\n\";\n code += \"crs \" + Rtemp + \".xyz,\" + nrmVel + \".xyz,\" + R_rev + \".xyz\\n\";\n //use cos as R_rev.w\n code += \"mul \" + xAxis + \".xyzw,\" + nrmVel + \".xyzw,\" + cos + \"\\n\";\n code += \"add \" + Rtemp + \".xyz,\" + Rtemp + \".xyz,\" + xAxis + \".xyz\\n\";\n code += \"mul \" + xAxis + \".xyz,\" + nrmVel + \".w,\" + R_rev + \".xyz\\n\";\n code += \"add \" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + Rtemp + \".xyz,\" + xAxis + \".xyz\\n\";\n var len = animationRegisterData.rotationRegisters.length;\n for (var i = 0; i < len; i++) {\n code += \"mov \" + nrmVel + \".xyz,\" + rotationRegister + \".xyz\\n\";\n code += \"mov \" + nrmVel + \".w,\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"mul \" + cos + \",\" + animationRegisterData.vertexTime + \",\" + rotationRegister + \".w\\n\";\n code += \"sin \" + sin + \",\" + cos + \"\\n\";\n code += \"cos \" + cos + \",\" + cos + \"\\n\";\n code += \"mul \" + Rtemp + \".xyz,\" + sin + \",\" + nrmVel + \".xyz\\n\";\n code += \"mul \" + R_rev + \".xyz,\" + sin + \",\" + nrmVel + \".xyz\\n\";\n code += \"neg \" + R_rev + \".xyz,\" + R_rev + \".xyz\\n\";\n code += \"crs \" + nrmVel + \".xyz,\" + Rtemp + \".xyz,\" + animationRegisterData.rotationRegisters[i] + \".xyz\\n\";\n code += \"mul \" + xAxis + \".xyz,\" + cos + \",\" + animationRegisterData.rotationRegisters[i] + \"\\n\";\n code += \"add \" + nrmVel + \".xyz,\" + nrmVel + \".xyz,\" + xAxis + \".xyz\\n\";\n code += \"dp3 \" + xAxis + \".w,\" + Rtemp + \".xyz,\" + animationRegisterData.rotationRegisters[i] + \"\\n\";\n code += \"neg \" + nrmVel + \".w,\" + xAxis + \".w\\n\";\n code += \"crs \" + Rtemp + \".xyz,\" + nrmVel + \".xyz,\" + R_rev + \".xyz\\n\";\n code += \"mul \" + xAxis + \".xyzw,\" + nrmVel + \".xyzw,\" + cos + \"\\n\";\n code += \"add \" + Rtemp + \".xyz,\" + Rtemp + \".xyz,\" + xAxis + \".xyz\\n\";\n code += \"mul \" + xAxis + \".xyz,\" + nrmVel + \".w,\" + R_rev + \".xyz\\n\";\n code += \"add \" + animationRegisterData.rotationRegisters[i] + \",\" + Rtemp + \".xyz,\" + xAxis + \".xyz\\n\";\n }\n return code;\n };\n /**\n * @inheritDoc\n */\n ParticleRotationalVelocityNode.prototype.getAnimationState = function (animator) {\n return animator.getAnimationState(this);\n };\n /**\n * @inheritDoc\n */\n ParticleRotationalVelocityNode.prototype._iGeneratePropertyOfOneParticle = function (param) {\n //(Vector3d.x,Vector3d.y,Vector3d.z) is rotation axis,Vector3d.w is cycle duration\n var rotate = param[ParticleRotationalVelocityNode.ROTATIONALVELOCITY_VECTOR3D];\n if (!rotate)\n throw (new Error(\"there is no \" + ParticleRotationalVelocityNode.ROTATIONALVELOCITY_VECTOR3D + \" in param!\"));\n if (rotate.length <= 0)\n rotate.z = 1; //set the default direction\n else\n rotate.normalize();\n this._pOneData[0] = rotate.x;\n this._pOneData[1] = rotate.y;\n this._pOneData[2] = rotate.z;\n if (rotate.w <= 0)\n throw (new Error(\"the cycle duration must greater than zero\"));\n // it's used as angle/2 in agal\n this._pOneData[3] = Math.PI / rotate.w;\n };\n return ParticleRotationalVelocityNode;\n}(ParticleNodeBase));\nexport { ParticleRotationalVelocityNode };\n/**\n * Reference for rotational velocity node properties on a single particle (when in local property mode).\n * Expects a Vector3D object representing the rotational velocity around an axis of the particle.\n */\nParticleRotationalVelocityNode.ROTATIONALVELOCITY_VECTOR3D = \"RotationalVelocityVector3D\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/ParticleRotationalVelocityNode.js","import * as tslib_1 from \"tslib\";\nimport { Vector3D } from \"@awayjs/core\";\nimport { ContextGLVertexBufferFormat } from \"@awayjs/stage\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleStateBase } from \"./ParticleStateBase\";\n/**\n * ...\n */\nvar ParticleScaleState = (function (_super) {\n tslib_1.__extends(ParticleScaleState, _super);\n function ParticleScaleState(animator, particleScaleNode) {\n var _this = _super.call(this, animator, particleScaleNode) || this;\n _this._particleScaleNode = particleScaleNode;\n _this._usesCycle = _this._particleScaleNode._iUsesCycle;\n _this._usesPhase = _this._particleScaleNode._iUsesPhase;\n _this._minScale = _this._particleScaleNode._iMinScale;\n _this._maxScale = _this._particleScaleNode._iMaxScale;\n _this._cycleDuration = _this._particleScaleNode._iCycleDuration;\n _this._cyclePhase = _this._particleScaleNode._iCyclePhase;\n _this.updateScaleData();\n return _this;\n }\n Object.defineProperty(ParticleScaleState.prototype, \"minScale\", {\n /**\n * Defines the end scale of the state, when in global mode. Defaults to 1.\n */\n get: function () {\n return this._minScale;\n },\n set: function (value) {\n this._minScale = value;\n this.updateScaleData();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleScaleState.prototype, \"maxScale\", {\n /**\n * Defines the end scale of the state, when in global mode. Defaults to 1.\n */\n get: function () {\n return this._maxScale;\n },\n set: function (value) {\n this._maxScale = value;\n this.updateScaleData();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleScaleState.prototype, \"cycleDuration\", {\n /**\n * Defines the duration of the animation in seconds, used as a period independent of particle duration when in global mode. Defaults to 1.\n */\n get: function () {\n return this._cycleDuration;\n },\n set: function (value) {\n this._cycleDuration = value;\n this.updateScaleData();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleScaleState.prototype, \"cyclePhase\", {\n /**\n * Defines the phase of the cycle in degrees, used as the starting offset of the cycle when in global mode. Defaults to 0.\n */\n get: function () {\n return this._cyclePhase;\n },\n set: function (value) {\n this._cyclePhase = value;\n this.updateScaleData();\n },\n enumerable: true,\n configurable: true\n });\n ParticleScaleState.prototype.setRenderState = function (shader, renderable, animationElements, animationRegisterData, projection, stage) {\n var index = animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleScaleState.SCALE_INDEX);\n if (this._particleScaleNode.mode == ParticlePropertiesMode.LOCAL_STATIC) {\n if (this._usesCycle) {\n if (this._usesPhase)\n animationElements.activateVertexBuffer(index, this._particleScaleNode._iDataOffset, stage, ContextGLVertexBufferFormat.FLOAT_4);\n else\n animationElements.activateVertexBuffer(index, this._particleScaleNode._iDataOffset, stage, ContextGLVertexBufferFormat.FLOAT_3);\n }\n else\n animationElements.activateVertexBuffer(index, this._particleScaleNode._iDataOffset, stage, ContextGLVertexBufferFormat.FLOAT_2);\n }\n else\n shader.setVertexConst(index, this._scaleData.x, this._scaleData.y, this._scaleData.z, this._scaleData.w);\n };\n ParticleScaleState.prototype.updateScaleData = function () {\n if (this._particleScaleNode.mode == ParticlePropertiesMode.GLOBAL) {\n if (this._usesCycle) {\n if (this._cycleDuration <= 0)\n throw (new Error(\"the cycle duration must be greater than zero\"));\n this._scaleData = new Vector3D((this._minScale + this._maxScale) / 2, Math.abs(this._minScale - this._maxScale) / 2, Math.PI * 2 / this._cycleDuration, this._cyclePhase * Math.PI / 180);\n }\n else\n this._scaleData = new Vector3D(this._minScale, this._maxScale - this._minScale, 0, 0);\n }\n };\n return ParticleScaleState;\n}(ParticleStateBase));\nexport { ParticleScaleState };\n/** @private */\nParticleScaleState.SCALE_INDEX = 0;\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/ParticleScaleState.js","import * as tslib_1 from \"tslib\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleScaleState } from \"../states/ParticleScaleState\";\nimport { ParticleNodeBase } from \"./ParticleNodeBase\";\n/**\n * A particle animation node used to control the scale variation of a particle over time.\n */\nvar ParticleScaleNode = (function (_super) {\n tslib_1.__extends(ParticleScaleNode, _super);\n /**\n * Creates a new ParticleScaleNode\n *\n * @param mode Defines whether the mode of operation acts on local properties of a particle or global properties of the node.\n * @param [optional] usesCycle Defines whether the node uses the cycleDuration property in the shader to calculate the period of animation independent of particle duration. Defaults to false.\n * @param [optional] usesPhase Defines whether the node uses the cyclePhase property in the shader to calculate a starting offset to the animation cycle. Defaults to false.\n * @param [optional] minScale Defines the default min scale transform of the node, when in global mode. Defaults to 1.\n * @param [optional] maxScale Defines the default max color transform of the node, when in global mode. Defaults to 1.\n * @param [optional] cycleDuration Defines the default duration of the animation in seconds, used as a period independent of particle duration when in global mode. Defaults to 1.\n * @param [optional] cyclePhase Defines the default phase of the cycle in degrees, used as the starting offset of the cycle when in global mode. Defaults to 0.\n */\n function ParticleScaleNode(mode, usesCycle, usesPhase, minScale, maxScale, cycleDuration, cyclePhase) {\n if (minScale === void 0) { minScale = 1; }\n if (maxScale === void 0) { maxScale = 1; }\n if (cycleDuration === void 0) { cycleDuration = 1; }\n if (cyclePhase === void 0) { cyclePhase = 0; }\n var _this = _super.call(this, \"ParticleScale\", mode, (usesCycle && usesPhase) ? 4 : ((usesCycle || usesPhase) ? 3 : 2), 3) || this;\n _this._pStateClass = ParticleScaleState;\n _this._iUsesCycle = usesCycle;\n _this._iUsesPhase = usesPhase;\n _this._iMinScale = minScale;\n _this._iMaxScale = maxScale;\n _this._iCycleDuration = cycleDuration;\n _this._iCyclePhase = cyclePhase;\n return _this;\n }\n /**\n * @inheritDoc\n */\n ParticleScaleNode.prototype.getAGALVertexCode = function (shader, animationSet, registerCache, animationRegisterData) {\n var code = \"\";\n var temp = registerCache.getFreeVertexSingleTemp();\n var scaleRegister = (this._pMode == ParticlePropertiesMode.GLOBAL) ? registerCache.getFreeVertexConstant() : registerCache.getFreeVertexAttribute();\n animationRegisterData.setRegisterIndex(this, ParticleScaleState.SCALE_INDEX, scaleRegister.index);\n if (this._iUsesCycle) {\n code += \"mul \" + temp + \",\" + animationRegisterData.vertexTime + \",\" + scaleRegister + \".z\\n\";\n if (this._iUsesPhase)\n code += \"add \" + temp + \",\" + temp + \",\" + scaleRegister + \".w\\n\";\n code += \"sin \" + temp + \",\" + temp + \"\\n\";\n }\n code += \"mul \" + temp + \",\" + scaleRegister + \".y,\" + ((this._iUsesCycle) ? temp : animationRegisterData.vertexLife) + \"\\n\";\n code += \"add \" + temp + \",\" + scaleRegister + \".x,\" + temp + \"\\n\";\n code += \"mul \" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + animationRegisterData.scaleAndRotateTarget + \".xyz,\" + temp + \"\\n\";\n return code;\n };\n /**\n * @inheritDoc\n */\n ParticleScaleNode.prototype.getAnimationState = function (animator) {\n return animator.getAnimationState(this);\n };\n /**\n * @inheritDoc\n */\n ParticleScaleNode.prototype._iGeneratePropertyOfOneParticle = function (param) {\n var scale = param[ParticleScaleNode.SCALE_VECTOR3D];\n if (!scale)\n throw (new Error(\"there is no \" + ParticleScaleNode.SCALE_VECTOR3D + \" in param!\"));\n if (this._iUsesCycle) {\n this._pOneData[0] = (scale.x + scale.y) / 2;\n this._pOneData[1] = Math.abs(scale.x - scale.y) / 2;\n if (scale.z <= 0)\n throw (new Error(\"the cycle duration must be greater than zero\"));\n this._pOneData[2] = Math.PI * 2 / scale.z;\n if (this._iUsesPhase)\n this._pOneData[3] = scale.w * Math.PI / 180;\n }\n else {\n this._pOneData[0] = scale.x;\n this._pOneData[1] = scale.y - scale.x;\n }\n };\n return ParticleScaleNode;\n}(ParticleNodeBase));\nexport { ParticleScaleNode };\n/**\n * Reference for scale node properties on a single particle (when in local property mode).\n * Expects a Vector3D representing the min scale (x), max scale(y), optional cycle speed (z) and phase offset (w) applied to the particle.\n */\nParticleScaleNode.SCALE_VECTOR3D = \"ScaleVector3D\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/ParticleScaleNode.js","import * as tslib_1 from \"tslib\";\nimport { ParticleStateBase } from \"./ParticleStateBase\";\n/**\n *\n */\nvar ParticleSegmentedColorState = (function (_super) {\n tslib_1.__extends(ParticleSegmentedColorState, _super);\n function ParticleSegmentedColorState(animator, particleSegmentedColorNode) {\n var _this = _super.call(this, animator, particleSegmentedColorNode) || this;\n _this._usesMultiplier = particleSegmentedColorNode._iUsesMultiplier;\n _this._usesOffset = particleSegmentedColorNode._iUsesOffset;\n _this._startColor = particleSegmentedColorNode._iStartColor;\n _this._endColor = particleSegmentedColorNode._iEndColor;\n _this._segmentPoints = particleSegmentedColorNode._iSegmentPoints;\n _this._numSegmentPoint = particleSegmentedColorNode._iNumSegmentPoint;\n _this.updateColorData();\n return _this;\n }\n Object.defineProperty(ParticleSegmentedColorState.prototype, \"startColor\", {\n /**\n * Defines the start color transform of the state, when in global mode.\n */\n get: function () {\n return this._startColor;\n },\n set: function (value) {\n this._startColor = value;\n this.updateColorData();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleSegmentedColorState.prototype, \"endColor\", {\n /**\n * Defines the end color transform of the state, when in global mode.\n */\n get: function () {\n return this._endColor;\n },\n set: function (value) {\n this._endColor = value;\n this.updateColorData();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleSegmentedColorState.prototype, \"numSegmentPoint\", {\n /**\n * Defines the number of segments.\n */\n get: function () {\n return this._numSegmentPoint;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleSegmentedColorState.prototype, \"segmentPoints\", {\n /**\n * Defines the key points of color\n */\n get: function () {\n return this._segmentPoints;\n },\n set: function (value) {\n this._segmentPoints = value;\n this.updateColorData();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleSegmentedColorState.prototype, \"usesMultiplier\", {\n get: function () {\n return this._usesMultiplier;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleSegmentedColorState.prototype, \"usesOffset\", {\n get: function () {\n return this._usesOffset;\n },\n enumerable: true,\n configurable: true\n });\n ParticleSegmentedColorState.prototype.setRenderState = function (shader, renderable, animationElements, animationRegisterData, projection, stage) {\n if (shader.usesFragmentAnimation) {\n if (this._numSegmentPoint > 0)\n shader.setVertexConst(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleSegmentedColorState.TIME_DATA_INDEX), this._timeLifeData[0], this._timeLifeData[1], this._timeLifeData[2], this._timeLifeData[3]);\n if (this._usesMultiplier)\n shader.setVertexConstFromArray(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleSegmentedColorState.START_MULTIPLIER_INDEX), this._multiplierData);\n if (this._usesOffset)\n shader.setVertexConstFromArray(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleSegmentedColorState.START_OFFSET_INDEX), this._offsetData);\n }\n };\n ParticleSegmentedColorState.prototype.updateColorData = function () {\n this._timeLifeData = new Float32Array(4);\n this._multiplierData = new Float32Array(4 * (this._numSegmentPoint + 1));\n this._offsetData = new Float32Array(4 * (this._numSegmentPoint + 1));\n //cut off the time data\n var i;\n var j = 0;\n var count = this._numSegmentPoint > 3 ? 3 : this._numSegmentPoint;\n for (i = 0; i < count; i++) {\n if (i == 0)\n this._timeLifeData[j++] = this._segmentPoints[i].life;\n else\n this._timeLifeData[j++] = this._segmentPoints[i].life - this._segmentPoints[i - 1].life;\n }\n i = count;\n if (this._numSegmentPoint == 0)\n this._timeLifeData[j++] = 1;\n else\n this._timeLifeData[j++] = 1 - this._segmentPoints[i - 1].life;\n if (this._usesMultiplier) {\n j = 0;\n this._multiplierData[j++] = this._startColor.redMultiplier;\n this._multiplierData[j++] = this._startColor.greenMultiplier;\n this._multiplierData[j++] = this._startColor.blueMultiplier;\n this._multiplierData[j++] = this._startColor.alphaMultiplier;\n for (i = 0; i < this._numSegmentPoint; i++) {\n if (i == 0) {\n this._multiplierData[j++] = (this._segmentPoints[i].color.redMultiplier - this._startColor.redMultiplier) / this._timeLifeData[i];\n this._multiplierData[j++] = (this._segmentPoints[i].color.greenMultiplier - this._startColor.greenMultiplier) / this._timeLifeData[i];\n this._multiplierData[j++] = (this._segmentPoints[i].color.blueMultiplier - this._startColor.blueMultiplier) / this._timeLifeData[i];\n this._multiplierData[j++] = (this._segmentPoints[i].color.alphaMultiplier - this._startColor.alphaMultiplier) / this._timeLifeData[i];\n }\n else {\n this._multiplierData[j++] = (this._segmentPoints[i].color.redMultiplier - this._segmentPoints[i - 1].color.redMultiplier) / this._timeLifeData[i];\n this._multiplierData[j++] = (this._segmentPoints[i].color.greenMultiplier - this._segmentPoints[i - 1].color.greenMultiplier) / this._timeLifeData[i];\n this._multiplierData[j++] = (this._segmentPoints[i].color.blueMultiplier - this._segmentPoints[i - 1].color.blueMultiplier) / this._timeLifeData[i];\n this._multiplierData[j++] = (this._segmentPoints[i].color.alphaMultiplier - this._segmentPoints[i - 1].color.alphaMultiplier) / this._timeLifeData[i];\n }\n }\n i = this._numSegmentPoint;\n if (this._numSegmentPoint == 0) {\n this._multiplierData[j++] = this._endColor.redMultiplier - this._startColor.redMultiplier;\n this._multiplierData[j++] = this._endColor.greenMultiplier - this._startColor.greenMultiplier;\n this._multiplierData[j++] = this._endColor.blueMultiplier - this._startColor.blueMultiplier;\n this._multiplierData[j++] = this._endColor.alphaMultiplier - this._startColor.alphaMultiplier;\n }\n else {\n this._multiplierData[j++] = (this._endColor.redMultiplier - this._segmentPoints[i - 1].color.redMultiplier) / this._timeLifeData[i];\n this._multiplierData[j++] = (this._endColor.greenMultiplier - this._segmentPoints[i - 1].color.greenMultiplier) / this._timeLifeData[i];\n this._multiplierData[j++] = (this._endColor.blueMultiplier - this._segmentPoints[i - 1].color.blueMultiplier) / this._timeLifeData[i];\n this._multiplierData[j++] = (this._endColor.alphaMultiplier - this._segmentPoints[i - 1].color.alphaMultiplier) / this._timeLifeData[i];\n }\n }\n if (this._usesOffset) {\n j = 0;\n this._offsetData[j++] = this._startColor.redOffset / 255;\n this._offsetData[j++] = this._startColor.greenOffset / 255;\n this._offsetData[j++] = this._startColor.blueOffset / 255;\n this._offsetData[j++] = this._startColor.alphaOffset / 255;\n for (i = 0; i < this._numSegmentPoint; i++) {\n if (i == 0) {\n this._offsetData[j++] = (this._segmentPoints[i].color.redOffset - this._startColor.redOffset) / this._timeLifeData[i] / 255;\n this._offsetData[j++] = (this._segmentPoints[i].color.greenOffset - this._startColor.greenOffset) / this._timeLifeData[i] / 255;\n this._offsetData[j++] = (this._segmentPoints[i].color.blueOffset - this._startColor.blueOffset) / this._timeLifeData[i] / 255;\n this._offsetData[j++] = (this._segmentPoints[i].color.alphaOffset - this._startColor.alphaOffset) / this._timeLifeData[i] / 255;\n }\n else {\n this._offsetData[j++] = (this._segmentPoints[i].color.redOffset - this._segmentPoints[i - 1].color.redOffset) / this._timeLifeData[i] / 255;\n this._offsetData[j++] = (this._segmentPoints[i].color.greenOffset - this._segmentPoints[i - 1].color.greenOffset) / this._timeLifeData[i] / 255;\n this._offsetData[j++] = (this._segmentPoints[i].color.blueOffset - this._segmentPoints[i - 1].color.blueOffset) / this._timeLifeData[i] / 255;\n this._offsetData[j++] = (this._segmentPoints[i].color.alphaOffset - this._segmentPoints[i - 1].color.alphaOffset) / this._timeLifeData[i] / 255;\n }\n }\n i = this._numSegmentPoint;\n if (this._numSegmentPoint == 0) {\n this._offsetData[j++] = (this._endColor.redOffset - this._startColor.redOffset) / 255;\n this._offsetData[j++] = (this._endColor.greenOffset - this._startColor.greenOffset) / 255;\n this._offsetData[j++] = (this._endColor.blueOffset - this._startColor.blueOffset) / 255;\n this._offsetData[j++] = (this._endColor.alphaOffset - this._startColor.alphaOffset) / 255;\n }\n else {\n this._offsetData[i] = (this._endColor.redOffset - this._segmentPoints[i - 1].color.redOffset) / this._timeLifeData[i] / 255;\n this._offsetData[j++] = (this._endColor.greenOffset - this._segmentPoints[i - 1].color.greenOffset) / this._timeLifeData[i] / 255;\n this._offsetData[j++] = (this._endColor.blueOffset - this._segmentPoints[i - 1].color.blueOffset) / this._timeLifeData[i] / 255;\n this._offsetData[j++] = (this._endColor.alphaOffset - this._segmentPoints[i - 1].color.alphaOffset) / this._timeLifeData[i] / 255;\n }\n }\n };\n return ParticleSegmentedColorState;\n}(ParticleStateBase));\nexport { ParticleSegmentedColorState };\n/** @private */\nParticleSegmentedColorState.START_MULTIPLIER_INDEX = 0;\n/** @private */\nParticleSegmentedColorState.START_OFFSET_INDEX = 1;\n/** @private */\nParticleSegmentedColorState.TIME_DATA_INDEX = 2;\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/ParticleSegmentedColorState.js","import * as tslib_1 from \"tslib\";\nimport { ShaderRegisterElement } from \"@awayjs/stage\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleSegmentedColorState } from \"../states/ParticleSegmentedColorState\";\nimport { ParticleAnimationSet } from \"../ParticleAnimationSet\";\nimport { ParticleNodeBase } from \"./ParticleNodeBase\";\n/**\n *\n */\nvar ParticleSegmentedColorNode = (function (_super) {\n tslib_1.__extends(ParticleSegmentedColorNode, _super);\n function ParticleSegmentedColorNode(usesMultiplier, usesOffset, numSegmentPoint, startColor, endColor, segmentPoints) {\n var _this = \n //because of the stage3d register limitation, it only support the global mode\n _super.call(this, \"ParticleSegmentedColor\", ParticlePropertiesMode.GLOBAL, 0, ParticleAnimationSet.COLOR_PRIORITY) || this;\n _this._pStateClass = ParticleSegmentedColorState;\n if (numSegmentPoint > 4)\n throw (new Error(\"the numSegmentPoint must be less or equal 4\"));\n _this._iUsesMultiplier = usesMultiplier;\n _this._iUsesOffset = usesOffset;\n _this._iNumSegmentPoint = numSegmentPoint;\n _this._iStartColor = startColor;\n _this._iEndColor = endColor;\n _this._iSegmentPoints = segmentPoints;\n return _this;\n }\n /**\n * @inheritDoc\n */\n ParticleSegmentedColorNode.prototype._iProcessAnimationSetting = function (particleAnimationSet) {\n if (this._iUsesMultiplier)\n particleAnimationSet.hasColorMulNode = true;\n if (this._iUsesOffset)\n particleAnimationSet.hasColorAddNode = true;\n };\n /**\n * @inheritDoc\n */\n ParticleSegmentedColorNode.prototype.getAGALVertexCode = function (shader, animationSet, registerCache, animationRegisterData) {\n var code = \"\";\n if (shader.usesFragmentAnimation) {\n var accMultiplierColor;\n //var accOffsetColor:ShaderRegisterElement;\n if (this._iUsesMultiplier) {\n accMultiplierColor = registerCache.getFreeVertexVectorTemp();\n registerCache.addVertexTempUsages(accMultiplierColor, 1);\n }\n var tempColor = registerCache.getFreeVertexVectorTemp();\n registerCache.addVertexTempUsages(tempColor, 1);\n var temp = registerCache.getFreeVertexVectorTemp();\n var accTime = new ShaderRegisterElement(temp.regName, temp.index, 0);\n var tempTime = new ShaderRegisterElement(temp.regName, temp.index, 1);\n if (this._iUsesMultiplier)\n registerCache.removeVertexTempUsage(accMultiplierColor);\n registerCache.removeVertexTempUsage(tempColor);\n //for saving all the life values (at most 4)\n var lifeTimeRegister = registerCache.getFreeVertexConstant();\n animationRegisterData.setRegisterIndex(this, ParticleSegmentedColorState.TIME_DATA_INDEX, lifeTimeRegister.index);\n var i;\n var startMulValue;\n var deltaMulValues;\n if (this._iUsesMultiplier) {\n startMulValue = registerCache.getFreeVertexConstant();\n animationRegisterData.setRegisterIndex(this, ParticleSegmentedColorState.START_MULTIPLIER_INDEX, startMulValue.index);\n deltaMulValues = new Array();\n for (i = 0; i < this._iNumSegmentPoint + 1; i++)\n deltaMulValues.push(registerCache.getFreeVertexConstant());\n }\n var startOffsetValue;\n var deltaOffsetValues;\n if (this._iUsesOffset) {\n startOffsetValue = registerCache.getFreeVertexConstant();\n animationRegisterData.setRegisterIndex(this, ParticleSegmentedColorState.START_OFFSET_INDEX, startOffsetValue.index);\n deltaOffsetValues = new Array();\n for (i = 0; i < this._iNumSegmentPoint + 1; i++)\n deltaOffsetValues.push(registerCache.getFreeVertexConstant());\n }\n if (this._iUsesMultiplier)\n code += \"mov \" + accMultiplierColor + \",\" + startMulValue + \"\\n\";\n if (this._iUsesOffset)\n code += \"add \" + animationRegisterData.colorAddTarget + \",\" + animationRegisterData.colorAddTarget + \",\" + startOffsetValue + \"\\n\";\n for (i = 0; i < this._iNumSegmentPoint; i++) {\n switch (i) {\n case 0:\n code += \"min \" + tempTime + \",\" + animationRegisterData.vertexLife + \",\" + lifeTimeRegister + \".x\\n\";\n break;\n case 1:\n code += \"sub \" + accTime + \",\" + animationRegisterData.vertexLife + \",\" + lifeTimeRegister + \".x\\n\";\n code += \"max \" + tempTime + \",\" + accTime + \",\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"min \" + tempTime + \",\" + tempTime + \",\" + lifeTimeRegister + \".y\\n\";\n break;\n case 2:\n code += \"sub \" + accTime + \",\" + accTime + \",\" + lifeTimeRegister + \".y\\n\";\n code += \"max \" + tempTime + \",\" + accTime + \",\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"min \" + tempTime + \",\" + tempTime + \",\" + lifeTimeRegister + \".z\\n\";\n break;\n case 3:\n code += \"sub \" + accTime + \",\" + accTime + \",\" + lifeTimeRegister + \".z\\n\";\n code += \"max \" + tempTime + \",\" + accTime + \",\" + animationRegisterData.vertexZeroConst + \"\\n\";\n code += \"min \" + tempTime + \",\" + tempTime + \",\" + lifeTimeRegister + \".w\\n\";\n break;\n }\n if (this._iUsesMultiplier) {\n code += \"mul \" + tempColor + \",\" + tempTime + \",\" + deltaMulValues[i] + \"\\n\";\n code += \"add \" + accMultiplierColor + \",\" + accMultiplierColor + \",\" + tempColor + \"\\n\";\n }\n if (this._iUsesOffset) {\n code += \"mul \" + tempColor + \",\" + tempTime + \",\" + deltaOffsetValues[i] + \"\\n\";\n code += \"add \" + animationRegisterData.colorAddTarget + \",\" + animationRegisterData.colorAddTarget + \",\" + tempColor + \"\\n\";\n }\n }\n //for the last segment:\n if (this._iNumSegmentPoint == 0)\n tempTime = animationRegisterData.vertexLife;\n else {\n switch (this._iNumSegmentPoint) {\n case 1:\n code += \"sub \" + accTime + \",\" + animationRegisterData.vertexLife + \",\" + lifeTimeRegister + \".x\\n\";\n break;\n case 2:\n code += \"sub \" + accTime + \",\" + accTime + \",\" + lifeTimeRegister + \".y\\n\";\n break;\n case 3:\n code += \"sub \" + accTime + \",\" + accTime + \",\" + lifeTimeRegister + \".z\\n\";\n break;\n case 4:\n code += \"sub \" + accTime + \",\" + accTime + \",\" + lifeTimeRegister + \".w\\n\";\n break;\n }\n code += \"max \" + tempTime + \",\" + accTime + \",\" + animationRegisterData.vertexZeroConst + \"\\n\";\n }\n if (this._iUsesMultiplier) {\n code += \"mul \" + tempColor + \",\" + tempTime + \",\" + deltaMulValues[this._iNumSegmentPoint] + \"\\n\";\n code += \"add \" + accMultiplierColor + \",\" + accMultiplierColor + \",\" + tempColor + \"\\n\";\n code += \"mul \" + animationRegisterData.colorMulTarget + \",\" + animationRegisterData.colorMulTarget + \",\" + accMultiplierColor + \"\\n\";\n }\n if (this._iUsesOffset) {\n code += \"mul \" + tempColor + \",\" + tempTime + \",\" + deltaOffsetValues[this._iNumSegmentPoint] + \"\\n\";\n code += \"add \" + animationRegisterData.colorAddTarget + \",\" + animationRegisterData.colorAddTarget + \",\" + tempColor + \"\\n\";\n }\n }\n return code;\n };\n return ParticleSegmentedColorNode;\n}(ParticleNodeBase));\nexport { ParticleSegmentedColorNode };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/ParticleSegmentedColorNode.js","import * as tslib_1 from \"tslib\";\nimport { ContextGLVertexBufferFormat } from \"@awayjs/stage\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleStateBase } from \"./ParticleStateBase\";\n/**\n * ...\n */\nvar ParticleSpriteSheetState = (function (_super) {\n tslib_1.__extends(ParticleSpriteSheetState, _super);\n function ParticleSpriteSheetState(animator, particleSpriteSheetNode) {\n var _this = _super.call(this, animator, particleSpriteSheetNode) || this;\n _this._particleSpriteSheetNode = particleSpriteSheetNode;\n _this._usesCycle = _this._particleSpriteSheetNode._iUsesCycle;\n _this._usesPhase = _this._particleSpriteSheetNode._iUsesCycle;\n _this._totalFrames = _this._particleSpriteSheetNode._iTotalFrames;\n _this._numColumns = _this._particleSpriteSheetNode._iNumColumns;\n _this._numRows = _this._particleSpriteSheetNode._iNumRows;\n _this._cycleDuration = _this._particleSpriteSheetNode._iCycleDuration;\n _this._cyclePhase = _this._particleSpriteSheetNode._iCyclePhase;\n _this.updateSpriteSheetData();\n return _this;\n }\n Object.defineProperty(ParticleSpriteSheetState.prototype, \"cyclePhase\", {\n /**\n * Defines the cycle phase, when in global mode. Defaults to zero.\n */\n get: function () {\n return this._cyclePhase;\n },\n set: function (value) {\n this._cyclePhase = value;\n this.updateSpriteSheetData();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleSpriteSheetState.prototype, \"cycleDuration\", {\n /**\n * Defines the cycle duration in seconds, when in global mode. Defaults to 1.\n */\n get: function () {\n return this._cycleDuration;\n },\n set: function (value) {\n this._cycleDuration = value;\n this.updateSpriteSheetData();\n },\n enumerable: true,\n configurable: true\n });\n ParticleSpriteSheetState.prototype.setRenderState = function (shader, renderable, animationElements, animationRegisterData, projection, stage) {\n if (!shader.usesUVTransform) {\n shader.setVertexConst(animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleSpriteSheetState.UV_INDEX_0), this._spriteSheetData[0], this._spriteSheetData[1], this._spriteSheetData[2], this._spriteSheetData[3]);\n if (this._usesCycle) {\n var index = animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleSpriteSheetState.UV_INDEX_1);\n if (this._particleSpriteSheetNode.mode == ParticlePropertiesMode.LOCAL_STATIC) {\n if (this._usesPhase)\n animationElements.activateVertexBuffer(index, this._particleSpriteSheetNode._iDataOffset, stage, ContextGLVertexBufferFormat.FLOAT_3);\n else\n animationElements.activateVertexBuffer(index, this._particleSpriteSheetNode._iDataOffset, stage, ContextGLVertexBufferFormat.FLOAT_2);\n }\n else\n shader.setVertexConst(index, this._spriteSheetData[4], this._spriteSheetData[5]);\n }\n }\n };\n ParticleSpriteSheetState.prototype.updateSpriteSheetData = function () {\n this._spriteSheetData = new Array(8);\n var uTotal = this._totalFrames / this._numColumns;\n this._spriteSheetData[0] = uTotal;\n this._spriteSheetData[1] = 1 / this._numColumns;\n this._spriteSheetData[2] = 1 / this._numRows;\n if (this._usesCycle) {\n if (this._cycleDuration <= 0)\n throw (new Error(\"the cycle duration must be greater than zero\"));\n this._spriteSheetData[4] = uTotal / this._cycleDuration;\n this._spriteSheetData[5] = this._cycleDuration;\n if (this._usesPhase)\n this._spriteSheetData[6] = this._cyclePhase;\n }\n };\n return ParticleSpriteSheetState;\n}(ParticleStateBase));\nexport { ParticleSpriteSheetState };\n/** @private */\nParticleSpriteSheetState.UV_INDEX_0 = 0;\n/** @private */\nParticleSpriteSheetState.UV_INDEX_1 = 1;\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/ParticleSpriteSheetState.js","import * as tslib_1 from \"tslib\";\nimport { ShaderRegisterElement } from \"@awayjs/stage\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleSpriteSheetState } from \"../states/ParticleSpriteSheetState\";\nimport { ParticleAnimationSet } from \"../ParticleAnimationSet\";\nimport { ParticleNodeBase } from \"./ParticleNodeBase\";\n/**\n * A particle animation node used when a spritesheet texture is required to animate the particle.\n * NB: to enable use of this node, the repeat property on the material has to be set to true.\n */\nvar ParticleSpriteSheetNode = (function (_super) {\n tslib_1.__extends(ParticleSpriteSheetNode, _super);\n /**\n * Creates a new ParticleSpriteSheetNode\n *\n * @param mode Defines whether the mode of operation acts on local properties of a particle or global properties of the node.\n * @param [optional] numColumns Defines the number of columns in the spritesheet, when in global mode. Defaults to 1.\n * @param [optional] numRows Defines the number of rows in the spritesheet, when in global mode. Defaults to 1.\n * @param [optional] cycleDuration Defines the default cycle duration in seconds, when in global mode. Defaults to 1.\n * @param [optional] cyclePhase Defines the default cycle phase, when in global mode. Defaults to 0.\n * @param [optional] totalFrames Defines the total number of frames used by the spritesheet, when in global mode. Defaults to the number defined by numColumns and numRows.\n * @param [optional] looping Defines whether the spritesheet animation is set to loop indefinitely. Defaults to true.\n */\n function ParticleSpriteSheetNode(mode, usesCycle, usesPhase, numColumns, numRows, cycleDuration, cyclePhase, totalFrames) {\n if (numColumns === void 0) { numColumns = 1; }\n if (numRows === void 0) { numRows = 1; }\n if (cycleDuration === void 0) { cycleDuration = 1; }\n if (cyclePhase === void 0) { cyclePhase = 0; }\n if (totalFrames === void 0) { totalFrames = Number.MAX_VALUE; }\n var _this = _super.call(this, \"ParticleSpriteSheet\", mode, usesCycle ? (usesPhase ? 3 : 2) : 1, ParticleAnimationSet.POST_PRIORITY + 1) || this;\n _this._pStateClass = ParticleSpriteSheetState;\n _this._iUsesCycle = usesCycle;\n _this._iUsesPhase = usesPhase;\n _this._iNumColumns = numColumns;\n _this._iNumRows = numRows;\n _this._iCyclePhase = cyclePhase;\n _this._iCycleDuration = cycleDuration;\n _this._iTotalFrames = Math.min(totalFrames, numColumns * numRows);\n return _this;\n }\n Object.defineProperty(ParticleSpriteSheetNode.prototype, \"numColumns\", {\n /**\n * Defines the number of columns in the spritesheet, when in global mode. Defaults to 1. Read only.\n */\n get: function () {\n return this._iNumColumns;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleSpriteSheetNode.prototype, \"numRows\", {\n /**\n * Defines the number of rows in the spritesheet, when in global mode. Defaults to 1. Read only.\n */\n get: function () {\n return this._iNumRows;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleSpriteSheetNode.prototype, \"totalFrames\", {\n /**\n * Defines the total number of frames used by the spritesheet, when in global mode. Defaults to the number defined by numColumns and numRows. Read only.\n */\n get: function () {\n return this._iTotalFrames;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * @inheritDoc\n */\n ParticleSpriteSheetNode.prototype.getAGALUVCode = function (shader, animationSet, registerCache, animationRegisterData) {\n //get 2 vc\n var uvParamConst1 = registerCache.getFreeVertexConstant();\n var uvParamConst2 = (this._pMode == ParticlePropertiesMode.GLOBAL) ? registerCache.getFreeVertexConstant() : registerCache.getFreeVertexAttribute();\n animationRegisterData.setRegisterIndex(this, ParticleSpriteSheetState.UV_INDEX_0, uvParamConst1.index);\n animationRegisterData.setRegisterIndex(this, ParticleSpriteSheetState.UV_INDEX_1, uvParamConst2.index);\n var uTotal = new ShaderRegisterElement(uvParamConst1.regName, uvParamConst1.index, 0);\n var uStep = new ShaderRegisterElement(uvParamConst1.regName, uvParamConst1.index, 1);\n var vStep = new ShaderRegisterElement(uvParamConst1.regName, uvParamConst1.index, 2);\n var uSpeed = new ShaderRegisterElement(uvParamConst2.regName, uvParamConst2.index, 0);\n var cycle = new ShaderRegisterElement(uvParamConst2.regName, uvParamConst2.index, 1);\n var phaseTime = new ShaderRegisterElement(uvParamConst2.regName, uvParamConst2.index, 2);\n var temp = registerCache.getFreeVertexVectorTemp();\n var time = new ShaderRegisterElement(temp.regName, temp.index, 0);\n var vOffset = new ShaderRegisterElement(temp.regName, temp.index, 1);\n temp = new ShaderRegisterElement(temp.regName, temp.index, 2);\n var temp2 = new ShaderRegisterElement(temp.regName, temp.index, 3);\n var u = new ShaderRegisterElement(animationRegisterData.uvTarget.regName, animationRegisterData.uvTarget.index, 0);\n var v = new ShaderRegisterElement(animationRegisterData.uvTarget.regName, animationRegisterData.uvTarget.index, 1);\n var code = \"\";\n //scale uv\n code += \"mul \" + u + \",\" + u + \",\" + uStep + \"\\n\";\n if (this._iNumRows > 1)\n code += \"mul \" + v + \",\" + v + \",\" + vStep + \"\\n\";\n if (this._iUsesCycle) {\n if (this._iUsesPhase)\n code += \"add \" + time + \",\" + animationRegisterData.vertexTime + \",\" + phaseTime + \"\\n\";\n else\n code += \"mov \" + time + \",\" + animationRegisterData.vertexTime + \"\\n\";\n code += \"div \" + time + \",\" + time + \",\" + cycle + \"\\n\";\n code += \"frc \" + time + \",\" + time + \"\\n\";\n code += \"mul \" + time + \",\" + time + \",\" + cycle + \"\\n\";\n code += \"mul \" + temp + \",\" + time + \",\" + uSpeed + \"\\n\";\n }\n else\n code += \"mul \" + temp.toString() + \",\" + animationRegisterData.vertexLife + \",\" + uTotal + \"\\n\";\n if (this._iNumRows > 1) {\n code += \"frc \" + temp2 + \",\" + temp + \"\\n\";\n code += \"sub \" + vOffset + \",\" + temp + \",\" + temp2 + \"\\n\";\n code += \"mul \" + vOffset + \",\" + vOffset + \",\" + vStep + \"\\n\";\n code += \"add \" + v + \",\" + v + \",\" + vOffset + \"\\n\";\n }\n code += \"div \" + temp2 + \",\" + temp + \",\" + uStep + \"\\n\";\n code += \"frc \" + temp + \",\" + temp2 + \"\\n\";\n code += \"sub \" + temp2 + \",\" + temp2 + \",\" + temp + \"\\n\";\n code += \"mul \" + temp + \",\" + temp2 + \",\" + uStep + \"\\n\";\n if (this._iNumRows > 1)\n code += \"frc \" + temp + \",\" + temp + \"\\n\";\n code += \"add \" + u + \",\" + u + \",\" + temp + \"\\n\";\n return code;\n };\n /**\n * @inheritDoc\n */\n ParticleSpriteSheetNode.prototype.getAnimationState = function (animator) {\n return animator.getAnimationState(this);\n };\n /**\n * @inheritDoc\n */\n ParticleSpriteSheetNode.prototype._iProcessAnimationSetting = function (particleAnimationSet) {\n particleAnimationSet.hasUVNode = true;\n };\n /**\n * @inheritDoc\n */\n ParticleSpriteSheetNode.prototype._iGeneratePropertyOfOneParticle = function (param) {\n if (this._iUsesCycle) {\n var uvCycle = param[ParticleSpriteSheetNode.UV_VECTOR3D];\n if (!uvCycle)\n throw (new Error(\"there is no \" + ParticleSpriteSheetNode.UV_VECTOR3D + \" in param!\"));\n if (uvCycle.x <= 0)\n throw (new Error(\"the cycle duration must be greater than zero\"));\n var uTotal = this._iTotalFrames / this._iNumColumns;\n this._pOneData[0] = uTotal / uvCycle.x;\n this._pOneData[1] = uvCycle.x;\n if (this._iUsesPhase)\n this._pOneData[2] = uvCycle.y;\n }\n };\n return ParticleSpriteSheetNode;\n}(ParticleNodeBase));\nexport { ParticleSpriteSheetNode };\n/**\n * Reference for spritesheet node properties on a single particle (when in local property mode).\n * Expects a Vector3D representing the cycleDuration (x), optional phaseTime (y).\n */\nParticleSpriteSheetNode.UV_VECTOR3D = \"UVVector3D\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/ParticleSpriteSheetNode.js","import * as tslib_1 from \"tslib\";\nimport { ParticleStateBase } from \"./ParticleStateBase\";\n/**\n * ...\n */\nvar ParticleUVState = (function (_super) {\n tslib_1.__extends(ParticleUVState, _super);\n function ParticleUVState(animator, particleUVNode) {\n var _this = _super.call(this, animator, particleUVNode) || this;\n _this._particleUVNode = particleUVNode;\n return _this;\n }\n ParticleUVState.prototype.setRenderState = function (shader, renderable, animationElements, animationRegisterData, projection, stage) {\n if (!shader.usesUVTransform) {\n var index = animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleUVState.UV_INDEX);\n var data = this._particleUVNode._iUvData;\n shader.setVertexConst(index, data.x, data.y);\n }\n };\n return ParticleUVState;\n}(ParticleStateBase));\nexport { ParticleUVState };\n/** @private */\nParticleUVState.UV_INDEX = 0;\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/ParticleUVState.js","import * as tslib_1 from \"tslib\";\nimport { Vector3D } from \"@awayjs/core\";\nimport { ShaderRegisterElement } from \"@awayjs/stage\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleUVState } from \"../states/ParticleUVState\";\nimport { ParticleAnimationSet } from \"../ParticleAnimationSet\";\nimport { ParticleNodeBase } from \"./ParticleNodeBase\";\n/**\n * A particle animation node used to control the UV offset and scale of a particle over time.\n */\nvar ParticleUVNode = (function (_super) {\n tslib_1.__extends(ParticleUVNode, _super);\n /**\n * Creates a new ParticleTimeNode\n *\n * @param mode Defines whether the mode of operation acts on local properties of a particle or global properties of the node.\n * @param [optional] cycle Defines whether the time track is in loop mode. Defaults to false.\n * @param [optional] scale Defines whether the time track is in loop mode. Defaults to false.\n * @param [optional] axis Defines whether the time track is in loop mode. Defaults to false.\n */\n function ParticleUVNode(mode, cycle, scale, axis) {\n if (cycle === void 0) { cycle = 1; }\n if (scale === void 0) { scale = 1; }\n if (axis === void 0) { axis = \"x\"; }\n var _this = \n //because of the stage3d register limitation, it only support the global mode\n _super.call(this, \"ParticleUV\", ParticlePropertiesMode.GLOBAL, 4, ParticleAnimationSet.POST_PRIORITY + 1) || this;\n _this._pStateClass = ParticleUVState;\n _this._cycle = cycle;\n _this._scale = scale;\n _this._axis = axis;\n _this.updateUVData();\n return _this;\n }\n Object.defineProperty(ParticleUVNode.prototype, \"cycle\", {\n /**\n *\n */\n get: function () {\n return this._cycle;\n },\n set: function (value) {\n this._cycle = value;\n this.updateUVData();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleUVNode.prototype, \"scale\", {\n /**\n *\n */\n get: function () {\n return this._scale;\n },\n set: function (value) {\n this._scale = value;\n this.updateUVData();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ParticleUVNode.prototype, \"axis\", {\n /**\n *\n */\n get: function () {\n return this._axis;\n },\n set: function (value) {\n this._axis = value;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * @inheritDoc\n */\n ParticleUVNode.prototype.getAGALUVCode = function (shader, animationSet, registerCache, animationRegisterData) {\n var code = \"\";\n var uvConst = registerCache.getFreeVertexConstant();\n animationRegisterData.setRegisterIndex(this, ParticleUVState.UV_INDEX, uvConst.index);\n var axisIndex = this._axis == \"x\" ? 0 : (this._axis == \"y\" ? 1 : 2);\n var target = new ShaderRegisterElement(animationRegisterData.uvTarget.regName, animationRegisterData.uvTarget.index, axisIndex);\n var sin = registerCache.getFreeVertexSingleTemp();\n if (this._scale != 1)\n code += \"mul \" + target + \",\" + target + \",\" + uvConst + \".y\\n\";\n code += \"mul \" + sin + \",\" + animationRegisterData.vertexTime + \",\" + uvConst + \".x\\n\";\n code += \"sin \" + sin + \",\" + sin + \"\\n\";\n code += \"add \" + target + \",\" + target + \",\" + sin + \"\\n\";\n return code;\n };\n /**\n * @inheritDoc\n */\n ParticleUVNode.prototype.getAnimationState = function (animator) {\n return animator.getAnimationState(this);\n };\n ParticleUVNode.prototype.updateUVData = function () {\n this._iUvData = new Vector3D(Math.PI * 2 / this._cycle, this._scale, 0, 0);\n };\n /**\n * @inheritDoc\n */\n ParticleUVNode.prototype._iProcessAnimationSetting = function (particleAnimationSet) {\n particleAnimationSet.hasUVNode = true;\n };\n return ParticleUVNode;\n}(ParticleNodeBase));\nexport { ParticleUVNode };\n/**\n *\n */\nParticleUVNode.U_AXIS = \"x\";\n/**\n *\n */\nParticleUVNode.V_AXIS = \"y\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/ParticleUVNode.js","import * as tslib_1 from \"tslib\";\nimport { ContextGLVertexBufferFormat } from \"@awayjs/stage\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleStateBase } from \"./ParticleStateBase\";\n/**\n * ...\n */\nvar ParticleVelocityState = (function (_super) {\n tslib_1.__extends(ParticleVelocityState, _super);\n function ParticleVelocityState(animator, particleVelocityNode) {\n var _this = _super.call(this, animator, particleVelocityNode) || this;\n _this._particleVelocityNode = particleVelocityNode;\n _this._velocity = _this._particleVelocityNode._iVelocity;\n return _this;\n }\n Object.defineProperty(ParticleVelocityState.prototype, \"velocity\", {\n /**\n * Defines the default velocity vector of the state, used when in global mode.\n */\n get: function () {\n return this._velocity;\n },\n set: function (value) {\n this._velocity = value;\n },\n enumerable: true,\n configurable: true\n });\n /**\n *\n */\n ParticleVelocityState.prototype.getVelocities = function () {\n return this._pDynamicProperties;\n };\n ParticleVelocityState.prototype.setVelocities = function (value) {\n this._pDynamicProperties = value;\n this._pDynamicPropertiesDirty = new Object();\n };\n ParticleVelocityState.prototype.setRenderState = function (shader, renderable, animationElements, animationRegisterData, projection, stage) {\n if (this._particleVelocityNode.mode == ParticlePropertiesMode.LOCAL_DYNAMIC && !this._pDynamicPropertiesDirty[animationElements._iUniqueId])\n this._pUpdateDynamicProperties(animationElements);\n var index = animationRegisterData.getRegisterIndex(this._pAnimationNode, ParticleVelocityState.VELOCITY_INDEX);\n if (this._particleVelocityNode.mode == ParticlePropertiesMode.GLOBAL)\n shader.setVertexConst(index, this._velocity.x, this._velocity.y, this._velocity.z);\n else\n animationElements.activateVertexBuffer(index, this._particleVelocityNode._iDataOffset, stage, ContextGLVertexBufferFormat.FLOAT_3);\n };\n return ParticleVelocityState;\n}(ParticleStateBase));\nexport { ParticleVelocityState };\n/** @private */\nParticleVelocityState.VELOCITY_INDEX = 0;\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/ParticleVelocityState.js","import * as tslib_1 from \"tslib\";\nimport { Vector3D } from \"@awayjs/core\";\nimport { ParticlePropertiesMode } from \"../data/ParticlePropertiesMode\";\nimport { ParticleVelocityState } from \"../states/ParticleVelocityState\";\nimport { ParticleNodeBase } from \"./ParticleNodeBase\";\n/**\n * A particle animation node used to set the starting velocity of a particle.\n */\nvar ParticleVelocityNode = (function (_super) {\n tslib_1.__extends(ParticleVelocityNode, _super);\n /**\n * Creates a new ParticleVelocityNode\n *\n * @param mode Defines whether the mode of operation acts on local properties of a particle or global properties of the node.\n * @param [optional] velocity Defines the default velocity vector of the node, used when in global mode.\n */\n function ParticleVelocityNode(mode, velocity) {\n if (velocity === void 0) { velocity = null; }\n var _this = _super.call(this, \"ParticleVelocity\", mode, 3) || this;\n _this._pStateClass = ParticleVelocityState;\n _this._iVelocity = velocity || new Vector3D();\n return _this;\n }\n /**\n * @inheritDoc\n */\n ParticleVelocityNode.prototype.getAGALVertexCode = function (shader, animationSet, registerCache, animationRegisterData) {\n var velocityValue = (this._pMode == ParticlePropertiesMode.GLOBAL) ? registerCache.getFreeVertexConstant() : registerCache.getFreeVertexAttribute();\n animationRegisterData.setRegisterIndex(this, ParticleVelocityState.VELOCITY_INDEX, velocityValue.index);\n var distance = registerCache.getFreeVertexVectorTemp();\n var code = \"\";\n code += \"mul \" + distance + \",\" + animationRegisterData.vertexTime + \",\" + velocityValue + \"\\n\";\n code += \"add \" + animationRegisterData.positionTarget + \".xyz,\" + distance + \",\" + animationRegisterData.positionTarget + \".xyz\\n\";\n if (animationSet.needVelocity)\n code += \"add \" + animationRegisterData.velocityTarget + \".xyz,\" + velocityValue + \".xyz,\" + animationRegisterData.velocityTarget + \".xyz\\n\";\n return code;\n };\n /**\n * @inheritDoc\n */\n ParticleVelocityNode.prototype.getAnimationState = function (animator) {\n return animator.getAnimationState(this);\n };\n /**\n * @inheritDoc\n */\n ParticleVelocityNode.prototype._iGeneratePropertyOfOneParticle = function (param) {\n var _tempVelocity = param[ParticleVelocityNode.VELOCITY_VECTOR3D];\n if (!_tempVelocity)\n throw new Error(\"there is no \" + ParticleVelocityNode.VELOCITY_VECTOR3D + \" in param!\");\n this._pOneData[0] = _tempVelocity.x;\n this._pOneData[1] = _tempVelocity.y;\n this._pOneData[2] = _tempVelocity.z;\n };\n return ParticleVelocityNode;\n}(ParticleNodeBase));\nexport { ParticleVelocityNode };\n/**\n * Reference for velocity node properties on a single particle (when in local property mode).\n * Expects a Vector3D object representing the direction of movement on the particle.\n */\nParticleVelocityNode.VELOCITY_VECTOR3D = \"VelocityVector3D\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/ParticleVelocityNode.js","import * as tslib_1 from \"tslib\";\nimport { JointPose } from \"../data/JointPose\";\nimport { SkeletonPose } from \"../data/SkeletonPose\";\nimport { AnimationStateBase } from \"./AnimationStateBase\";\n/**\n *\n */\nvar SkeletonBinaryLERPState = (function (_super) {\n tslib_1.__extends(SkeletonBinaryLERPState, _super);\n function SkeletonBinaryLERPState(animator, skeletonAnimationNode) {\n var _this = _super.call(this, animator, skeletonAnimationNode) || this;\n _this._blendWeight = 0;\n _this._skeletonPose = new SkeletonPose();\n _this._skeletonPoseDirty = true;\n _this._skeletonAnimationNode = skeletonAnimationNode;\n _this._inputA = animator.getAnimationState(_this._skeletonAnimationNode.inputA);\n _this._inputB = animator.getAnimationState(_this._skeletonAnimationNode.inputB);\n return _this;\n }\n Object.defineProperty(SkeletonBinaryLERPState.prototype, \"blendWeight\", {\n /**\n * Defines a fractional value between 0 and 1 representing the blending ratio between inputA (0) and inputB (1),\n * used to produce the skeleton pose output.\n *\n * @see inputA\n * @see inputB\n */\n get: function () {\n return this._blendWeight;\n },\n set: function (value) {\n this._blendWeight = value;\n this._pPositionDeltaDirty = true;\n this._skeletonPoseDirty = true;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * @inheritDoc\n */\n SkeletonBinaryLERPState.prototype.phase = function (value) {\n this._skeletonPoseDirty = true;\n this._pPositionDeltaDirty = true;\n this._inputA.phase(value);\n this._inputB.phase(value);\n };\n /**\n * @inheritDoc\n */\n SkeletonBinaryLERPState.prototype._pUpdateTime = function (time) {\n this._skeletonPoseDirty = true;\n this._inputA.update(time);\n this._inputB.update(time);\n _super.prototype._pUpdateTime.call(this, time);\n };\n /**\n * Returns the current skeleton pose of the animation in the clip based on the internal playhead position.\n */\n SkeletonBinaryLERPState.prototype.getSkeletonPose = function (skeleton) {\n if (this._skeletonPoseDirty)\n this.updateSkeletonPose(skeleton);\n return this._skeletonPose;\n };\n /**\n * @inheritDoc\n */\n SkeletonBinaryLERPState.prototype._pUpdatePositionDelta = function () {\n this._pPositionDeltaDirty = false;\n var deltA = this._inputA.positionDelta;\n var deltB = this._inputB.positionDelta;\n this._pRootDelta.x = deltA.x + this._blendWeight * (deltB.x - deltA.x);\n this._pRootDelta.y = deltA.y + this._blendWeight * (deltB.y - deltA.y);\n this._pRootDelta.z = deltA.z + this._blendWeight * (deltB.z - deltA.z);\n };\n /**\n * Updates the output skeleton pose of the node based on the blendWeight value between input nodes.\n *\n * @param skeleton The skeleton used by the animator requesting the ouput pose.\n */\n SkeletonBinaryLERPState.prototype.updateSkeletonPose = function (skeleton) {\n this._skeletonPoseDirty = false;\n var endPose;\n var endPoses = this._skeletonPose.jointPoses;\n var poses1 = this._inputA.getSkeletonPose(skeleton).jointPoses;\n var poses2 = this._inputB.getSkeletonPose(skeleton).jointPoses;\n var pose1, pose2;\n var p1, p2;\n var tr;\n var numJoints = skeleton.numJoints;\n // :s\n if (endPoses.length != numJoints)\n endPoses.length = numJoints;\n for (var i = 0; i < numJoints; ++i) {\n endPose = endPoses[i];\n if (endPose == null)\n endPose = endPoses[i] = new JointPose();\n pose1 = poses1[i];\n pose2 = poses2[i];\n p1 = pose1.translation;\n p2 = pose2.translation;\n endPose.orientation.lerp(pose1.orientation, pose2.orientation, this._blendWeight);\n tr = endPose.translation;\n tr.x = p1.x + this._blendWeight * (p2.x - p1.x);\n tr.y = p1.y + this._blendWeight * (p2.y - p1.y);\n tr.z = p1.z + this._blendWeight * (p2.z - p1.z);\n }\n };\n return SkeletonBinaryLERPState;\n}(AnimationStateBase));\nexport { SkeletonBinaryLERPState };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/SkeletonBinaryLERPState.js","import * as tslib_1 from \"tslib\";\nimport { AnimationNodeBase } from \"@awayjs/graphics\";\nimport { SkeletonBinaryLERPState } from \"../states/SkeletonBinaryLERPState\";\n/**\n * A skeleton animation node that uses two animation node inputs to blend a lineraly interpolated output of a skeleton pose.\n */\nvar SkeletonBinaryLERPNode = (function (_super) {\n tslib_1.__extends(SkeletonBinaryLERPNode, _super);\n /**\n * Creates a new SkeletonBinaryLERPNode object.\n */\n function SkeletonBinaryLERPNode() {\n var _this = _super.call(this) || this;\n _this._pStateClass = SkeletonBinaryLERPState;\n return _this;\n }\n /**\n * @inheritDoc\n */\n SkeletonBinaryLERPNode.prototype.getAnimationState = function (animator) {\n return animator.getAnimationState(this);\n };\n return SkeletonBinaryLERPNode;\n}(AnimationNodeBase));\nexport { SkeletonBinaryLERPNode };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/SkeletonBinaryLERPNode.js","import * as tslib_1 from \"tslib\";\nimport { EventBase } from \"@awayjs/core\";\n/**\n * Dispatched to notify changes in an animation state's state.\n */\nvar AnimationStateEvent = (function (_super) {\n tslib_1.__extends(AnimationStateEvent, _super);\n /**\n * Create a new AnimatonStateEvent\n *\n * @param type The event type.\n * @param animator The animation state object that is the subject of this event.\n * @param animationNode The animation node inside the animation state from which the event originated.\n */\n function AnimationStateEvent(type, animator, animationState, animationNode) {\n var _this = _super.call(this, type) || this;\n _this._animator = animator;\n _this._animationState = animationState;\n _this._animationNode = animationNode;\n return _this;\n }\n Object.defineProperty(AnimationStateEvent.prototype, \"animator\", {\n /**\n * The animator object that is the subject of this event.\n */\n get: function () {\n return this._animator;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AnimationStateEvent.prototype, \"animationState\", {\n /**\n * The animation state object that is the subject of this event.\n */\n get: function () {\n return this._animationState;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AnimationStateEvent.prototype, \"animationNode\", {\n /**\n * The animation node inside the animation state from which the event originated.\n */\n get: function () {\n return this._animationNode;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * Clones the event.\n *\n * @return An exact duplicate of the current object.\n */\n AnimationStateEvent.prototype.clone = function () {\n return new AnimationStateEvent(this.type, this._animator, this._animationState, this._animationNode);\n };\n return AnimationStateEvent;\n}(EventBase));\nexport { AnimationStateEvent };\n/**\n * Dispatched when a non-looping clip node inside an animation state reaches the end of its timeline.\n */\nAnimationStateEvent.PLAYBACK_COMPLETE = \"playbackComplete\";\nAnimationStateEvent.TRANSITION_COMPLETE = \"transitionComplete\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/events/AnimationStateEvent.js","import * as tslib_1 from \"tslib\";\nimport { AnimationStateEvent } from \"../../events/AnimationStateEvent\";\nimport { AnimationStateBase } from \"./AnimationStateBase\";\n/**\n *\n */\nvar AnimationClipState = (function (_super) {\n tslib_1.__extends(AnimationClipState, _super);\n function AnimationClipState(animator, animationClipNode) {\n var _this = _super.call(this, animator, animationClipNode) || this;\n _this._pFramesDirty = true;\n _this._animationClipNode = animationClipNode;\n return _this;\n }\n Object.defineProperty(AnimationClipState.prototype, \"blendWeight\", {\n /**\n * Returns a fractional value between 0 and 1 representing the blending ratio of the current playhead position\n * between the current frame (0) and next frame (1) of the animation.\n *\n * @see #currentFrame\n * @see #nextFrame\n */\n get: function () {\n if (this._pFramesDirty)\n this._pUpdateFrames();\n return this._pBlendWeight;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AnimationClipState.prototype, \"currentFrame\", {\n /**\n * Returns the current frame of animation in the clip based on the internal playhead position.\n */\n get: function () {\n if (this._pFramesDirty)\n this._pUpdateFrames();\n return this._pCurrentFrame;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AnimationClipState.prototype, \"nextFrame\", {\n /**\n * Returns the next frame of animation in the clip based on the internal playhead position.\n */\n get: function () {\n if (this._pFramesDirty)\n this._pUpdateFrames();\n return this._pNextFrame;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * @inheritDoc\n */\n AnimationClipState.prototype.update = function (time) {\n if (!this._animationClipNode.looping) {\n if (time > this._pStartTime + this._animationClipNode.totalDuration)\n time = this._pStartTime + this._animationClipNode.totalDuration;\n else if (time < this._pStartTime)\n time = this._pStartTime;\n }\n if (this._pTime == time - this._pStartTime)\n return;\n this._pUpdateTime(time);\n };\n /**\n * @inheritDoc\n */\n AnimationClipState.prototype.phase = function (value) {\n var time = value * this._animationClipNode.totalDuration + this._pStartTime;\n if (this._pTime == time - this._pStartTime)\n return;\n this._pUpdateTime(time);\n };\n /**\n * @inheritDoc\n */\n AnimationClipState.prototype._pUpdateTime = function (time) {\n this._pFramesDirty = true;\n this._pTimeDir = (time - this._pStartTime > this._pTime) ? 1 : -1;\n _super.prototype._pUpdateTime.call(this, time);\n };\n /**\n * Updates the nodes internal playhead to determine the current and next animation frame, and the blendWeight between the two.\n *\n * @see #currentFrame\n * @see #nextFrame\n * @see #blendWeight\n */\n AnimationClipState.prototype._pUpdateFrames = function () {\n this._pFramesDirty = false;\n var looping = this._animationClipNode.looping;\n var totalDuration = this._animationClipNode.totalDuration;\n var lastFrame = this._animationClipNode.lastFrame;\n var time = this._pTime;\n //trace(\"time\", time, totalDuration)\n if (looping && (time >= totalDuration || time < 0)) {\n time %= totalDuration;\n if (time < 0)\n time += totalDuration;\n }\n if (!looping && time >= totalDuration) {\n this.notifyPlaybackComplete();\n this._pCurrentFrame = lastFrame;\n this._pNextFrame = lastFrame;\n this._pBlendWeight = 0;\n }\n else if (!looping && time <= 0) {\n this._pCurrentFrame = 0;\n this._pNextFrame = 0;\n this._pBlendWeight = 0;\n }\n else if (this._animationClipNode.fixedFrameRate) {\n var t = time / totalDuration * lastFrame;\n this._pCurrentFrame = Math.floor(t);\n this._pBlendWeight = t - this._pCurrentFrame;\n this._pNextFrame = this._pCurrentFrame + 1;\n }\n else {\n this._pCurrentFrame = 0;\n this._pNextFrame = 0;\n var dur = 0, frameTime;\n var durations = this._animationClipNode.durations;\n do {\n frameTime = dur;\n dur += durations[this._pNextFrame];\n this._pCurrentFrame = this._pNextFrame++;\n } while (time > dur);\n if (this._pCurrentFrame == lastFrame) {\n this._pCurrentFrame = 0;\n this._pNextFrame = 1;\n }\n this._pBlendWeight = (time - frameTime) / durations[this._pCurrentFrame];\n }\n };\n AnimationClipState.prototype.notifyPlaybackComplete = function () {\n if (this._animationStatePlaybackComplete == null)\n this._animationStatePlaybackComplete = new AnimationStateEvent(AnimationStateEvent.PLAYBACK_COMPLETE, this._pAnimator, this, this._animationClipNode);\n this._animationClipNode.dispatchEvent(this._animationStatePlaybackComplete);\n };\n return AnimationClipState;\n}(AnimationStateBase));\nexport { AnimationClipState };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/AnimationClipState.js","import * as tslib_1 from \"tslib\";\nimport { Vector3D } from \"@awayjs/core\";\nimport { JointPose } from \"../data/JointPose\";\nimport { SkeletonPose } from \"../data/SkeletonPose\";\nimport { AnimationClipState } from \"./AnimationClipState\";\n/**\n *\n */\nvar SkeletonClipState = (function (_super) {\n tslib_1.__extends(SkeletonClipState, _super);\n function SkeletonClipState(animator, skeletonClipNode) {\n var _this = _super.call(this, animator, skeletonClipNode) || this;\n _this._rootPos = new Vector3D();\n _this._skeletonPose = new SkeletonPose();\n _this._skeletonPoseDirty = true;\n _this._skeletonClipNode = skeletonClipNode;\n _this._frames = _this._skeletonClipNode.frames;\n return _this;\n }\n Object.defineProperty(SkeletonClipState.prototype, \"currentPose\", {\n /**\n * Returns the current skeleton pose frame of animation in the clip based on the internal playhead position.\n */\n get: function () {\n if (this._pFramesDirty)\n this._pUpdateFrames();\n return this._currentPose;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(SkeletonClipState.prototype, \"nextPose\", {\n /**\n * Returns the next skeleton pose frame of animation in the clip based on the internal playhead position.\n */\n get: function () {\n if (this._pFramesDirty)\n this._pUpdateFrames();\n return this._nextPose;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * Returns the current skeleton pose of the animation in the clip based on the internal playhead position.\n */\n SkeletonClipState.prototype.getSkeletonPose = function (skeleton) {\n if (this._skeletonPoseDirty)\n this.updateSkeletonPose(skeleton);\n return this._skeletonPose;\n };\n /**\n * @inheritDoc\n */\n SkeletonClipState.prototype._pUpdateTime = function (time) {\n this._skeletonPoseDirty = true;\n _super.prototype._pUpdateTime.call(this, time);\n };\n /**\n * @inheritDoc\n */\n SkeletonClipState.prototype._pUpdateFrames = function () {\n _super.prototype._pUpdateFrames.call(this);\n this._currentPose = this._frames[this._pCurrentFrame];\n if (this._skeletonClipNode.looping && this._pNextFrame >= this._skeletonClipNode.lastFrame) {\n this._nextPose = this._frames[0];\n this._pAnimator.dispatchCycleEvent();\n }\n else\n this._nextPose = this._frames[this._pNextFrame];\n };\n /**\n * Updates the output skeleton pose of the node based on the internal playhead position.\n *\n * @param skeleton The skeleton used by the animator requesting the ouput pose.\n */\n SkeletonClipState.prototype.updateSkeletonPose = function (skeleton) {\n this._skeletonPoseDirty = false;\n if (!this._skeletonClipNode.totalDuration)\n return;\n if (this._pFramesDirty)\n this._pUpdateFrames();\n var currentPose = this._currentPose.jointPoses;\n var nextPose = this._nextPose.jointPoses;\n var numJoints = skeleton.numJoints;\n var p1, p2;\n var pose1, pose2;\n var endPoses = this._skeletonPose.jointPoses;\n var endPose;\n var tr;\n // :s\n if (endPoses.length != numJoints)\n endPoses.length = numJoints;\n if ((numJoints != currentPose.length) || (numJoints != nextPose.length))\n throw new Error(\"joint counts don't match!\");\n for (var i = 0; i < numJoints; ++i) {\n endPose = endPoses[i];\n if (endPose == null)\n endPose = endPoses[i] = new JointPose();\n pose1 = currentPose[i];\n pose2 = nextPose[i];\n p1 = pose1.translation;\n p2 = pose2.translation;\n if (this._skeletonClipNode.highQuality)\n endPose.orientation.slerp(pose1.orientation, pose2.orientation, this._pBlendWeight);\n else\n endPose.orientation.lerp(pose1.orientation, pose2.orientation, this._pBlendWeight);\n if (i > 0) {\n tr = endPose.translation;\n tr.x = p1.x + this._pBlendWeight * (p2.x - p1.x);\n tr.y = p1.y + this._pBlendWeight * (p2.y - p1.y);\n tr.z = p1.z + this._pBlendWeight * (p2.z - p1.z);\n }\n }\n };\n /**\n * @inheritDoc\n */\n SkeletonClipState.prototype._pUpdatePositionDelta = function () {\n this._pPositionDeltaDirty = false;\n if (this._pFramesDirty)\n this._pUpdateFrames();\n var p1, p2, p3;\n var totalDelta = this._skeletonClipNode.totalDelta;\n // jumping back, need to reset position\n if ((this._pTimeDir > 0 && this._pNextFrame < this._pOldFrame) || (this._pTimeDir < 0 && this._pNextFrame > this._pOldFrame)) {\n this._rootPos.x -= totalDelta.x * this._pTimeDir;\n this._rootPos.y -= totalDelta.y * this._pTimeDir;\n this._rootPos.z -= totalDelta.z * this._pTimeDir;\n }\n var dx = this._rootPos.x;\n var dy = this._rootPos.y;\n var dz = this._rootPos.z;\n if (this._skeletonClipNode.stitchFinalFrame && this._pNextFrame == this._skeletonClipNode.lastFrame) {\n p1 = this._frames[0].jointPoses[0].translation;\n p2 = this._frames[1].jointPoses[0].translation;\n p3 = this._currentPose.jointPoses[0].translation;\n this._rootPos.x = p3.x + p1.x + this._pBlendWeight * (p2.x - p1.x);\n this._rootPos.y = p3.y + p1.y + this._pBlendWeight * (p2.y - p1.y);\n this._rootPos.z = p3.z + p1.z + this._pBlendWeight * (p2.z - p1.z);\n }\n else {\n p1 = this._currentPose.jointPoses[0].translation;\n p2 = this._frames[this._pNextFrame].jointPoses[0].translation; //cover the instances where we wrap the pose but still want the final frame translation values\n this._rootPos.x = p1.x + this._pBlendWeight * (p2.x - p1.x);\n this._rootPos.y = p1.y + this._pBlendWeight * (p2.y - p1.y);\n this._rootPos.z = p1.z + this._pBlendWeight * (p2.z - p1.z);\n }\n this._pRootDelta.x = this._rootPos.x - dx;\n this._pRootDelta.y = this._rootPos.y - dy;\n this._pRootDelta.z = this._rootPos.z - dz;\n this._pOldFrame = this._pNextFrame;\n };\n return SkeletonClipState;\n}(AnimationClipState));\nexport { SkeletonClipState };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/SkeletonClipState.js","import * as tslib_1 from \"tslib\";\nimport { SkeletonClipState } from \"../states/SkeletonClipState\";\nimport { AnimationClipNodeBase } from \"./AnimationClipNodeBase\";\n/**\n * A skeleton animation node containing time-based animation data as individual skeleton poses.\n */\nvar SkeletonClipNode = (function (_super) {\n tslib_1.__extends(SkeletonClipNode, _super);\n /**\n * Creates a new SkeletonClipNode object.\n */\n function SkeletonClipNode() {\n var _this = _super.call(this) || this;\n _this._frames = new Array();\n /**\n * Determines whether to use SLERP equations (true) or LERP equations (false) in the calculation\n * of the output skeleton pose. Defaults to false.\n */\n _this.highQuality = false;\n _this._pStateClass = SkeletonClipState;\n return _this;\n }\n Object.defineProperty(SkeletonClipNode.prototype, \"frames\", {\n /**\n * Returns a vector of skeleton poses representing the pose of each animation frame in the clip.\n */\n get: function () {\n return this._frames;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * Adds a skeleton pose frame to the internal timeline of the animation node.\n *\n * @param skeletonPose The skeleton pose object to add to the timeline of the node.\n * @param duration The specified duration of the frame in milliseconds.\n */\n SkeletonClipNode.prototype.addFrame = function (skeletonPose, duration) {\n this._frames.push(skeletonPose);\n this._pDurations.push(duration);\n this._pNumFrames = this._pDurations.length;\n this._pStitchDirty = true;\n };\n /**\n * @inheritDoc\n */\n SkeletonClipNode.prototype.getAnimationState = function (animator) {\n return animator.getAnimationState(this);\n };\n /**\n * @inheritDoc\n */\n SkeletonClipNode.prototype._pUpdateStitch = function () {\n _super.prototype._pUpdateStitch.call(this);\n var i = this._pNumFrames - 1;\n var p1, p2, delta;\n while (i--) {\n this._pTotalDuration += this._pDurations[i];\n p1 = this._frames[i].jointPoses[0].translation;\n p2 = this._frames[i + 1].jointPoses[0].translation;\n delta = p2.subtract(p1);\n this._pTotalDelta.x += delta.x;\n this._pTotalDelta.y += delta.y;\n this._pTotalDelta.z += delta.z;\n }\n if (this._pStitchFinalFrame || !this._pLooping) {\n this._pTotalDuration += this._pDurations[this._pNumFrames - 1];\n p1 = this._frames[0].jointPoses[0].translation;\n p2 = this._frames[1].jointPoses[0].translation;\n delta = p2.subtract(p1);\n this._pTotalDelta.x += delta.x;\n this._pTotalDelta.y += delta.y;\n this._pTotalDelta.z += delta.z;\n }\n };\n return SkeletonClipNode;\n}(AnimationClipNodeBase));\nexport { SkeletonClipNode };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/SkeletonClipNode.js","import * as tslib_1 from \"tslib\";\nimport { Quaternion } from \"@awayjs/core\";\nimport { JointPose } from \"../data/JointPose\";\nimport { SkeletonPose } from \"../data/SkeletonPose\";\nimport { AnimationStateBase } from \"./AnimationStateBase\";\n/**\n *\n */\nvar SkeletonDifferenceState = (function (_super) {\n tslib_1.__extends(SkeletonDifferenceState, _super);\n function SkeletonDifferenceState(animator, skeletonAnimationNode) {\n var _this = _super.call(this, animator, skeletonAnimationNode) || this;\n _this._blendWeight = 0;\n _this._skeletonPose = new SkeletonPose();\n _this._skeletonPoseDirty = true;\n _this._skeletonAnimationNode = skeletonAnimationNode;\n _this._baseInput = animator.getAnimationState(_this._skeletonAnimationNode.baseInput);\n _this._differenceInput = animator.getAnimationState(_this._skeletonAnimationNode.differenceInput);\n return _this;\n }\n Object.defineProperty(SkeletonDifferenceState.prototype, \"blendWeight\", {\n /**\n * Defines a fractional value between 0 and 1 representing the blending ratio between the base input (0) and difference input (1),\n * used to produce the skeleton pose output.\n *\n * @see #baseInput\n * @see #differenceInput\n */\n get: function () {\n return this._blendWeight;\n },\n set: function (value) {\n this._blendWeight = value;\n this._pPositionDeltaDirty = true;\n this._skeletonPoseDirty = true;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * @inheritDoc\n */\n SkeletonDifferenceState.prototype.phase = function (value) {\n this._skeletonPoseDirty = true;\n this._pPositionDeltaDirty = true;\n this._baseInput.phase(value);\n this._baseInput.phase(value);\n };\n /**\n * @inheritDoc\n */\n SkeletonDifferenceState.prototype._pUpdateTime = function (time) {\n this._skeletonPoseDirty = true;\n this._baseInput.update(time);\n this._differenceInput.update(time);\n _super.prototype._pUpdateTime.call(this, time);\n };\n /**\n * Returns the current skeleton pose of the animation in the clip based on the internal playhead position.\n */\n SkeletonDifferenceState.prototype.getSkeletonPose = function (skeleton) {\n if (this._skeletonPoseDirty)\n this.updateSkeletonPose(skeleton);\n return this._skeletonPose;\n };\n /**\n * @inheritDoc\n */\n SkeletonDifferenceState.prototype._pUpdatePositionDelta = function () {\n this._pPositionDeltaDirty = false;\n var deltA = this._baseInput.positionDelta;\n var deltB = this._differenceInput.positionDelta;\n this.positionDelta.x = deltA.x + this._blendWeight * deltB.x;\n this.positionDelta.y = deltA.y + this._blendWeight * deltB.y;\n this.positionDelta.z = deltA.z + this._blendWeight * deltB.z;\n };\n /**\n * Updates the output skeleton pose of the node based on the blendWeight value between base input and difference input nodes.\n *\n * @param skeleton The skeleton used by the animator requesting the ouput pose.\n */\n SkeletonDifferenceState.prototype.updateSkeletonPose = function (skeleton) {\n this._skeletonPoseDirty = false;\n var endPose;\n var endPoses = this._skeletonPose.jointPoses;\n var basePoses = this._baseInput.getSkeletonPose(skeleton).jointPoses;\n var diffPoses = this._differenceInput.getSkeletonPose(skeleton).jointPoses;\n var base, diff;\n var basePos, diffPos;\n var tr;\n var numJoints = skeleton.numJoints;\n // :s\n if (endPoses.length != numJoints)\n endPoses.length = numJoints;\n for (var i = 0; i < numJoints; ++i) {\n endPose = endPoses[i];\n if (endPose == null)\n endPose = endPoses[i] = new JointPose();\n base = basePoses[i];\n diff = diffPoses[i];\n basePos = base.translation;\n diffPos = diff.translation;\n SkeletonDifferenceState._tempQuat.multiply(diff.orientation, base.orientation);\n endPose.orientation.lerp(base.orientation, SkeletonDifferenceState._tempQuat, this._blendWeight);\n tr = endPose.translation;\n tr.x = basePos.x + this._blendWeight * diffPos.x;\n tr.y = basePos.y + this._blendWeight * diffPos.y;\n tr.z = basePos.z + this._blendWeight * diffPos.z;\n }\n };\n return SkeletonDifferenceState;\n}(AnimationStateBase));\nexport { SkeletonDifferenceState };\nSkeletonDifferenceState._tempQuat = new Quaternion();\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/SkeletonDifferenceState.js","import * as tslib_1 from \"tslib\";\nimport { AnimationNodeBase } from \"@awayjs/graphics\";\nimport { SkeletonDifferenceState } from \"../states/SkeletonDifferenceState\";\n/**\n * A skeleton animation node that uses a difference input pose with a base input pose to blend a linearly interpolated output of a skeleton pose.\n */\nvar SkeletonDifferenceNode = (function (_super) {\n tslib_1.__extends(SkeletonDifferenceNode, _super);\n /**\n * Creates a new SkeletonAdditiveNode object.\n */\n function SkeletonDifferenceNode() {\n var _this = _super.call(this) || this;\n _this._pStateClass = SkeletonDifferenceState;\n return _this;\n }\n /**\n * @inheritDoc\n */\n SkeletonDifferenceNode.prototype.getAnimationState = function (animator) {\n return animator.getAnimationState(this);\n };\n return SkeletonDifferenceNode;\n}(AnimationNodeBase));\nexport { SkeletonDifferenceNode };\nexport default SkeletonDifferenceNode;\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/SkeletonDifferenceNode.js","import * as tslib_1 from \"tslib\";\nimport { JointPose } from \"../data/JointPose\";\nimport { SkeletonPose } from \"../data/SkeletonPose\";\nimport { AnimationStateBase } from \"./AnimationStateBase\";\n/**\n *\n */\nvar SkeletonDirectionalState = (function (_super) {\n tslib_1.__extends(SkeletonDirectionalState, _super);\n function SkeletonDirectionalState(animator, skeletonAnimationNode) {\n var _this = _super.call(this, animator, skeletonAnimationNode) || this;\n _this._skeletonPose = new SkeletonPose();\n _this._skeletonPoseDirty = true;\n _this._blendWeight = 0;\n _this._direction = 0;\n _this._blendDirty = true;\n _this._skeletonAnimationNode = skeletonAnimationNode;\n _this._forward = animator.getAnimationState(_this._skeletonAnimationNode.forward);\n _this._backward = animator.getAnimationState(_this._skeletonAnimationNode.backward);\n _this._left = animator.getAnimationState(_this._skeletonAnimationNode.left);\n _this._right = animator.getAnimationState(_this._skeletonAnimationNode.right);\n return _this;\n }\n Object.defineProperty(SkeletonDirectionalState.prototype, \"direction\", {\n get: function () {\n return this._direction;\n },\n /**\n * Defines the direction in degrees of the aniamtion between the forwards (0), right(90) backwards (180) and left(270) input nodes,\n * used to produce the skeleton pose output.\n */\n set: function (value) {\n if (this._direction == value)\n return;\n this._direction = value;\n this._blendDirty = true;\n this._skeletonPoseDirty = true;\n this._pPositionDeltaDirty = true;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * @inheritDoc\n */\n SkeletonDirectionalState.prototype.phase = function (value) {\n if (this._blendDirty)\n this.updateBlend();\n this._skeletonPoseDirty = true;\n this._pPositionDeltaDirty = true;\n this._inputA.phase(value);\n this._inputB.phase(value);\n };\n /**\n * @inheritDoc\n */\n SkeletonDirectionalState.prototype._pUdateTime = function (time) {\n if (this._blendDirty)\n this.updateBlend();\n this._skeletonPoseDirty = true;\n this._inputA.update(time);\n this._inputB.update(time);\n _super.prototype._pUpdateTime.call(this, time);\n };\n /**\n * Returns the current skeleton pose of the animation in the clip based on the internal playhead position.\n */\n SkeletonDirectionalState.prototype.getSkeletonPose = function (skeleton) {\n if (this._skeletonPoseDirty)\n this.updateSkeletonPose(skeleton);\n return this._skeletonPose;\n };\n /**\n * @inheritDoc\n */\n SkeletonDirectionalState.prototype._pUpdatePositionDelta = function () {\n this._pPositionDeltaDirty = false;\n if (this._blendDirty)\n this.updateBlend();\n var deltA = this._inputA.positionDelta;\n var deltB = this._inputB.positionDelta;\n this.positionDelta.x = deltA.x + this._blendWeight * (deltB.x - deltA.x);\n this.positionDelta.y = deltA.y + this._blendWeight * (deltB.y - deltA.y);\n this.positionDelta.z = deltA.z + this._blendWeight * (deltB.z - deltA.z);\n };\n /**\n * Updates the output skeleton pose of the node based on the direction value between forward, backwards, left and right input nodes.\n *\n * @param skeleton The skeleton used by the animator requesting the ouput pose.\n */\n SkeletonDirectionalState.prototype.updateSkeletonPose = function (skeleton) {\n this._skeletonPoseDirty = false;\n if (this._blendDirty)\n this.updateBlend();\n var endPose;\n var endPoses = this._skeletonPose.jointPoses;\n var poses1 = this._inputA.getSkeletonPose(skeleton).jointPoses;\n var poses2 = this._inputB.getSkeletonPose(skeleton).jointPoses;\n var pose1, pose2;\n var p1, p2;\n var tr;\n var numJoints = skeleton.numJoints;\n // :s\n if (endPoses.length != numJoints)\n endPoses.length = numJoints;\n for (var i = 0; i < numJoints; ++i) {\n endPose = endPoses[i];\n if (endPose == null)\n endPose = endPoses[i] = new JointPose();\n pose1 = poses1[i];\n pose2 = poses2[i];\n p1 = pose1.translation;\n p2 = pose2.translation;\n endPose.orientation.lerp(pose1.orientation, pose2.orientation, this._blendWeight);\n tr = endPose.translation;\n tr.x = p1.x + this._blendWeight * (p2.x - p1.x);\n tr.y = p1.y + this._blendWeight * (p2.y - p1.y);\n tr.z = p1.z + this._blendWeight * (p2.z - p1.z);\n }\n };\n /**\n * Updates the blend value for the animation output based on the direction value between forward, backwards, left and right input nodes.\n *\n * @private\n */\n SkeletonDirectionalState.prototype.updateBlend = function () {\n this._blendDirty = false;\n if (this._direction < 0 || this._direction > 360) {\n this._direction %= 360;\n if (this._direction < 0)\n this._direction += 360;\n }\n if (this._direction < 90) {\n this._inputA = this._forward;\n this._inputB = this._right;\n this._blendWeight = this._direction / 90;\n }\n else if (this._direction < 180) {\n this._inputA = this._right;\n this._inputB = this._backward;\n this._blendWeight = (this._direction - 90) / 90;\n }\n else if (this._direction < 270) {\n this._inputA = this._backward;\n this._inputB = this._left;\n this._blendWeight = (this._direction - 180) / 90;\n }\n else {\n this._inputA = this._left;\n this._inputB = this._forward;\n this._blendWeight = (this._direction - 270) / 90;\n }\n };\n return SkeletonDirectionalState;\n}(AnimationStateBase));\nexport { SkeletonDirectionalState };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/SkeletonDirectionalState.js","import * as tslib_1 from \"tslib\";\nimport { AnimationNodeBase } from \"@awayjs/graphics\";\nimport { SkeletonDirectionalState } from \"../states/SkeletonDirectionalState\";\n/**\n * A skeleton animation node that uses four directional input poses with an input direction to blend a linearly interpolated output of a skeleton pose.\n */\nvar SkeletonDirectionalNode = (function (_super) {\n tslib_1.__extends(SkeletonDirectionalNode, _super);\n function SkeletonDirectionalNode() {\n var _this = _super.call(this) || this;\n _this._pStateClass = SkeletonDirectionalState;\n return _this;\n }\n /**\n * @inheritDoc\n */\n SkeletonDirectionalNode.prototype.getAnimationState = function (animator) {\n return animator.getAnimationState(this);\n };\n return SkeletonDirectionalNode;\n}(AnimationNodeBase));\nexport { SkeletonDirectionalNode };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/SkeletonDirectionalNode.js","import * as tslib_1 from \"tslib\";\nimport { JointPose } from \"../data/JointPose\";\nimport { SkeletonPose } from \"../data/SkeletonPose\";\nimport { AnimationStateBase } from \"./AnimationStateBase\";\n/**\n *\n */\nvar SkeletonNaryLERPState = (function (_super) {\n tslib_1.__extends(SkeletonNaryLERPState, _super);\n function SkeletonNaryLERPState(animator, skeletonAnimationNode) {\n var _this = _super.call(this, animator, skeletonAnimationNode) || this;\n _this._skeletonPose = new SkeletonPose();\n _this._skeletonPoseDirty = true;\n _this._blendWeights = new Array();\n _this._inputs = new Array();\n _this._skeletonAnimationNode = skeletonAnimationNode;\n var i = _this._skeletonAnimationNode.numInputs;\n while (i--)\n _this._inputs[i] = animator.getAnimationState(_this._skeletonAnimationNode._iInputs[i]);\n return _this;\n }\n /**\n * @inheritDoc\n */\n SkeletonNaryLERPState.prototype.phase = function (value) {\n this._skeletonPoseDirty = true;\n this._pPositionDeltaDirty = true;\n for (var j = 0; j < this._skeletonAnimationNode.numInputs; ++j) {\n if (this._blendWeights[j])\n this._inputs[j].update(value);\n }\n };\n /**\n * @inheritDoc\n */\n SkeletonNaryLERPState.prototype._pUdateTime = function (time) {\n for (var j = 0; j < this._skeletonAnimationNode.numInputs; ++j) {\n if (this._blendWeights[j])\n this._inputs[j].update(time);\n }\n _super.prototype._pUpdateTime.call(this, time);\n };\n /**\n * Returns the current skeleton pose of the animation in the clip based on the internal playhead position.\n */\n SkeletonNaryLERPState.prototype.getSkeletonPose = function (skeleton) {\n if (this._skeletonPoseDirty)\n this.updateSkeletonPose(skeleton);\n return this._skeletonPose;\n };\n /**\n * Returns the blend weight of the skeleton aniamtion node that resides at the given input index.\n *\n * @param index The input index for which the skeleton animation node blend weight is requested.\n */\n SkeletonNaryLERPState.prototype.getBlendWeightAt = function (index) {\n return this._blendWeights[index];\n };\n /**\n * Sets the blend weight of the skeleton aniamtion node that resides at the given input index.\n *\n * @param index The input index on which the skeleton animation node blend weight is to be set.\n * @param blendWeight The blend weight value to use for the given skeleton animation node index.\n */\n SkeletonNaryLERPState.prototype.setBlendWeightAt = function (index, blendWeight) {\n this._blendWeights[index] = blendWeight;\n this._pPositionDeltaDirty = true;\n this._skeletonPoseDirty = true;\n };\n /**\n * @inheritDoc\n */\n SkeletonNaryLERPState.prototype._pUpdatePositionDelta = function () {\n this._pPositionDeltaDirty = false;\n var delta;\n var weight;\n this.positionDelta.x = 0;\n this.positionDelta.y = 0;\n this.positionDelta.z = 0;\n for (var j = 0; j < this._skeletonAnimationNode.numInputs; ++j) {\n weight = this._blendWeights[j];\n if (weight) {\n delta = this._inputs[j].positionDelta;\n this.positionDelta.x += weight * delta.x;\n this.positionDelta.y += weight * delta.y;\n this.positionDelta.z += weight * delta.z;\n }\n }\n };\n /**\n * Updates the output skeleton pose of the node based on the blend weight values given to the input nodes.\n *\n * @param skeleton The skeleton used by the animator requesting the ouput pose.\n */\n SkeletonNaryLERPState.prototype.updateSkeletonPose = function (skeleton) {\n this._skeletonPoseDirty = false;\n var weight;\n var endPoses = this._skeletonPose.jointPoses;\n var poses;\n var endPose, pose;\n var endTr, tr;\n var endQuat, q;\n var firstPose;\n var i;\n var w0, x0, y0, z0;\n var w1, x1, y1, z1;\n var numJoints = skeleton.numJoints;\n // :s\n if (endPoses.length != numJoints)\n endPoses.length = numJoints;\n for (var j = 0; j < this._skeletonAnimationNode.numInputs; ++j) {\n weight = this._blendWeights[j];\n if (!weight)\n continue;\n poses = this._inputs[j].getSkeletonPose(skeleton).jointPoses;\n if (!firstPose) {\n firstPose = poses;\n for (i = 0; i < numJoints; ++i) {\n endPose = endPoses[i];\n if (endPose == null)\n endPose = endPoses[i] = new JointPose();\n pose = poses[i];\n q = pose.orientation;\n tr = pose.translation;\n endQuat = endPose.orientation;\n endQuat.x = weight * q.x;\n endQuat.y = weight * q.y;\n endQuat.z = weight * q.z;\n endQuat.w = weight * q.w;\n endTr = endPose.translation;\n endTr.x = weight * tr.x;\n endTr.y = weight * tr.y;\n endTr.z = weight * tr.z;\n }\n }\n else {\n for (i = 0; i < skeleton.numJoints; ++i) {\n endPose = endPoses[i];\n pose = poses[i];\n q = firstPose[i].orientation;\n x0 = q.x;\n y0 = q.y;\n z0 = q.z;\n w0 = q.w;\n q = pose.orientation;\n tr = pose.translation;\n x1 = q.x;\n y1 = q.y;\n z1 = q.z;\n w1 = q.w;\n // find shortest direction\n if (x0 * x1 + y0 * y1 + z0 * z1 + w0 * w1 < 0) {\n x1 = -x1;\n y1 = -y1;\n z1 = -z1;\n w1 = -w1;\n }\n endQuat = endPose.orientation;\n endQuat.x += weight * x1;\n endQuat.y += weight * y1;\n endQuat.z += weight * z1;\n endQuat.w += weight * w1;\n endTr = endPose.translation;\n endTr.x += weight * tr.x;\n endTr.y += weight * tr.y;\n endTr.z += weight * tr.z;\n }\n }\n }\n for (i = 0; i < skeleton.numJoints; ++i)\n endPoses[i].orientation.normalize();\n };\n return SkeletonNaryLERPState;\n}(AnimationStateBase));\nexport { SkeletonNaryLERPState };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/SkeletonNaryLERPState.js","import * as tslib_1 from \"tslib\";\nimport { AnimationNodeBase } from \"@awayjs/graphics\";\nimport { SkeletonNaryLERPState } from \"../states/SkeletonNaryLERPState\";\n/**\n * A skeleton animation node that uses an n-dimensional array of animation node inputs to blend a lineraly interpolated output of a skeleton pose.\n */\nvar SkeletonNaryLERPNode = (function (_super) {\n tslib_1.__extends(SkeletonNaryLERPNode, _super);\n /**\n * Creates a new SkeletonNaryLERPNode object.\n */\n function SkeletonNaryLERPNode() {\n var _this = _super.call(this) || this;\n _this._iInputs = new Array();\n _this._pStateClass = SkeletonNaryLERPState;\n return _this;\n }\n Object.defineProperty(SkeletonNaryLERPNode.prototype, \"numInputs\", {\n get: function () {\n return this._numInputs;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * Returns an integer representing the input index of the given skeleton animation node.\n *\n * @param input The skeleton animation node for with the input index is requested.\n */\n SkeletonNaryLERPNode.prototype.getInputIndex = function (input) {\n return this._iInputs.indexOf(input);\n };\n /**\n * Returns the skeleton animation node object that resides at the given input index.\n *\n * @param index The input index for which the skeleton animation node is requested.\n */\n SkeletonNaryLERPNode.prototype.getInputAt = function (index) {\n return this._iInputs[index];\n };\n /**\n * Adds a new skeleton animation node input to the animation node.\n */\n SkeletonNaryLERPNode.prototype.addInput = function (input) {\n this._iInputs[this._numInputs++] = input;\n };\n /**\n * @inheritDoc\n */\n SkeletonNaryLERPNode.prototype.getAnimationState = function (animator) {\n return animator.getAnimationState(this);\n };\n return SkeletonNaryLERPNode;\n}(AnimationNodeBase));\nexport { SkeletonNaryLERPNode };\nexport default SkeletonNaryLERPNode;\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/SkeletonNaryLERPNode.js","import * as tslib_1 from \"tslib\";\nimport { AnimationClipState } from \"./AnimationClipState\";\n/**\n *\n */\nvar VertexClipState = (function (_super) {\n tslib_1.__extends(VertexClipState, _super);\n function VertexClipState(animator, vertexClipNode) {\n var _this = _super.call(this, animator, vertexClipNode) || this;\n _this._vertexClipNode = vertexClipNode;\n _this._frames = _this._vertexClipNode.frames;\n return _this;\n }\n Object.defineProperty(VertexClipState.prototype, \"currentGraphics\", {\n /**\n * @inheritDoc\n */\n get: function () {\n if (this._pFramesDirty)\n this._pUpdateFrames();\n return this._currentGraphics;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(VertexClipState.prototype, \"nextGraphics\", {\n /**\n * @inheritDoc\n */\n get: function () {\n if (this._pFramesDirty)\n this._pUpdateFrames();\n return this._nextGraphics;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * @inheritDoc\n */\n VertexClipState.prototype._pUpdateFrames = function () {\n _super.prototype._pUpdateFrames.call(this);\n this._currentGraphics = this._frames[this._pCurrentFrame];\n if (this._vertexClipNode.looping && this._pNextFrame >= this._vertexClipNode.lastFrame) {\n this._nextGraphics = this._frames[0];\n this._pAnimator.dispatchCycleEvent();\n }\n else\n this._nextGraphics = this._frames[this._pNextFrame];\n };\n /**\n * @inheritDoc\n */\n VertexClipState.prototype._pUpdatePositionDelta = function () {\n //TODO:implement positiondelta functionality for vertex animations\n };\n return VertexClipState;\n}(AnimationClipState));\nexport { VertexClipState };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/states/VertexClipState.js","import * as tslib_1 from \"tslib\";\nimport { Vector3D } from \"@awayjs/core\";\nimport { VertexClipState } from \"../states/VertexClipState\";\nimport { AnimationClipNodeBase } from \"./AnimationClipNodeBase\";\n/**\n * A vertex animation node containing time-based animation data as individual geometry obejcts.\n */\nvar VertexClipNode = (function (_super) {\n tslib_1.__extends(VertexClipNode, _super);\n /**\n * Creates a new VertexClipNode object.\n */\n function VertexClipNode() {\n var _this = _super.call(this) || this;\n _this._frames = new Array();\n _this._translations = new Array();\n _this._pStateClass = VertexClipState;\n return _this;\n }\n Object.defineProperty(VertexClipNode.prototype, \"frames\", {\n /**\n * Returns a vector of geometry frames representing the vertex values of each animation frame in the clip.\n */\n get: function () {\n return this._frames;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * Adds a geometry object to the internal timeline of the animation node.\n *\n * @param geometry The geometry object to add to the timeline of the node.\n * @param duration The specified duration of the frame in milliseconds.\n * @param translation The absolute translation of the frame, used in root delta calculations for sprite movement.\n */\n VertexClipNode.prototype.addFrame = function (geometry, duration, translation) {\n if (translation === void 0) { translation = null; }\n this._frames.push(geometry);\n this._pDurations.push(duration);\n this._translations.push(translation || new Vector3D());\n this._pNumFrames = this._pDurations.length;\n this._pStitchDirty = true;\n };\n /**\n * @inheritDoc\n */\n VertexClipNode.prototype._pUpdateStitch = function () {\n _super.prototype._pUpdateStitch.call(this);\n var i = this._pNumFrames - 1;\n var p1, p2, delta;\n while (i--) {\n this._pTotalDuration += this._pDurations[i];\n p1 = this._translations[i];\n p2 = this._translations[i + 1];\n delta = p2.subtract(p1);\n this._pTotalDelta.x += delta.x;\n this._pTotalDelta.y += delta.y;\n this._pTotalDelta.z += delta.z;\n }\n if (this._pNumFrames > 1 && (this._pStitchFinalFrame || !this._pLooping)) {\n this._pTotalDuration += this._pDurations[this._pNumFrames - 1];\n p1 = this._translations[0];\n p2 = this._translations[1];\n delta = p2.subtract(p1);\n this._pTotalDelta.x += delta.x;\n this._pTotalDelta.y += delta.y;\n this._pTotalDelta.z += delta.z;\n }\n };\n return VertexClipNode;\n}(AnimationClipNodeBase));\nexport { VertexClipNode };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/nodes/VertexClipNode.js","import * as tslib_1 from \"tslib\";\nimport { AnimationStateEvent } from \"../../events/AnimationStateEvent\";\nimport { SkeletonBinaryLERPState } from \"../states/SkeletonBinaryLERPState\";\n/**\n *\n */\nvar CrossfadeTransitionState = (function (_super) {\n tslib_1.__extends(CrossfadeTransitionState, _super);\n function CrossfadeTransitionState(animator, skeletonAnimationNode) {\n var _this = _super.call(this, animator, skeletonAnimationNode) || this;\n _this._crossfadeTransitionNode = skeletonAnimationNode;\n return _this;\n }\n /**\n * @inheritDoc\n */\n CrossfadeTransitionState.prototype._pUpdateTime = function (time) {\n this.blendWeight = Math.abs(time - this._crossfadeTransitionNode.startBlend) / (1000 * this._crossfadeTransitionNode.blendSpeed);\n if (this.blendWeight >= 1) {\n this.blendWeight = 1;\n if (this._animationStateTransitionComplete == null)\n this._animationStateTransitionComplete = new AnimationStateEvent(AnimationStateEvent.TRANSITION_COMPLETE, this._pAnimator, this, this._crossfadeTransitionNode);\n this._crossfadeTransitionNode.dispatchEvent(this._animationStateTransitionComplete);\n }\n _super.prototype._pUpdateTime.call(this, time);\n };\n return CrossfadeTransitionState;\n}(SkeletonBinaryLERPState));\nexport { CrossfadeTransitionState };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/transitions/CrossfadeTransitionState.js","import * as tslib_1 from \"tslib\";\nimport { SkeletonBinaryLERPNode } from \"../nodes/SkeletonBinaryLERPNode\";\nimport { CrossfadeTransitionState } from \"./CrossfadeTransitionState\";\n/**\n * A skeleton animation node that uses two animation node inputs to blend a lineraly interpolated output of a skeleton pose.\n */\nvar CrossfadeTransitionNode = (function (_super) {\n tslib_1.__extends(CrossfadeTransitionNode, _super);\n /**\n * Creates a new CrossfadeTransitionNode object.\n */\n function CrossfadeTransitionNode() {\n var _this = _super.call(this) || this;\n _this._pStateClass = CrossfadeTransitionState;\n return _this;\n }\n return CrossfadeTransitionNode;\n}(SkeletonBinaryLERPNode));\nexport { CrossfadeTransitionNode };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/transitions/CrossfadeTransitionNode.js","import { CrossfadeTransitionNode } from \"../transitions/CrossfadeTransitionNode\";\n/**\n *\n */\nvar CrossfadeTransition = (function () {\n function CrossfadeTransition(blendSpeed) {\n this.blendSpeed = 0.5;\n this.blendSpeed = blendSpeed;\n }\n CrossfadeTransition.prototype.getAnimationNode = function (animator, startNode, endNode, startBlend) {\n var crossFadeTransitionNode = new CrossfadeTransitionNode();\n crossFadeTransitionNode.inputA = startNode;\n crossFadeTransitionNode.inputB = endNode;\n crossFadeTransitionNode.blendSpeed = this.blendSpeed;\n crossFadeTransitionNode.startBlend = startBlend;\n return crossFadeTransitionNode;\n };\n return CrossfadeTransition;\n}());\nexport { CrossfadeTransition };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/transitions/CrossfadeTransition.js","import * as tslib_1 from \"tslib\";\nimport { AnimatorBase } from \"@awayjs/stage\";\nimport { AnimationElements } from \"./data/AnimationElements\";\nimport { ParticlePropertiesMode } from \"./data/ParticlePropertiesMode\";\n/**\n * Provides an interface for assigning paricle-based animation data sets to sprite-based entity objects\n * and controlling the various available states of animation through an interative playhead that can be\n * automatically updated or manually triggered.\n *\n * Requires that the containing geometry of the parent sprite is particle geometry\n *\n * @see away.base.ParticleGraphics\n */\nvar ParticleAnimator = (function (_super) {\n tslib_1.__extends(ParticleAnimator, _super);\n /**\n * Creates a new ParticleAnimator object.\n *\n * @param particleAnimationSet The animation data set containing the particle animations used by the animator.\n */\n function ParticleAnimator(particleAnimationSet) {\n var _this = _super.call(this, particleAnimationSet) || this;\n _this._animationParticleStates = new Array();\n _this._animatorParticleStates = new Array();\n _this._timeParticleStates = new Array();\n _this._totalLenOfOneVertex = 0;\n _this._animatorSubGeometries = new Object();\n _this._particleAnimationSet = particleAnimationSet;\n var state;\n var node;\n for (var i = 0; i < _this._particleAnimationSet.particleNodes.length; i++) {\n node = _this._particleAnimationSet.particleNodes[i];\n state = _this.getAnimationState(node);\n if (node.mode == ParticlePropertiesMode.LOCAL_DYNAMIC) {\n _this._animatorParticleStates.push(state);\n node._iDataOffset = _this._totalLenOfOneVertex;\n _this._totalLenOfOneVertex += node.dataLength;\n }\n else {\n _this._animationParticleStates.push(state);\n }\n if (state.needUpdateTime)\n _this._timeParticleStates.push(state);\n }\n return _this;\n }\n /**\n * @inheritDoc\n */\n ParticleAnimator.prototype.clone = function () {\n return new ParticleAnimator(this._particleAnimationSet);\n };\n /**\n * @inheritDoc\n */\n ParticleAnimator.prototype.setRenderState = function (shader, renderable, stage, projection) {\n var animationRegisterData = this._particleAnimationSet._iAnimationRegisterData;\n var graphics = renderable.sourceEntity.graphics;\n var shape = renderable.shape;\n if (!shape)\n throw (new Error(\"Must be shape\"));\n //process animation sub geometries\n var animationElements = this._particleAnimationSet.getAnimationElements(graphics, shape);\n var i;\n for (i = 0; i < this._animationParticleStates.length; i++)\n this._animationParticleStates[i].setRenderState(shader, renderable, animationElements, animationRegisterData, projection, stage);\n //process animator subgeometries\n var animatorElements = this.getAnimatorElements(graphics, shape);\n for (i = 0; i < this._animatorParticleStates.length; i++)\n this._animatorParticleStates[i].setRenderState(shader, renderable, animatorElements, animationRegisterData, projection, stage);\n };\n /**\n * @inheritDoc\n */\n ParticleAnimator.prototype.testGPUCompatibility = function (shader) {\n };\n /**\n * @inheritDoc\n */\n ParticleAnimator.prototype.start = function () {\n _super.prototype.start.call(this);\n for (var i = 0; i < this._timeParticleStates.length; i++)\n this._timeParticleStates[i].offset(this._pAbsoluteTime);\n };\n /**\n * @inheritDoc\n */\n ParticleAnimator.prototype._pUpdateDeltaTime = function (dt) {\n this._pAbsoluteTime += dt;\n for (var i = 0; i < this._timeParticleStates.length; i++)\n this._timeParticleStates[i].update(this._pAbsoluteTime);\n };\n /**\n * @inheritDoc\n */\n ParticleAnimator.prototype.resetTime = function (offset) {\n if (offset === void 0) { offset = 0; }\n for (var i = 0; i < this._timeParticleStates.length; i++)\n this._timeParticleStates[i].offset(this._pAbsoluteTime + offset);\n this.update(this.time);\n };\n ParticleAnimator.prototype.dispose = function () {\n for (var key in this._animatorSubGeometries)\n this._animatorSubGeometries[key].dispose();\n };\n ParticleAnimator.prototype.getAnimatorElements = function (graphics, shape) {\n if (!this._animatorParticleStates.length)\n return;\n var elements = shape.elements;\n var animatorElements = this._animatorSubGeometries[elements.id] = new AnimationElements();\n //create the vertexData vector that will be used for local state data\n animatorElements.createVertexData(elements.numVertices, this._totalLenOfOneVertex);\n //pass the particles data to the animator elements\n animatorElements.animationParticles = this._particleAnimationSet.getAnimationElements(graphics, shape).animationParticles;\n };\n return ParticleAnimator;\n}(AnimatorBase));\nexport { ParticleAnimator };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/ParticleAnimator.js","import * as tslib_1 from \"tslib\";\nimport { AnimationSetBase } from \"@awayjs/stage\";\n/**\n * The animation data set used by skeleton-based animators, containing skeleton animation data.\n *\n * @see away.animators.SkeletonAnimator\n */\nvar SkeletonAnimationSet = (function (_super) {\n tslib_1.__extends(SkeletonAnimationSet, _super);\n /**\n * Creates a new SkeletonAnimationSet object.\n *\n * @param jointsPerVertex Sets the amount of skeleton joints that can be linked to a single vertex via skinned weight values. For GPU-base animation, the maximum allowed value is 4. Defaults to 4.\n */\n function SkeletonAnimationSet(jointsPerVertex) {\n if (jointsPerVertex === void 0) { jointsPerVertex = 4; }\n var _this = _super.call(this) || this;\n _this._jointsPerVertex = jointsPerVertex;\n return _this;\n }\n Object.defineProperty(SkeletonAnimationSet.prototype, \"jointsPerVertex\", {\n /**\n * Returns the amount of skeleton joints that can be linked to a single vertex via skinned weight values. For GPU-base animation, the\n * maximum allowed value is 4.\n */\n get: function () {\n return this._jointsPerVertex;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(SkeletonAnimationSet.prototype, \"matricesIndex\", {\n get: function () {\n return this._matricesIndex;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * @inheritDoc\n */\n SkeletonAnimationSet.prototype.getAGALVertexCode = function (shader, registerCache, sharedRegisters) {\n this._matricesIndex = registerCache.numUsedVertexConstants;\n var indexOffset0 = this._matricesIndex;\n var indexOffset1 = this._matricesIndex + 1;\n var indexOffset2 = this._matricesIndex + 2;\n var indexStream = registerCache.getFreeVertexAttribute();\n shader.jointIndexIndex = indexStream.index;\n var weightStream = registerCache.getFreeVertexAttribute();\n shader.jointWeightIndex = weightStream.index;\n var indices = [indexStream + \".x\", indexStream + \".y\", indexStream + \".z\", indexStream + \".w\"];\n var weights = [weightStream + \".x\", weightStream + \".y\", weightStream + \".z\", weightStream + \".w\"];\n var temp1 = registerCache.getFreeVertexVectorTemp();\n var dot = \"dp4\";\n var code = \"\";\n var len = sharedRegisters.animatableAttributes.length;\n for (var i = 0; i < len; ++i) {\n var source = sharedRegisters.animatableAttributes[i];\n var target = sharedRegisters.animationTargetRegisters[i];\n for (var j = 0; j < this._jointsPerVertex; ++j) {\n registerCache.getFreeVertexConstant();\n registerCache.getFreeVertexConstant();\n registerCache.getFreeVertexConstant();\n code += dot + \" \" + temp1 + \".x, \" + source + \", vc[\" + indices[j] + \"+\" + indexOffset0 + \"]\\n\" +\n dot + \" \" + temp1 + \".y, \" + source + \", vc[\" + indices[j] + \"+\" + indexOffset1 + \"]\\n\" +\n dot + \" \" + temp1 + \".z, \" + source + \", vc[\" + indices[j] + \"+\" + indexOffset2 + \"]\\n\" +\n \"mov \" + temp1 + \".w, \" + source + \".w\\n\" +\n \"mul \" + temp1 + \", \" + temp1 + \", \" + weights[j] + \"\\n\"; // apply weight\n // add or mov to target. Need to write to a temp reg first, because an output can be a target\n if (j == 0)\n code += \"mov \" + target + \", \" + temp1 + \"\\n\";\n else\n code += \"add \" + target + \", \" + target + \", \" + temp1 + \"\\n\";\n }\n // switch to dp3 once positions have been transformed, from now on, it should only be vectors instead of points\n dot = \"dp3\";\n }\n return code;\n };\n /**\n * @inheritDoc\n */\n SkeletonAnimationSet.prototype.getAGALFragmentCode = function (shader, registerCache, shadedTarget) {\n return \"\";\n };\n /**\n * @inheritDoc\n */\n SkeletonAnimationSet.prototype.getAGALUVCode = function (shader, registerCache, sharedRegisters) {\n return \"mov \" + sharedRegisters.uvTarget + \",\" + sharedRegisters.uvSource + \"\\n\";\n };\n /**\n * @inheritDoc\n */\n SkeletonAnimationSet.prototype.doneAGALCode = function (shader) {\n };\n return SkeletonAnimationSet;\n}(AnimationSetBase));\nexport { SkeletonAnimationSet };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/SkeletonAnimationSet.js","import * as tslib_1 from \"tslib\";\nimport { ElementsEvent } from \"@awayjs/graphics\";\nimport { AnimatorBase } from \"@awayjs/stage\";\nimport { AnimationStateEvent } from \"../events/AnimationStateEvent\";\nimport { JointPose } from \"./data/JointPose\";\nimport { SkeletonPose } from \"./data/SkeletonPose\";\n/**\n * Provides an interface for assigning skeleton-based animation data sets to sprite-based entity objects\n * and controlling the various available states of animation through an interative playhead that can be\n * automatically updated or manually triggered.\n */\nvar SkeletonAnimator = (function (_super) {\n tslib_1.__extends(SkeletonAnimator, _super);\n /**\n * Creates a new SkeletonAnimator object.\n *\n * @param skeletonAnimationSet The animation data set containing the skeleton animations used by the animator.\n * @param skeleton The skeleton object used for calculating the resulting global matrices for transforming skinned sprite data.\n * @param forceCPU Optional value that only allows the animator to perform calculation on the CPU. Defaults to false.\n */\n function SkeletonAnimator(animationSet, skeleton, forceCPU) {\n if (forceCPU === void 0) { forceCPU = false; }\n var _this = _super.call(this, animationSet) || this;\n _this._globalPose = new SkeletonPose();\n _this._morphedElements = new Object();\n _this._morphedElementsDirty = new Object();\n _this._skeletonAnimationSet = animationSet;\n _this._skeleton = skeleton;\n _this._forceCPU = forceCPU;\n _this._jointsPerVertex = animationSet.jointsPerVertex;\n _this._numJoints = _this._skeleton.numJoints;\n _this._globalMatrices = new Float32Array(_this._numJoints * 12);\n var j = 0;\n for (var i = 0; i < _this._numJoints; ++i) {\n _this._globalMatrices[j++] = 1;\n _this._globalMatrices[j++] = 0;\n _this._globalMatrices[j++] = 0;\n _this._globalMatrices[j++] = 0;\n _this._globalMatrices[j++] = 0;\n _this._globalMatrices[j++] = 1;\n _this._globalMatrices[j++] = 0;\n _this._globalMatrices[j++] = 0;\n _this._globalMatrices[j++] = 0;\n _this._globalMatrices[j++] = 0;\n _this._globalMatrices[j++] = 1;\n _this._globalMatrices[j++] = 0;\n }\n _this._onTransitionCompleteDelegate = function (event) { return _this.onTransitionComplete(event); };\n _this._onIndicesUpdateDelegate = function (event) { return _this.onIndicesUpdate(event); };\n _this._onVerticesUpdateDelegate = function (event) { return _this.onVerticesUpdate(event); };\n return _this;\n }\n Object.defineProperty(SkeletonAnimator.prototype, \"globalMatrices\", {\n /**\n * returns the calculated global matrices of the current skeleton pose.\n *\n * @see #globalPose\n */\n get: function () {\n if (this._globalPropertiesDirty)\n this.updateGlobalProperties();\n return this._globalMatrices;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(SkeletonAnimator.prototype, \"globalPose\", {\n /**\n * returns the current skeleton pose output from the animator.\n *\n * @see away.animators.data.SkeletonPose\n */\n get: function () {\n if (this._globalPropertiesDirty)\n this.updateGlobalProperties();\n return this._globalPose;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(SkeletonAnimator.prototype, \"skeleton\", {\n /**\n * Returns the skeleton object in use by the animator - this defines the number and heirarchy of joints used by the\n * skinned geoemtry to which skeleon animator is applied.\n */\n get: function () {\n return this._skeleton;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(SkeletonAnimator.prototype, \"forceCPU\", {\n /**\n * Indicates whether the skeleton animator is disabled by default for GPU rendering, something that allows the animator to perform calculation on the GPU.\n * Defaults to false.\n */\n get: function () {\n return this._forceCPU;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(SkeletonAnimator.prototype, \"useCondensedIndices\", {\n /**\n * Offers the option of enabling GPU accelerated animation on skeletons larger than 32 joints\n * by condensing the number of joint index values required per sprite. Only applicable to\n * skeleton animations that utilise more than one sprite object. Defaults to false.\n */\n get: function () {\n return this._useCondensedIndices;\n },\n set: function (value) {\n this._useCondensedIndices = value;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * @inheritDoc\n */\n SkeletonAnimator.prototype.clone = function () {\n return new SkeletonAnimator(this._skeletonAnimationSet, this._skeleton, this._forceCPU);\n };\n /**\n * Plays an animation state registered with the given name in the animation data set.\n *\n * @param name The data set name of the animation state to be played.\n * @param transition An optional transition object that determines how the animator will transition from the currently active animation state.\n * @param offset An option offset time (in milliseconds) that resets the state's internal clock to the absolute time of the animator plus the offset value. Required for non-looping animation states.\n */\n SkeletonAnimator.prototype.play = function (name, transition, offset) {\n if (transition === void 0) { transition = null; }\n if (offset === void 0) { offset = NaN; }\n if (this._pActiveAnimationName == name)\n return;\n this._pActiveAnimationName = name;\n if (!this._pAnimationSet.hasAnimation(name))\n throw new Error(\"Animation root node \" + name + \" not found!\");\n if (transition && this._pActiveNode) {\n //setup the transition\n this._pActiveNode = transition.getAnimationNode(this, this._pActiveNode, this._pAnimationSet.getAnimation(name), this._pAbsoluteTime);\n this._pActiveNode.addEventListener(AnimationStateEvent.TRANSITION_COMPLETE, this._onTransitionCompleteDelegate);\n }\n else\n this._pActiveNode = this._pAnimationSet.getAnimation(name);\n this._pActiveState = this.getAnimationState(this._pActiveNode);\n if (this.updatePosition) {\n //update straight away to reset position deltas\n this._pActiveState.update(this._pAbsoluteTime);\n this._pActiveState.positionDelta;\n }\n this._activeSkeletonState = this._pActiveState;\n this.start();\n //apply a time offset if specified\n if (!isNaN(offset))\n this.reset(name, offset);\n };\n /**\n * @inheritDoc\n */\n SkeletonAnimator.prototype.setRenderState = function (shader, renderable, stage, projection) {\n // do on request of globalProperties\n if (this._globalPropertiesDirty)\n this.updateGlobalProperties();\n var elements = renderable.shape.elements;\n elements.useCondensedIndices = this._useCondensedIndices;\n if (this._useCondensedIndices) {\n // using a condensed data set\n this.updateCondensedMatrices(elements.condensedIndexLookUp);\n shader.setVertexConstFromArray(this._skeletonAnimationSet.matricesIndex, this._condensedMatrices);\n }\n else {\n if (this._pAnimationSet.usesCPU) {\n if (this._morphedElementsDirty[elements.id])\n this.morphElements(renderable, elements);\n return;\n }\n shader.setVertexConstFromArray(this._skeletonAnimationSet.matricesIndex, this._globalMatrices);\n }\n };\n /**\n * @inheritDoc\n */\n SkeletonAnimator.prototype.testGPUCompatibility = function (shader) {\n if (!this._useCondensedIndices && (this._forceCPU || this._jointsPerVertex > 4 || shader.numUsedVertexConstants + this._numJoints * 3 > 128))\n this._pAnimationSet.cancelGPUCompatibility();\n };\n /**\n * Applies the calculated time delta to the active animation state node or state transition object.\n */\n SkeletonAnimator.prototype._pUpdateDeltaTime = function (dt) {\n _super.prototype._pUpdateDeltaTime.call(this, dt);\n //invalidate pose matrices\n this._globalPropertiesDirty = true;\n //trigger geometry invalidation if using CPU animation\n if (this._pAnimationSet.usesCPU)\n this.invalidateElements();\n };\n SkeletonAnimator.prototype.updateCondensedMatrices = function (condensedIndexLookUp) {\n var j = 0, k = 0;\n var len = condensedIndexLookUp.length;\n var srcIndex;\n this._condensedMatrices = new Float32Array(len * 12);\n for (var i = 0; i < len; i++) {\n srcIndex = condensedIndexLookUp[i] * 12; //12 required for the three 4-component vectors that store the matrix\n k = 12;\n // copy into condensed\n while (k--)\n this._condensedMatrices[j++] = this._globalMatrices[srcIndex++];\n }\n };\n SkeletonAnimator.prototype.updateGlobalProperties = function () {\n this._globalPropertiesDirty = false;\n //get global pose\n this.localToGlobalPose(this._activeSkeletonState.getSkeletonPose(this._skeleton), this._globalPose, this._skeleton);\n // convert pose to matrix\n var mtxOffset = 0;\n var globalPoses = this._globalPose.jointPoses;\n var raw;\n var ox, oy, oz, ow;\n var xy2, xz2, xw2;\n var yz2, yw2, zw2;\n var n11, n12, n13;\n var n21, n22, n23;\n var n31, n32, n33;\n var m11, m12, m13, m14;\n var m21, m22, m23, m24;\n var m31, m32, m33, m34;\n var joints = this._skeleton.joints;\n var pose;\n var quat;\n var vec;\n var t;\n for (var i = 0; i < this._numJoints; ++i) {\n pose = globalPoses[i];\n quat = pose.orientation;\n vec = pose.translation;\n ox = quat.x;\n oy = quat.y;\n oz = quat.z;\n ow = quat.w;\n xy2 = (t = 2.0 * ox) * oy;\n xz2 = t * oz;\n xw2 = t * ow;\n yz2 = (t = 2.0 * oy) * oz;\n yw2 = t * ow;\n zw2 = 2.0 * oz * ow;\n yz2 = 2.0 * oy * oz;\n yw2 = 2.0 * oy * ow;\n zw2 = 2.0 * oz * ow;\n ox *= ox;\n oy *= oy;\n oz *= oz;\n ow *= ow;\n n11 = (t = ox - oy) - oz + ow;\n n12 = xy2 - zw2;\n n13 = xz2 + yw2;\n n21 = xy2 + zw2;\n n22 = -t - oz + ow;\n n23 = yz2 - xw2;\n n31 = xz2 - yw2;\n n32 = yz2 + xw2;\n n33 = -ox - oy + oz + ow;\n // prepend inverse bind pose\n raw = joints[i].inverseBindPose;\n m11 = raw[0];\n m12 = raw[4];\n m13 = raw[8];\n m14 = raw[12];\n m21 = raw[1];\n m22 = raw[5];\n m23 = raw[9];\n m24 = raw[13];\n m31 = raw[2];\n m32 = raw[6];\n m33 = raw[10];\n m34 = raw[14];\n this._globalMatrices[mtxOffset] = n11 * m11 + n12 * m21 + n13 * m31;\n this._globalMatrices[mtxOffset + 1] = n11 * m12 + n12 * m22 + n13 * m32;\n this._globalMatrices[mtxOffset + 2] = n11 * m13 + n12 * m23 + n13 * m33;\n this._globalMatrices[mtxOffset + 3] = n11 * m14 + n12 * m24 + n13 * m34 + vec.x;\n this._globalMatrices[mtxOffset + 4] = n21 * m11 + n22 * m21 + n23 * m31;\n this._globalMatrices[mtxOffset + 5] = n21 * m12 + n22 * m22 + n23 * m32;\n this._globalMatrices[mtxOffset + 6] = n21 * m13 + n22 * m23 + n23 * m33;\n this._globalMatrices[mtxOffset + 7] = n21 * m14 + n22 * m24 + n23 * m34 + vec.y;\n this._globalMatrices[mtxOffset + 8] = n31 * m11 + n32 * m21 + n33 * m31;\n this._globalMatrices[mtxOffset + 9] = n31 * m12 + n32 * m22 + n33 * m32;\n this._globalMatrices[mtxOffset + 10] = n31 * m13 + n32 * m23 + n33 * m33;\n this._globalMatrices[mtxOffset + 11] = n31 * m14 + n32 * m24 + n33 * m34 + vec.z;\n mtxOffset = mtxOffset + 12;\n }\n };\n SkeletonAnimator.prototype.getRenderableElements = function (renderable, sourceElements) {\n this._morphedElementsDirty[sourceElements.id] = true;\n //early out for GPU animations\n if (!this._pAnimationSet.usesCPU)\n return sourceElements;\n var targetElements;\n if (!(targetElements = this._morphedElements[sourceElements.id])) {\n //not yet stored\n sourceElements.normals;\n sourceElements.tangents;\n targetElements = this._morphedElements[sourceElements.id] = sourceElements.clone();\n //turn off auto calculations on the morphed geometry\n targetElements.autoDeriveNormals = false;\n targetElements.autoDeriveTangents = false;\n //add event listeners for any changes in UV values on the source geometry\n sourceElements.addEventListener(ElementsEvent.INVALIDATE_INDICES, this._onIndicesUpdateDelegate);\n sourceElements.addEventListener(ElementsEvent.INVALIDATE_VERTICES, this._onVerticesUpdateDelegate);\n }\n return targetElements;\n };\n /**\n * If the animation can't be performed on GPU, transform vertices manually\n * @param subGeom The subgeometry containing the weights and joint index data per vertex.\n * @param pass The material pass for which we need to transform the vertices\n */\n SkeletonAnimator.prototype.morphElements = function (renderable, sourceElements) {\n this._morphedElementsDirty[sourceElements.id] = false;\n var numVertices = sourceElements.numVertices;\n var sourcePositions = sourceElements.positions.get(numVertices);\n var sourceNormals = sourceElements.normals.get(numVertices);\n var sourceTangents = sourceElements.tangents.get(numVertices);\n var posDim = sourceElements.positions.dimensions;\n var posStride = sourceElements.positions.stride;\n var normalStride = sourceElements.normals.stride;\n var tangentStride = sourceElements.tangents.stride;\n var jointIndices = sourceElements.jointIndices.get(numVertices);\n var jointWeights = sourceElements.jointWeights.get(numVertices);\n var jointStride = sourceElements.jointIndices.stride;\n var targetElements = this._morphedElements[sourceElements.id];\n var targetPositions = targetElements.positions.get(numVertices);\n var targetNormals = targetElements.normals.get(numVertices);\n var targetTangents = targetElements.tangents.get(numVertices);\n targetElements.positions.attributesBuffer.invalidate();\n targetElements.normals.attributesBuffer.invalidate();\n targetElements.tangents.attributesBuffer.invalidate();\n var index = 0;\n var i0 = 0;\n var i1 = 0;\n var i2 = 0;\n var i3 = 0;\n var k;\n var vx, vy, vz;\n var nx, ny, nz;\n var tx, ty, tz;\n var weight;\n var vertX, vertY, vertZ;\n var normX, normY, normZ;\n var tangX, tangY, tangZ;\n var m11, m12, m13, m14;\n var m21, m22, m23, m24;\n var m31, m32, m33, m34;\n while (index < numVertices) {\n i0 = index * posStride;\n vertX = sourcePositions[i0];\n vertY = sourcePositions[i0 + 1];\n vertZ = (posDim == 3) ? sourcePositions[i0 + 2] : 0;\n i1 = index * normalStride;\n normX = sourceNormals[i1];\n normY = sourceNormals[i1 + 1];\n normZ = sourceNormals[i1 + 2];\n i2 = index * tangentStride;\n tangX = sourceTangents[i2];\n tangY = sourceTangents[i2 + 1];\n tangZ = sourceTangents[i2 + 2];\n vx = 0;\n vy = 0;\n vz = 0;\n nx = 0;\n ny = 0;\n nz = 0;\n tx = 0;\n ty = 0;\n tz = 0;\n k = 0;\n i3 = index * jointStride;\n while (k < this._jointsPerVertex) {\n weight = jointWeights[i3 + k];\n if (weight > 0) {\n // implicit /3*12 (/3 because indices are multiplied by 3 for gpu matrix access, *12 because it's the matrix size)\n var mtxOffset = jointIndices[i3 + k] << 2;\n m11 = this._globalMatrices[mtxOffset];\n m12 = this._globalMatrices[mtxOffset + 1];\n m13 = this._globalMatrices[mtxOffset + 2];\n m14 = this._globalMatrices[mtxOffset + 3];\n m21 = this._globalMatrices[mtxOffset + 4];\n m22 = this._globalMatrices[mtxOffset + 5];\n m23 = this._globalMatrices[mtxOffset + 6];\n m24 = this._globalMatrices[mtxOffset + 7];\n m31 = this._globalMatrices[mtxOffset + 8];\n m32 = this._globalMatrices[mtxOffset + 9];\n m33 = this._globalMatrices[mtxOffset + 10];\n m34 = this._globalMatrices[mtxOffset + 11];\n vx += weight * (m11 * vertX + m12 * vertY + m13 * vertZ + m14);\n vy += weight * (m21 * vertX + m22 * vertY + m23 * vertZ + m24);\n vz += weight * (m31 * vertX + m32 * vertY + m33 * vertZ + m34);\n nx += weight * (m11 * normX + m12 * normY + m13 * normZ);\n ny += weight * (m21 * normX + m22 * normY + m23 * normZ);\n nz += weight * (m31 * normX + m32 * normY + m33 * normZ);\n tx += weight * (m11 * tangX + m12 * tangY + m13 * tangZ);\n ty += weight * (m21 * tangX + m22 * tangY + m23 * tangZ);\n tz += weight * (m31 * tangX + m32 * tangY + m33 * tangZ);\n k++;\n }\n else {\n //if zero weight encountered, skip to the next vertex\n k = this._jointsPerVertex;\n }\n }\n targetPositions[i0] = vx;\n targetPositions[i0 + 1] = vy;\n if (posDim == 3)\n targetPositions[i0 + 2] = vz;\n targetNormals[i1] = nx;\n targetNormals[i1 + 1] = ny;\n targetNormals[i1 + 2] = nz;\n targetTangents[i2] = tx;\n targetTangents[i2 + 1] = ty;\n targetTangents[i2 + 2] = tz;\n index++;\n }\n };\n /**\n * Converts a local hierarchical skeleton pose to a global pose\n * @param targetPose The SkeletonPose object that will contain the global pose.\n * @param skeleton The skeleton containing the joints, and as such, the hierarchical data to transform to global poses.\n */\n SkeletonAnimator.prototype.localToGlobalPose = function (sourcePose, targetPose, skeleton) {\n var globalPoses = targetPose.jointPoses;\n var globalJointPose;\n var joints = skeleton.joints;\n var len = sourcePose.numJointPoses;\n var jointPoses = sourcePose.jointPoses;\n var parentIndex;\n var joint;\n var parentPose;\n var pose;\n var or;\n var tr;\n var t;\n var q;\n var x1, y1, z1, w1;\n var x2, y2, z2, w2;\n var x3, y3, z3;\n // :s\n if (globalPoses.length != len)\n globalPoses.length = len;\n for (var i = 0; i < len; ++i) {\n globalJointPose = globalPoses[i];\n if (globalJointPose == null)\n globalJointPose = globalPoses[i] = new JointPose();\n joint = joints[i];\n parentIndex = joint.parentIndex;\n pose = jointPoses[i];\n q = globalJointPose.orientation;\n t = globalJointPose.translation;\n if (parentIndex < 0) {\n tr = pose.translation;\n or = pose.orientation;\n q.x = or.x;\n q.y = or.y;\n q.z = or.z;\n q.w = or.w;\n t.x = tr.x;\n t.y = tr.y;\n t.z = tr.z;\n }\n else {\n // append parent pose\n parentPose = globalPoses[parentIndex];\n // rotate point\n or = parentPose.orientation;\n tr = pose.translation;\n x2 = or.x;\n y2 = or.y;\n z2 = or.z;\n w2 = or.w;\n x3 = tr.x;\n y3 = tr.y;\n z3 = tr.z;\n w1 = -x2 * x3 - y2 * y3 - z2 * z3;\n x1 = w2 * x3 + y2 * z3 - z2 * y3;\n y1 = w2 * y3 - x2 * z3 + z2 * x3;\n z1 = w2 * z3 + x2 * y3 - y2 * x3;\n // append parent translation\n tr = parentPose.translation;\n t.x = -w1 * x2 + x1 * w2 - y1 * z2 + z1 * y2 + tr.x;\n t.y = -w1 * y2 + x1 * z2 + y1 * w2 - z1 * x2 + tr.y;\n t.z = -w1 * z2 - x1 * y2 + y1 * x2 + z1 * w2 + tr.z;\n // append parent orientation\n x1 = or.x;\n y1 = or.y;\n z1 = or.z;\n w1 = or.w;\n or = pose.orientation;\n x2 = or.x;\n y2 = or.y;\n z2 = or.z;\n w2 = or.w;\n q.w = w1 * w2 - x1 * x2 - y1 * y2 - z1 * z2;\n q.x = w1 * x2 + x1 * w2 + y1 * z2 - z1 * y2;\n q.y = w1 * y2 - x1 * z2 + y1 * w2 + z1 * x2;\n q.z = w1 * z2 + x1 * y2 - y1 * x2 + z1 * w2;\n }\n }\n };\n SkeletonAnimator.prototype.onTransitionComplete = function (event) {\n if (event.type == AnimationStateEvent.TRANSITION_COMPLETE) {\n event.animationNode.removeEventListener(AnimationStateEvent.TRANSITION_COMPLETE, this._onTransitionCompleteDelegate);\n //if this is the current active state transition, revert control to the active node\n if (this._pActiveState == event.animationState) {\n this._pActiveNode = this._pAnimationSet.getAnimation(this._pActiveAnimationName);\n this._pActiveState = this.getAnimationState(this._pActiveNode);\n this._activeSkeletonState = this._pActiveState;\n }\n }\n };\n SkeletonAnimator.prototype.onIndicesUpdate = function (event) {\n var elements = event.target;\n this._morphedElements[elements.id].setIndices(elements.indices);\n };\n SkeletonAnimator.prototype.onVerticesUpdate = function (event) {\n //only update uvs\n if (event.attributesView != elements.uvs && event.attributesView != elements.getCustomAtributes(\"secondaryUVs\"))\n return;\n var elements = event.target;\n var morphGraphics = this._morphedElements[elements.id];\n var morphUVs = morphGraphics.uvs.get(elements.numVertices);\n morphGraphics.invalidateVertices(morphGraphics.uvs);\n var uvStride = morphGraphics.uvs.stride;\n var uvs = event.attributesView.get(elements.numVertices);\n var len = elements.numVertices * uvStride;\n for (var i = 0; i < len; i += uvStride) {\n morphUVs[i] = uvs[i];\n morphUVs[i + 1] = uvs[i + 1];\n }\n };\n return SkeletonAnimator;\n}(AnimatorBase));\nexport { SkeletonAnimator };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/SkeletonAnimator.js","import * as tslib_1 from \"tslib\";\nimport { AnimationRegisterData, AnimationSetBase } from \"@awayjs/stage\";\nimport { VertexAnimationMode } from \"./data/VertexAnimationMode\";\n/**\n * The animation data set used by vertex-based animators, containing vertex animation state data.\n *\n * @see VertexAnimator\n */\nvar VertexAnimationSet = (function (_super) {\n tslib_1.__extends(VertexAnimationSet, _super);\n /**\n * Returns whether or not normal data is used in last set GPU pass of the vertex shader.\n */\n //\t\tpublic get useNormals():boolean\n //\t\t{\n //\t\t\treturn this._uploadNormals;\n //\t\t}\n /**\n * Creates a new VertexAnimationSet object.\n *\n * @param numPoses The number of poses made available at once to the GPU animation code.\n * @param blendMode Optional value for setting the animation mode of the vertex animator object.\n *\n * @see away3d.animators.data.VertexAnimationMode\n */\n function VertexAnimationSet(numPoses, blendMode) {\n if (numPoses === void 0) { numPoses = 2; }\n if (blendMode === void 0) { blendMode = \"absolute\"; }\n var _this = _super.call(this) || this;\n _this._numPoses = numPoses;\n _this._blendMode = blendMode;\n return _this;\n }\n Object.defineProperty(VertexAnimationSet.prototype, \"numPoses\", {\n /**\n * Returns the number of poses made available at once to the GPU animation code.\n */\n get: function () {\n return this._numPoses;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(VertexAnimationSet.prototype, \"blendMode\", {\n /**\n * Returns the active blend mode of the vertex animator object.\n */\n get: function () {\n return this._blendMode;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * @inheritDoc\n */\n VertexAnimationSet.prototype.getAGALVertexCode = function (shader, registerCache, sharedRegisters) {\n //grab animationRegisterData from the materialpassbase or create a new one if the first time\n this._iAnimationRegisterData = shader.animationRegisterData;\n if (this._iAnimationRegisterData == null)\n this._iAnimationRegisterData = shader.animationRegisterData = new AnimationRegisterData();\n if (this._blendMode == VertexAnimationMode.ABSOLUTE)\n return this.getAbsoluteAGALCode(shader, registerCache, sharedRegisters);\n else\n return this.getAdditiveAGALCode(shader, registerCache, sharedRegisters);\n };\n /**\n * @inheritDoc\n */\n VertexAnimationSet.prototype.getAGALFragmentCode = function (shader, registerCache, shadedTarget) {\n return \"\";\n };\n /**\n * @inheritDoc\n */\n VertexAnimationSet.prototype.getAGALUVCode = function (shader, registerCache, sharedRegisters) {\n return \"mov \" + sharedRegisters.uvTarget + \",\" + sharedRegisters.uvSource + \"\\n\";\n };\n /**\n * @inheritDoc\n */\n VertexAnimationSet.prototype.doneAGALCode = function (shader) {\n };\n /**\n * Generates the vertex AGAL code for absolute blending.\n */\n VertexAnimationSet.prototype.getAbsoluteAGALCode = function (shader, registerCache, sharedRegisters) {\n var code = \"\";\n var temp1 = registerCache.getFreeVertexVectorTemp();\n registerCache.addVertexTempUsages(temp1, 1);\n var temp2 = registerCache.getFreeVertexVectorTemp();\n var regs = new Array(\".x\", \".y\", \".z\", \".w\");\n var len = sharedRegisters.animatableAttributes.length;\n var constantReg = registerCache.getFreeVertexConstant();\n this._iAnimationRegisterData.weightsIndex = constantReg.index;\n this._iAnimationRegisterData.poseIndices = new Array(this._numPoses);\n var poseInput;\n var k = 0;\n if (len > 2)\n len = 2;\n for (var i = 0; i < len; ++i) {\n code += \"mul \" + temp1 + \", \" + sharedRegisters.animatableAttributes[i] + \", \" + constantReg + regs[0] + \"\\n\";\n for (var j = 1; j < this._numPoses; ++j) {\n poseInput = registerCache.getFreeVertexAttribute();\n this._iAnimationRegisterData.poseIndices[k++] = poseInput.index;\n code += \"mul \" + temp2 + \", \" + poseInput + \", \" + constantReg + regs[j] + \"\\n\";\n if (j < this._numPoses - 1)\n code += \"add \" + temp1 + \", \" + temp1 + \", \" + temp2 + \"\\n\";\n }\n code += \"add \" + sharedRegisters.animationTargetRegisters[i] + \", \" + temp1 + \", \" + temp2 + \"\\n\";\n }\n // add code for bitangents if tangents are used\n if (shader.tangentDependencies > 0 || shader.outputsNormals) {\n code += \"dp3 \" + temp1 + \".x, \" + sharedRegisters.animatableAttributes[2] + \", \" + sharedRegisters.animationTargetRegisters[1] + \"\\n\" +\n \"mul \" + temp1 + \", \" + sharedRegisters.animationTargetRegisters[1] + \", \" + temp1 + \".x\\n\" +\n \"sub \" + sharedRegisters.animationTargetRegisters[2] + \", \" + sharedRegisters.animationTargetRegisters[2] + \", \" + temp1 + \"\\n\";\n }\n //\n // // simply write attributes to targets, do not animate them\n // // projection will pick up on targets[0] to do the projection\n // var len:number = sharedRegisters.animatableAttributes.length;\n // for (var i:number = 0; i < len; ++i)\n // \tcode += \"mov \" + sharedRegisters.animationTargetRegisters[i] + \", \" + sharedRegisters.animatableAttributes[i] + \"\\n\";\n return code;\n };\n /**\n * Generates the vertex AGAL code for additive blending.\n */\n VertexAnimationSet.prototype.getAdditiveAGALCode = function (shader, registerCache, sharedRegisters) {\n var code = \"\";\n var len = sharedRegisters.animatableAttributes.length;\n var regs = [\".x\", \".y\", \".z\", \".w\"];\n var temp1 = registerCache.getFreeVertexVectorTemp();\n var constantReg = registerCache.getFreeVertexConstant();\n this._iAnimationRegisterData.weightsIndex = constantReg.index;\n this._iAnimationRegisterData.poseIndices = new Array(this._numPoses);\n var poseInput;\n var k = 0;\n if (len > 2)\n len = 2;\n code += \"mov \" + sharedRegisters.animationTargetRegisters[0] + \", \" + sharedRegisters.animatableAttributes[0] + \"\\n\";\n if (shader.normalDependencies > 0)\n code += \"mov \" + sharedRegisters.animationTargetRegisters[1] + \", \" + sharedRegisters.animatableAttributes[1] + \"\\n\";\n for (var i = 0; i < len; ++i) {\n for (var j = 0; j < this._numPoses; ++j) {\n poseInput = registerCache.getFreeVertexAttribute();\n this._iAnimationRegisterData.poseIndices[k++] = poseInput.index;\n code += \"mul \" + temp1 + \", \" + poseInput + \", \" + constantReg + regs[j] + \"\\n\" +\n \"add \" + sharedRegisters.animationTargetRegisters[i] + \", \" + sharedRegisters.animationTargetRegisters[i] + \", \" + temp1 + \"\\n\";\n }\n }\n if (shader.tangentDependencies > 0 || shader.outputsNormals) {\n code += \"dp3 \" + temp1 + \".x, \" + sharedRegisters.animatableAttributes[2] + \", \" + sharedRegisters.animationTargetRegisters[1] + \"\\n\" +\n \"mul \" + temp1 + \", \" + sharedRegisters.animationTargetRegisters[1] + \", \" + temp1 + \".x\\n\" +\n \"sub \" + sharedRegisters.animationTargetRegisters[2] + \", \" + sharedRegisters.animatableAttributes[2] + \", \" + temp1 + \"\\n\";\n }\n return code;\n };\n return VertexAnimationSet;\n}(AnimationSetBase));\nexport { VertexAnimationSet };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/VertexAnimationSet.js","import * as tslib_1 from \"tslib\";\nimport { TriangleElements } from \"@awayjs/graphics\";\nimport { AnimatorBase } from \"@awayjs/stage\";\nimport { VertexAnimationMode } from \"./data/VertexAnimationMode\";\n/**\n * Provides an interface for assigning vertex-based animation data sets to sprite-based entity objects\n * and controlling the various available states of animation through an interative playhead that can be\n * automatically updated or manually triggered.\n */\nvar VertexAnimator = (function (_super) {\n tslib_1.__extends(VertexAnimator, _super);\n /**\n * Creates a new VertexAnimator object.\n *\n * @param vertexAnimationSet The animation data set containing the vertex animations used by the animator.\n */\n function VertexAnimator(vertexAnimationSet) {\n var _this = _super.call(this, vertexAnimationSet) || this;\n _this._poses = new Array();\n _this._weights = new Float32Array([1, 0, 0, 0]);\n _this._vertexAnimationSet = vertexAnimationSet;\n return _this;\n }\n /**\n * @inheritDoc\n */\n VertexAnimator.prototype.clone = function () {\n return new VertexAnimator(this._vertexAnimationSet);\n };\n /**\n * Plays a sequence with a given name. If the sequence is not found, it may not be loaded yet, and it will retry every frame.\n * @param sequenceName The name of the clip to be played.\n */\n VertexAnimator.prototype.play = function (name, transition, offset) {\n if (transition === void 0) { transition = null; }\n if (offset === void 0) { offset = NaN; }\n if (this._pActiveAnimationName == name)\n return;\n this._pActiveAnimationName = name;\n //TODO: implement transitions in vertex animator\n if (!this._pAnimationSet.hasAnimation(name))\n throw new Error(\"Animation root node \" + name + \" not found!\");\n this._pActiveNode = this._pAnimationSet.getAnimation(name);\n this._pActiveState = this.getAnimationState(this._pActiveNode);\n if (this.updatePosition) {\n //update straight away to reset position deltas\n this._pActiveState.update(this._pAbsoluteTime);\n this._pActiveState.positionDelta;\n }\n this._activeVertexState = this._pActiveState;\n this.start();\n //apply a time offset if specified\n if (!isNaN(offset))\n this.reset(name, offset);\n };\n /**\n * @inheritDoc\n */\n VertexAnimator.prototype._pUpdateDeltaTime = function (dt) {\n _super.prototype._pUpdateDeltaTime.call(this, dt);\n var geometryFlag = false;\n if (this._poses[0] != this._activeVertexState.currentGraphics) {\n this._poses[0] = this._activeVertexState.currentGraphics;\n geometryFlag = true;\n }\n if (this._poses[1] != this._activeVertexState.nextGraphics)\n this._poses[1] = this._activeVertexState.nextGraphics;\n this._weights[0] = 1 - (this._weights[1] = this._activeVertexState.blendWeight);\n if (geometryFlag)\n this.invalidateElements();\n };\n /**\n * @inheritDoc\n */\n VertexAnimator.prototype.setRenderState = function (shader, renderable, stage, projection) {\n // todo: add code for when running on cpu\n // this type of animation can only be Shape\n var shape = renderable.shape;\n var sprite = renderable.sourceEntity;\n var elements = shape.elements;\n // if no poses defined, set temp data\n if (!this._poses.length) {\n this.setNullPose(shader, elements, stage);\n return;\n }\n var animationRegisterData = shader.animationRegisterData;\n var i;\n var len = this._vertexAnimationSet.numPoses;\n shader.setVertexConstFromArray(animationRegisterData.weightsIndex, this._weights);\n if (this._vertexAnimationSet.blendMode == VertexAnimationMode.ABSOLUTE)\n i = 1;\n else\n i = 0;\n var elementsGL;\n var k = 0;\n var shapeIndex = sprite.graphics.getShapeIndex(shape);\n for (; i < len; ++i) {\n elements = this._poses[i].getShapeAt(shapeIndex).elements || shape.elements;\n elementsGL = stage.getAbstraction(elements);\n elementsGL._indexMappings = stage.getAbstraction(shape.elements).getIndexMappings();\n if (elements.isAsset(TriangleElements)) {\n elementsGL.activateVertexBufferVO(animationRegisterData.poseIndices[k++], elements.positions);\n if (shader.normalDependencies > 0)\n elementsGL.activateVertexBufferVO(animationRegisterData.poseIndices[k++], elements.normals);\n }\n }\n };\n VertexAnimator.prototype.setNullPose = function (shader, elements, stage) {\n var animationRegisterData = shader.animationRegisterData;\n shader.setVertexConstFromArray(animationRegisterData.weightsIndex, this._weights);\n var elementsGL = stage.getAbstraction(elements);\n var k = 0;\n if (this._vertexAnimationSet.blendMode == VertexAnimationMode.ABSOLUTE) {\n var len = this._vertexAnimationSet.numPoses;\n for (var i = 1; i < len; ++i) {\n if (elements.isAsset(TriangleElements)) {\n elementsGL.activateVertexBufferVO(animationRegisterData.poseIndices[k++], elements.positions);\n if (shader.normalDependencies > 0)\n elementsGL.activateVertexBufferVO(animationRegisterData.poseIndices[k++], elements.normals);\n }\n }\n }\n // todo: set temp data for additive?\n };\n /**\n * Verifies if the animation will be used on cpu. Needs to be true for all passes for a material to be able to use it on gpu.\n * Needs to be called if gpu code is potentially required.\n */\n VertexAnimator.prototype.testGPUCompatibility = function (shader) {\n };\n VertexAnimator.prototype.getRenderableElements = function (renderable, sourceElements) {\n if (this._vertexAnimationSet.blendMode == VertexAnimationMode.ABSOLUTE && this._poses.length)\n return this._poses[0].getShapeAt(renderable.sourceEntity.graphics.getShapeIndex(renderable.shape)).elements || sourceElements;\n //nothing to do here\n return sourceElements;\n };\n return VertexAnimator;\n}(AnimatorBase));\nexport { VertexAnimator };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/animators/VertexAnimator.js","import * as tslib_1 from \"tslib\";\nimport { EventBase } from \"@awayjs/core\";\nvar RTTEvent = (function (_super) {\n tslib_1.__extends(RTTEvent, _super);\n function RTTEvent(type, rttManager) {\n var _this = _super.call(this, type) || this;\n _this._rttManager = rttManager;\n return _this;\n }\n Object.defineProperty(RTTEvent.prototype, \"rttManager\", {\n /**\n *\n */\n get: function () {\n return this._rttManager;\n },\n enumerable: true,\n configurable: true\n });\n /**\n *\n */\n RTTEvent.prototype.clone = function () {\n return new RTTEvent(this.type, this._rttManager);\n };\n return RTTEvent;\n}(EventBase));\nexport { RTTEvent };\n/**\n *\n */\nRTTEvent.RESIZE = \"rttManagerResize\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/events/RTTEvent.js","import * as tslib_1 from \"tslib\";\nimport { Rectangle, EventDispatcher } from \"@awayjs/core\";\nimport { ImageUtils } from \"@awayjs/graphics\";\nimport { RTTEvent } from \"../events/RTTEvent\";\nvar RTTBufferManager = (function (_super) {\n tslib_1.__extends(RTTBufferManager, _super);\n function RTTBufferManager(stage) {\n var _this = _super.call(this) || this;\n _this._viewWidth = -1;\n _this._viewHeight = -1;\n _this._textureWidth = -1;\n _this._textureHeight = -1;\n _this._buffersInvalid = true;\n _this._renderToTextureRect = new Rectangle();\n _this._stage = stage;\n return _this;\n }\n RTTBufferManager.getInstance = function (stage) {\n if (!stage)\n throw new Error(\"stage key cannot be null!\");\n if (RTTBufferManager._instances == null)\n RTTBufferManager._instances = new Array();\n var rttBufferManager = RTTBufferManager.getRTTBufferManagerFromStage(stage);\n if (rttBufferManager == null) {\n rttBufferManager = new RTTBufferManager(stage);\n var vo = new RTTBufferManagerVO();\n vo.stage3d = stage;\n vo.rttbfm = rttBufferManager;\n RTTBufferManager._instances.push(vo);\n }\n return rttBufferManager;\n };\n RTTBufferManager.getRTTBufferManagerFromStage = function (stage) {\n var l = RTTBufferManager._instances.length;\n var r;\n for (var c = 0; c < l; c++) {\n r = RTTBufferManager._instances[c];\n if (r.stage3d === stage)\n return r.rttbfm;\n }\n return null;\n };\n RTTBufferManager.deleteRTTBufferManager = function (stage) {\n var l = RTTBufferManager._instances.length;\n var r;\n for (var c = 0; c < l; c++) {\n r = RTTBufferManager._instances[c];\n if (r.stage3d === stage) {\n RTTBufferManager._instances.splice(c, 1);\n return;\n }\n }\n };\n Object.defineProperty(RTTBufferManager.prototype, \"textureRatioX\", {\n get: function () {\n if (this._buffersInvalid)\n this.updateRTTBuffers();\n return this._textureRatioX;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RTTBufferManager.prototype, \"textureRatioY\", {\n get: function () {\n if (this._buffersInvalid)\n this.updateRTTBuffers();\n return this._textureRatioY;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RTTBufferManager.prototype, \"viewWidth\", {\n get: function () {\n return this._viewWidth;\n },\n set: function (value) {\n if (value == this._viewWidth)\n return;\n this._viewWidth = value;\n this._buffersInvalid = true;\n this._textureWidth = ImageUtils.getBestPowerOf2(this._viewWidth);\n if (this._textureWidth > this._viewWidth) {\n this._renderToTextureRect.x = Math.floor((this._textureWidth - this._viewWidth) * .5);\n this._renderToTextureRect.width = this._viewWidth;\n }\n else {\n this._renderToTextureRect.x = 0;\n this._renderToTextureRect.width = this._textureWidth;\n }\n this.dispatchEvent(new RTTEvent(RTTEvent.RESIZE, this));\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RTTBufferManager.prototype, \"viewHeight\", {\n get: function () {\n return this._viewHeight;\n },\n set: function (value) {\n if (value == this._viewHeight)\n return;\n this._viewHeight = value;\n this._buffersInvalid = true;\n this._textureHeight = ImageUtils.getBestPowerOf2(this._viewHeight);\n if (this._textureHeight > this._viewHeight) {\n this._renderToTextureRect.y = Math.floor((this._textureHeight - this._viewHeight) * .5);\n this._renderToTextureRect.height = this._viewHeight;\n }\n else {\n this._renderToTextureRect.y = 0;\n this._renderToTextureRect.height = this._textureHeight;\n }\n this.dispatchEvent(new RTTEvent(RTTEvent.RESIZE, this));\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RTTBufferManager.prototype, \"renderToTextureVertexBuffer\", {\n get: function () {\n if (this._buffersInvalid)\n this.updateRTTBuffers();\n return this._renderToTextureVertexBuffer;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RTTBufferManager.prototype, \"renderToScreenVertexBuffer\", {\n get: function () {\n if (this._buffersInvalid)\n this.updateRTTBuffers();\n return this._renderToScreenVertexBuffer;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RTTBufferManager.prototype, \"indexBuffer\", {\n get: function () {\n return this._indexBuffer;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RTTBufferManager.prototype, \"renderToTextureRect\", {\n get: function () {\n if (this._buffersInvalid)\n this.updateRTTBuffers();\n return this._renderToTextureRect;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RTTBufferManager.prototype, \"textureWidth\", {\n get: function () {\n return this._textureWidth;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RTTBufferManager.prototype, \"textureHeight\", {\n get: function () {\n return this._textureHeight;\n },\n enumerable: true,\n configurable: true\n });\n RTTBufferManager.prototype.dispose = function () {\n RTTBufferManager.deleteRTTBufferManager(this._stage);\n if (this._indexBuffer) {\n this._indexBuffer.dispose();\n this._renderToScreenVertexBuffer.dispose();\n this._renderToTextureVertexBuffer.dispose();\n this._renderToScreenVertexBuffer = null;\n this._renderToTextureVertexBuffer = null;\n this._indexBuffer = null;\n }\n };\n // todo: place all this in a separate model, since it's used all over the place\n // maybe it even has a place in the core (together with screenRect etc)?\n // needs to be stored per view of course\n RTTBufferManager.prototype.updateRTTBuffers = function () {\n var context = this._stage.context;\n var textureVerts;\n var screenVerts;\n var x;\n var y;\n if (this._renderToTextureVertexBuffer == null)\n this._renderToTextureVertexBuffer = context.createVertexBuffer(4, 20);\n if (this._renderToScreenVertexBuffer == null)\n this._renderToScreenVertexBuffer = context.createVertexBuffer(4, 20);\n if (!this._indexBuffer) {\n this._indexBuffer = context.createIndexBuffer(6);\n this._indexBuffer.uploadFromArray([2, 1, 0, 3, 2, 0], 0, 6);\n }\n this._textureRatioX = x = Math.min(this._viewWidth / this._textureWidth, 1);\n this._textureRatioY = y = Math.min(this._viewHeight / this._textureHeight, 1);\n var u1 = (1 - x) * .5;\n var u2 = (x + 1) * .5;\n var v1 = (1 - y) * .5;\n var v2 = (y + 1) * .5;\n // last element contains indices for data per vertex that can be passed to the vertex shader if necessary (ie: frustum corners for deferred rendering)\n textureVerts = [-x, -y, u1, v1, 0, x, -y, u2, v1, 1, x, y, u2, v2, 2, -x, y, u1, v2, 3];\n screenVerts = [-1, -1, u1, v1, 0, 1, -1, u2, v1, 1, 1, 1, u2, v2, 2, -1, 1, u1, v2, 3];\n this._renderToTextureVertexBuffer.uploadFromArray(textureVerts, 0, 4);\n this._renderToScreenVertexBuffer.uploadFromArray(screenVerts, 0, 4);\n this._buffersInvalid = false;\n };\n return RTTBufferManager;\n}(EventDispatcher));\nexport { RTTBufferManager };\nvar RTTBufferManagerVO = (function () {\n function RTTBufferManagerVO() {\n }\n return RTTBufferManagerVO;\n}());\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/managers/RTTBufferManager.js","import * as tslib_1 from \"tslib\";\nimport { ShaderBase, GL_MaterialPassBase } from \"@awayjs/stage\";\n/**\n * GL_DepthMaterial forms an abstract base class for the default shaded materials provided by Stage,\n * using material methods to define their appearance.\n */\nvar GL_DepthMaterial = (function (_super) {\n tslib_1.__extends(GL_DepthMaterial, _super);\n /**\n *\n * @param pool\n * @param surface\n * @param elementsClass\n * @param stage\n */\n function GL_DepthMaterial(material, materialPool) {\n var _this = _super.call(this, material, materialPool) || this;\n _this._shader = new ShaderBase(materialPool.elementsClass, _this, _this._stage);\n _this._pAddPass(_this);\n return _this;\n }\n GL_DepthMaterial.prototype.invalidate = function () {\n _super.prototype.invalidate.call(this);\n this._textureVO = this._material.getTextureAt(0) ? this._shader.getAbstraction(this._material.getTextureAt(0)) : null;\n };\n GL_DepthMaterial.prototype._includeDependencies = function (shader) {\n _super.prototype._includeDependencies.call(this, shader);\n shader.projectionDependencies++;\n if (shader.alphaThreshold > 0)\n shader.uvDependencies++;\n };\n GL_DepthMaterial.prototype._initConstantData = function (shader) {\n _super.prototype._initConstantData.call(this, shader);\n var index = this._fragmentConstantsIndex;\n var data = shader.fragmentConstantData;\n data[index] = 1.0;\n data[index + 1] = 255.0;\n data[index + 2] = 65025.0;\n data[index + 3] = 16581375.0;\n data[index + 4] = 1.0 / 255.0;\n data[index + 5] = 1.0 / 255.0;\n data[index + 6] = 1.0 / 255.0;\n data[index + 7] = 0.0;\n };\n /**\n * @inheritDoc\n */\n GL_DepthMaterial.prototype._getFragmentCode = function (registerCache, sharedRegisters) {\n var code = \"\";\n var targetReg = sharedRegisters.shadedTarget;\n var dataReg1 = registerCache.getFreeFragmentConstant();\n var dataReg2 = registerCache.getFreeFragmentConstant();\n this._fragmentConstantsIndex = dataReg1.index * 4;\n var temp1 = registerCache.getFreeFragmentVectorTemp();\n registerCache.addFragmentTempUsages(temp1, 1);\n var temp2 = registerCache.getFreeFragmentVectorTemp();\n registerCache.addFragmentTempUsages(temp2, 1);\n code += \"div \" + temp1 + \", \" + sharedRegisters.projectionFragment + \", \" + sharedRegisters.projectionFragment + \".w\\n\" +\n \"mul \" + temp1 + \", \" + dataReg1 + \", \" + temp1 + \".z\\n\" +\n \"frc \" + temp1 + \", \" + temp1 + \"\\n\" +\n \"mul \" + temp2 + \", \" + temp1 + \".yzww, \" + dataReg2 + \"\\n\";\n //codeF += \"mov ft1.w, fc1.w\t\\n\" +\n // \"mov ft0.w, fc0.x\t\\n\";\n if (this._textureVO && this._shader.alphaThreshold > 0) {\n var albedo = registerCache.getFreeFragmentVectorTemp();\n code += this._textureVO._getFragmentCode(albedo, registerCache, sharedRegisters, sharedRegisters.uvVarying);\n var cutOffReg = registerCache.getFreeFragmentConstant();\n code += \"sub \" + albedo + \".w, \" + albedo + \".w, \" + cutOffReg + \".x\\n\" +\n \"kil \" + albedo + \".w\\n\";\n }\n code += \"sub \" + targetReg + \", \" + temp1 + \", \" + temp2 + \"\\n\";\n registerCache.removeFragmentTempUsage(temp1);\n registerCache.removeFragmentTempUsage(temp2);\n return code;\n };\n /**\n * @inheritDoc\n */\n GL_DepthMaterial.prototype._activate = function (projection) {\n _super.prototype._activate.call(this, projection);\n if (this._textureVO && this._shader.alphaThreshold > 0) {\n this._textureVO.activate();\n this._shader.fragmentConstantData[this._fragmentConstantsIndex + 8] = this._shader.alphaThreshold;\n }\n };\n return GL_DepthMaterial;\n}(GL_MaterialPassBase));\nexport { GL_DepthMaterial };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/materials/GL_DepthMaterial.js","import * as tslib_1 from \"tslib\";\nimport { ShaderBase, GL_MaterialPassBase } from \"@awayjs/stage\";\n/**\n * DistanceRender is a pass that writes distance values to a depth map as a 32-bit value exploded over the 4 texture channels.\n * This is used to render omnidirectional shadow maps.\n */\nvar GL_DistanceMaterial = (function (_super) {\n tslib_1.__extends(GL_DistanceMaterial, _super);\n /**\n * Creates a new DistanceRender object.\n *\n * @param material The material to which this pass belongs.\n */\n function GL_DistanceMaterial(material, materialPool) {\n var _this = _super.call(this, material, materialPool) || this;\n _this._shader = new ShaderBase(materialPool.elementsClass, _this, _this._stage);\n _this._pAddPass(_this);\n return _this;\n }\n GL_DistanceMaterial.prototype.invalidate = function () {\n _super.prototype.invalidate.call(this);\n this._textureVO = this._material.getTextureAt(0) ? this._shader.getAbstraction(this._material.getTextureAt(0)) : null;\n };\n /**\n * Initializes the unchanging constant data for this material.\n */\n GL_DistanceMaterial.prototype._initConstantData = function (shader) {\n _super.prototype._initConstantData.call(this, shader);\n var index = this._fragmentConstantsIndex;\n var data = shader.fragmentConstantData;\n data[index + 4] = 1.0 / 255.0;\n data[index + 5] = 1.0 / 255.0;\n data[index + 6] = 1.0 / 255.0;\n data[index + 7] = 0.0;\n };\n GL_DistanceMaterial.prototype._includeDependencies = function (shader) {\n _super.prototype._includeDependencies.call(this, shader);\n shader.projectionDependencies++;\n shader.viewDirDependencies++;\n if (shader.alphaThreshold > 0)\n shader.uvDependencies++;\n if (shader.viewDirDependencies > 0)\n shader.globalPosDependencies++;\n };\n /**\n * @inheritDoc\n */\n GL_DistanceMaterial.prototype._getFragmentCode = function (registerCache, sharedRegisters) {\n var code;\n var targetReg = sharedRegisters.shadedTarget;\n var dataReg1 = registerCache.getFreeFragmentConstant();\n var dataReg2 = registerCache.getFreeFragmentConstant();\n this._fragmentConstantsIndex = dataReg1.index * 4;\n var temp1 = registerCache.getFreeFragmentVectorTemp();\n registerCache.addFragmentTempUsages(temp1, 1);\n var temp2 = registerCache.getFreeFragmentVectorTemp();\n registerCache.addFragmentTempUsages(temp2, 1);\n // squared distance to view\n code = \"dp3 \" + temp1 + \".z, \" + sharedRegisters.viewDirVarying + \".xyz, \" + sharedRegisters.viewDirVarying + \".xyz\\n\" +\n \"mul \" + temp1 + \", \" + dataReg1 + \", \" + temp1 + \".z\\n\" +\n \"frc \" + temp1 + \", \" + temp1 + \"\\n\" +\n \"mul \" + temp2 + \", \" + temp1 + \".yzww, \" + dataReg2 + \"\\n\";\n if (this._textureVO && this._shader.alphaThreshold > 0) {\n var albedo = registerCache.getFreeFragmentVectorTemp();\n code += this._textureVO._getFragmentCode(albedo, registerCache, sharedRegisters, sharedRegisters.uvVarying);\n var cutOffReg = registerCache.getFreeFragmentConstant();\n code += \"sub \" + albedo + \".w, \" + albedo + \".w, \" + cutOffReg + \".x\\n\" +\n \"kil \" + albedo + \".w\\n\";\n }\n code += \"sub \" + targetReg + \", \" + temp1 + \", \" + temp2 + \"\\n\";\n return code;\n };\n /**\n * @inheritDoc\n */\n GL_DistanceMaterial.prototype._activate = function (projection) {\n _super.prototype._activate.call(this, projection);\n var f = projection.far;\n f = 1 / (2 * f * f);\n // sqrt(f*f+f*f) is largest possible distance for any frustum, so we need to divide by it. Rarely a tight fit, but with 32 bits precision, it's enough.\n var index = this._fragmentConstantsIndex;\n var data = this._shader.fragmentConstantData;\n data[index] = 1.0 * f;\n data[index + 1] = 255.0 * f;\n data[index + 2] = 65025.0 * f;\n data[index + 3] = 16581375.0 * f;\n if (this._textureVO && this._shader.alphaThreshold > 0) {\n this._textureVO.activate();\n data[index + 8] = this._shader.alphaThreshold;\n }\n };\n return GL_DistanceMaterial;\n}(GL_MaterialPassBase));\nexport { GL_DistanceMaterial };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/materials/GL_DistanceMaterial.js","import * as tslib_1 from \"tslib\";\nimport { EventBase } from \"@awayjs/core\";\nvar RendererEvent = (function (_super) {\n tslib_1.__extends(RendererEvent, _super);\n function RendererEvent(type) {\n return _super.call(this, type) || this;\n }\n return RendererEvent;\n}(EventBase));\nexport { RendererEvent };\nRendererEvent.VIEWPORT_UPDATED = \"viewportUpdated\";\nRendererEvent.SCISSOR_UPDATED = \"scissorUpdated\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/events/RendererEvent.js","/**\n * @class away.sort.RenderableMergeSort\n */\nvar RenderableMergeSort = (function () {\n function RenderableMergeSort() {\n }\n RenderableMergeSort.prototype.sortBlendedRenderables = function (head) {\n var headB;\n var fast;\n var slow;\n if (!head || !head.next) {\n return head;\n }\n // split in two sublists\n slow = head;\n fast = head.next;\n while (fast) {\n fast = fast.next;\n if (fast) {\n slow = slow.next;\n fast = fast.next;\n }\n }\n headB = slow.next;\n slow.next = null;\n // recurse\n head = this.sortBlendedRenderables(head);\n headB = this.sortBlendedRenderables(headB);\n // merge sublists while respecting order\n var result;\n var curr;\n var l;\n if (!head)\n return headB;\n if (!headB)\n return head;\n while (head && headB) {\n if (head.zIndex < headB.zIndex) {\n l = head;\n head = head.next;\n }\n else {\n l = headB;\n headB = headB.next;\n }\n if (!result)\n result = l;\n else\n curr.next = l;\n curr = l;\n }\n if (head)\n curr.next = head;\n else if (headB)\n curr.next = headB;\n return result;\n };\n RenderableMergeSort.prototype.sortOpaqueRenderables = function (head) {\n var headB;\n var fast, slow;\n if (!head || !head.next) {\n return head;\n }\n // split in two sublists\n slow = head;\n fast = head.next;\n while (fast) {\n fast = fast.next;\n if (fast) {\n slow = slow.next;\n fast = fast.next;\n }\n }\n headB = slow.next;\n slow.next = null;\n // recurse\n head = this.sortOpaqueRenderables(head);\n headB = this.sortOpaqueRenderables(headB);\n // merge sublists while respecting order\n var result;\n var curr;\n var l;\n var cmp = 0;\n if (!head)\n return headB;\n if (!headB)\n return head;\n while (head && headB && head != null && headB != null) {\n // first sort per render order id (reduces program3D switches),\n // then on render object id (reduces setting props),\n // then on zIndex (reduces overdraw)\n var aid = head.renderOrderId;\n var bid = headB.renderOrderId;\n if (aid == bid) {\n var ma = head.materialID;\n var mb = headB.materialID;\n if (ma == mb) {\n if (head.zIndex < headB.zIndex)\n cmp = 1;\n else\n cmp = -1;\n }\n else if (ma > mb) {\n cmp = 1;\n }\n else {\n cmp = -1;\n }\n }\n else if (aid > bid) {\n cmp = 1;\n }\n else {\n cmp = -1;\n }\n if (cmp < 0) {\n l = head;\n head = head.next;\n }\n else {\n l = headB;\n headB = headB.next;\n }\n if (!result) {\n result = l;\n curr = l;\n }\n else {\n curr.next = l;\n curr = l;\n }\n }\n if (head)\n curr.next = head;\n else if (headB)\n curr.next = headB;\n return result;\n };\n return RenderableMergeSort;\n}());\nexport { RenderableMergeSort };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/sort/RenderableMergeSort.js","import * as tslib_1 from \"tslib\";\nimport { Rectangle, Vector3D } from \"@awayjs/core\";\nimport { TraverserBase } from \"@awayjs/graphics\";\nimport { ContextGLProfile, ContextMode, AGALMiniAssembler, ContextGLBlendFactor, ContextGLCompareMode, ContextGLStencilAction, ContextGLTriangleFace, StageEvent, StageManager } from \"@awayjs/stage\";\nimport { RendererEvent } from \"./events/RendererEvent\";\nimport { RenderableMergeSort } from \"./sort/RenderableMergeSort\";\n/**\n * RendererBase forms an abstract base class for classes that are used in the rendering pipeline to render the\n * contents of a partition\n *\n * @class away.render.RendererBase\n */\nvar RendererBase = (function (_super) {\n tslib_1.__extends(RendererBase, _super);\n /**\n * Creates a new RendererBase object.\n */\n function RendererBase(stage, forceSoftware, profile, mode) {\n if (stage === void 0) { stage = null; }\n if (forceSoftware === void 0) { forceSoftware = false; }\n if (profile === void 0) { profile = ContextGLProfile.BASELINE; }\n if (mode === void 0) { mode = ContextMode.AUTO; }\n var _this = _super.call(this) || this;\n _this._activeMasksConfig = new Array();\n _this._registeredMasks = new Array();\n _this._numUsedStreams = 0;\n _this._numUsedTextures = 0;\n _this._cameraForward = new Vector3D();\n _this._pBackBufferInvalid = true;\n _this._pDepthTextureInvalid = true;\n _this._depthPrepass = false;\n _this._backgroundR = 0;\n _this._backgroundG = 0;\n _this._backgroundB = 0;\n _this._backgroundAlpha = 1;\n // only used by renderers that need to render geometry to textures\n _this._width = 0;\n _this._height = 0;\n _this.textureRatioX = 1;\n _this.textureRatioY = 1;\n _this._x = 0;\n _this._y = 0;\n _this._pScissorRect = new Rectangle();\n _this._pNumElements = 0;\n _this._disableColor = false;\n _this._disableClear = false;\n _this._renderBlended = true;\n _this._numCullPlanes = 0;\n _this._onViewportUpdatedDelegate = function (event) { return _this.onViewportUpdated(event); };\n _this._onContextUpdateDelegate = function (event) { return _this.onContextUpdate(event); };\n //default sorting algorithm\n _this.renderableSorter = new RenderableMergeSort();\n //set stage\n _this._pStage = stage || StageManager.getInstance().getFreeStage(forceSoftware, profile, mode);\n _this._pStage.addEventListener(StageEvent.CONTEXT_CREATED, _this._onContextUpdateDelegate);\n _this._pStage.addEventListener(StageEvent.CONTEXT_RECREATED, _this._onContextUpdateDelegate);\n _this._pStage.addEventListener(StageEvent.VIEWPORT_UPDATED, _this._onViewportUpdatedDelegate);\n /*\n if (_backgroundImageRenderer)\n _backgroundImageRenderer.stage = value;\n */\n if (_this._pStage.context)\n _this._pContext = _this._pStage.context;\n return _this;\n }\n Object.defineProperty(RendererBase.prototype, \"cullPlanes\", {\n /**\n *\n */\n get: function () {\n return this._customCullPlanes;\n },\n set: function (value) {\n this._customCullPlanes = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RendererBase.prototype, \"renderBlended\", {\n get: function () {\n return this._renderBlended;\n },\n set: function (value) {\n this._renderBlended = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RendererBase.prototype, \"disableColor\", {\n get: function () {\n return this._disableColor;\n },\n set: function (value) {\n this._disableColor = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RendererBase.prototype, \"disableClear\", {\n get: function () {\n return this._disableClear;\n },\n set: function (value) {\n this._disableClear = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RendererBase.prototype, \"numElements\", {\n /**\n *\n */\n get: function () {\n return this._pNumElements;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RendererBase.prototype, \"viewPort\", {\n /**\n * A viewPort rectangle equivalent of the Stage size and position.\n */\n get: function () {\n return this._pStage.viewPort;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RendererBase.prototype, \"scissorRect\", {\n /**\n * A scissor rectangle equivalent of the view size and position.\n */\n get: function () {\n if (this._scissorDirty) {\n this._scissorDirty = false;\n if (this.shareContext) {\n this._pScissorRect.x = this._x - this._pStage.viewPort.x;\n this._pScissorRect.y = this._y - this._pStage.viewPort.y;\n }\n else {\n this._pScissorRect.x = 0;\n this._pScissorRect.y = 0;\n }\n }\n return this._pScissorRect;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RendererBase.prototype, \"x\", {\n /**\n *\n */\n get: function () {\n return this._x;\n },\n set: function (value) {\n if (this._x == value)\n return;\n this._x = value;\n if (!this.shareContext)\n this._pStage.x = value;\n this.notifyScissorUpdate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RendererBase.prototype, \"y\", {\n /**\n *\n */\n get: function () {\n return this._y;\n },\n set: function (value) {\n if (this._y == value)\n return;\n this._y = value;\n if (!this.shareContext)\n this._pStage.y = value;\n this.notifyScissorUpdate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RendererBase.prototype, \"width\", {\n /**\n *\n */\n get: function () {\n return this._width;\n },\n set: function (value) {\n if (this._width == value)\n return;\n this._width = value;\n this._pScissorRect.width = value;\n if (this._pRttBufferManager)\n this._pRttBufferManager.viewWidth = value;\n if (!this.shareContext) {\n this._pBackBufferInvalid = true;\n this._pDepthTextureInvalid = true;\n }\n this.notifyScissorUpdate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RendererBase.prototype, \"height\", {\n /**\n *\n */\n get: function () {\n return this._height;\n },\n set: function (value) {\n if (this._height == value)\n return;\n this._height = value;\n this._pScissorRect.height = value;\n if (this._pRttBufferManager)\n this._pRttBufferManager.viewHeight = value;\n if (!this.shareContext) {\n this._pBackBufferInvalid = true;\n this._pDepthTextureInvalid = true;\n }\n this.notifyScissorUpdate();\n },\n enumerable: true,\n configurable: true\n });\n RendererBase.prototype.activatePass = function (pass, projection) {\n //clear unused vertex streams\n var i;\n for (i = pass.shader.numUsedStreams; i < this._numUsedStreams; i++)\n this._pContext.setVertexBufferAt(i, null);\n //clear unused texture streams\n for (i = pass.shader.numUsedTextures; i < this._numUsedTextures; i++)\n this._pContext.setTextureAt(i, null);\n //check program data is uploaded\n var programData = pass.shader.programData;\n if (!programData.program) {\n programData.program = this._pContext.createProgram();\n var vertexByteCode = (new AGALMiniAssembler().assemble(\"part vertex 1\\n\" + programData.vertexString + \"endpart\"))['vertex'].data;\n var fragmentByteCode = (new AGALMiniAssembler().assemble(\"part fragment 1\\n\" + programData.fragmentString + \"endpart\"))['fragment'].data;\n programData.program.upload(vertexByteCode, fragmentByteCode);\n }\n //set program data\n this._pContext.setProgram(programData.program);\n //activate shader object through pass\n pass._activate(projection);\n };\n RendererBase.prototype.deactivatePass = function (pass) {\n //deactivate shader object through pass\n pass._deactivate();\n this._numUsedStreams = pass.shader.numUsedStreams;\n this._numUsedTextures = pass.shader.numUsedTextures;\n };\n Object.defineProperty(RendererBase.prototype, \"_iBackgroundR\", {\n /**\n * The background color's red component, used when clearing.\n *\n * @private\n */\n get: function () {\n return this._backgroundR;\n },\n set: function (value) {\n if (this._backgroundR == value)\n return;\n this._backgroundR = value;\n this._pBackBufferInvalid = true;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RendererBase.prototype, \"_iBackgroundG\", {\n /**\n * The background color's green component, used when clearing.\n *\n * @private\n */\n get: function () {\n return this._backgroundG;\n },\n set: function (value) {\n if (this._backgroundG == value)\n return;\n this._backgroundG = value;\n this._pBackBufferInvalid = true;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RendererBase.prototype, \"_iBackgroundB\", {\n /**\n * The background color's blue component, used when clearing.\n *\n * @private\n */\n get: function () {\n return this._backgroundB;\n },\n set: function (value) {\n if (this._backgroundB == value)\n return;\n this._backgroundB = value;\n this._pBackBufferInvalid = true;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RendererBase.prototype, \"context\", {\n get: function () {\n return this._pContext;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(RendererBase.prototype, \"stage\", {\n /**\n * The Stage that will provide the ContextGL used for rendering.\n */\n get: function () {\n return this._pStage;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * Disposes the resources used by the RendererBase.\n */\n RendererBase.prototype.dispose = function () {\n this._pStage.removeEventListener(StageEvent.CONTEXT_CREATED, this._onContextUpdateDelegate);\n this._pStage.removeEventListener(StageEvent.CONTEXT_RECREATED, this._onContextUpdateDelegate);\n this._pStage.removeEventListener(StageEvent.VIEWPORT_UPDATED, this._onViewportUpdatedDelegate);\n this._pStage = null;\n this._pContext = null;\n /*\n if (_backgroundImageRenderer) {\n _backgroundImageRenderer.dispose();\n _backgroundImageRenderer = null;\n }\n */\n };\n RendererBase.prototype.render = function (view) {\n };\n /**\n * Renders the potentially visible geometry to the back buffer or texture.\n * @param target An option target texture to render to.\n * @param surfaceSelector The index of a CubeTexture's face to render to.\n * @param additionalClearMask Additional clear mask information, in case extra clear channels are to be omitted.\n */\n RendererBase.prototype._iRender = function (projection, view, target, scissorRect, surfaceSelector) {\n if (target === void 0) { target = null; }\n if (scissorRect === void 0) { scissorRect = null; }\n if (surfaceSelector === void 0) { surfaceSelector = 0; }\n //TODO refactor setTarget so that rendertextures are created before this check\n if (!this._pStage || !this._pContext)\n return;\n //reset head values\n this._pBlendedRenderableHead = null;\n this._pOpaqueRenderableHead = null;\n this._pNumElements = 0;\n this._cameraTransform = projection.transform.concatenatedMatrix3D;\n this._cameraForward = projection.transform.forwardVector;\n this._cullPlanes = this._customCullPlanes ? this._customCullPlanes : projection.frustumPlanes;\n this._numCullPlanes = this._cullPlanes ? this._cullPlanes.length : 0;\n RendererBase._iCollectionMark++;\n view.traversePartitions(this);\n //sort the resulting renderables\n if (this.renderableSorter) {\n this._pOpaqueRenderableHead = this.renderableSorter.sortOpaqueRenderables(this._pOpaqueRenderableHead);\n this._pBlendedRenderableHead = this.renderableSorter.sortBlendedRenderables(this._pBlendedRenderableHead);\n }\n // this._pRttViewProjectionMatrix.copyFrom(projection.viewMatrix3D);\n // this._pRttViewProjectionMatrix.appendScale(this.textureRatioX, this.textureRatioY, 1);\n this.pExecuteRender(projection, view, target, scissorRect, surfaceSelector);\n // invalidate mipmaps (if target exists) to regenerate if required\n if (target)\n target.invalidateMipmaps();\n // clear buffers\n for (var i = 0; i < 8; ++i) {\n this._pContext.setVertexBufferAt(i, null);\n this._pContext.setTextureAt(i, null);\n }\n };\n RendererBase.prototype._iRenderCascades = function (projection, view, target, numCascades, scissorRects, projections) {\n this._pStage.setRenderTarget(target, true, 0);\n this._pContext.clear(1, 1, 1, 1, 1, 0);\n this._pContext.setBlendFactors(ContextGLBlendFactor.ONE, ContextGLBlendFactor.ZERO);\n this._pContext.setDepthTest(true, ContextGLCompareMode.LESS);\n var head = this._pOpaqueRenderableHead;\n var first = true;\n //TODO cascades must have separate collectors, rather than separate draw commands\n for (var i = numCascades - 1; i >= 0; --i) {\n this._pStage.scissorRect = scissorRects[i];\n //this.drawCascadeRenderables(head, cameras[i], first? null : cameras[i].frustumPlanes);\n first = false;\n }\n //line required for correct rendering when using away3d with starling. DO NOT REMOVE UNLESS STARLING INTEGRATION IS RETESTED!\n this._pContext.setDepthTest(false, ContextGLCompareMode.LESS_EQUAL);\n this._pStage.scissorRect = null;\n };\n /**\n * Renders the potentially visible geometry to the back buffer or texture. Only executed if everything is set up.\n *\n * @param target An option target texture to render to.\n * @param surfaceSelector The index of a CubeTexture's face to render to.\n * @param additionalClearMask Additional clear mask information, in case extra clear channels are to be omitted.\n */\n RendererBase.prototype.pExecuteRender = function (projection, view, target, scissorRect, surfaceSelector) {\n if (target === void 0) { target = null; }\n if (scissorRect === void 0) { scissorRect = null; }\n if (surfaceSelector === void 0) { surfaceSelector = 0; }\n this._pStage.setRenderTarget(target, true, surfaceSelector);\n if ((target || !this.shareContext) && !this._depthPrepass && !this._disableClear)\n this._pContext.clear(this._backgroundR, this._backgroundG, this._backgroundB, this._backgroundAlpha, 1, 0);\n this._pStage.scissorRect = scissorRect;\n /*\n if (_backgroundImageRenderer)\n _backgroundImageRenderer.render();\n */\n this._pContext.setBlendFactors(ContextGLBlendFactor.ONE, ContextGLBlendFactor.ZERO);\n this.pDraw(projection);\n //line required for correct rendering when using away3d with starling. DO NOT REMOVE UNLESS STARLING INTEGRATION IS RETESTED!\n //this._pContext.setDepthTest(false, ContextGLCompareMode.LESS_EQUAL); //oopsie\n if (target || !this.shareContext) {\n if (this._snapshotRequired && this._snapshotBitmapImage2D) {\n this._pContext.drawToBitmapImage2D(this._snapshotBitmapImage2D);\n this._snapshotRequired = false;\n }\n }\n this._pStage.scissorRect = null;\n };\n /*\n * Will draw the renderer's output on next render to the provided bitmap data.\n * */\n RendererBase.prototype.queueSnapshot = function (bmd) {\n this._snapshotRequired = true;\n this._snapshotBitmapImage2D = bmd;\n };\n /**\n * Performs the actual drawing of geometry to the target.\n */\n RendererBase.prototype.pDraw = function (projection) {\n this._pContext.setDepthTest(true, ContextGLCompareMode.LESS_EQUAL);\n if (this._disableColor)\n this._pContext.setColorMask(false, false, false, false);\n this.drawRenderables(projection, this._pOpaqueRenderableHead);\n if (this._renderBlended)\n this.drawRenderables(projection, this._pBlendedRenderableHead);\n if (this._disableColor)\n this._pContext.setColorMask(true, true, true, true);\n };\n //private drawCascadeRenderables(renderableGL:GL_RenderableBase, camera:Camera, cullPlanes:ArrayCompositeChunkBase object.\n *\n * @param modulateMethod The method which will add the code to alter the base method's strength. It needs to have the signature clampDiffuse(t:ShaderRegisterElement, regCache:ShaderRegisterCache):string, in which t.w will contain the diffuse strength.\n * @param baseMethod The base diffuse method on which this method's shading is based.\n */\n function CompositeChunkBase(method, shader) {\n var _this = _super.call(this, method, shader) || this;\n _this.chunkVO = new ChunkVO();\n _this._baseChunk = shader.getAbstraction(method.baseMethod);\n return _this;\n }\n CompositeChunkBase.prototype._isUsed = function () {\n return true;\n };\n CompositeChunkBase.prototype._usesTangentSpace = function () {\n return this._baseChunk._usesTangentSpace();\n };\n /**\n * @inheritDoc\n */\n CompositeChunkBase.prototype._initVO = function (chunkVO) {\n this._baseChunk._initVO(chunkVO);\n };\n /**\n * @inheritDoc\n */\n CompositeChunkBase.prototype._initConstants = function () {\n this._baseChunk._initConstants();\n };\n /**\n * @inheritDoc\n */\n CompositeChunkBase.prototype._activate = function () {\n this._baseChunk._activate();\n };\n /**\n * @inheritDoc\n */\n CompositeChunkBase.prototype._setRenderState = function (renderable, projection) {\n this._baseChunk._setRenderState(renderable, projection);\n };\n /**\n * @inheritDoc\n */\n CompositeChunkBase.prototype._deactivate = function () {\n this._baseChunk._deactivate();\n this._invalid = false;\n };\n /**\n * @inheritDoc\n */\n CompositeChunkBase.prototype._getVertexCode = function (registerCache, sharedRegisters) {\n return this._baseChunk._getVertexCode(registerCache, sharedRegisters);\n };\n /**\n * @inheritDoc\n */\n CompositeChunkBase.prototype._getFragmentCode = function (targetReg, registerCache, sharedRegisters) {\n return this._baseChunk._getFragmentCode(targetReg, registerCache, sharedRegisters);\n };\n /**\n * @inheritDoc\n */\n CompositeChunkBase.prototype._reset = function (chunkVO) {\n this._baseChunk._reset(chunkVO);\n this._invalid = true;\n this._cleanCompilationData();\n };\n /**\n * @inheritDoc\n */\n CompositeChunkBase.prototype._cleanCompilationData = function () {\n this._baseChunk._cleanCompilationData();\n };\n return CompositeChunkBase;\n}(AbstractionBase));\nexport { CompositeChunkBase };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/chunks/CompositeChunkBase.js","import * as tslib_1 from \"tslib\";\nimport { CompositeChunkBase } from \"./CompositeChunkBase\";\n/**\n * LightingCompositeBase provides a base class for diffuse methods that wrap a diffuse method to alter the\n * calculated diffuse reflection strength.\n */\nvar LightingCompositeChunk = (function (_super) {\n tslib_1.__extends(LightingCompositeChunk, _super);\n function LightingCompositeChunk() {\n return _super.apply(this, arguments) || this;\n }\n /**\n * @inheritDoc\n */\n LightingCompositeChunk.prototype._getFragmentPreLightingCode = function (registerCache, sharedRegisters) {\n return this._baseChunk._getFragmentPreLightingCode(registerCache, sharedRegisters);\n };\n /**\n * @inheritDoc\n */\n LightingCompositeChunk.prototype._getFragmentCodePerLight = function (lightDirReg, lightColReg, registerCache, sharedRegisters) {\n var code = this._baseChunk._getFragmentCodePerLight(lightDirReg, lightColReg, registerCache, sharedRegisters);\n this._totalLightColorReg = this._baseChunk._totalLightColorReg;\n return code;\n };\n /**\n * @inheritDoc\n */\n LightingCompositeChunk.prototype._getFragmentCodePerProbe = function (cubeMapReg, weightRegister, registerCache, sharedRegisters) {\n var code = this._baseChunk._getFragmentCodePerProbe(cubeMapReg, weightRegister, registerCache, sharedRegisters);\n this._totalLightColorReg = this._baseChunk._totalLightColorReg;\n return code;\n };\n return LightingCompositeChunk;\n}(CompositeChunkBase));\nexport { LightingCompositeChunk };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/chunks/LightingCompositeChunk.js","import * as tslib_1 from \"tslib\";\nimport { AmbientBasicMethod } from \"./AmbientBasicMethod\";\n/**\n * AmbientDepthMethod provides a debug method to visualise depth maps\n */\nvar AmbientDepthMethod = (function (_super) {\n tslib_1.__extends(AmbientDepthMethod, _super);\n /**\n * Creates a new AmbientDepthMethod object.\n */\n function AmbientDepthMethod(castingLight) {\n var _this = _super.call(this) || this;\n _this._castingLight = castingLight;\n castingLight.shadowsEnabled = true;\n _this._shadowMapper = castingLight.shadowMapper;\n _this.iAddTexture(castingLight.shadowMapper.depthMap);\n return _this;\n }\n Object.defineProperty(AmbientDepthMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return AmbientDepthMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(AmbientDepthMethod.prototype, \"castingLight\", {\n /**\n * The light casting the shadows.\n */\n get: function () {\n return this._castingLight;\n },\n enumerable: true,\n configurable: true\n });\n return AmbientDepthMethod;\n}(AmbientBasicMethod));\nexport { AmbientDepthMethod };\nAmbientDepthMethod.assetType = \"[asset AmbientDepthMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/AmbientDepthMethod.js","import * as tslib_1 from \"tslib\";\nimport { AbstractMethodError } from \"@awayjs/core\";\nimport { ShadingMethodEvent } from \"@awayjs/renderer\";\nimport { ShadingMethodBase } from \"./ShadingMethodBase\";\n/**\n * CompositeMethodBase provides a base class for diffuse methods that wrap a diffuse method to alter the\n * calculated diffuse reflection strength.\n */\nvar CompositeMethodBase = (function (_super) {\n tslib_1.__extends(CompositeMethodBase, _super);\n /**\n * Creates a new CompositeMethodBase object.\n *\n * @param modulateMethod The method which will add the code to alter the base method's strength. It needs to have the signature clampDiffuse(t:ShaderRegisterElement, regCache:ShaderRegisterCache):string, in which t.w will contain the diffuse strength.\n * @param baseMethod The base diffuse method on which this method's shading is based.\n */\n function CompositeMethodBase(baseMethod) {\n if (baseMethod === void 0) { baseMethod = null; }\n var _this = _super.call(this) || this;\n _this._onShaderInvalidatedDelegate = function (event) { return _this.onShaderInvalidated(event); };\n _this._baseMethod = baseMethod || _this.createBaseMethod();\n _this._baseMethod.addEventListener(ShadingMethodEvent.SHADER_INVALIDATED, _this._onShaderInvalidatedDelegate);\n return _this;\n }\n Object.defineProperty(CompositeMethodBase.prototype, \"baseMethod\", {\n /**\n * The base diffuse method on which this method's shading is based.\n */\n get: function () {\n return this._baseMethod;\n },\n set: function (value) {\n if (this._baseMethod == value)\n return;\n this._baseMethod.removeEventListener(ShadingMethodEvent.SHADER_INVALIDATED, this._onShaderInvalidatedDelegate);\n this._baseMethod = value;\n this._baseMethod.addEventListener(ShadingMethodEvent.SHADER_INVALIDATED, this._onShaderInvalidatedDelegate);\n this.invalidateShaderProgram();\n },\n enumerable: true,\n configurable: true\n });\n CompositeMethodBase.prototype.createBaseMethod = function () {\n throw new AbstractMethodError();\n };\n CompositeMethodBase.prototype.iAddOwner = function (owner) {\n _super.prototype.iAddOwner.call(this, owner);\n this._baseMethod.iAddOwner(owner);\n };\n CompositeMethodBase.prototype.iRemoveOwner = function (owner) {\n _super.prototype.iRemoveOwner.call(this, owner);\n this._baseMethod.iRemoveOwner(owner);\n };\n /**\n * @inheritDoc\n */\n CompositeMethodBase.prototype.dispose = function () {\n this._baseMethod.removeEventListener(ShadingMethodEvent.SHADER_INVALIDATED, this._onShaderInvalidatedDelegate);\n };\n /**\n * Called when the base method's shader code is invalidated.\n */\n CompositeMethodBase.prototype.onShaderInvalidated = function (event) {\n this.invalidateShaderProgram();\n };\n return CompositeMethodBase;\n}(ShadingMethodBase));\nexport { CompositeMethodBase };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/CompositeMethodBase.js","import * as tslib_1 from \"tslib\";\nimport { DiffuseBasicMethod } from \"./DiffuseBasicMethod\";\nimport { CompositeMethodBase } from \"./CompositeMethodBase\";\n/**\n * DiffuseCompositeMethod provides a base class for diffuse methods that wrap a diffuse method to alter the\n * calculated diffuse reflection strength.\n */\nvar DiffuseCompositeMethod = (function (_super) {\n tslib_1.__extends(DiffuseCompositeMethod, _super);\n /**\n * Creates a new DiffuseCompositeMethod object.\n *\n * @param modulateMethod The method which will add the code to alter the base method's strength. It needs to have the signature clampDiffuse(t:ShaderRegisterElement, regCache:ShaderRegisterCache):string, in which t.w will contain the diffuse strength.\n * @param baseMethod The base diffuse method on which this method's shading is based.\n */\n function DiffuseCompositeMethod(baseMethod) {\n if (baseMethod === void 0) { baseMethod = null; }\n return _super.call(this, baseMethod) || this;\n }\n DiffuseCompositeMethod.prototype.createBaseMethod = function () {\n return new DiffuseBasicMethod();\n };\n Object.defineProperty(DiffuseCompositeMethod.prototype, \"texture\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return this._baseMethod.texture;\n },\n set: function (value) {\n this._baseMethod.texture = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DiffuseCompositeMethod.prototype, \"color\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return this._baseMethod.color;\n },\n set: function (value) {\n this._baseMethod.color = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DiffuseCompositeMethod.prototype, \"multiply\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return this._baseMethod.multiply;\n },\n set: function (value) {\n this._baseMethod.multiply = value;\n },\n enumerable: true,\n configurable: true\n });\n return DiffuseCompositeMethod;\n}(CompositeMethodBase));\nexport { DiffuseCompositeMethod };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/DiffuseCompositeMethod.js","import * as tslib_1 from \"tslib\";\nimport { DiffuseCompositeMethod } from \"./DiffuseCompositeMethod\";\n/**\n * DiffuseCelMethod provides a shading method to add diffuse cel (cartoon) shading.\n */\nvar DiffuseCelMethod = (function (_super) {\n tslib_1.__extends(DiffuseCelMethod, _super);\n /**\n * Creates a new DiffuseCelMethod object.\n * @param levels The amount of shadow gradations.\n * @param baseMethod An optional diffuse method on which the cartoon shading is based. If omitted, DiffuseBasicMethod is used.\n */\n function DiffuseCelMethod(levels, smoothness, baseMethod) {\n if (levels === void 0) { levels = 3; }\n if (smoothness === void 0) { smoothness = 0.1; }\n if (baseMethod === void 0) { baseMethod = null; }\n var _this = _super.call(this, baseMethod) || this;\n _this._levels = levels;\n _this._smoothness = smoothness;\n return _this;\n }\n Object.defineProperty(DiffuseCelMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return DiffuseCelMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DiffuseCelMethod.prototype, \"levels\", {\n /**\n * The amount of shadow gradations.\n */\n get: function () {\n return this._levels;\n },\n set: function (value) {\n this._levels = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DiffuseCelMethod.prototype, \"smoothness\", {\n /**\n * The smoothness of the edge between 2 shading levels.\n */\n get: function () {\n return this._smoothness;\n },\n set: function (value) {\n this._smoothness = value;\n },\n enumerable: true,\n configurable: true\n });\n return DiffuseCelMethod;\n}(DiffuseCompositeMethod));\nexport { DiffuseCelMethod };\nDiffuseCelMethod.assetType = \"[asset DiffuseCelMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/DiffuseCelMethod.js","import * as tslib_1 from \"tslib\";\nimport { DiffuseBasicMethod } from \"./DiffuseBasicMethod\";\n/**\n * DiffuseGradientMethod is an alternative to DiffuseBasicMethod in which the shading can be modulated with a gradient\n * to introduce color-tinted shading as opposed to the single-channel diffuse strength. This can be used as a crude\n * approximation to subsurface scattering (for instance, the mid-range shading for skin can be tinted red to similate\n * scattered light within the skin attributing to the final colour)\n */\nvar DiffuseGradientMethod = (function (_super) {\n tslib_1.__extends(DiffuseGradientMethod, _super);\n /**\n * Creates a new DiffuseGradientMethod object.\n * @param gradient A texture that contains the light colour based on the angle. This can be used to change\n * the light colour due to subsurface scattering when the surface faces away from the light.\n */\n function DiffuseGradientMethod(gradient) {\n var _this = _super.call(this) || this;\n _this._gradient = gradient;\n _this.iAddTexture(_this._gradient);\n return _this;\n }\n Object.defineProperty(DiffuseGradientMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return DiffuseGradientMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DiffuseGradientMethod.prototype, \"gradient\", {\n /**\n * A texture that contains the light colour based on the angle. This can be used to change the light colour\n * due to subsurface scattering when the surface faces away from the light.\n */\n get: function () {\n return this._gradient;\n },\n set: function (value) {\n if (this._gradient == value)\n return;\n if (this._gradient)\n this.iRemoveTexture(this._gradient);\n this._gradient = value;\n if (this._gradient)\n this.iAddTexture(this._gradient);\n this.invalidateShaderProgram();\n },\n enumerable: true,\n configurable: true\n });\n return DiffuseGradientMethod;\n}(DiffuseBasicMethod));\nexport { DiffuseGradientMethod };\nDiffuseGradientMethod.assetType = \"[asset DiffuseGradientMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/DiffuseGradientMethod.js","import * as tslib_1 from \"tslib\";\nimport { DiffuseCompositeMethod } from \"./DiffuseCompositeMethod\";\n/**\n * DiffuseLightMapMethod provides a diffuse shading method that uses a light map to modulate the calculated diffuse\n * lighting. It is different from EffectLightMapMethod in that the latter modulates the entire calculated pixel color, rather\n * than only the diffuse lighting value.\n */\nvar DiffuseLightMapMethod = (function (_super) {\n tslib_1.__extends(DiffuseLightMapMethod, _super);\n /**\n * Creates a new DiffuseLightMapMethod method.\n *\n * @param lightMap The texture containing the light map.\n * @param blendMode The blend mode with which the light map should be applied to the lighting result.\n * @param useSecondaryUV Indicates whether the secondary UV set should be used to map the light map.\n * @param baseMethod The diffuse method used to calculate the regular diffuse-based lighting.\n */\n function DiffuseLightMapMethod(lightMap, blendMode, useSecondaryUV, baseMethod) {\n if (blendMode === void 0) { blendMode = \"multiply\"; }\n if (useSecondaryUV === void 0) { useSecondaryUV = false; }\n if (baseMethod === void 0) { baseMethod = null; }\n var _this = _super.call(this, baseMethod) || this;\n _this._lightMap = lightMap;\n _this.blendMode = blendMode;\n _this._useSecondaryUV = useSecondaryUV;\n if (_this._lightMap)\n _this.iAddTexture(_this._lightMap);\n return _this;\n }\n Object.defineProperty(DiffuseLightMapMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return DiffuseLightMapMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DiffuseLightMapMethod.prototype, \"blendMode\", {\n /**\n * The blend mode with which the light map should be applied to the lighting result.\n *\n * @see DiffuseLightMapMethod.ADD\n * @see DiffuseLightMapMethod.MULTIPLY\n */\n get: function () {\n return this._blendMode;\n },\n set: function (value) {\n if (value != DiffuseLightMapMethod.ADD && value != DiffuseLightMapMethod.MULTIPLY)\n throw new Error(\"Unknown blendmode!\");\n if (this._blendMode == value)\n return;\n this._blendMode = value;\n this.invalidateShaderProgram();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DiffuseLightMapMethod.prototype, \"lightMap\", {\n /**\n * The texture containing the light map data.\n */\n get: function () {\n return this._lightMap;\n },\n set: function (value) {\n if (this._lightMap == value)\n return;\n if (this._lightMap)\n this.iRemoveTexture(this._lightMap);\n this._lightMap = value;\n if (this._lightMap)\n this.iAddTexture(this._lightMap);\n this.invalidateShaderProgram();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DiffuseLightMapMethod.prototype, \"useSecondaryUV\", {\n /**\n * Indicates whether the secondary UV set should be used to map the light map.\n */\n get: function () {\n return this._useSecondaryUV;\n },\n set: function (value) {\n if (this._useSecondaryUV == value)\n return;\n this._useSecondaryUV = value;\n this.invalidateShaderProgram();\n },\n enumerable: true,\n configurable: true\n });\n return DiffuseLightMapMethod;\n}(DiffuseCompositeMethod));\nexport { DiffuseLightMapMethod };\n/**\n * Indicates the light map should be multiplied with the calculated shading result.\n * This can be used to add pre-calculated shadows or occlusion.\n */\nDiffuseLightMapMethod.MULTIPLY = \"multiply\";\n/**\n * Indicates the light map should be added into the calculated shading result.\n * This can be used to add pre-calculated lighting or global illumination.\n */\nDiffuseLightMapMethod.ADD = \"add\";\nDiffuseLightMapMethod.assetType = \"[asset DiffuseLightMapMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/DiffuseLightMapMethod.js","import * as tslib_1 from \"tslib\";\nimport { DiffuseBasicMethod } from \"./DiffuseBasicMethod\";\n/**\n * DiffuseWrapMethod is an alternative to DiffuseBasicMethod in which the light is allowed to be \"wrapped around\" the normally dark area, to some extent.\n * It can be used as a crude approximation to Oren-Nayar or simple subsurface scattering.\n */\nvar DiffuseWrapMethod = (function (_super) {\n tslib_1.__extends(DiffuseWrapMethod, _super);\n /**\n * Creates a new DiffuseWrapMethod object.\n * @param wrapFactor A factor to indicate the amount by which the light is allowed to wrap\n */\n function DiffuseWrapMethod(wrapFactor) {\n if (wrapFactor === void 0) { wrapFactor = .5; }\n var _this = _super.call(this) || this;\n _this.wrapFactor = wrapFactor;\n return _this;\n }\n Object.defineProperty(DiffuseWrapMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return DiffuseWrapMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(DiffuseWrapMethod.prototype, \"wrapFactor\", {\n /**\n * A factor to indicate the amount by which the light is allowed to wrap.\n */\n get: function () {\n return this._wrapFactor;\n },\n set: function (value) {\n this._wrapFactor = value;\n this._wrapFactor = 1 / (value + 1);\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n return DiffuseWrapMethod;\n}(DiffuseBasicMethod));\nexport { DiffuseWrapMethod };\nDiffuseWrapMethod.assetType = \"[asset DiffuseWrapMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/DiffuseWrapMethod.js","import * as tslib_1 from \"tslib\";\nimport { ShadingMethodBase } from \"./ShadingMethodBase\";\n/**\n * EffectAlphaMaskMethod allows the use of an additional texture to specify the alpha value of the material. When used\n * with the secondary uv set, it allows for a tiled main texture with independently varying alpha (useful for water\n * etc).\n */\nvar EffectAlphaMaskMethod = (function (_super) {\n tslib_1.__extends(EffectAlphaMaskMethod, _super);\n /**\n * Creates a new EffectAlphaMaskMethod object.\n *\n * @param texture The texture to use as the alpha mask.\n * @param useSecondaryUV Indicated whether or not the secondary uv set for the mask. This allows mapping alpha independently.\n */\n function EffectAlphaMaskMethod(texture, useSecondaryUV) {\n if (useSecondaryUV === void 0) { useSecondaryUV = false; }\n var _this = _super.call(this) || this;\n _this._texture = texture;\n _this._useSecondaryUV = useSecondaryUV;\n if (_this._texture)\n _this.iAddTexture(_this._texture);\n return _this;\n }\n Object.defineProperty(EffectAlphaMaskMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return EffectAlphaMaskMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectAlphaMaskMethod.prototype, \"texture\", {\n /**\n * The texture to use as the alpha mask.\n */\n get: function () {\n return this._texture;\n },\n set: function (value) {\n if (this._texture == value)\n return;\n if (this._texture)\n this.iRemoveTexture(this._texture);\n this._texture = value;\n if (this._texture)\n this.iAddTexture(this._texture);\n this.invalidateShaderProgram();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectAlphaMaskMethod.prototype, \"useSecondaryUV\", {\n /**\n * Indicated whether or not the secondary uv set for the mask. This allows mapping alpha independently, for\n * instance to tile the main texture and normal map while providing untiled alpha, for example to define the\n * transparency over a tiled water surface.\n */\n get: function () {\n return this._useSecondaryUV;\n },\n set: function (value) {\n if (this._useSecondaryUV == value)\n return;\n this._useSecondaryUV = value;\n this.invalidateShaderProgram();\n },\n enumerable: true,\n configurable: true\n });\n return EffectAlphaMaskMethod;\n}(ShadingMethodBase));\nexport { EffectAlphaMaskMethod };\nEffectAlphaMaskMethod.assetType = \"[asset EffectAlphaMaskMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/EffectAlphaMaskMethod.js","import * as tslib_1 from \"tslib\";\nimport { ShadingMethodBase } from \"./ShadingMethodBase\";\n/**\n * EffectColorMatrixMethod provides a shading method that changes the colour of a material analogous to a ColorMatrixFilter.\n */\nvar EffectColorMatrixMethod = (function (_super) {\n tslib_1.__extends(EffectColorMatrixMethod, _super);\n /**\n * Creates a new EffectColorTransformMethod.\n *\n * @param matrix An array of 20 items for 4 x 5 color transform.\n */\n function EffectColorMatrixMethod(matrix) {\n var _this = _super.call(this) || this;\n if (matrix.length != 20)\n throw new Error(\"Matrix length must be 20!\");\n _this._matrix = matrix;\n return _this;\n }\n Object.defineProperty(EffectColorMatrixMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return EffectColorMatrixMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectColorMatrixMethod.prototype, \"matrix\", {\n /**\n * The 4 x 5 matrix to transform the color of the material.\n */\n get: function () {\n return this._matrix;\n },\n set: function (value) {\n if (value.length != 20)\n throw new Error(\"Matrix length must be 20!\");\n this._matrix = value;\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n return EffectColorMatrixMethod;\n}(ShadingMethodBase));\nexport { EffectColorMatrixMethod };\nEffectColorMatrixMethod.assetType = \"[asset EffectColorMatrixMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/EffectColorMatrixMethod.js","import * as tslib_1 from \"tslib\";\nimport { ShadingMethodBase } from \"./ShadingMethodBase\";\n/**\n * EffectColorTransformMethod provides a shading method that changes the colour of a material analogous to a\n * ColorTransform object.\n */\nvar EffectColorTransformMethod = (function (_super) {\n tslib_1.__extends(EffectColorTransformMethod, _super);\n /**\n * Creates a new EffectColorTransformMethod.\n */\n function EffectColorTransformMethod(colorTransform) {\n if (colorTransform === void 0) { colorTransform = null; }\n var _this = _super.call(this) || this;\n _this._colorTransform = colorTransform;\n return _this;\n }\n Object.defineProperty(EffectColorTransformMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return EffectColorTransformMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectColorTransformMethod.prototype, \"colorTransform\", {\n /**\n * The ColorTransform object to transform the colour of the material with.\n */\n get: function () {\n return this._colorTransform;\n },\n set: function (value) {\n this._colorTransform = value;\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n return EffectColorTransformMethod;\n}(ShadingMethodBase));\nexport { EffectColorTransformMethod };\nEffectColorTransformMethod.assetType = \"[asset EffectColorTransformMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/EffectColorTransformMethod.js","import * as tslib_1 from \"tslib\";\nimport { ShadingMethodBase } from \"./ShadingMethodBase\";\n/**\n * EffectEnvMapMethod provides a material method to perform reflection mapping using cube maps.\n */\nvar EffectEnvMapMethod = (function (_super) {\n tslib_1.__extends(EffectEnvMapMethod, _super);\n /**\n * Creates an EffectEnvMapMethod object.\n * @param envMap The environment map containing the reflected scene.\n * @param alpha The reflectivity of the surface.\n */\n function EffectEnvMapMethod(envMap, alpha) {\n if (alpha === void 0) { alpha = 1; }\n var _this = _super.call(this) || this;\n _this._envMap = envMap;\n _this._alpha = alpha;\n _this.iAddTexture(_this._envMap);\n return _this;\n }\n Object.defineProperty(EffectEnvMapMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return EffectEnvMapMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectEnvMapMethod.prototype, \"envMap\", {\n /**\n * The cubic environment map containing the reflected scene.\n */\n get: function () {\n return this._envMap;\n },\n set: function (value) {\n if (this._envMap == value)\n return;\n if (this._envMap)\n this.iRemoveTexture(this._envMap);\n this._envMap = value;\n if (this._envMap)\n this.iAddTexture(this._envMap);\n this.invalidateShaderProgram();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectEnvMapMethod.prototype, \"mask\", {\n /**\n * An optional texture to modulate the reflectivity of the surface.\n */\n get: function () {\n return this._mask;\n },\n set: function (value) {\n if (value == this._mask)\n return;\n if (this._mask)\n this.iRemoveTexture(this._mask);\n this._mask = value;\n if (this._mask)\n this.iAddTexture(this._mask);\n this.invalidateShaderProgram();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectEnvMapMethod.prototype, \"alpha\", {\n /**\n * The reflectivity of the surface.\n */\n get: function () {\n return this._alpha;\n },\n set: function (value) {\n this._alpha = value;\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n /**\n * @inheritDoc\n */\n EffectEnvMapMethod.prototype.dispose = function () {\n };\n return EffectEnvMapMethod;\n}(ShadingMethodBase));\nexport { EffectEnvMapMethod };\nEffectEnvMapMethod.assetType = \"[asset EffectEnvMapMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/EffectEnvMapMethod.js","import * as tslib_1 from \"tslib\";\nimport { ShadingMethodBase } from \"./ShadingMethodBase\";\n/**\n * EffectFogMethod provides a method to add distance-based fog to a material.\n */\nvar EffectFogMethod = (function (_super) {\n tslib_1.__extends(EffectFogMethod, _super);\n /**\n * Creates a new EffectFogMethod object.\n * @param minDistance The distance from which the fog starts appearing.\n * @param maxDistance The distance at which the fog is densest.\n * @param fogColor The colour of the fog.\n */\n function EffectFogMethod(minDistance, maxDistance, fogColor) {\n if (minDistance === void 0) { minDistance = 0; }\n if (maxDistance === void 0) { maxDistance = 1000; }\n if (fogColor === void 0) { fogColor = 0x808080; }\n var _this = _super.call(this) || this;\n _this._minDistance = minDistance;\n _this._maxDistance = maxDistance;\n _this._fogColor = fogColor;\n return _this;\n }\n Object.defineProperty(EffectFogMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return EffectFogMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectFogMethod.prototype, \"minDistance\", {\n /**\n * The distance from which the fog starts appearing.\n */\n get: function () {\n return this._minDistance;\n },\n set: function (value) {\n this._minDistance = value;\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectFogMethod.prototype, \"maxDistance\", {\n /**\n * The distance at which the fog is densest.\n */\n get: function () {\n return this._maxDistance;\n },\n set: function (value) {\n this._maxDistance = value;\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectFogMethod.prototype, \"fogColor\", {\n /**\n * The colour of the fog.\n */\n get: function () {\n return this._fogColor;\n },\n set: function (value) {\n this._fogColor = value;\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n return EffectFogMethod;\n}(ShadingMethodBase));\nexport { EffectFogMethod };\nEffectFogMethod.assetType = \"[asset EffectFogMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/EffectFogMethod.js","import * as tslib_1 from \"tslib\";\nimport { EffectEnvMapMethod } from \"./EffectEnvMapMethod\";\n/**\n * EffectFresnelEnvMapMethod provides a method to add fresnel-based reflectivity to an object using cube maps, which gets\n * stronger as the viewing angle becomes more grazing.\n */\nvar EffectFresnelEnvMapMethod = (function (_super) {\n tslib_1.__extends(EffectFresnelEnvMapMethod, _super);\n /**\n * Creates a new EffectFresnelEnvMapMethod object.\n *\n * @param envMap The environment map containing the reflected scene.\n * @param alpha The reflectivity of the material.\n */\n function EffectFresnelEnvMapMethod(envMap, alpha, fresnelPower, normalReflectance) {\n if (alpha === void 0) { alpha = 1; }\n if (fresnelPower === void 0) { fresnelPower = 5; }\n if (normalReflectance === void 0) { normalReflectance = 0; }\n var _this = _super.call(this, envMap, alpha) || this;\n _this._fresnelPower = fresnelPower;\n _this._normalReflectance = normalReflectance;\n return _this;\n }\n Object.defineProperty(EffectFresnelEnvMapMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return EffectFresnelEnvMapMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectFresnelEnvMapMethod.prototype, \"fresnelPower\", {\n /**\n * The power used in the Fresnel equation. Higher values make the fresnel effect more pronounced. Defaults to 5.\n */\n get: function () {\n return this._fresnelPower;\n },\n set: function (value) {\n this._fresnelPower = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectFresnelEnvMapMethod.prototype, \"normalReflectance\", {\n /**\n * The minimum amount of reflectance, ie the reflectance when the view direction is normal to the surface or light direction.\n */\n get: function () {\n return this._normalReflectance;\n },\n set: function (value) {\n if (this._normalReflectance == value)\n return;\n this._normalReflectance = value;\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n return EffectFresnelEnvMapMethod;\n}(EffectEnvMapMethod));\nexport { EffectFresnelEnvMapMethod };\nEffectFresnelEnvMapMethod.assetType = \"[asset EffectFresnelEnvMapMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/EffectFresnelEnvMapMethod.js","import * as tslib_1 from \"tslib\";\nimport { ShadingMethodBase } from \"./ShadingMethodBase\";\n/**\n * EffectLightMapMethod provides a method that allows applying a light map texture to the calculated pixel colour.\n * It is different from DiffuseLightMapMethod in that the latter only modulates the diffuse shading value rather\n * than the whole pixel colour.\n */\nvar EffectLightMapMethod = (function (_super) {\n tslib_1.__extends(EffectLightMapMethod, _super);\n /**\n * Creates a new EffectLightMapMethod object.\n *\n * @param lightMap The texture containing the light map.\n * @param blendMode The blend mode with which the light map should be applied to the lighting result.\n * @param useSecondaryUV Indicates whether the secondary UV set should be used to map the light map.\n */\n function EffectLightMapMethod(lightMap, blendMode, useSecondaryUV) {\n if (blendMode === void 0) { blendMode = \"multiply\"; }\n if (useSecondaryUV === void 0) { useSecondaryUV = false; }\n var _this = _super.call(this) || this;\n if (blendMode != EffectLightMapMethod.ADD && blendMode != EffectLightMapMethod.MULTIPLY)\n throw new Error(\"Unknown blendmode!\");\n _this._lightMap = lightMap;\n _this._blendMode = blendMode;\n _this._useSecondaryUV = useSecondaryUV;\n if (_this._lightMap)\n _this.iAddTexture(_this._lightMap);\n return _this;\n }\n Object.defineProperty(EffectLightMapMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return EffectLightMapMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectLightMapMethod.prototype, \"blendMode\", {\n /**\n * The blend mode with which the light map should be applied to the lighting result.\n *\n * @see EffectLightMapMethod.ADD\n * @see EffectLightMapMethod.MULTIPLY\n */\n get: function () {\n return this._blendMode;\n },\n set: function (value) {\n if (this._blendMode == value)\n return;\n if (value != EffectLightMapMethod.ADD && value != EffectLightMapMethod.MULTIPLY)\n throw new Error(\"Unknown blendmode!\");\n this._blendMode = value;\n this.invalidateShaderProgram();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectLightMapMethod.prototype, \"lightMap\", {\n /**\n * The lightMap containing the light map.\n */\n get: function () {\n return this._lightMap;\n },\n set: function (value) {\n if (this._lightMap == value)\n return;\n if (this._lightMap)\n this.iRemoveTexture(this._lightMap);\n this._lightMap = value;\n if (this._lightMap)\n this.iAddTexture(this._lightMap);\n this.invalidateShaderProgram();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectLightMapMethod.prototype, \"useSecondaryUV\", {\n /**\n * Indicates whether the secondary UV set should be used to map the light map.\n */\n get: function () {\n return this._useSecondaryUV;\n },\n set: function (value) {\n if (this._useSecondaryUV == value)\n return;\n this._useSecondaryUV = value;\n this.invalidateShaderProgram();\n },\n enumerable: true,\n configurable: true\n });\n return EffectLightMapMethod;\n}(ShadingMethodBase));\nexport { EffectLightMapMethod };\n/**\n * Indicates the light map should be multiplied with the calculated shading result.\n */\nEffectLightMapMethod.MULTIPLY = \"multiply\";\n/**\n * Indicates the light map should be added into the calculated shading result.\n */\nEffectLightMapMethod.ADD = \"add\";\nEffectLightMapMethod.assetType = \"[asset EffectLightMapMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/EffectLightMapMethod.js","import * as tslib_1 from \"tslib\";\nimport { TextureProjectorEvent } from \"@awayjs/scene\";\nimport { ShadingMethodBase } from \"./ShadingMethodBase\";\n/**\n * ProjectiveTextureMethod is a material method used to project a texture unto the surface of an object.\n * This can be used for various effects apart from acting like a normal projector, such as projecting fake shadows\n * unto a surface, the impact of light coming through a stained glass window, ...\n */\nvar EffectProjectiveTextureMethod = (function (_super) {\n tslib_1.__extends(EffectProjectiveTextureMethod, _super);\n /**\n * Creates a new ProjectiveTextureMethod object.\n *\n * @param projector The TextureProjector object that defines the projection properties as well as the texture.\n * @param mode The blend mode with which the texture is blended unto the surface.\n *\n * @see away3d.entities.TextureProjector\n */\n function EffectProjectiveTextureMethod(projector, mode, exposure) {\n if (mode === void 0) { mode = \"multiply\"; }\n if (exposure === void 0) { exposure = 1; }\n var _this = _super.call(this) || this;\n _this._onTextureChangedDelegate = function (event) { return _this._onTextureChanged(event); };\n _this._projector = projector;\n _this._exposure = exposure;\n _this._mode = mode;\n _this._projector.addEventListener(TextureProjectorEvent.TEXTURE_CHANGE, _this._onTextureChangedDelegate);\n return _this;\n }\n Object.defineProperty(EffectProjectiveTextureMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return EffectProjectiveTextureMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectProjectiveTextureMethod.prototype, \"exposure\", {\n /**\n *\n */\n get: function () {\n return this._exposure;\n },\n set: function (value) {\n if (this._exposure == value)\n return;\n this._exposure = value;\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectProjectiveTextureMethod.prototype, \"mode\", {\n /**\n * The blend mode with which the texture is blended unto the object.\n * ProjectiveTextureMethod.MULTIPLY can be used to project shadows. To prevent clamping, the texture's alpha should be white!\n * ProjectiveTextureMethod.ADD can be used to project light, such as a slide projector or light coming through stained glass. To prevent clamping, the texture's alpha should be black!\n * ProjectiveTextureMethod.MIX provides normal alpha blending. To prevent clamping, the texture's alpha should be transparent!\n */\n get: function () {\n return this._mode;\n },\n set: function (value) {\n if (this._mode == value)\n return;\n this._mode = value;\n this.invalidateShaderProgram();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectProjectiveTextureMethod.prototype, \"projector\", {\n /**\n * The TextureProjector object that defines the projection properties as well as the texture.\n *\n * @see away3d.entities.TextureProjector\n */\n get: function () {\n return this._projector;\n },\n set: function (value) {\n if (this._projector == value)\n return;\n if (this._projector)\n this._projector.removeEventListener(TextureProjectorEvent.TEXTURE_CHANGE, this._onTextureChangedDelegate);\n this._projector = value;\n if (this._projector)\n this._projector.addEventListener(TextureProjectorEvent.TEXTURE_CHANGE, this._onTextureChangedDelegate);\n this.updateTexture();\n },\n enumerable: true,\n configurable: true\n });\n EffectProjectiveTextureMethod.prototype._onTextureChanged = function (event) {\n this.updateTexture();\n };\n EffectProjectiveTextureMethod.prototype.updateTexture = function () {\n if (this._texture)\n this.iRemoveTexture(this._texture);\n this._texture = (this._projector) ? this._projector.texture : null;\n if (this._texture)\n this.iAddTexture(this._texture);\n this.invalidateShaderProgram();\n };\n return EffectProjectiveTextureMethod;\n}(ShadingMethodBase));\nexport { EffectProjectiveTextureMethod };\nEffectProjectiveTextureMethod.OVERLAY = \"overlay\";\nEffectProjectiveTextureMethod.MULTIPLY = \"multiply\";\nEffectProjectiveTextureMethod.ADD = \"add\";\nEffectProjectiveTextureMethod.MIX = \"mix\";\nEffectProjectiveTextureMethod.assetType = \"[asset EffectProjectiveTextureMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/EffectProjectiveTextureMethod.js","import * as tslib_1 from \"tslib\";\nimport { EffectEnvMapMethod } from \"./EffectEnvMapMethod\";\n/**\n * EffectRefractionEnvMapMethod provides a method to add refracted transparency based on cube maps.\n */\nvar EffectRefractionEnvMapMethod = (function (_super) {\n tslib_1.__extends(EffectRefractionEnvMapMethod, _super);\n /**\n * Creates a new EffectRefractionEnvMapMethod object. Example values for dispersion are: dispersionR: -0.03, dispersionG: -0.01, dispersionB: = .0015\n *\n * @param envMap The environment map containing the refracted scene.\n * @param refractionIndex The refractive index of the material.\n * @param dispersionR The amount of chromatic dispersion of the red channel. Defaults to 0 (none).\n * @param dispersionG The amount of chromatic dispersion of the green channel. Defaults to 0 (none).\n * @param dispersionB The amount of chromatic dispersion of the blue channel. Defaults to 0 (none).\n */\n function EffectRefractionEnvMapMethod(envMap, alpha, refractionIndex, dispersionR, dispersionG, dispersionB) {\n if (alpha === void 0) { alpha = 1; }\n if (refractionIndex === void 0) { refractionIndex = .1; }\n if (dispersionR === void 0) { dispersionR = 0; }\n if (dispersionG === void 0) { dispersionG = 0; }\n if (dispersionB === void 0) { dispersionB = 0; }\n var _this = _super.call(this, envMap, alpha) || this;\n _this._dispersionR = 0;\n _this._dispersionG = 0;\n _this._dispersionB = 0;\n _this._refractionIndex = refractionIndex;\n _this._dispersionR = dispersionR;\n _this._dispersionG = dispersionG;\n _this._dispersionB = dispersionB;\n return _this;\n }\n Object.defineProperty(EffectRefractionEnvMapMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return EffectRefractionEnvMapMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectRefractionEnvMapMethod.prototype, \"refractionIndex\", {\n /**\n * The refractive index of the material.\n */\n get: function () {\n return this._refractionIndex;\n },\n set: function (value) {\n this._refractionIndex = value;\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectRefractionEnvMapMethod.prototype, \"dispersionR\", {\n /**\n * The amount of chromatic dispersion of the red channel. Defaults to 0 (none).\n */\n get: function () {\n return this._dispersionR;\n },\n set: function (value) {\n if (this._dispersionR == value)\n return;\n this._dispersionR = value;\n this.invalidateShaderProgram();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectRefractionEnvMapMethod.prototype, \"dispersionG\", {\n /**\n * The amount of chromatic dispersion of the green channel. Defaults to 0 (none).\n */\n get: function () {\n return this._dispersionG;\n },\n set: function (value) {\n if (this._dispersionG == value)\n return;\n this._dispersionG = value;\n this.invalidateShaderProgram();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectRefractionEnvMapMethod.prototype, \"dispersionB\", {\n /**\n * The amount of chromatic dispersion of the blue channel. Defaults to 0 (none).\n */\n get: function () {\n return this._dispersionB;\n },\n set: function (value) {\n if (this._dispersionB == value)\n return;\n this._dispersionB = value;\n this.invalidateShaderProgram();\n },\n enumerable: true,\n configurable: true\n });\n return EffectRefractionEnvMapMethod;\n}(EffectEnvMapMethod));\nexport { EffectRefractionEnvMapMethod };\nEffectRefractionEnvMapMethod.assetType = \"[asset EffectRefractionEnvMapMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/EffectRefractionEnvMapMethod.js","import * as tslib_1 from \"tslib\";\nimport { ShadingMethodBase } from \"./ShadingMethodBase\";\n/**\n * EffectRimLightMethod provides a method to add rim lighting to a material. This adds a glow-like effect to edges of objects.\n */\nvar EffectRimLightMethod = (function (_super) {\n tslib_1.__extends(EffectRimLightMethod, _super);\n /**\n * Creates a new EffectRimLightMethod object.\n *\n * @param color The colour of the rim light.\n * @param strength The strength of the rim light.\n * @param power The power of the rim light. Higher values will result in a higher edge fall-off.\n * @param blend The blend mode with which to add the light to the object.\n */\n function EffectRimLightMethod(color, strength, power, blend) {\n if (color === void 0) { color = 0xffffff; }\n if (strength === void 0) { strength = .4; }\n if (power === void 0) { power = 2; }\n if (blend === void 0) { blend = \"mix\"; }\n var _this = _super.call(this) || this;\n _this._blendMode = blend;\n _this._strength = strength;\n _this._power = power;\n _this._color = color;\n return _this;\n }\n Object.defineProperty(EffectRimLightMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return EffectRimLightMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectRimLightMethod.prototype, \"color\", {\n /**\n * The color of the rim light.\n */\n get: function () {\n return this._color;\n },\n set: function (value /*uint*/) {\n if (this._power == value)\n return;\n this._color = value;\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectRimLightMethod.prototype, \"strength\", {\n /**\n * The strength of the rim light.\n */\n get: function () {\n return this._strength;\n },\n set: function (value) {\n if (this._strength == value)\n return;\n this._strength = value;\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectRimLightMethod.prototype, \"power\", {\n /**\n * The power of the rim light. Higher values will result in a higher edge fall-off.\n */\n get: function () {\n return this._power;\n },\n set: function (value) {\n if (this._power == value)\n return;\n this._power = value;\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(EffectRimLightMethod.prototype, \"blendMode\", {\n /**\n * The blend mode with which to add the light to the object.\n *\n * EffectRimLightMethod.MULTIPLY multiplies the rim light with the material's colour.\n * EffectRimLightMethod.ADD adds the rim light with the material's colour.\n * EffectRimLightMethod.MIX provides normal alpha blending.\n */\n get: function () {\n return this._blendMode;\n },\n set: function (value) {\n if (this._blendMode == value)\n return;\n this._blendMode = value;\n this.invalidateShaderProgram();\n },\n enumerable: true,\n configurable: true\n });\n return EffectRimLightMethod;\n}(ShadingMethodBase));\nexport { EffectRimLightMethod };\nEffectRimLightMethod.ADD = \"add\";\nEffectRimLightMethod.MULTIPLY = \"multiply\";\nEffectRimLightMethod.MIX = \"mix\";\nEffectRimLightMethod.assetType = \"[asset EffectRimLightMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/EffectRimLightMethod.js","import * as tslib_1 from \"tslib\";\nimport { NormalBasicMethod } from \"./NormalBasicMethod\";\n/**\n * NormalHeightMapMethod provides a normal map method that uses a height map to calculate the normals.\n */\nvar NormalHeightMapMethod = (function (_super) {\n tslib_1.__extends(NormalHeightMapMethod, _super);\n /**\n * Creates a new NormalHeightMapMethod method.\n *\n * @param heightMap The texture containing the height data. 0 means low, 1 means high.\n * @param worldWidth The width of the 'world'. This is used to map uv coordinates' u component to scene dimensions.\n * @param worldHeight The height of the 'world'. This is used to map the height map values to scene dimensions.\n * @param worldDepth The depth of the 'world'. This is used to map uv coordinates' v component to scene dimensions.\n */\n function NormalHeightMapMethod(heightMap, worldWidth, worldHeight, worldDepth) {\n var _this = _super.call(this) || this;\n _this.texture = heightMap;\n _this._worldXYRatio = worldWidth / worldHeight;\n _this._worldXZRatio = worldDepth / worldHeight;\n return _this;\n }\n Object.defineProperty(NormalHeightMapMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return NormalHeightMapMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(NormalHeightMapMethod.prototype, \"worldXYRatio\", {\n get: function () {\n return this._worldXYRatio;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(NormalHeightMapMethod.prototype, \"worldXZRatio\", {\n get: function () {\n return this._worldXZRatio;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * @inheritDoc\n */\n NormalHeightMapMethod.prototype.copyFrom = function (method) {\n _super.prototype.copyFrom.call(this, method);\n this._worldXYRatio = method._worldXYRatio;\n this._worldXZRatio = method._worldXZRatio;\n };\n return NormalHeightMapMethod;\n}(NormalBasicMethod));\nexport { NormalHeightMapMethod };\nNormalHeightMapMethod.assetType = \"[asset NormalHeightMapMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/NormalHeightMapMethod.js","import * as tslib_1 from \"tslib\";\nimport { NormalBasicMethod } from \"./NormalBasicMethod\";\n/**\n * NormalSimpleWaterMethod provides a basic normal map method to create water ripples by translating two wave normal maps.\n */\nvar NormalSimpleWaterMethod = (function (_super) {\n tslib_1.__extends(NormalSimpleWaterMethod, _super);\n /**\n * Creates a new NormalSimpleWaterMethod object.\n * @param waveMap1 A normal map containing one layer of a wave structure.\n * @param waveMap2 A normal map containing a second layer of a wave structure.\n */\n function NormalSimpleWaterMethod(normalMap, secondaryNormalMap) {\n if (normalMap === void 0) { normalMap = null; }\n if (secondaryNormalMap === void 0) { secondaryNormalMap = null; }\n var _this = _super.call(this, normalMap) || this;\n _this._water1OffsetX = 0;\n _this._water1OffsetY = 0;\n _this._water2OffsetX = 0;\n _this._water2OffsetY = 0;\n _this._secondaryNormalMap = secondaryNormalMap;\n if (_this._secondaryNormalMap)\n _this.iAddTexture(_this._secondaryNormalMap);\n return _this;\n }\n Object.defineProperty(NormalSimpleWaterMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return NormalSimpleWaterMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(NormalSimpleWaterMethod.prototype, \"water1OffsetX\", {\n /**\n * The translation of the first wave layer along the X-axis.\n */\n get: function () {\n return this._water1OffsetX;\n },\n set: function (value) {\n this._water1OffsetX = value;\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(NormalSimpleWaterMethod.prototype, \"water1OffsetY\", {\n /**\n * The translation of the first wave layer along the Y-axis.\n */\n get: function () {\n return this._water1OffsetY;\n },\n set: function (value) {\n this._water1OffsetY = value;\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(NormalSimpleWaterMethod.prototype, \"water2OffsetX\", {\n /**\n * The translation of the second wave layer along the X-axis.\n */\n get: function () {\n return this._water2OffsetX;\n },\n set: function (value) {\n this._water2OffsetX = value;\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(NormalSimpleWaterMethod.prototype, \"water2OffsetY\", {\n /**\n * The translation of the second wave layer along the Y-axis.\n */\n get: function () {\n return this._water2OffsetY;\n },\n set: function (value) {\n this._water2OffsetY = value;\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(NormalSimpleWaterMethod.prototype, \"secondaryNormalMap\", {\n /**\n * A second normal map that will be combined with the first to create a wave-like animation pattern.\n */\n get: function () {\n return this._secondaryNormalMap;\n },\n set: function (value) {\n if (this._secondaryNormalMap == value)\n return;\n if (this._secondaryNormalMap)\n this.iRemoveTexture(this._secondaryNormalMap);\n this._secondaryNormalMap = value;\n if (this._secondaryNormalMap)\n this.iAddTexture(this._secondaryNormalMap);\n this.invalidateShaderProgram();\n },\n enumerable: true,\n configurable: true\n });\n /**\n * @inheritDoc\n */\n NormalSimpleWaterMethod.prototype.dispose = function () {\n _super.prototype.dispose.call(this);\n this._secondaryNormalMap = null;\n };\n return NormalSimpleWaterMethod;\n}(NormalBasicMethod));\nexport { NormalSimpleWaterMethod };\nNormalSimpleWaterMethod.assetType = \"[asset NormalSimpleWaterMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/NormalSimpleWaterMethod.js","import * as tslib_1 from \"tslib\";\nimport { ShadingMethodBase } from \"./ShadingMethodBase\";\n/**\n * ShadowMethodBase provides an abstract base method for shadow map methods.\n */\nvar ShadowMethodBase = (function (_super) {\n tslib_1.__extends(ShadowMethodBase, _super);\n /**\n * Creates a new ShadowMethodBase object.\n * @param castingLight The light used to cast shadows.\n */\n function ShadowMethodBase(castingLight) {\n var _this = _super.call(this) || this;\n _this._epsilon = .02;\n _this._alpha = 1;\n castingLight.shadowsEnabled = true;\n _this._castingLight = castingLight;\n _this.iAddTexture(castingLight.shadowMapper.depthMap);\n return _this;\n }\n Object.defineProperty(ShadowMethodBase.prototype, \"alpha\", {\n /**\n * The \"transparency\" of the shadows. This allows making shadows less strong.\n */\n get: function () {\n return this._alpha;\n },\n set: function (value) {\n this._alpha = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ShadowMethodBase.prototype, \"castingLight\", {\n /**\n * The light casting the shadows.\n */\n get: function () {\n return this._castingLight;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ShadowMethodBase.prototype, \"epsilon\", {\n /**\n * A small value to counter floating point precision errors when comparing values in the shadow map with the\n * calculated depth value. Increase this if shadow banding occurs, decrease it if the shadow seems to be too detached.\n */\n get: function () {\n return this._epsilon;\n },\n set: function (value) {\n this._epsilon = value;\n },\n enumerable: true,\n configurable: true\n });\n return ShadowMethodBase;\n}(ShadingMethodBase));\nexport { ShadowMethodBase };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/ShadowMethodBase.js","import * as tslib_1 from \"tslib\";\nimport { ShadowMethodBase } from \"./ShadowMethodBase\";\n/**\n * ShadowHardMethod provides the cheapest shadow map method by using a single tap without any filtering.\n */\nvar ShadowHardMethod = (function (_super) {\n tslib_1.__extends(ShadowHardMethod, _super);\n function ShadowHardMethod() {\n return _super.apply(this, arguments) || this;\n }\n Object.defineProperty(ShadowHardMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return ShadowHardMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n return ShadowHardMethod;\n}(ShadowMethodBase));\nexport { ShadowHardMethod };\nShadowHardMethod.assetType = \"[asset ShadowHardMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/ShadowHardMethod.js","import * as tslib_1 from \"tslib\";\nimport { AssetEvent } from \"@awayjs/core\";\nimport { DirectionalLight } from \"@awayjs/scene\";\nimport { CompositeMethodBase } from \"./CompositeMethodBase\";\nimport { ShadowHardMethod } from \"./ShadowHardMethod\";\n/**\n * ShadowCompositeMethod is a shadow map method to apply cascade shadow mapping on materials.\n * Must be used with a DirectionalLight with a CascadeShadowMapper assigned to its shadowMapper property.\n *\n * @see away.lights.CascadeShadowMapper\n */\nvar ShadowCompositeMethod = (function (_super) {\n tslib_1.__extends(ShadowCompositeMethod, _super);\n /**\n * Creates a new ShadowCompositeMethod object.\n *\n * @param shadowMethodBase The shadow map sampling method used to sample individual cascades (fe: ShadowHardMethod, ShadowSoftMethod)\n */\n function ShadowCompositeMethod(baseMethod) {\n var _this = _super.call(this, baseMethod) || this;\n if (!(baseMethod.castingLight instanceof DirectionalLight))\n throw new Error(\"ShadowCompositeMethod is only compatible with DirectionalLight\");\n baseMethod.castingLight.shadowMapper.addEventListener(AssetEvent.INVALIDATE, function (event) { return _this.onShadowMapperInvalidate(event); });\n return _this;\n }\n Object.defineProperty(ShadowCompositeMethod.prototype, \"castingLight\", {\n /**\n * The light casting the shadows.\n */\n get: function () {\n return this._baseMethod.castingLight;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ShadowCompositeMethod.prototype, \"alpha\", {\n /**\n *\n */\n get: function () {\n return this._baseMethod.alpha;\n },\n set: function (value) {\n this._baseMethod.alpha = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ShadowCompositeMethod.prototype, \"epsilon\", {\n /**\n *\n */\n get: function () {\n return this._baseMethod.epsilon;\n },\n set: function (value) {\n this._baseMethod.epsilon = value;\n },\n enumerable: true,\n configurable: true\n });\n ShadowCompositeMethod.prototype.createBaseMethod = function () {\n return new ShadowHardMethod(new DirectionalLight());\n };\n /**\n * Called when the shadow mappers cascade configuration changes.\n */\n ShadowCompositeMethod.prototype.onShadowMapperInvalidate = function (event) {\n this.invalidateShaderProgram();\n };\n return ShadowCompositeMethod;\n}(CompositeMethodBase));\nexport { ShadowCompositeMethod };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/ShadowCompositeMethod.js","import * as tslib_1 from \"tslib\";\nimport { CascadeShadowMapper } from \"@awayjs/scene\";\nimport { ShadowCompositeMethod } from \"./ShadowCompositeMethod\";\n/**\n * ShadowCascadeMethod is a shadow map method to apply cascade shadow mapping on materials.\n * Must be used with a DirectionalLight with a CascadeShadowMapper assigned to its shadowMapper property.\n *\n * @see away.lights.CascadeShadowMapper\n */\nvar ShadowCascadeMethod = (function (_super) {\n tslib_1.__extends(ShadowCascadeMethod, _super);\n /**\n * Creates a new ShadowCascadeMethod object.\n *\n * @param shadowMethodBase The shadow map sampling method used to sample individual cascades (fe: ShadowHardMethod, ShadowSoftMethod)\n */\n function ShadowCascadeMethod(baseMethod) {\n var _this = _super.call(this, baseMethod) || this;\n if (!(baseMethod.castingLight.shadowMapper instanceof CascadeShadowMapper))\n throw new Error(\"ShadowCascadeMethod requires a light that has a CascadeShadowMapper instance assigned to shadowMapper.\");\n return _this;\n }\n Object.defineProperty(ShadowCascadeMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return ShadowCascadeMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ShadowCascadeMethod.prototype, \"cascadeShadowMapper\", {\n get: function () {\n return this._baseMethod.castingLight.shadowMapper;\n },\n enumerable: true,\n configurable: true\n });\n return ShadowCascadeMethod;\n}(ShadowCompositeMethod));\nexport { ShadowCascadeMethod };\nShadowCascadeMethod.assetType = \"[asset ShadowCascadeMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/ShadowCascadeMethod.js","import * as tslib_1 from \"tslib\";\nimport { BitmapImage2D, Single2DTexture } from \"@awayjs/graphics\";\nimport { ShadowMethodBase } from \"./ShadowMethodBase\";\n/**\n * ShadowDitheredMethod provides a soft shadowing technique by randomly distributing sample points differently for each fragment.\n */\nvar ShadowDitheredMethod = (function (_super) {\n tslib_1.__extends(ShadowDitheredMethod, _super);\n /**\n * Creates a new ShadowDitheredMethod object.\n * @param castingLight The light casting the shadows\n * @param numSamples The amount of samples to take for dithering. Minimum 1, maximum 24.\n */\n function ShadowDitheredMethod(castingLight, numSamples, range) {\n if (numSamples === void 0) { numSamples = 4; }\n if (range === void 0) { range = 1; }\n var _this = _super.call(this, castingLight) || this;\n _this._depthMapSize = _this._castingLight.shadowMapper.depthMapSize;\n _this.numSamples = numSamples;\n _this.range = range;\n ++ShadowDitheredMethod._grainUsages;\n if (!ShadowDitheredMethod._grainTexture)\n _this.initGrainTexture();\n return _this;\n }\n Object.defineProperty(ShadowDitheredMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return ShadowDitheredMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ShadowDitheredMethod.prototype, \"numSamples\", {\n /**\n * The amount of samples to take for dithering. Minimum 1, maximum 24. The actual maximum may depend on the\n * complexity of the shader.\n */\n get: function () {\n return this._numSamples;\n },\n set: function (value) {\n if (value < 1)\n value = 1;\n else if (value > 24)\n value = 24;\n if (this._numSamples == value)\n return;\n this._numSamples = value;\n this.invalidateShaderProgram();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ShadowDitheredMethod.prototype, \"range\", {\n /**\n * The range in the shadow map in which to distribute the samples.\n */\n get: function () {\n return this._range * 2;\n },\n set: function (value) {\n this._range = value / 2;\n },\n enumerable: true,\n configurable: true\n });\n /**\n * Creates a texture containing the dithering noise texture.\n */\n ShadowDitheredMethod.prototype.initGrainTexture = function () {\n ShadowDitheredMethod._grainBitmapImage2D = new BitmapImage2D(64, 64, false);\n var vec = new Array();\n var len = 4096;\n var step = 1 / (this._depthMapSize * this._range);\n var r, g;\n for (var i = 0; i < len; ++i) {\n r = 2 * (Math.random() - .5);\n g = 2 * (Math.random() - .5);\n if (r < 0)\n r -= step;\n else\n r += step;\n if (g < 0)\n g -= step;\n else\n g += step;\n if (r > 1)\n r = 1;\n else if (r < -1)\n r = -1;\n if (g > 1)\n g = 1;\n else if (g < -1)\n g = -1;\n vec[i] = (Math.floor((r * .5 + .5) * 0xff) << 16) | (Math.floor((g * .5 + .5) * 0xff) << 8);\n }\n ShadowDitheredMethod._grainBitmapImage2D.setArray(ShadowDitheredMethod._grainBitmapImage2D.rect, vec);\n ShadowDitheredMethod._grainTexture = new Single2DTexture(ShadowDitheredMethod._grainBitmapImage2D);\n };\n /**\n * @inheritDoc\n */\n ShadowDitheredMethod.prototype.dispose = function () {\n if (--ShadowDitheredMethod._grainUsages == 0) {\n ShadowDitheredMethod._grainTexture.dispose();\n ShadowDitheredMethod._grainBitmapImage2D.dispose();\n ShadowDitheredMethod._grainTexture = null;\n }\n };\n return ShadowDitheredMethod;\n}(ShadowMethodBase));\nexport { ShadowDitheredMethod };\nShadowDitheredMethod.assetType = \"[asset ShadowDitheredMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/ShadowDitheredMethod.js","import * as tslib_1 from \"tslib\";\nimport { ShadowMethodBase } from \"./ShadowMethodBase\";\n/**\n * ShadowFilteredMethod provides a softened shadowing technique by bilinearly interpolating shadow comparison\n * results of neighbouring pixels.\n */\nvar ShadowFilteredMethod = (function (_super) {\n tslib_1.__extends(ShadowFilteredMethod, _super);\n function ShadowFilteredMethod() {\n return _super.apply(this, arguments) || this;\n }\n Object.defineProperty(ShadowFilteredMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return ShadowFilteredMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n return ShadowFilteredMethod;\n}(ShadowMethodBase));\nexport { ShadowFilteredMethod };\nShadowFilteredMethod.assetType = \"[asset ShadowFilteredMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/ShadowFilteredMethod.js","import * as tslib_1 from \"tslib\";\nimport { NearDirectionalShadowMapper } from \"@awayjs/scene\";\nimport { ShadowCompositeMethod } from \"./ShadowCompositeMethod\";\n// TODO: shadow mappers references in materials should be an interface so that this class should NOT extend ShadowMapMethodBase just for some delegation work\n/**\n * ShadowNearMethod provides a shadow map method that restricts the shadowed area near the camera to optimize\n * shadow map usage. This method needs to be used in conjunction with a NearDirectionalShadowMapper.\n *\n * @see away.lights.NearDirectionalShadowMapper\n */\nvar ShadowNearMethod = (function (_super) {\n tslib_1.__extends(ShadowNearMethod, _super);\n /**\n * Creates a new ShadowNearMethod object.\n * @param baseMethod The shadow map sampling method used to sample individual cascades (fe: ShadowHardMethod, ShadowSoftMethod)\n * @param fadeRatio The amount of shadow fading to the outer shadow area. A value of 1 would mean the shadows start fading from the camera's near plane.\n */\n function ShadowNearMethod(baseMethod, fadeRatio) {\n if (baseMethod === void 0) { baseMethod = null; }\n if (fadeRatio === void 0) { fadeRatio = .1; }\n var _this = _super.call(this, baseMethod) || this;\n _this._fadeRatio = fadeRatio;\n if (!(baseMethod.castingLight.shadowMapper instanceof NearDirectionalShadowMapper))\n throw new Error(\"ShadowNearMethod requires a light that has a NearDirectionalShadowMapper instance assigned to shadowMapper.\");\n return _this;\n }\n Object.defineProperty(ShadowNearMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return ShadowNearMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ShadowNearMethod.prototype, \"fadeRatio\", {\n /**\n * The amount of shadow fading to the outer shadow area. A value of 1 would mean the shadows start fading from the camera's near plane.\n */\n get: function () {\n return this._fadeRatio;\n },\n set: function (value) {\n this._fadeRatio = value;\n },\n enumerable: true,\n configurable: true\n });\n return ShadowNearMethod;\n}(ShadowCompositeMethod));\nexport { ShadowNearMethod };\nShadowNearMethod.assetType = \"[asset ShadowNearMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/ShadowNearMethod.js","import * as tslib_1 from \"tslib\";\nimport { PoissonLookup } from \"@awayjs/core\";\nimport { ShadowMethodBase } from \"./ShadowMethodBase\";\n/**\n * ShadowSoftMethod provides a soft shadowing technique by randomly distributing sample points.\n */\nvar ShadowSoftMethod = (function (_super) {\n tslib_1.__extends(ShadowSoftMethod, _super);\n /**\n * Creates a new DiffuseBasicMethod object.\n *\n * @param castingLight The light casting the shadows\n * @param numSamples The amount of samples to take for dithering. Minimum 1, maximum 32.\n */\n function ShadowSoftMethod(castingLight, numSamples, range) {\n if (numSamples === void 0) { numSamples = 5; }\n if (range === void 0) { range = 1; }\n var _this = _super.call(this, castingLight) || this;\n _this.numSamples = numSamples;\n _this.range = range;\n return _this;\n }\n Object.defineProperty(ShadowSoftMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return ShadowSoftMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ShadowSoftMethod.prototype, \"offsets\", {\n get: function () {\n return this._offsets;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ShadowSoftMethod.prototype, \"numSamples\", {\n /**\n * The amount of samples to take for dithering. Minimum 1, maximum 32. The actual maximum may depend on the\n * complexity of the shader.\n */\n get: function () {\n return this._numSamples;\n },\n set: function (value) {\n this._numSamples = value;\n if (this._numSamples < 1)\n this._numSamples = 1;\n else if (this._numSamples > 32)\n this._numSamples = 32;\n this._offsets = PoissonLookup.getDistribution(this._numSamples);\n this.invalidateShaderProgram();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(ShadowSoftMethod.prototype, \"range\", {\n /**\n * The range in the shadow map in which to distribute the samples.\n */\n get: function () {\n return this._range;\n },\n set: function (value) {\n this._range = value;\n },\n enumerable: true,\n configurable: true\n });\n return ShadowSoftMethod;\n}(ShadowMethodBase));\nexport { ShadowSoftMethod };\nShadowSoftMethod.assetType = \"[asset ShadowSoftMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/ShadowSoftMethod.js","import * as tslib_1 from \"tslib\";\nimport { SpecularBasicMethod } from \"./SpecularBasicMethod\";\n/**\n * SpecularAnisotropicMethod provides a specular method resulting in anisotropic highlights. These are typical for\n * surfaces with microfacet details such as tiny grooves. In particular, this uses the Heidrich-Seidel distrubution.\n * The tangent vectors are used as the surface groove directions.\n */\nvar SpecularAnisotropicMethod = (function (_super) {\n tslib_1.__extends(SpecularAnisotropicMethod, _super);\n /**\n * Creates a new SpecularAnisotropicMethod object.\n */\n function SpecularAnisotropicMethod() {\n return _super.call(this) || this;\n }\n Object.defineProperty(SpecularAnisotropicMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return SpecularAnisotropicMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n return SpecularAnisotropicMethod;\n}(SpecularBasicMethod));\nexport { SpecularAnisotropicMethod };\nSpecularAnisotropicMethod.assetType = \"[asset SpecularAnisotropicMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/SpecularAnisotropicMethod.js","import * as tslib_1 from \"tslib\";\nimport { CompositeMethodBase } from \"./CompositeMethodBase\";\nimport { SpecularBasicMethod } from \"./SpecularBasicMethod\";\n/**\n * SpecularCompositeMethod provides a base class for specular methods that wrap a specular method to alter the\n * calculated specular reflection strength.\n */\nvar SpecularCompositeMethod = (function (_super) {\n tslib_1.__extends(SpecularCompositeMethod, _super);\n /**\n * Creates a new SpecularCompositeMethod object.\n *\n * @param modulateMethod The method which will add the code to alter the base method's strength. It needs to have the signature clampDiffuse(t:ShaderRegisterElement, regCache:ShaderRegisterCache):string, in which t.w will contain the diffuse strength.\n * @param baseMethod The base specular method on which this method's shading is based.\n */\n function SpecularCompositeMethod(baseMethod) {\n if (baseMethod === void 0) { baseMethod = null; }\n return _super.call(this, baseMethod) || this;\n }\n SpecularCompositeMethod.prototype.createBaseMethod = function () {\n return new SpecularBasicMethod();\n };\n Object.defineProperty(SpecularCompositeMethod.prototype, \"gloss\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return this._baseMethod.gloss;\n },\n set: function (value) {\n this._baseMethod.gloss = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(SpecularCompositeMethod.prototype, \"strength\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return this._baseMethod.strength;\n },\n set: function (value) {\n this._baseMethod.strength = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(SpecularCompositeMethod.prototype, \"color\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return this._baseMethod.color;\n },\n /**\n * @inheritDoc\n */\n set: function (value) {\n this._baseMethod.color = value;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(SpecularCompositeMethod.prototype, \"texture\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return this._baseMethod.texture;\n },\n set: function (value) {\n this._baseMethod.texture = value;\n },\n enumerable: true,\n configurable: true\n });\n return SpecularCompositeMethod;\n}(CompositeMethodBase));\nexport { SpecularCompositeMethod };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/SpecularCompositeMethod.js","import * as tslib_1 from \"tslib\";\nimport { SpecularCompositeMethod } from \"./SpecularCompositeMethod\";\n/**\n * SpecularCelMethod provides a shading method to add specular cel (cartoon) shading.\n */\nvar SpecularCelMethod = (function (_super) {\n tslib_1.__extends(SpecularCelMethod, _super);\n /**\n * Creates a new SpecularCelMethod object.\n * @param specularCutOff The threshold at which the specular highlight should be shown.\n * @param smoothness The smoothness of the highlight edge.\n * @param baseMethod An optional specular method on which the cartoon shading is based. If ommitted, SpecularBasicMethod is used.\n */\n function SpecularCelMethod(specularCutOff, smoothness, baseMethod) {\n if (specularCutOff === void 0) { specularCutOff = 0.5; }\n if (smoothness === void 0) { smoothness = 0.1; }\n if (baseMethod === void 0) { baseMethod = null; }\n var _this = _super.call(this, baseMethod) || this;\n _this._specularCutOff = specularCutOff;\n _this._smoothness = smoothness;\n return _this;\n }\n Object.defineProperty(SpecularCelMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return SpecularCelMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(SpecularCelMethod.prototype, \"smoothness\", {\n /**\n * The smoothness of the highlight edge.\n */\n get: function () {\n return this._smoothness;\n },\n set: function (value) {\n if (this._smoothness == value)\n return;\n this._smoothness = value;\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(SpecularCelMethod.prototype, \"specularCutOff\", {\n /**\n * The threshold at which the specular highlight should be shown.\n */\n get: function () {\n return this._specularCutOff;\n },\n set: function (value) {\n if (this._specularCutOff == value)\n return;\n this._specularCutOff = value;\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n return SpecularCelMethod;\n}(SpecularCompositeMethod));\nexport { SpecularCelMethod };\nSpecularCelMethod.assetType = \"[asset SpecularCelMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/SpecularCelMethod.js","import * as tslib_1 from \"tslib\";\nimport { SpecularCompositeMethod } from \"./SpecularCompositeMethod\";\n/**\n * SpecularFresnelMethod provides a specular shading method that causes stronger highlights on grazing view angles.\n */\nvar SpecularFresnelMethod = (function (_super) {\n tslib_1.__extends(SpecularFresnelMethod, _super);\n /**\n * Creates a new SpecularFresnelMethod object.\n * @param basedOnSurface Defines whether the fresnel effect should be based on the view angle on the surface (if true), or on the angle between the light and the view.\n * @param baseMethod The specular method to which the fresnel equation. Defaults to SpecularBasicMethod.\n */\n function SpecularFresnelMethod(basedOnSurface, fresnelPower, normalReflectance, baseMethod) {\n if (basedOnSurface === void 0) { basedOnSurface = true; }\n if (fresnelPower === void 0) { fresnelPower = 5; }\n if (normalReflectance === void 0) { normalReflectance = 0.028; }\n if (baseMethod === void 0) { baseMethod = null; }\n var _this = _super.call(this, baseMethod) || this;\n _this._basedOnSurface = basedOnSurface;\n _this._fresnelPower = fresnelPower;\n _this._normalReflectance = normalReflectance;\n return _this;\n }\n Object.defineProperty(SpecularFresnelMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return SpecularFresnelMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(SpecularFresnelMethod.prototype, \"basedOnSurface\", {\n /**\n * Defines whether the fresnel effect should be based on the view angle on the surface (if true), or on the angle between the light and the view.\n */\n get: function () {\n return this._basedOnSurface;\n },\n set: function (value) {\n if (this._basedOnSurface == value)\n return;\n this._basedOnSurface = value;\n this.invalidateShaderProgram();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(SpecularFresnelMethod.prototype, \"fresnelPower\", {\n /**\n * The power used in the Fresnel equation. Higher values make the fresnel effect more pronounced. Defaults to 5.\n */\n get: function () {\n return this._fresnelPower;\n },\n set: function (value) {\n if (this._fresnelPower == value)\n return;\n this._fresnelPower = value;\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n Object.defineProperty(SpecularFresnelMethod.prototype, \"normalReflectance\", {\n /**\n * The minimum amount of reflectance, ie the reflectance when the view direction is normal to the surface or light direction.\n */\n get: function () {\n return this._normalReflectance;\n },\n set: function (value) {\n if (this._normalReflectance == value)\n return;\n this._normalReflectance = value;\n this.invalidate();\n },\n enumerable: true,\n configurable: true\n });\n return SpecularFresnelMethod;\n}(SpecularCompositeMethod));\nexport { SpecularFresnelMethod };\nSpecularFresnelMethod.assetType = \"[asset SpecularFresnelMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/SpecularFresnelMethod.js","import * as tslib_1 from \"tslib\";\nimport { SpecularBasicMethod } from \"./SpecularBasicMethod\";\n/**\n * SpecularPhongMethod provides a specular method that provides Phong highlights.\n */\nvar SpecularPhongMethod = (function (_super) {\n tslib_1.__extends(SpecularPhongMethod, _super);\n /**\n * Creates a new SpecularPhongMethod object.\n */\n function SpecularPhongMethod() {\n return _super.call(this) || this;\n }\n Object.defineProperty(SpecularPhongMethod.prototype, \"assetType\", {\n /**\n * @inheritDoc\n */\n get: function () {\n return SpecularPhongMethod.assetType;\n },\n enumerable: true,\n configurable: true\n });\n return SpecularPhongMethod;\n}(SpecularBasicMethod));\nexport { SpecularPhongMethod };\nSpecularPhongMethod.assetType = \"[asset SpecularPhongMethod]\";\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/methods/SpecularPhongMethod.js","import * as tslib_1 from \"tslib\";\nimport { AbstractionBase } from \"@awayjs/core\";\nimport { ChunkVO } from \"../data/ChunkVO\";\n/**\n * ShaderChunkBase provides an abstract base method for shading methods, used by compiled passes to compile\n * the final shading program.\n */\nvar ShaderChunkBase = (function (_super) {\n tslib_1.__extends(ShaderChunkBase, _super);\n /**\n * Create a new ShaderChunkBase object.\n */\n function ShaderChunkBase(method, shader) {\n var _this = _super.call(this, method, shader) || this;\n _this.chunkVO = new ChunkVO();\n _this._stage = shader._stage;\n return _this;\n }\n /**\n *\n */\n ShaderChunkBase.prototype.onClear = function (event) {\n _super.prototype.onClear.call(this, event);\n this._stage = null;\n };\n ShaderChunkBase.prototype._isUsed = function () {\n return true;\n };\n ShaderChunkBase.prototype._usesTangentSpace = function () {\n return true;\n };\n /**\n * Initializes the properties for a MethodVO, including register and texture indices.\n *\n * @param methodVO The MethodVO object linking this method with the pass currently being compiled.\n *\n * @internal\n */\n ShaderChunkBase.prototype._initVO = function (chunkVO) {\n };\n /**\n * Initializes unchanging shader constants using the data from a MethodVO.\n *\n * @param methodVO The MethodVO object linking this method with the pass currently being compiled.\n *\n * @internal\n */\n ShaderChunkBase.prototype._initConstants = function () {\n };\n /**\n * Resets the compilation state of the method.\n *\n * @internal\n */\n ShaderChunkBase.prototype._reset = function (chunkVO) {\n this._invalid = true;\n chunkVO.useChunk = false;\n chunkVO.needsProjection = false;\n chunkVO.needsView = false;\n chunkVO.needsNormals = false;\n chunkVO.needsTangents = false;\n chunkVO.needsGlobalVertexPos = false;\n chunkVO.needsGlobalFragmentPos = false;\n this._cleanCompilationData();\n };\n /**\n * Resets the method's state for compilation.\n *\n * @internal\n */\n ShaderChunkBase.prototype._cleanCompilationData = function () {\n };\n /**\n * Get the vertex shader code for this method.\n * @param vo The MethodVO object linking this method with the pass currently being compiled.\n * @param regCache The register cache used during the compilation.\n *\n * @internal\n */\n ShaderChunkBase.prototype._getVertexCode = function (registerCache, sharedRegisters) {\n return \"\";\n };\n /**\n * @inheritDoc\n */\n ShaderChunkBase.prototype._getFragmentCode = function (targetReg, registerCache, sharedRegisters) {\n return \"\";\n };\n /**\n * Sets the render state for this method.\n *\n * @param methodVO The MethodVO object linking this method with the pass currently being compiled.\n * @param stage The Stage object currently used for rendering.\n *\n * @internal\n */\n ShaderChunkBase.prototype._activate = function () {\n };\n /**\n * Sets the render state for a single renderable.\n *\n * @param vo The MethodVO object linking this method with the pass currently being compiled.\n * @param renderable The renderable currently being rendered.\n * @param stage The Stage object currently used for rendering.\n * @param camera The camera from which the scene is currently rendered.\n *\n * @internal\n */\n ShaderChunkBase.prototype._setRenderState = function (renderable, projection) {\n };\n /**\n * Clears the render state for this method.\n * @param vo The MethodVO object linking this method with the pass currently being compiled.\n * @param stage The Stage object currently used for rendering.\n *\n * @internal\n */\n ShaderChunkBase.prototype._deactivate = function () {\n this._invalid = false;\n };\n return ShaderChunkBase;\n}(AbstractionBase));\nexport { ShaderChunkBase };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/chunks/ShaderChunkBase.js","import * as tslib_1 from \"tslib\";\nimport { AssetEvent } from \"@awayjs/core\";\nimport { MappingMode } from \"@awayjs/graphics\";\nimport { ShaderChunkBase } from \"./ShaderChunkBase\";\n/**\n * AmbientBasicChunk provides the default shading method for uniform ambient lighting.\n */\nvar AmbientBasicChunk = (function (_super) {\n tslib_1.__extends(AmbientBasicChunk, _super);\n /**\n * Creates a new AmbientBasicChunk object.\n */\n function AmbientBasicChunk(method, shader) {\n var _this = _super.call(this, method, shader) || this;\n _this._method = method;\n _this._shader = shader;\n return _this;\n }\n /**\n *\n */\n AmbientBasicChunk.prototype.onClear = function (event) {\n _super.prototype.onClear.call(this, event);\n this._method = null;\n this._shader = null;\n if (this._texture) {\n this._texture.onClear(new AssetEvent(AssetEvent.CLEAR, this._method.texture));\n this._texture = null;\n }\n };\n /**\n * @inheritDoc\n */\n AmbientBasicChunk.prototype._initVO = function (chunkVO) {\n if (this._method.texture) {\n this._texture = this._shader.getAbstraction(this._method.texture);\n if (this._method.texture.mappingMode == MappingMode.CUBE)\n chunkVO.needsNormals = true;\n else\n this._shader.uvDependencies++;\n }\n else if (this._texture) {\n this._texture = null;\n }\n };\n /**\n * @inheritDoc\n */\n AmbientBasicChunk.prototype._getFragmentCode = function (targetReg, registerCache, sharedRegisters) {\n var code = \"\";\n if (this._texture) {\n code += this._texture._getFragmentCode(targetReg, registerCache, sharedRegisters, (this._method.texture.mappingMode == MappingMode.CUBE) ? sharedRegisters.normalFragment : sharedRegisters.uvVarying);\n if (this._shader.alphaThreshold > 0) {\n var cutOffReg = registerCache.getFreeFragmentConstant();\n this._colorIndex = cutOffReg.index * 4;\n code += \"sub \" + targetReg + \".w, \" + targetReg + \".w, \" + cutOffReg + \".x\\n\" +\n \"kil \" + targetReg + \".w\\n\" +\n \"add \" + targetReg + \".w, \" + targetReg + \".w, \" + cutOffReg + \".x\\n\";\n }\n }\n else {\n var ambientInputRegister = registerCache.getFreeFragmentConstant();\n this._colorIndex = ambientInputRegister.index * 4;\n code += \"mov \" + targetReg + \", \" + ambientInputRegister + \"\\n\";\n }\n return code;\n };\n /**\n * @inheritDoc\n */\n AmbientBasicChunk.prototype._activate = function () {\n if (this._texture) {\n this._texture.activate();\n if (this._invalid && this._shader.alphaThreshold > 0)\n this._shader.fragmentConstantData[this._colorIndex] = this._shader.alphaThreshold;\n }\n else if (this._invalid) {\n var index = this._colorIndex;\n var data = this._shader.fragmentConstantData;\n var color = this._shader.numLights ? 0xFFFFFF : this._shader.pass.style.color;\n data[index] = ((color >> 16) & 0xff) / 0xff * this._method.strength;\n data[index + 1] = ((color >> 8) & 0xff) / 0xff * this._method.strength;\n data[index + 2] = (color & 0xff) / 0xff * this._method.strength;\n data[index + 3] = this._method.alpha;\n }\n };\n AmbientBasicChunk.prototype._setRenderState = function (renderable, projection) {\n if (this._texture)\n this._texture._setRenderState(renderable);\n };\n return AmbientBasicChunk;\n}(ShaderChunkBase));\nexport { AmbientBasicChunk };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/chunks/AmbientBasicChunk.js","import * as tslib_1 from \"tslib\";\nimport { AmbientBasicChunk } from \"./AmbientBasicChunk\";\n/**\n * AmbientDepthChunk provides a debug method to visualise depth maps\n */\nvar AmbientDepthChunk = (function (_super) {\n tslib_1.__extends(AmbientDepthChunk, _super);\n /**\n * Creates a new AmbientBasicChunk object.\n */\n function AmbientDepthChunk(method, shader) {\n var _this = _super.call(this, method, shader) || this;\n _this._shadowTexture = shader.getAbstraction(method.castingLight.shadowMapper.depthMap);\n return _this;\n }\n /**\n * @inheritDoc\n */\n AmbientDepthChunk.prototype._initConstants = function () {\n var data = this._shader.fragmentConstantData;\n var index = this._decRegIndex;\n data[index] = 1.0;\n data[index + 1] = 1 / 255.0;\n data[index + 2] = 1 / 65025.0;\n data[index + 3] = 1 / 16581375.0;\n };\n AmbientDepthChunk.prototype._getFragmentCode = function (targetReg, registerCache, sharedRegisters) {\n var code = \"\";\n var decReg;\n var decReg = registerCache.getFreeFragmentConstant();\n this._decRegIndex = decReg.index * 4;\n code += this._shadowTexture._getFragmentCode(targetReg, registerCache, sharedRegisters, sharedRegisters.uvVarying) +\n \"dp4 \" + targetReg + \".x, \" + targetReg + \", \" + decReg + \"\\n\" +\n \"mov \" + targetReg + \".yz, \" + targetReg + \".xx\t\t\t\\n\" +\n \"mov \" + targetReg + \".w, \" + decReg + \".x\\n\" +\n \"sub \" + targetReg + \".xyz, \" + decReg + \".xxx, \" + targetReg + \".xyz\\n\";\n return code;\n };\n return AmbientDepthChunk;\n}(AmbientBasicChunk));\nexport { AmbientDepthChunk };\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/chunks/AmbientDepthChunk.js","import * as tslib_1 from \"tslib\";\nimport { MappingMode } from \"@awayjs/graphics\";\nimport { ShaderChunkBase } from \"./ShaderChunkBase\";\n/**\n * DiffuseBasicChunk provides the default shading method for Lambert (dot3) diffuse lighting.\n */\nvar DiffuseBasicChunk = (function (_super) {\n tslib_1.__extends(DiffuseBasicChunk, _super);\n /**\n * Creates a new DiffuseBasicChunk object.\n */\n function DiffuseBasicChunk(method, shader) {\n var _this = _super.call(this, method, shader) || this;\n _this._ambientColorR = 1;\n _this._ambientColorG = 1;\n _this._ambientColorB = 1;\n _this._color = 0xffffff;\n _this._colorR = 1;\n _this._colorG = 1;\n _this._colorB = 1;\n _this._method = method;\n _this._shader = shader;\n return _this;\n }\n /**\n *\n */\n DiffuseBasicChunk.prototype.onInvalidate = function (event) {\n _super.prototype.onInvalidate.call(this, event);\n this._updateProperties();\n };\n DiffuseBasicChunk.prototype._isUsed = function () {\n return Boolean(this._shader.numLights);\n };\n DiffuseBasicChunk.prototype._initVO = function (chunkVO) {\n if (this._method.texture) {\n this._texture = this._shader.getAbstraction(this._method.texture);\n if (this._method.texture.mappingMode == MappingMode.CUBE)\n chunkVO.needsNormals = true;\n else\n this._shader.uvDependencies++;\n }\n else if (this._texture) {\n this._texture = null;\n }\n if (this._shader.numLights) {\n this._shader.usesCommonData = true;\n chunkVO.needsNormals = true;\n }\n };\n /**\n * @inheritDoc\n */\n DiffuseBasicChunk.prototype._initConstants = function () {\n this._updateProperties();\n };\n /**\n * @inheritDoc\n */\n DiffuseBasicChunk.prototype._cleanCompilationData = function () {\n _super.prototype._cleanCompilationData.call(this);\n this._totalLightColorReg = null;\n };\n /**\n * @inheritDoc\n */\n DiffuseBasicChunk.prototype._getFragmentPreLightingCode = function (registerCache, sharedRegisters) {\n var code = \"\";\n this._pIsFirstLight = true;\n registerCache.addFragmentTempUsages(this._totalLightColorReg = registerCache.getFreeFragmentVectorTemp(), 1);\n return code;\n };\n /**\n * @inheritDoc\n */\n DiffuseBasicChunk.prototype._getFragmentCodePerLight = function (lightDirReg, lightColReg, registerCache, sharedRegisters) {\n var code = \"\";\n var t;\n // write in temporary if not first light, so we can add to total diffuse colour\n if (this._pIsFirstLight) {\n t = this._totalLightColorReg;\n }\n else {\n t = registerCache.getFreeFragmentVectorTemp();\n registerCache.addFragmentTempUsages(t, 1);\n }\n code += \"dp3 \" + t + \".x, \" + lightDirReg + \", \" + sharedRegisters.normalFragment + \"\\n\" +\n \"max \" + t + \".w, \" + t + \".x, \" + sharedRegisters.commons + \".y\\n\";\n if (this._shader.usesLightFallOff)\n code += \"mul \" + t + \".w, \" + t + \".w, \" + lightDirReg + \".w\\n\";\n if (this._modulateFunction != null)\n code += this._modulateFunction(t, registerCache, sharedRegisters);\n code += \"mul \" + t + \", \" + t + \".w, \" + lightColReg + \"\\n\";\n if (!this._pIsFirstLight) {\n code += \"add \" + this._totalLightColorReg + \".xyz, \" + this._totalLightColorReg + \", \" + t + \"\\n\";\n registerCache.removeFragmentTempUsage(t);\n }\n this._pIsFirstLight = false;\n return code;\n };\n /**\n * @inheritDoc\n */\n DiffuseBasicChunk.prototype._getFragmentCodePerProbe = function (cubeMapReg, weightRegister, registerCache, sharedRegisters) {\n var code = \"\";\n var t;\n // write in temporary if not first light, so we can add to total diffuse colour\n if (this._pIsFirstLight) {\n t = this._totalLightColorReg;\n }\n else {\n t = registerCache.getFreeFragmentVectorTemp();\n registerCache.addFragmentTempUsages(t, 1);\n }\n code += \"tex \" + t + \", \" + sharedRegisters.normalFragment + \", \" + cubeMapReg + \" Max3DSParser object.\r\n *\r\n * @param useSmoothingGroups Determines whether the parser looks for smoothing groups in the 3ds file or assumes uniform smoothing. Defaults to true.\r\n */\r\n function Max3DSParser(useSmoothingGroups) {\r\n if (useSmoothingGroups === void 0) { useSmoothingGroups = true; }\r\n var _this = _super.call(this, URLLoaderDataFormat.ARRAY_BUFFER) || this;\r\n _this._useSmoothingGroups = useSmoothingGroups;\r\n return _this;\r\n }\r\n /**\r\n * Indicates whether or not a given file extension is supported by the parser.\r\n * @param extension The file extension of a potential file to be parsed.\r\n * @return Whether or not the given file type is supported.\r\n */\r\n Max3DSParser.supportsType = function (extension) {\r\n extension = extension.toLowerCase();\r\n return extension == \"3ds\";\r\n };\r\n /**\r\n * Tests whether a data block can be parsed by the parser.\r\n * @param data The data block to potentially be parsed.\r\n * @return Whether or not the given data is supported.\r\n */\r\n Max3DSParser.supportsData = function (data) {\r\n var ba;\r\n try {\r\n //TODO!!!: crashes when trying to check against AudioData\r\n ba = ParserUtils.toByteArray(data);\r\n if (ba) {\r\n ba.position = 0;\r\n if (ba.readShort() == 0x4d4d)\r\n return true;\r\n }\r\n }\r\n catch (err) {\r\n return false;\r\n }\r\n return false;\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n Max3DSParser.prototype._iResolveDependency = function (resourceDependency) {\r\n if (resourceDependency.assets.length == 1) {\r\n var asset;\r\n asset = resourceDependency.assets[0];\r\n if (asset.isAsset(BitmapImage2D)) {\r\n var tex;\r\n tex = this._textures[resourceDependency.id];\r\n tex.texture = new Single2DTexture(asset);\r\n }\r\n }\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n Max3DSParser.prototype._iResolveDependencyFailure = function (resourceDependency) {\r\n // TODO: Implement\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n Max3DSParser.prototype._pProceedParsing = function () {\r\n if (!this._byteData) {\r\n this._byteData = this._pGetByteData();\r\n this._byteData.position = 0;\r\n //----------------------------------------------------------------------------\r\n // LITTLE_ENDIAN - Default for ArrayBuffer / Not implemented in ByteArray\r\n //----------------------------------------------------------------------------\r\n //this._byteData.endian = Endian.LITTLE_ENDIAN;// Should be default\r\n //----------------------------------------------------------------------------\r\n this._textures = {};\r\n this._materials = {};\r\n this._unfinalized_objects = {};\r\n }\r\n // TODO: With this construct, the loop will run no-op for as long\r\n // as there is time once file has finished reading. Consider a nice\r\n // way to stop loop when byte array is empty, without putting it in\r\n // the while-conditional, which will prevent finalizations from\r\n // happening after the last chunk.\r\n while (this._pHasTime()) {\r\n // If we are currently working on an object, and the most recent chunk was\r\n // the last one in that object, finalize the current object.\r\n if (this._cur_mat && this._byteData.position >= this._cur_mat_end)\r\n this.finalizeCurrentMaterial();\r\n else if (this._cur_obj && this._byteData.position >= this._cur_obj_end) {\r\n // Can't finalize at this point, because we have to wait until the full\r\n // animation section has been parsed for any potential pivot definitions\r\n this._unfinalized_objects[this._cur_obj.name] = this._cur_obj;\r\n this._cur_obj_end = Number.MAX_VALUE /*uint*/;\r\n this._cur_obj = null;\r\n }\r\n if (this._byteData.getBytesAvailable() > 0) {\r\n var cid /*uint*/;\r\n var len /*uint*/;\r\n var end /*uint*/;\r\n cid = this._byteData.readUnsignedShort();\r\n len = this._byteData.readUnsignedInt();\r\n end = this._byteData.position + (len - 6);\r\n switch (cid) {\r\n case 0x4D4D: // MAIN3DS\r\n case 0x3D3D: // EDIT3DS\r\n case 0xB000:\r\n // This types are \"container chunks\" and contain only\r\n // sub-chunks (no data on their own.) This means that\r\n // there is nothing more to parse at this point, and\r\n // instead we should progress to the next chunk, which\r\n // will be the first sub-chunk of this one.\r\n continue;\r\n case 0xAFFF:\r\n this._cur_mat_end = end;\r\n this._cur_mat = this.parseMaterial();\r\n break;\r\n case 0x4000:\r\n this._cur_obj_end = end;\r\n this._cur_obj = new ObjectVO();\r\n this._cur_obj.name = this.readNulTermstring();\r\n this._cur_obj.materials = new Array();\r\n this._cur_obj.materialFaces = {};\r\n break;\r\n case 0x4100:\r\n this._cur_obj.type = Sprite.assetType;\r\n break;\r\n case 0x4110:\r\n this.parseVertexList();\r\n break;\r\n case 0x4120:\r\n this.parseFaceList();\r\n break;\r\n case 0x4140:\r\n this.parseUVList();\r\n break;\r\n case 0x4130:\r\n this.parseFaceMaterialList();\r\n break;\r\n case 0x4160:\r\n this._cur_obj.transform = this.readTransform();\r\n break;\r\n case 0xB002:\r\n this.parseObjectAnimation(end);\r\n break;\r\n case 0x4150:\r\n this.parseSmoothingGroups();\r\n break;\r\n default:\r\n // Skip this (unknown) chunk\r\n this._byteData.position += (len - 6);\r\n break;\r\n }\r\n // Pause parsing if there were any dependencies found during this\r\n // iteration (i.e. if there are any dependencies that need to be\r\n // retrieved at this time.)\r\n if (this.dependencies.length) {\r\n this._pPauseAndRetrieveDependencies();\r\n break;\r\n }\r\n }\r\n }\r\n // More parsing is required if the entire byte array has not yet\r\n // been read, or if there is a currently non-finalized object in\r\n // the pipeline.\r\n if (this._byteData.getBytesAvailable() || this._cur_obj || this._cur_mat) {\r\n return ParserBase.MORE_TO_PARSE;\r\n }\r\n else {\r\n var name;\r\n // Finalize any remaining objects before ending.\r\n for (name in this._unfinalized_objects) {\r\n var obj;\r\n obj = this.constructObject(this._unfinalized_objects[name]);\r\n if (obj) {\r\n //add to the content property\r\n this._pContent.addChild(obj);\r\n this._pFinalizeAsset(obj, name);\r\n }\r\n }\r\n return ParserBase.PARSING_DONE;\r\n }\r\n };\r\n Max3DSParser.prototype._pStartParsing = function (frameLimit) {\r\n //create a content object for Loaders\r\n this._pContent = new DisplayObjectContainer();\r\n _super.prototype._pStartParsing.call(this, frameLimit);\r\n };\r\n Max3DSParser.prototype.parseMaterial = function () {\r\n var mat;\r\n mat = new MaterialVO();\r\n while (this._byteData.position < this._cur_mat_end) {\r\n var cid /*uint*/;\r\n var len /*uint*/;\r\n var end /*uint*/;\r\n cid = this._byteData.readUnsignedShort();\r\n len = this._byteData.readUnsignedInt();\r\n end = this._byteData.position + (len - 6);\r\n switch (cid) {\r\n case 0xA000:\r\n mat.name = this.readNulTermstring();\r\n break;\r\n case 0xA010:\r\n mat.ambientColor = this.readColor();\r\n break;\r\n case 0xA020:\r\n mat.diffuseColor = this.readColor();\r\n break;\r\n case 0xA030:\r\n mat.specularColor = this.readColor();\r\n break;\r\n case 0xA081:\r\n mat.twoSided = true;\r\n break;\r\n case 0xA200:\r\n mat.colorMap = this.parseTexture(end);\r\n break;\r\n case 0xA204:\r\n mat.specularMap = this.parseTexture(end);\r\n break;\r\n default:\r\n this._byteData.position = end;\r\n break;\r\n }\r\n }\r\n return mat;\r\n };\r\n Max3DSParser.prototype.parseTexture = function (end /*uint*/) {\r\n var tex;\r\n tex = new TextureVO();\r\n while (this._byteData.position < end) {\r\n var cid /*uint*/;\r\n var len /*uint*/;\r\n cid = this._byteData.readUnsignedShort();\r\n len = this._byteData.readUnsignedInt();\r\n switch (cid) {\r\n case 0xA300:\r\n tex.url = this.readNulTermstring();\r\n break;\r\n default:\r\n // Skip this unknown texture sub-chunk\r\n this._byteData.position += (len - 6);\r\n break;\r\n }\r\n }\r\n this._textures[tex.url] = tex;\r\n this._pAddDependency(tex.url, new URLRequest(tex.url));\r\n return tex;\r\n };\r\n Max3DSParser.prototype.parseVertexList = function () {\r\n var i /*uint*/;\r\n var len /*uint*/;\r\n var count /*uint*/;\r\n count = this._byteData.readUnsignedShort();\r\n this._cur_obj.verts = new Array(count * 3);\r\n i = 0;\r\n len = this._cur_obj.verts.length;\r\n while (i < len) {\r\n var x, y, z;\r\n x = this._byteData.readFloat();\r\n y = this._byteData.readFloat();\r\n z = this._byteData.readFloat();\r\n this._cur_obj.verts[i++] = x;\r\n this._cur_obj.verts[i++] = z;\r\n this._cur_obj.verts[i++] = y;\r\n }\r\n };\r\n Max3DSParser.prototype.parseFaceList = function () {\r\n var i /*uint*/;\r\n var len /*uint*/;\r\n var count /*uint*/;\r\n count = this._byteData.readUnsignedShort();\r\n this._cur_obj.indices = new Array(count * 3) /*uint*/;\r\n i = 0;\r\n len = this._cur_obj.indices.length;\r\n while (i < len) {\r\n var i0 /*uint*/, i1 /*uint*/, i2 /*uint*/;\r\n i0 = this._byteData.readUnsignedShort();\r\n i1 = this._byteData.readUnsignedShort();\r\n i2 = this._byteData.readUnsignedShort();\r\n this._cur_obj.indices[i++] = i0;\r\n this._cur_obj.indices[i++] = i2;\r\n this._cur_obj.indices[i++] = i1;\r\n // Skip \"face info\", irrelevant in Away3D\r\n this._byteData.position += 2;\r\n }\r\n this._cur_obj.smoothingGroups = new Array(count) /*uint*/;\r\n };\r\n Max3DSParser.prototype.parseSmoothingGroups = function () {\r\n var len = this._cur_obj.indices.length / 3;\r\n var i = 0;\r\n while (i < len) {\r\n this._cur_obj.smoothingGroups[i] = this._byteData.readUnsignedInt();\r\n i++;\r\n }\r\n };\r\n Max3DSParser.prototype.parseUVList = function () {\r\n var i /*uint*/;\r\n var len /*uint*/;\r\n var count /*uint*/;\r\n count = this._byteData.readUnsignedShort();\r\n this._cur_obj.uvs = new Array(count * 2);\r\n i = 0;\r\n len = this._cur_obj.uvs.length;\r\n while (i < len) {\r\n this._cur_obj.uvs[i++] = this._byteData.readFloat();\r\n this._cur_obj.uvs[i++] = 1.0 - this._byteData.readFloat();\r\n }\r\n };\r\n Max3DSParser.prototype.parseFaceMaterialList = function () {\r\n var mat;\r\n var count /*uint*/;\r\n var i /*uint*/;\r\n var faces /*uint*/;\r\n mat = this.readNulTermstring();\r\n count = this._byteData.readUnsignedShort();\r\n faces = new Array(count) /*uint*/;\r\n i = 0;\r\n while (i < faces.length)\r\n faces[i++] = this._byteData.readUnsignedShort();\r\n this._cur_obj.materials.push(mat);\r\n this._cur_obj.materialFaces[mat] = faces;\r\n };\r\n Max3DSParser.prototype.parseObjectAnimation = function (end) {\r\n var vo;\r\n var obj;\r\n var pivot;\r\n var name;\r\n var hier /*uint*/;\r\n // Pivot defaults to origin\r\n pivot = new Vector3D;\r\n while (this._byteData.position < end) {\r\n var cid /*uint*/;\r\n var len /*uint*/;\r\n cid = this._byteData.readUnsignedShort();\r\n len = this._byteData.readUnsignedInt();\r\n switch (cid) {\r\n case 0xb010:\r\n name = this.readNulTermstring();\r\n this._byteData.position += 4;\r\n hier = this._byteData.readShort();\r\n break;\r\n case 0xb013:\r\n pivot.x = this._byteData.readFloat();\r\n pivot.z = this._byteData.readFloat();\r\n pivot.y = this._byteData.readFloat();\r\n break;\r\n default:\r\n this._byteData.position += (len - 6);\r\n break;\r\n }\r\n }\r\n // If name is \"$$$DUMMY\" this is an empty object (e.g. a container)\r\n // and will be ignored in this version of the parser\r\n // TODO: Implement containers in 3DS parser.\r\n if (name != '$$$DUMMY' && this._unfinalized_objects.hasOwnProperty(name)) {\r\n vo = this._unfinalized_objects[name];\r\n obj = this.constructObject(vo, pivot);\r\n if (obj) {\r\n //add to the content property\r\n this._pContent.addChild(obj);\r\n this._pFinalizeAsset(obj, vo.name);\r\n }\r\n delete this._unfinalized_objects[name];\r\n }\r\n };\r\n Max3DSParser.prototype.constructObject = function (obj, pivot) {\r\n if (pivot === void 0) { pivot = null; }\r\n if (obj.type == Sprite.assetType) {\r\n var i /*uint*/;\r\n var sub;\r\n var graphics;\r\n var mat;\r\n var sprite;\r\n var mtx;\r\n var vertices;\r\n var faces;\r\n if (obj.materials.length > 1)\r\n console.log(\"The Away3D 3DS parser does not support multiple materials per sprite at this point.\");\r\n // Ignore empty objects\r\n if (!obj.indices || obj.indices.length == 0)\r\n return null;\r\n vertices = new Array(obj.verts.length / 3);\r\n faces = new Array(obj.indices.length / 3);\r\n this.prepareData(vertices, faces, obj);\r\n if (this._useSmoothingGroups)\r\n this.applySmoothGroups(vertices, faces);\r\n obj.verts = new Array(vertices.length * 3);\r\n for (i = 0; i < vertices.length; i++) {\r\n obj.verts[i * 3] = vertices[i].x;\r\n obj.verts[i * 3 + 1] = vertices[i].y;\r\n obj.verts[i * 3 + 2] = vertices[i].z;\r\n }\r\n obj.indices = new Array(faces.length * 3) /*uint*/;\r\n for (i = 0; i < faces.length; i++) {\r\n obj.indices[i * 3] = faces[i].a;\r\n obj.indices[i * 3 + 1] = faces[i].b;\r\n obj.indices[i * 3 + 2] = faces[i].c;\r\n }\r\n if (obj.uvs) {\r\n // If the object had UVs to start with, use UVs generated by\r\n // smoothing group splitting algorithm. Otherwise those UVs\r\n // will be nonsense and should be skipped.\r\n obj.uvs = new Array(vertices.length * 2);\r\n for (i = 0; i < vertices.length; i++) {\r\n obj.uvs[i * 2] = vertices[i].u;\r\n obj.uvs[i * 2 + 1] = vertices[i].v;\r\n }\r\n }\r\n if (obj.materials.length > 0) {\r\n var mname;\r\n mname = obj.materials[0];\r\n mat = this._materials[mname].material;\r\n }\r\n // Build sprite and return it\r\n sprite = new Sprite(mat);\r\n sprite.transform.matrix3D = new Matrix3D(obj.transform);\r\n graphics = sprite.graphics;\r\n // Construct elements (potentially splitting buffers)\r\n // and add them to graphics.\r\n sub = new TriangleElements(new AttributesBuffer());\r\n sub.setIndices(obj.indices);\r\n sub.setPositions(obj.verts);\r\n sub.setUVs(obj.uvs);\r\n graphics.addShape(new Shape(sub));\r\n // Apply pivot translation to graphics if a pivot was\r\n // found while parsing the keyframe chunk earlier.\r\n if (pivot) {\r\n if (obj.transform) {\r\n // If a transform was found while parsing the\r\n // object chunk, use it to find the local pivot vector\r\n mtx = new Matrix3D();\r\n mtx.copyRawDataFrom(obj.transform);\r\n mtx._rawData[12] = 0;\r\n mtx._rawData[13] = 0;\r\n mtx._rawData[14] = 0;\r\n pivot = mtx.transformVector(pivot);\r\n }\r\n pivot.scaleBy(-1);\r\n mtx = new Matrix3D();\r\n mtx.appendTranslation(pivot.x, pivot.y, pivot.z);\r\n graphics.applyTransformation(mtx);\r\n }\r\n // Apply transformation to graphics if a transformation\r\n // was found while parsing the object chunk earlier.\r\n if (obj.transform) {\r\n mtx = new Matrix3D();\r\n mtx.copyRawDataFrom(obj.transform);\r\n mtx.invert();\r\n graphics.applyTransformation(mtx);\r\n }\r\n // Final transform applied to graphics. Finalize the graphics,\r\n // which will no longer be modified after this point.\r\n this._pFinalizeAsset(graphics, obj.name.concat('_graphics'));\r\n return sprite;\r\n }\r\n // If reached, unknown\r\n return null;\r\n };\r\n Max3DSParser.prototype.prepareData = function (vertices, faces, obj) {\r\n // convert raw ObjectVO's data to structured VertexVO and FaceVO\r\n var i /*int*/;\r\n var j /*int*/;\r\n var k /*int*/;\r\n var len = obj.verts.length;\r\n for (i = 0, j = 0, k = 0; i < len;) {\r\n var v = new VertexVO;\r\n v.x = obj.verts[i++];\r\n v.y = obj.verts[i++];\r\n v.z = obj.verts[i++];\r\n if (obj.uvs) {\r\n v.u = obj.uvs[j++];\r\n v.v = obj.uvs[j++];\r\n }\r\n vertices[k++] = v;\r\n }\r\n len = obj.indices.length;\r\n for (i = 0, k = 0; i < len;) {\r\n var f = new FaceVO();\r\n f.a = obj.indices[i++];\r\n f.b = obj.indices[i++];\r\n f.c = obj.indices[i++];\r\n f.smoothGroup = obj.smoothingGroups[k] || 0;\r\n faces[k++] = f;\r\n }\r\n };\r\n Max3DSParser.prototype.applySmoothGroups = function (vertices, faces) {\r\n // clone vertices according to following rule:\r\n // clone if vertex's in faces from groups 1+2 and 3\r\n // don't clone if vertex's in faces from groups 1+2, 3 and 1+3\r\n var i /*int*/;\r\n var j /*int*/;\r\n var k /*int*/;\r\n var l /*int*/;\r\n var len /*int*/;\r\n var numVerts = vertices.length;\r\n var numFaces = faces.length;\r\n // extract groups data for vertices\r\n var vGroups = new Array(numVerts) /*uint*/;\r\n for (i = 0; i < numVerts; i++)\r\n vGroups[i] = new Array() /*uint*/;\r\n for (i = 0; i < numFaces; i++) {\r\n var face = faces[i];\r\n for (j = 0; j < 3; j++) {\r\n var groups = vGroups[(j == 0) ? face.a : ((j == 1) ? face.b : face.c)];\r\n var group = face.smoothGroup;\r\n for (k = groups.length - 1; k >= 0; k--) {\r\n if ((group & groups[k]) > 0) {\r\n group |= groups[k];\r\n groups.splice(k, 1);\r\n k = groups.length - 1;\r\n }\r\n }\r\n groups.push(group);\r\n }\r\n }\r\n // clone vertices\r\n var vClones = new Array(numVerts) /*uint*/;\r\n for (i = 0; i < numVerts; i++) {\r\n if ((len = vGroups[i].length) < 1)\r\n continue;\r\n var clones = new Array(len) /*uint*/;\r\n vClones[i] = clones;\r\n clones[0] = i;\r\n var v0 = vertices[i];\r\n for (j = 1; j < len; j++) {\r\n var v1 = new VertexVO;\r\n v1.x = v0.x;\r\n v1.y = v0.y;\r\n v1.z = v0.z;\r\n v1.u = v0.u;\r\n v1.v = v0.v;\r\n clones[j] = vertices.length;\r\n vertices.push(v1);\r\n }\r\n }\r\n numVerts = vertices.length;\r\n for (i = 0; i < numFaces; i++) {\r\n face = faces[i];\r\n group = face.smoothGroup;\r\n for (j = 0; j < 3; j++) {\r\n k = (j == 0) ? face.a : ((j == 1) ? face.b : face.c);\r\n groups = vGroups[k];\r\n len = groups.length;\r\n clones = vClones[k];\r\n for (l = 0; l < len; l++) {\r\n if (((group == 0) && (groups[l] == 0)) || ((group & groups[l]) > 0)) {\r\n var index = clones[l];\r\n if (group == 0) {\r\n // vertex is unique if no smoothGroup found\r\n groups.splice(l, 1);\r\n clones.splice(l, 1);\r\n }\r\n if (j == 0)\r\n face.a = index;\r\n else if (j == 1)\r\n face.b = index;\r\n else\r\n face.c = index;\r\n l = len;\r\n }\r\n }\r\n }\r\n }\r\n };\r\n Max3DSParser.prototype.finalizeCurrentMaterial = function () {\r\n var mat;\r\n mat = new MethodMaterial(this._cur_mat.ambientColor);\r\n if (this._cur_mat.colorMap)\r\n mat.ambientMethod.texture = this._cur_mat.colorMap.texture || DefaultMaterialManager.getDefaultTexture();\r\n mat.diffuseMethod.color = this._cur_mat.diffuseColor;\r\n mat.specularMethod.color = this._cur_mat.specularColor;\r\n if (this.materialMode >= 2)\r\n mat.mode = MethodMaterialMode.MULTI_PASS;\r\n mat.bothSides = this._cur_mat.twoSided;\r\n this._pFinalizeAsset(mat, this._cur_mat.name);\r\n this._materials[this._cur_mat.name] = this._cur_mat;\r\n this._cur_mat.material = mat;\r\n this._cur_mat = null;\r\n };\r\n Max3DSParser.prototype.readNulTermstring = function () {\r\n var chr /*int*/;\r\n var str = \"\";\r\n while ((chr = this._byteData.readUnsignedByte()) > 0)\r\n str += String.fromCharCode(chr);\r\n return str;\r\n };\r\n Max3DSParser.prototype.readTransform = function () {\r\n var data = new Float32Array(16);\r\n // X axis\r\n data[0] = this._byteData.readFloat(); // X\r\n data[2] = this._byteData.readFloat(); // Z\r\n data[1] = this._byteData.readFloat(); // Y\r\n data[3] = 0;\r\n // Z axis\r\n data[8] = this._byteData.readFloat(); // X\r\n data[10] = this._byteData.readFloat(); // Z\r\n data[9] = this._byteData.readFloat(); // Y\r\n data[11] = 0;\r\n // Y Axis\r\n data[4] = this._byteData.readFloat(); // X\r\n data[6] = this._byteData.readFloat(); // Z\r\n data[5] = this._byteData.readFloat(); // Y\r\n data[7] = 0;\r\n // Translation\r\n data[12] = this._byteData.readFloat(); // X\r\n data[14] = this._byteData.readFloat(); // Z\r\n data[13] = this._byteData.readFloat(); // Y\r\n data[15] = 1;\r\n return data;\r\n };\r\n Max3DSParser.prototype.readColor = function () {\r\n var cid /*int*/;\r\n var len /*int*/;\r\n var r /*int*/, g /*int*/, b /*int*/;\r\n cid = this._byteData.readUnsignedShort();\r\n len = this._byteData.readUnsignedInt();\r\n switch (cid) {\r\n case 0x0010:\r\n r = this._byteData.readFloat() * 255;\r\n g = this._byteData.readFloat() * 255;\r\n b = this._byteData.readFloat() * 255;\r\n break;\r\n case 0x0011:\r\n r = this._byteData.readUnsignedByte();\r\n g = this._byteData.readUnsignedByte();\r\n b = this._byteData.readUnsignedByte();\r\n break;\r\n default:\r\n this._byteData.position += (len - 6);\r\n break;\r\n }\r\n return (r << 16) | (g << 8) | b;\r\n };\r\n return Max3DSParser;\r\n}(ParserBase));\r\nexport { Max3DSParser };\r\n/**\r\n *\r\n */\r\nvar FaceVO = (function () {\r\n function FaceVO() {\r\n }\r\n return FaceVO;\r\n}());\r\nexport { FaceVO };\r\n/**\r\n *\r\n */\r\nvar MaterialVO = (function () {\r\n function MaterialVO() {\r\n }\r\n return MaterialVO;\r\n}());\r\nexport { MaterialVO };\r\n/**\r\n *\r\n */\r\nvar ObjectVO = (function () {\r\n function ObjectVO() {\r\n }\r\n return ObjectVO;\r\n}());\r\nexport { ObjectVO };\r\n/**\r\n *\r\n */\r\nvar TextureVO = (function () {\r\n function TextureVO() {\r\n }\r\n return TextureVO;\r\n}());\r\nexport { TextureVO };\r\n/**\r\n *\r\n */\r\nvar VertexVO = (function () {\r\n function VertexVO() {\r\n }\r\n return VertexVO;\r\n}());\r\nexport { VertexVO };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/Max3DSParser.js","import * as tslib_1 from \"tslib\";\r\nimport { URLLoaderDataFormat, URLRequest, ParserBase, ParserUtils, XmlUtils } from \"@awayjs/core\";\r\nimport { Sampler2D } from \"@awayjs/graphics\";\r\nimport { BitmapFontTable, Font } from \"@awayjs/scene\";\r\nimport { MethodMaterial } from \"@awayjs/materials\";\r\n/**\r\n * TextureAtlasParser provides a \"parser\" for natively supported image types (jpg, png). While it simply loads bytes into\r\n * a loader object, it wraps it in a BitmapImage2DResource so resource management can happen consistently without\r\n * exception cases.\r\n */\r\nvar FNTParser = (function (_super) {\r\n tslib_1.__extends(FNTParser, _super);\r\n /**\r\n * Creates a new TextureAtlasParser object.\r\n * @param uri The url or id of the data or file to be parsed.\r\n * @param extra The holder for extra contextual data that the parser might need.\r\n */\r\n function FNTParser() {\r\n var _this = _super.call(this, URLLoaderDataFormat.TEXT) || this;\r\n _this._parseState = 0;\r\n return _this;\r\n }\r\n /**\r\n * Indicates whether or not a given file extension is supported by the parser.\r\n * @param extension The file extension of a potential file to be parsed.\r\n * @return Whether or not the given file type is supported.\r\n */\r\n FNTParser.supportsType = function (extension) {\r\n extension = extension.toLowerCase();\r\n return extension == \"fnt\";\r\n };\r\n /**\r\n * Tests whether a data block can be parsed by the parser.\r\n * @param data The data block to potentially be parsed.\r\n * @return Whether or not the given data is supported.\r\n */\r\n FNTParser.supportsData = function (data) {\r\n try {\r\n var content = ParserUtils.toString(data);\r\n if (content.indexOf(\"font\") != -1 || content.indexOf(\"Font\") != -1) {\r\n //console.log(\"supportsData fnt\");\r\n return true;\r\n }\r\n return false;\r\n }\r\n catch (e) {\r\n return false;\r\n }\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n FNTParser.prototype._iResolveDependency = function (resourceDependency) {\r\n if (resourceDependency.assets.length) {\r\n var asset = resourceDependency.assets[0];\r\n asset.width = this._bitmapFontTable.texture_width;\r\n asset.height = this._bitmapFontTable.texture_height;\r\n var mat = new MethodMaterial(asset);\r\n mat.bothSides = true;\r\n mat.alphaBlending = true;\r\n mat.useColorTransform = true;\r\n mat.style.sampler = new Sampler2D(false, true, true);\r\n this._bitmapFontTable.addMaterial(mat);\r\n this._pFinalizeAsset(resourceDependency.assets[0]);\r\n this._pFinalizeAsset(mat);\r\n this._parseState = FNTParserState.PARSE_CHARS;\r\n }\r\n else {\r\n this._parseState = FNTParserState.PARSE_COMPLETE;\r\n }\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n FNTParser.prototype._iResolveDependencyFailure = function (resourceDependency) {\r\n this._parseState = FNTParserState.PARSE_COMPLETE;\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n FNTParser.prototype._pProceedParsing = function () {\r\n var nodes;\r\n switch (this._parseState) {\r\n case FNTParserState.PARSE_XML:\r\n try {\r\n this._doc = XmlUtils.getChildrenWithTag(XmlUtils.strToXml(this._pGetTextData()), \"font\")[0];\r\n var page_node = XmlUtils.getChildrenWithTag(this._doc, \"pages\")[0];\r\n var all_pages = XmlUtils.getChildrenWithTag(page_node, \"page\");\r\n var len = all_pages.length;\r\n // todo: correctly support multiple pages\r\n for (var i = 0; i < len; i++) {\r\n this._imagePath = XmlUtils.readAttributeValue(all_pages[i], \"file\");\r\n }\r\n var char_node = XmlUtils.getChildrenWithTag(this._doc, \"chars\")[0];\r\n this._chars = XmlUtils.getChildrenWithTag(char_node, \"char\");\r\n this._parseState = FNTParserState.PARSE_IMAGE;\r\n var info_node = XmlUtils.getChildrenWithTag(this._doc, \"info\")[0];\r\n var common_node = XmlUtils.getChildrenWithTag(this._doc, \"common\")[0];\r\n var font_name = XmlUtils.readAttributeValue(info_node, \"face\");\r\n //this._font = AssetLibrary.getAsset(font_name);\r\n //if(this._font==undefined){\r\n this._font = new Font();\r\n this._font.name = font_name;\r\n //}\r\n var bold = XmlUtils.readAttributeValue(info_node, \"bold\");\r\n if (bold != \"0\")\r\n font_name += \"_bold\";\r\n var italic = XmlUtils.readAttributeValue(info_node, \"italic\");\r\n if (italic != \"0\")\r\n font_name += \"_italic\";\r\n this._bitmapFontTable = this._font.get_font_table(font_name, BitmapFontTable.assetType);\r\n var size = XmlUtils.readAttributeValue(info_node, \"size\");\r\n this._bitmapFontTable._init_size = parseInt(size);\r\n var scaleH = XmlUtils.readAttributeValue(common_node, \"scaleH\");\r\n this._bitmapFontTable.texture_height = parseInt(scaleH);\r\n var scaleW = XmlUtils.readAttributeValue(common_node, \"scaleW\");\r\n this._bitmapFontTable.texture_width = parseInt(scaleW);\r\n var adjustSize = XmlUtils.readAttributeValue(common_node, \"adjustSize\");\r\n if (adjustSize != \"\")\r\n this._bitmapFontTable._adjust_size = parseFloat(adjustSize);\r\n }\r\n catch (Error) {\r\n return ParserBase.PARSING_DONE;\r\n }\r\n break;\r\n case FNTParserState.PARSE_IMAGE:\r\n if (this._imagePath) {\r\n this._pAddDependency(this._imagePath, new URLRequest(this._imagePath));\r\n this._pPauseAndRetrieveDependencies();\r\n }\r\n else {\r\n return ParserBase.PARSING_DONE;\r\n }\r\n break;\r\n case FNTParserState.PARSE_CHARS:\r\n var element;\r\n var x, y, width, height, xoff, yoff, xadv, page, chnl;\r\n var id;\r\n var len = this._chars.length;\r\n for (var i = 0; i < len; i++) {\r\n element = this._chars[i];\r\n x = parseInt(XmlUtils.readAttributeValue(element, \"x\"));\r\n y = parseInt(XmlUtils.readAttributeValue(element, \"y\"));\r\n width = parseInt(XmlUtils.readAttributeValue(element, \"width\"));\r\n height = parseInt(XmlUtils.readAttributeValue(element, \"height\"));\r\n xoff = parseInt(XmlUtils.readAttributeValue(element, \"xoffset\"));\r\n yoff = parseInt(XmlUtils.readAttributeValue(element, \"yoffset\"));\r\n xadv = parseInt(XmlUtils.readAttributeValue(element, \"xadvance\"));\r\n page = parseInt(XmlUtils.readAttributeValue(element, \"page\"));\r\n chnl = parseInt(XmlUtils.readAttributeValue(element, \"chnl\"));\r\n id = XmlUtils.readAttributeValue(element, \"id\");\r\n this._bitmapFontTable.setChar(id, x, y, width, height, xoff, yoff, xadv, page, chnl);\r\n }\r\n this._pFinalizeAsset(this._font, this._font.name);\r\n this._parseState = FNTParserState.PARSE_COMPLETE;\r\n break;\r\n case FNTParserState.PARSE_COMPLETE:\r\n return ParserBase.PARSING_DONE;\r\n }\r\n return ParserBase.MORE_TO_PARSE;\r\n };\r\n return FNTParser;\r\n}(ParserBase));\r\nexport { FNTParser };\r\nvar FNTParserState = (function () {\r\n function FNTParserState() {\r\n }\r\n return FNTParserState;\r\n}());\r\nFNTParserState.PARSE_XML = 0;\r\nFNTParserState.PARSE_IMAGE = 1;\r\nFNTParserState.PARSE_CHARS = 2;\r\nFNTParserState.PARSE_COMPLETE = 3;\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/FNTParser.js","import * as tslib_1 from \"tslib\";\r\nimport { AssetLibrary, URLLoaderDataFormat, ParserBase, ParserUtils } from \"@awayjs/core\";\r\nimport { Font, TesselatedFontTable } from \"@awayjs/scene\";\r\nvar opentype;\r\n/**\r\n * FontParser should parse Fonts into TesselatedFontTable for usage with webGL, or just load the Font as css class for usage with canvas and no webGL\r\n */\r\nvar FontParser = (function (_super) {\r\n tslib_1.__extends(FontParser, _super);\r\n /**\r\n * Creates a new TextureAtlasParser object.\r\n * @param uri The url or id of the data or file to be parsed.\r\n * @param extra The holder for extra contextual data that the parser might need.\r\n */\r\n function FontParser(useWebGL) {\r\n if (useWebGL === void 0) { useWebGL = true; }\r\n var _this = _super.call(this, URLLoaderDataFormat.ARRAY_BUFFER) || this;\r\n _this._useWebGL = false;\r\n _this._useWebGL = useWebGL;\r\n return _this;\r\n }\r\n /**\r\n * Indicates whether or not a given file extension is supported by the parser.\r\n * @param extension The file extension of a potential file to be parsed.\r\n * @return Whether or not the given file type is supported.\r\n */\r\n FontParser.supportsType = function (extension) {\r\n extension = extension.toLowerCase();\r\n var supports = ((extension == \"ttf\") || (extension == \"otf\"));\r\n if (supports) {\r\n console.log(\"FontParse encountered file with supported extension: = \" + extension);\r\n }\r\n return ((extension == \"ttf\") || (extension == \"otf\"));\r\n };\r\n /**\r\n * Tests whether a data block can be parsed by the parser.\r\n * @param data The data block to potentially be parsed.\r\n * @return Whether or not the given data is supported.\r\n */\r\n FontParser.supportsData = function (data) {\r\n console.log(\"ParserFont = \" + ParserUtils.toString(data, 20));\r\n try {\r\n /*\r\n var content:string = ParserUtils.toString(data);\r\n if(content.indexOf(\"font\") != -1 || content.indexOf(\"Font\") != -1){\r\n console.log(\"supportsData fnt\");\r\n return true;\r\n\r\n }\r\n */\r\n return true;\r\n }\r\n catch (e) {\r\n return false;\r\n }\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n FontParser.prototype._iResolveDependency = function (resourceDependency) {\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n FontParser.prototype._iResolveDependencyFailure = function (resourceDependency) {\r\n };\r\n FontParser.prototype.sortKeys = function (dict) {\r\n var keys = [];\r\n for (var key in dict) {\r\n keys.push(key);\r\n }\r\n keys.sort();\r\n return keys;\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n FontParser.prototype._pProceedParsing = function () {\r\n //console.log(\"proceed parsing = \"+this._iFileName);\r\n opentype = window[\"opentype\"];\r\n if (opentype) {\r\n //console.log(\"parsing font = \"+this._iFileName+\" / bytelength = \"+this._pGetByteData().getBytesAvailable());\r\n var font_name = \"\";\r\n var font_style_name = \"\";\r\n var font = opentype.parse(this.data);\r\n var tablename, table, property, value, fontname;\r\n var head = font.tables.head;\r\n /*\r\n */\r\n for (tablename in font.tables) {\r\n table = font.tables[tablename];\r\n if (tablename == 'name') {\r\n var properties = this.sortKeys(table);\r\n for (var i = 0; i < properties.length; i++) {\r\n var property = properties[i];\r\n var translations = table[property];\r\n var langs = this.sortKeys(translations);\r\n for (var j = 0; j < langs.length; j++) {\r\n var lang = langs[j];\r\n if (property == \"fontFamily\") {\r\n font_name = translations[lang];\r\n }\r\n else if (property == \"fontSubfamily\") {\r\n font_style_name = translations[lang];\r\n }\r\n console.log(\" \" + property + \": \" + lang + \" : \" + translations[lang]);\r\n }\r\n }\r\n }\r\n }\r\n if (font_name == \"\") {\r\n console.log(\"FontParser.ts '\" + this._iFileName + \"': Could not read fontname !!!\");\r\n }\r\n if (font_style_name == \"\") {\r\n console.log(\"FontParser.ts '\" + this._iFileName + \"': Could not read font_style_name !!!\");\r\n }\r\n var new_font = AssetLibrary.getAsset(font_name);\r\n var newfont = false;\r\n if (new_font == undefined) {\r\n new_font = new Font();\r\n newfont = true;\r\n }\r\n new_font.name = font_name;\r\n var new_font_style = new_font.get_font_table(font_style_name, TesselatedFontTable.assetType, font);\r\n }\r\n if (document) {\r\n var s = document.createElement('style');\r\n s.type = \"text/css\";\r\n document.getElementsByTagName('head')[0].appendChild(s);\r\n s.style.cssText = \"@font-face {\\\r\n\t\t\t\t\tfont-family: ''\" + this._iFileName + \"';\\\r\n\t\t\t\t\tsrc: url('\" + this._iFileName + \"');\\\r\n\t\t\t\t\t};\";\r\n }\r\n this._pFinalizeAsset(new_font, new_font.name);\r\n return ParserBase.PARSING_DONE;\r\n };\r\n return FontParser;\r\n}(ParserBase));\r\nexport { FontParser };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/FontParser.js","import * as tslib_1 from \"tslib\";\r\nimport { AttributesBuffer, URLLoaderDataFormat, URLRequest, ParserBase, ParserUtils } from \"@awayjs/core\";\r\nimport { Graphics, Shape, TriangleElements, DefaultMaterialManager } from \"@awayjs/graphics\";\r\nimport { DisplayObjectContainer, Sprite } from \"@awayjs/scene\";\r\nimport { VertexClipNode, VertexAnimationSet } from \"@awayjs/renderer\";\r\nimport { MethodMaterial, MethodMaterialMode } from \"@awayjs/materials\";\r\n/**\r\n * MD2Parser provides a parser for the MD2 data type.\r\n */\r\nvar MD2Parser = (function (_super) {\r\n tslib_1.__extends(MD2Parser, _super);\r\n /**\r\n * Creates a new MD2Parser object.\r\n * @param textureType The extension of the texture (e.g. jpg/png/...)\r\n * @param ignoreTexturePath If true, the path of the texture is ignored\r\n */\r\n function MD2Parser(textureType, ignoreTexturePath) {\r\n if (textureType === void 0) { textureType = \"jpg\"; }\r\n if (ignoreTexturePath === void 0) { ignoreTexturePath = true; }\r\n var _this = _super.call(this, URLLoaderDataFormat.ARRAY_BUFFER) || this;\r\n _this._clipNodes = new Object();\r\n // the current elements being built\r\n _this._animationSet = new VertexAnimationSet();\r\n _this.materialFinal = false;\r\n _this.graphicsCreated = false;\r\n _this._textureType = textureType;\r\n _this._ignoreTexturePath = ignoreTexturePath;\r\n return _this;\r\n }\r\n /**\r\n * Indicates whether or not a given file extension is supported by the parser.\r\n * @param extension The file extension of a potential file to be parsed.\r\n * @return Whether or not the given file type is supported.\r\n */\r\n MD2Parser.supportsType = function (extension) {\r\n extension = extension.toLowerCase();\r\n return extension == \"md2\";\r\n };\r\n /**\r\n * Tests whether a data block can be parsed by the parser.\r\n * @param data The data block to potentially be parsed.\r\n * @return Whether or not the given data is supported.\r\n */\r\n MD2Parser.supportsData = function (data) {\r\n return (ParserUtils.toString(data, 4) == 'IDP2');\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n MD2Parser.prototype._iResolveDependency = function (resourceDependency) {\r\n if (resourceDependency.assets.length != 1)\r\n return;\r\n var material = new MethodMaterial(resourceDependency.assets[0]);\r\n if (this.materialMode >= 2)\r\n material.mode = MethodMaterialMode.MULTI_PASS;\r\n //add to the content property\r\n this._pContent.addChild(this._sprite);\r\n material.name = this._sprite.material.name;\r\n this._sprite.material = material;\r\n this._pFinalizeAsset(material);\r\n this._pFinalizeAsset(this._sprite.graphics);\r\n this._pFinalizeAsset(this._sprite);\r\n this.materialFinal = true;\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n MD2Parser.prototype._iResolveDependencyFailure = function (resourceDependency) {\r\n // apply system default\r\n if (this.materialMode < 2) {\r\n this._sprite.material = DefaultMaterialManager.getDefaultMaterial();\r\n }\r\n else {\r\n this._sprite.material = new MethodMaterial(DefaultMaterialManager.getDefaultImage2D());\r\n this._sprite.material.mode = MethodMaterialMode.MULTI_PASS;\r\n }\r\n //add to the content property\r\n this._pContent.addChild(this._sprite);\r\n this._pFinalizeAsset(this._sprite.graphics);\r\n this._pFinalizeAsset(this._sprite);\r\n this.materialFinal = true;\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n MD2Parser.prototype._pProceedParsing = function () {\r\n if (!this._startedParsing) {\r\n this._byteData = this._pGetByteData();\r\n this._startedParsing = true;\r\n // Reset bytearray read position (which may have been\r\n // moved forward by the supportsData() function.)\r\n this._byteData.position = 0;\r\n }\r\n while (this._pHasTime()) {\r\n if (!this._parsedHeader) {\r\n //----------------------------------------------------------------------------\r\n // LITTLE_ENDIAN - Default for ArrayBuffer / Not implemented in ByteArray\r\n //----------------------------------------------------------------------------\r\n //this._byteData.endian = Endian.LITTLE_ENDIAN;\r\n // TODO: Create a sprite only when encountered (if it makes sense\r\n // for this file format) and return it using this._pFinalizeAsset()\r\n this._sprite = new Sprite();\r\n this._graphics = this._sprite.graphics;\r\n if (this.materialMode < 2) {\r\n this._sprite.material = DefaultMaterialManager.getDefaultMaterial();\r\n }\r\n else {\r\n this._sprite.material = new MethodMaterial(DefaultMaterialManager.getDefaultImage2D());\r\n this._sprite.material.mode = MethodMaterialMode.MULTI_PASS;\r\n }\r\n //_graphics.animation = new VertexAnimation(2, VertexAnimationMode.ABSOLUTE);\r\n //_animator = new VertexAnimator(VertexAnimationState(_sprite.animationState));\r\n // Parse header and decompress body\r\n this.parseHeader();\r\n this.parseMaterialNames();\r\n }\r\n else if (!this._parsedUV) {\r\n this.parseUV();\r\n }\r\n else if (!this._parsedFaces) {\r\n this.parseFaces();\r\n }\r\n else if (!this._parsedFrames) {\r\n this.parseFrames();\r\n }\r\n else if ((this.graphicsCreated) && (this.materialFinal)) {\r\n return ParserBase.PARSING_DONE;\r\n }\r\n else if (!this.graphicsCreated) {\r\n this.graphicsCreated = true;\r\n //create default subgraphics\r\n this._graphics.addShape(new Shape(this._firstElements.clone()));\r\n // Force name to be chosen by this._pFinalizeAsset()\r\n this._sprite.name = \"\";\r\n if (this.materialFinal) {\r\n //add to the content property\r\n this._pContent.addChild(this._sprite);\r\n this._pFinalizeAsset(this._sprite.graphics);\r\n this._pFinalizeAsset(this._sprite);\r\n }\r\n this._pPauseAndRetrieveDependencies();\r\n }\r\n }\r\n return ParserBase.MORE_TO_PARSE;\r\n };\r\n MD2Parser.prototype._pStartParsing = function (frameLimit) {\r\n //create a content object for Loaders\r\n this._pContent = new DisplayObjectContainer();\r\n _super.prototype._pStartParsing.call(this, frameLimit);\r\n };\r\n /**\r\n * Reads in all that MD2 Header data that is declared as private variables.\r\n * I know its a lot, and it looks ugly, but only way to do it in Flash\r\n */\r\n MD2Parser.prototype.parseHeader = function () {\r\n this._ident = this._byteData.readInt();\r\n this._version = this._byteData.readInt();\r\n this._skinWidth = this._byteData.readInt();\r\n this._skinHeight = this._byteData.readInt();\r\n //skip this._frameSize\r\n this._byteData.readInt();\r\n this._numSkins = this._byteData.readInt();\r\n this._numVertices = this._byteData.readInt();\r\n this._numST = this._byteData.readInt();\r\n this._numTris = this._byteData.readInt();\r\n //skip this._numGlCmds\r\n this._byteData.readInt();\r\n this._numFrames = this._byteData.readInt();\r\n this._offsetSkins = this._byteData.readInt();\r\n this._offsetST = this._byteData.readInt();\r\n this._offsetTris = this._byteData.readInt();\r\n this._offsetFrames = this._byteData.readInt();\r\n //skip this._offsetGlCmds\r\n this._byteData.readInt();\r\n this._offsetEnd = this._byteData.readInt();\r\n this._parsedHeader = true;\r\n };\r\n /**\r\n * Parses the file names for the materials.\r\n */\r\n MD2Parser.prototype.parseMaterialNames = function () {\r\n var url;\r\n var name;\r\n var extIndex /*int*/;\r\n var slashIndex /*int*/;\r\n this._materialNames = new Array();\r\n this._byteData.position = this._offsetSkins;\r\n var regExp = new RegExp(\"[^a-zA-Z0-9\\\\_\\/.]\", \"g\");\r\n for (var i = 0; i < this._numSkins; ++i) {\r\n name = this._byteData.readUTFBytes(64);\r\n name = name.replace(regExp, \"\");\r\n extIndex = name.lastIndexOf(\".\");\r\n if (this._ignoreTexturePath)\r\n slashIndex = name.lastIndexOf(\"/\");\r\n if (name.toLowerCase().indexOf(\".jpg\") == -1 && name.toLowerCase().indexOf(\".png\") == -1) {\r\n name = name.substring(slashIndex + 1, extIndex);\r\n url = name + \".\" + this._textureType;\r\n }\r\n else {\r\n url = name;\r\n }\r\n this._materialNames[i] = name;\r\n // only support 1 skin TODO: really?\r\n if (this.dependencies.length == 0)\r\n this._pAddDependency(name, new URLRequest(url));\r\n }\r\n if (this._materialNames.length > 0)\r\n this._sprite.material.name = this._materialNames[0];\r\n else\r\n this.materialFinal = true;\r\n };\r\n /**\r\n * Parses the uv data for the sprite.\r\n */\r\n MD2Parser.prototype.parseUV = function () {\r\n var j = 0;\r\n this._uvs = new Array(this._numST * 2);\r\n this._byteData.position = this._offsetST;\r\n for (var i = 0; i < this._numST; i++) {\r\n this._uvs[j++] = this._byteData.readShort() / this._skinWidth;\r\n this._uvs[j++] = this._byteData.readShort() / this._skinHeight;\r\n }\r\n this._parsedUV = true;\r\n };\r\n /**\r\n * Parses unique indices for the faces.\r\n */\r\n MD2Parser.prototype.parseFaces = function () {\r\n var a /*uint*/, b /*uint*/, c /*uint*/, ta /*uint*/, tb /*uint*/, tc /*uint*/;\r\n var i /*uint*/;\r\n this._vertIndices = new Array();\r\n this._uvIndices = new Array();\r\n this._indices = new Array() /*uint*/;\r\n this._byteData.position = this._offsetTris;\r\n for (i = 0; i < this._numTris; i++) {\r\n //collect vertex indices\r\n a = this._byteData.readUnsignedShort();\r\n b = this._byteData.readUnsignedShort();\r\n c = this._byteData.readUnsignedShort();\r\n //collect uv indices\r\n ta = this._byteData.readUnsignedShort();\r\n tb = this._byteData.readUnsignedShort();\r\n tc = this._byteData.readUnsignedShort();\r\n this.addIndex(a, ta);\r\n this.addIndex(b, tb);\r\n this.addIndex(c, tc);\r\n }\r\n var len = this._uvIndices.length;\r\n this._finalUV = new Array(len * 2);\r\n for (i = 0; i < len; ++i) {\r\n this._finalUV[i << 1] = this._uvs[this._uvIndices[i] << 1];\r\n this._finalUV[(i << 1) + 1] = this._uvs[(this._uvIndices[i] << 1) + 1];\r\n }\r\n this._parsedFaces = true;\r\n };\r\n /**\r\n * Adds a face index to the list if it doesn't exist yet, based on vertexIndex and uvIndex, and adds the\r\n * corresponding vertex and uv data in the correct location.\r\n * @param vertexIndex The original index in the vertex list.\r\n * @param uvIndex The original index in the uv list.\r\n */\r\n MD2Parser.prototype.addIndex = function (vertexIndex /*uint*/, uvIndex /*uint*/) {\r\n var index = this.findIndex(vertexIndex, uvIndex);\r\n if (index == -1) {\r\n this._indices.push(this._vertIndices.length);\r\n this._vertIndices.push(vertexIndex);\r\n this._uvIndices.push(uvIndex);\r\n }\r\n else\r\n this._indices.push(index);\r\n };\r\n /**\r\n * Finds the final index corresponding to the original MD2's vertex and uv indices. Returns -1 if it wasn't added yet.\r\n * @param vertexIndex The original index in the vertex list.\r\n * @param uvIndex The original index in the uv list.\r\n * @return The index of the final sprite corresponding to the original vertex and uv index. -1 if it doesn't exist yet.\r\n */\r\n MD2Parser.prototype.findIndex = function (vertexIndex /*uint*/, uvIndex /*uint*/) {\r\n var len = this._vertIndices.length;\r\n for (var i = 0; i < len; ++i) {\r\n if (this._vertIndices[i] == vertexIndex && this._uvIndices[i] == uvIndex)\r\n return i;\r\n }\r\n return -1;\r\n };\r\n /**\r\n * Parses all the frame elements.\r\n */\r\n MD2Parser.prototype.parseFrames = function () {\r\n var sx, sy, sz;\r\n var tx, ty, tz;\r\n var graphics;\r\n var elements;\r\n var vertLen = this._vertIndices.length;\r\n var fvertices;\r\n var tvertices;\r\n var i /*uint*/, j /*int*/, k /*uint*/;\r\n //var ch : number /*uint*/;\r\n var name = \"\";\r\n var prevClip = null;\r\n this._byteData.position = this._offsetFrames;\r\n for (i = 0; i < this._numFrames; i++) {\r\n tvertices = new Array();\r\n fvertices = new Array(vertLen * 3);\r\n sx = this._byteData.readFloat();\r\n sy = this._byteData.readFloat();\r\n sz = this._byteData.readFloat();\r\n tx = this._byteData.readFloat();\r\n ty = this._byteData.readFloat();\r\n tz = this._byteData.readFloat();\r\n name = this.readFrameName();\r\n // Note, the extra data.position++ in the for loop is there\r\n // to skip over a byte that holds the \"vertex normal index\"\r\n for (j = 0; j < this._numVertices; j++, this._byteData.position++)\r\n tvertices.push(sx * this._byteData.readUnsignedByte() + tx, sy * this._byteData.readUnsignedByte() + ty, sz * this._byteData.readUnsignedByte() + tz);\r\n k = 0;\r\n for (j = 0; j < vertLen; j++) {\r\n fvertices[k++] = tvertices[this._vertIndices[j] * 3];\r\n fvertices[k++] = tvertices[this._vertIndices[j] * 3 + 2];\r\n fvertices[k++] = tvertices[this._vertIndices[j] * 3 + 1];\r\n }\r\n elements = new TriangleElements(new AttributesBuffer());\r\n elements.setIndices(this._indices);\r\n elements.setPositions(fvertices);\r\n elements.setUVs(this._finalUV);\r\n // cause explicit updates\r\n elements.setNormals(null);\r\n elements.setTangents(null);\r\n // turn auto updates off because they may be animated and set explicitly\r\n elements.autoDeriveNormals = false;\r\n elements.autoDeriveTangents = false;\r\n if (this._firstElements == null)\r\n this._firstElements = elements;\r\n graphics = new Graphics();\r\n graphics.addShape(new Shape(elements));\r\n var clip = this._clipNodes[name];\r\n if (!clip) {\r\n // If another sequence was parsed before this one, starting\r\n // a new state means the previous one is complete and can\r\n // hence be finalized.\r\n if (prevClip) {\r\n this._pFinalizeAsset(prevClip);\r\n this._animationSet.addAnimation(prevClip);\r\n }\r\n clip = new VertexClipNode();\r\n clip.name = name;\r\n clip.stitchFinalFrame = true;\r\n this._clipNodes[name] = clip;\r\n prevClip = clip;\r\n }\r\n clip.addFrame(graphics, 1000 / MD2Parser.FPS);\r\n }\r\n // Finalize the last state\r\n if (prevClip) {\r\n this._pFinalizeAsset(prevClip);\r\n this._animationSet.addAnimation(prevClip);\r\n }\r\n // Force this._pFinalizeAsset() to decide name\r\n this._pFinalizeAsset(this._animationSet);\r\n this._parsedFrames = true;\r\n };\r\n MD2Parser.prototype.readFrameName = function () {\r\n var name = \"\";\r\n var k = 0;\r\n for (var j = 0; j < 16; j++) {\r\n var ch = this._byteData.readUnsignedByte();\r\n if (Math.floor(ch) > 0x39 && Math.floor(ch) <= 0x7A && k == 0)\r\n name += String.fromCharCode(ch);\r\n if (Math.floor(ch) >= 0x30 && Math.floor(ch) <= 0x39)\r\n k++;\r\n }\r\n return name;\r\n };\r\n return MD2Parser;\r\n}(ParserBase));\r\nexport { MD2Parser };\r\nMD2Parser.FPS = 6;\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/MD2Parser.js","import * as tslib_1 from \"tslib\";\r\nimport { Quaternion, Vector3D, URLLoaderDataFormat, ParserBase } from \"@awayjs/core\";\r\nimport { JointPose, SkeletonPose, SkeletonClipNode } from \"@awayjs/renderer\";\r\n/**\r\n * MD5AnimParser provides a parser for the md5anim data type, providing an animation sequence for the md5 format.\r\n *\r\n * todo: optimize\r\n */\r\nvar MD5AnimParser = (function (_super) {\r\n tslib_1.__extends(MD5AnimParser, _super);\r\n /**\r\n * Creates a new MD5AnimParser object.\r\n * @param uri The url or id of the data or file to be parsed.\r\n * @param extra The holder for extra contextual data that the parser might need.\r\n */\r\n function MD5AnimParser(additionalRotationAxis, additionalRotationRadians) {\r\n if (additionalRotationAxis === void 0) { additionalRotationAxis = null; }\r\n if (additionalRotationRadians === void 0) { additionalRotationRadians = 0; }\r\n var _this = _super.call(this, URLLoaderDataFormat.TEXT) || this;\r\n _this._parseIndex = 0;\r\n _this._line = 0;\r\n _this._charLineIndex = 0;\r\n _this._rotationQuat = new Quaternion();\r\n var t1 = new Quaternion();\r\n var t2 = new Quaternion();\r\n t1.fromAxisAngle(Vector3D.X_AXIS, -Math.PI * .5);\r\n t2.fromAxisAngle(Vector3D.Y_AXIS, -Math.PI * .5);\r\n _this._rotationQuat.multiply(t2, t1);\r\n if (additionalRotationAxis) {\r\n _this._rotationQuat.multiply(t2, t1);\r\n t1.fromAxisAngle(additionalRotationAxis, additionalRotationRadians);\r\n _this._rotationQuat.multiply(t1, _this._rotationQuat);\r\n }\r\n return _this;\r\n }\r\n /**\r\n * Indicates whether or not a given file extension is supported by the parser.\r\n * @param extension The file extension of a potential file to be parsed.\r\n * @return Whether or not the given file type is supported.\r\n */\r\n MD5AnimParser.supportsType = function (extension) {\r\n extension = extension.toLowerCase();\r\n return extension == \"md5anim\";\r\n };\r\n /**\r\n * Tests whether a data block can be parsed by the parser.\r\n * @param data The data block to potentially be parsed.\r\n * @return Whether or not the given data is supported.\r\n */\r\n MD5AnimParser.supportsData = function (data) {\r\n return false;\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n MD5AnimParser.prototype._pProceedParsing = function () {\r\n var token;\r\n if (!this._startedParsing) {\r\n this._textData = this._pGetTextData();\r\n this._startedParsing = true;\r\n }\r\n while (this._pHasTime()) {\r\n token = this.getNextToken();\r\n switch (token) {\r\n case MD5AnimParser.COMMENT_TOKEN:\r\n this.ignoreLine();\r\n break;\r\n case \"\":\r\n // can occur at the end of a file\r\n break;\r\n case MD5AnimParser.VERSION_TOKEN:\r\n this._version = this.getNextInt();\r\n if (this._version != 10)\r\n throw new Error(\"Unknown version number encountered!\");\r\n break;\r\n case MD5AnimParser.COMMAND_LINE_TOKEN:\r\n this.parseCMD();\r\n break;\r\n case MD5AnimParser.NUM_FRAMES_TOKEN:\r\n this._numFrames = this.getNextInt();\r\n this._bounds = new Array();\r\n this._frameData = new Array();\r\n break;\r\n case MD5AnimParser.NUM_JOINTS_TOKEN:\r\n this._numJoints = this.getNextInt();\r\n this._hierarchy = new Array(this._numJoints);\r\n this._baseFrameData = new Array(this._numJoints);\r\n break;\r\n case MD5AnimParser.FRAME_RATE_TOKEN:\r\n this._frameRate = this.getNextInt();\r\n break;\r\n case MD5AnimParser.NUM_ANIMATED_COMPONENTS_TOKEN:\r\n this._numAnimatedComponents = this.getNextInt();\r\n break;\r\n case MD5AnimParser.HIERARCHY_TOKEN:\r\n this.parseHierarchy();\r\n break;\r\n case MD5AnimParser.BOUNDS_TOKEN:\r\n this.parseBounds();\r\n break;\r\n case MD5AnimParser.BASE_FRAME_TOKEN:\r\n this.parseBaseFrame();\r\n break;\r\n case MD5AnimParser.FRAME_TOKEN:\r\n this.parseFrame();\r\n break;\r\n default:\r\n if (!this._reachedEOF)\r\n this.sendUnknownKeywordError();\r\n }\r\n if (this._reachedEOF) {\r\n this._clip = new SkeletonClipNode();\r\n this.translateClip();\r\n this._pFinalizeAsset(this._clip);\r\n return ParserBase.PARSING_DONE;\r\n }\r\n }\r\n return ParserBase.MORE_TO_PARSE;\r\n };\r\n /**\r\n * Converts all key frame data to an SkinnedAnimationSequence.\r\n */\r\n MD5AnimParser.prototype.translateClip = function () {\r\n for (var i = 0; i < this._numFrames; ++i)\r\n this._clip.addFrame(this.translatePose(this._frameData[i]), 1000 / this._frameRate);\r\n };\r\n /**\r\n * Converts a single key frame data to a SkeletonPose.\r\n * @param frameData The actual frame data.\r\n * @return A SkeletonPose containing the frame data's pose.\r\n */\r\n MD5AnimParser.prototype.translatePose = function (frameData) {\r\n var hierarchy;\r\n var pose;\r\n var base;\r\n var flags /*int*/;\r\n var j /*int*/;\r\n var translate = new Vector3D();\r\n var orientation = new Quaternion();\r\n var components = frameData.components;\r\n var skelPose = new SkeletonPose();\r\n var jointPoses = skelPose.jointPoses;\r\n for (var i = 0; i < this._numJoints; ++i) {\r\n j = 0;\r\n pose = new JointPose();\r\n hierarchy = this._hierarchy[i];\r\n base = this._baseFrameData[i];\r\n flags = hierarchy.flags;\r\n translate.x = base.position.x;\r\n translate.y = base.position.y;\r\n translate.z = base.position.z;\r\n orientation.x = base.orientation.x;\r\n orientation.y = base.orientation.y;\r\n orientation.z = base.orientation.z;\r\n if (flags & 1)\r\n translate.x = components[hierarchy.startIndex + (j++)];\r\n if (flags & 2)\r\n translate.y = components[hierarchy.startIndex + (j++)];\r\n if (flags & 4)\r\n translate.z = components[hierarchy.startIndex + (j++)];\r\n if (flags & 8)\r\n orientation.x = components[hierarchy.startIndex + (j++)];\r\n if (flags & 16)\r\n orientation.y = components[hierarchy.startIndex + (j++)];\r\n if (flags & 32)\r\n orientation.z = components[hierarchy.startIndex + (j++)];\r\n var w = 1 - orientation.x * orientation.x - orientation.y * orientation.y - orientation.z * orientation.z;\r\n orientation.w = w < 0 ? 0 : -Math.sqrt(w);\r\n if (hierarchy.parentIndex < 0) {\r\n pose.orientation.multiply(this._rotationQuat, orientation);\r\n pose.translation = this._rotationQuat.rotatePoint(translate);\r\n }\r\n else {\r\n pose.orientation.copyFrom(orientation);\r\n pose.translation.x = translate.x;\r\n pose.translation.y = translate.y;\r\n pose.translation.z = translate.z;\r\n }\r\n pose.orientation.y = -pose.orientation.y;\r\n pose.orientation.z = -pose.orientation.z;\r\n pose.translation.x = -pose.translation.x;\r\n jointPoses[i] = pose;\r\n }\r\n return skelPose;\r\n };\r\n /**\r\n * Parses the skeleton's hierarchy data.\r\n */\r\n MD5AnimParser.prototype.parseHierarchy = function () {\r\n var ch;\r\n var data;\r\n var token = this.getNextToken();\r\n var i = 0;\r\n if (token != \"{\")\r\n this.sendUnknownKeywordError();\r\n do {\r\n if (this._reachedEOF)\r\n this.sendEOFError();\r\n data = new HierarchyData();\r\n data.name = this.parseLiteralstring();\r\n data.parentIndex = this.getNextInt();\r\n data.flags = this.getNextInt();\r\n data.startIndex = this.getNextInt();\r\n this._hierarchy[i++] = data;\r\n ch = this.getNextChar();\r\n if (ch == \"/\") {\r\n this.putBack();\r\n ch = this.getNextToken();\r\n if (ch == MD5AnimParser.COMMENT_TOKEN)\r\n this.ignoreLine();\r\n ch = this.getNextChar();\r\n }\r\n if (ch != \"}\")\r\n this.putBack();\r\n } while (ch != \"}\");\r\n };\r\n /**\r\n * Parses frame bounds.\r\n */\r\n MD5AnimParser.prototype.parseBounds = function () {\r\n var ch;\r\n var data;\r\n var token = this.getNextToken();\r\n var i = 0;\r\n if (token != \"{\")\r\n this.sendUnknownKeywordError();\r\n do {\r\n if (this._reachedEOF)\r\n this.sendEOFError();\r\n data = new BoundsData();\r\n data.min = this.parseVector3D();\r\n data.max = this.parseVector3D();\r\n this._bounds[i++] = data;\r\n ch = this.getNextChar();\r\n if (ch == \"/\") {\r\n this.putBack();\r\n ch = this.getNextToken();\r\n if (ch == MD5AnimParser.COMMENT_TOKEN)\r\n this.ignoreLine();\r\n ch = this.getNextChar();\r\n }\r\n if (ch != \"}\")\r\n this.putBack();\r\n } while (ch != \"}\");\r\n };\r\n /**\r\n * Parses the base frame.\r\n */\r\n MD5AnimParser.prototype.parseBaseFrame = function () {\r\n var ch;\r\n var data;\r\n var token = this.getNextToken();\r\n var i = 0;\r\n if (token != \"{\")\r\n this.sendUnknownKeywordError();\r\n do {\r\n if (this._reachedEOF)\r\n this.sendEOFError();\r\n data = new BaseFrameData();\r\n data.position = this.parseVector3D();\r\n data.orientation = this.parseQuaternion();\r\n this._baseFrameData[i++] = data;\r\n ch = this.getNextChar();\r\n if (ch == \"/\") {\r\n this.putBack();\r\n ch = this.getNextToken();\r\n if (ch == MD5AnimParser.COMMENT_TOKEN)\r\n this.ignoreLine();\r\n ch = this.getNextChar();\r\n }\r\n if (ch != \"}\")\r\n this.putBack();\r\n } while (ch != \"}\");\r\n };\r\n /**\r\n * Parses a single frame.\r\n */\r\n MD5AnimParser.prototype.parseFrame = function () {\r\n var ch;\r\n var data;\r\n var token;\r\n var frameIndex /*int*/;\r\n frameIndex = this.getNextInt();\r\n token = this.getNextToken();\r\n if (token != \"{\")\r\n this.sendUnknownKeywordError();\r\n do {\r\n if (this._reachedEOF)\r\n this.sendEOFError();\r\n data = new FrameData();\r\n data.components = new Array(this._numAnimatedComponents);\r\n for (var i = 0; i < this._numAnimatedComponents; ++i)\r\n data.components[i] = this.getNextNumber();\r\n this._frameData[frameIndex] = data;\r\n ch = this.getNextChar();\r\n if (ch == \"/\") {\r\n this.putBack();\r\n ch = this.getNextToken();\r\n if (ch == MD5AnimParser.COMMENT_TOKEN)\r\n this.ignoreLine();\r\n ch = this.getNextChar();\r\n }\r\n if (ch != \"}\")\r\n this.putBack();\r\n } while (ch != \"}\");\r\n };\r\n /**\r\n * Puts back the last read character into the data stream.\r\n */\r\n MD5AnimParser.prototype.putBack = function () {\r\n this._parseIndex--;\r\n this._charLineIndex--;\r\n this._reachedEOF = this._parseIndex >= this._textData.length;\r\n };\r\n /**\r\n * Gets the next token in the data stream.\r\n */\r\n MD5AnimParser.prototype.getNextToken = function () {\r\n var ch;\r\n var token = \"\";\r\n while (!this._reachedEOF) {\r\n ch = this.getNextChar();\r\n if (ch == \" \" || ch == \"\\r\" || ch == \"\\n\" || ch == \"\\t\") {\r\n if (token != MD5AnimParser.COMMENT_TOKEN)\r\n this.skipWhiteSpace();\r\n if (token != \"\")\r\n return token;\r\n }\r\n else\r\n token += ch;\r\n if (token == MD5AnimParser.COMMENT_TOKEN)\r\n return token;\r\n }\r\n return token;\r\n };\r\n /**\r\n * Skips all whitespace in the data stream.\r\n */\r\n MD5AnimParser.prototype.skipWhiteSpace = function () {\r\n var ch;\r\n do\r\n ch = this.getNextChar();\r\n while (ch == \"\\n\" || ch == \" \" || ch == \"\\r\" || ch == \"\\t\");\r\n this.putBack();\r\n };\r\n /**\r\n * Skips to the next line.\r\n */\r\n MD5AnimParser.prototype.ignoreLine = function () {\r\n var ch;\r\n while (!this._reachedEOF && ch != \"\\n\")\r\n ch = this.getNextChar();\r\n };\r\n /**\r\n * Retrieves the next single character in the data stream.\r\n */\r\n MD5AnimParser.prototype.getNextChar = function () {\r\n var ch = this._textData.charAt(this._parseIndex++);\r\n if (ch == \"\\n\") {\r\n ++this._line;\r\n this._charLineIndex = 0;\r\n }\r\n else if (ch != \"\\r\")\r\n ++this._charLineIndex;\r\n if (this._parseIndex == this._textData.length)\r\n this._reachedEOF = true;\r\n return ch;\r\n };\r\n /**\r\n * Retrieves the next integer in the data stream.\r\n */\r\n MD5AnimParser.prototype.getNextInt = function () {\r\n var i = parseInt(this.getNextToken());\r\n if (isNaN(i))\r\n this.sendParseError(\"int type\");\r\n return i;\r\n };\r\n /**\r\n * Retrieves the next floating point number in the data stream.\r\n */\r\n MD5AnimParser.prototype.getNextNumber = function () {\r\n var f = parseFloat(this.getNextToken());\r\n if (isNaN(f))\r\n this.sendParseError(\"float type\");\r\n return f;\r\n };\r\n /**\r\n * Retrieves the next 3d vector in the data stream.\r\n */\r\n MD5AnimParser.prototype.parseVector3D = function () {\r\n var vec = new Vector3D();\r\n var ch = this.getNextToken();\r\n if (ch != \"(\")\r\n this.sendParseError(\"(\");\r\n vec.x = this.getNextNumber();\r\n vec.y = this.getNextNumber();\r\n vec.z = this.getNextNumber();\r\n if (this.getNextToken() != \")\")\r\n this.sendParseError(\")\");\r\n return vec;\r\n };\r\n /**\r\n * Retrieves the next quaternion in the data stream.\r\n */\r\n MD5AnimParser.prototype.parseQuaternion = function () {\r\n var quat = new Quaternion();\r\n var ch = this.getNextToken();\r\n if (ch != \"(\")\r\n this.sendParseError(\"(\");\r\n quat.x = this.getNextNumber();\r\n quat.y = this.getNextNumber();\r\n quat.z = this.getNextNumber();\r\n // quat supposed to be unit length\r\n var t = 1 - (quat.x * quat.x) - (quat.y * quat.y) - (quat.z * quat.z);\r\n quat.w = t < 0 ? 0 : -Math.sqrt(t);\r\n if (this.getNextToken() != \")\")\r\n this.sendParseError(\")\");\r\n return quat;\r\n };\r\n /**\r\n * Parses the command line data.\r\n */\r\n MD5AnimParser.prototype.parseCMD = function () {\r\n // just ignore the command line property\r\n this.parseLiteralstring();\r\n };\r\n /**\r\n * Retrieves the next literal string in the data stream. A literal string is a sequence of characters bounded\r\n * by double quotes.\r\n */\r\n MD5AnimParser.prototype.parseLiteralstring = function () {\r\n this.skipWhiteSpace();\r\n var ch = this.getNextChar();\r\n var str = \"\";\r\n if (ch != \"\\\"\")\r\n this.sendParseError(\"\\\"\");\r\n do {\r\n if (this._reachedEOF)\r\n this.sendEOFError();\r\n ch = this.getNextChar();\r\n if (ch != \"\\\"\")\r\n str += ch;\r\n } while (ch != \"\\\"\");\r\n return str;\r\n };\r\n /**\r\n * Throws an end-of-file error when a premature end of file was encountered.\r\n */\r\n MD5AnimParser.prototype.sendEOFError = function () {\r\n throw new Error(\"Unexpected end of file\");\r\n };\r\n /**\r\n * Throws an error when an unexpected token was encountered.\r\n * @param expected The token type that was actually expected.\r\n */\r\n MD5AnimParser.prototype.sendParseError = function (expected) {\r\n throw new Error(\"Unexpected token at line \" + (this._line + 1) + \", character \" + this._charLineIndex + \". \" + expected + \" expected, but \" + this._textData.charAt(this._parseIndex - 1) + \" encountered\");\r\n };\r\n /**\r\n * Throws an error when an unknown keyword was encountered.\r\n */\r\n MD5AnimParser.prototype.sendUnknownKeywordError = function () {\r\n throw new Error(\"Unknown keyword at line \" + (this._line + 1) + \", character \" + this._charLineIndex + \". \");\r\n };\r\n return MD5AnimParser;\r\n}(ParserBase));\r\nexport { MD5AnimParser };\r\nMD5AnimParser.VERSION_TOKEN = \"MD5Version\";\r\nMD5AnimParser.COMMAND_LINE_TOKEN = \"commandline\";\r\nMD5AnimParser.NUM_FRAMES_TOKEN = \"numFrames\";\r\nMD5AnimParser.NUM_JOINTS_TOKEN = \"numJoints\";\r\nMD5AnimParser.FRAME_RATE_TOKEN = \"frameRate\";\r\nMD5AnimParser.NUM_ANIMATED_COMPONENTS_TOKEN = \"numAnimatedComponents\";\r\nMD5AnimParser.HIERARCHY_TOKEN = \"hierarchy\";\r\nMD5AnimParser.BOUNDS_TOKEN = \"bounds\";\r\nMD5AnimParser.BASE_FRAME_TOKEN = \"baseframe\";\r\nMD5AnimParser.FRAME_TOKEN = \"frame\";\r\nMD5AnimParser.COMMENT_TOKEN = \"//\";\r\n/**\r\n *\r\n */\r\nvar BaseFrameData = (function () {\r\n function BaseFrameData() {\r\n }\r\n return BaseFrameData;\r\n}());\r\nexport { BaseFrameData };\r\n/**\r\n *\r\n */\r\nvar BoundsData = (function () {\r\n function BoundsData() {\r\n }\r\n return BoundsData;\r\n}());\r\nexport { BoundsData };\r\n/**\r\n *\r\n */\r\nvar FrameData = (function () {\r\n function FrameData() {\r\n }\r\n return FrameData;\r\n}());\r\nexport { FrameData };\r\n/**\r\n *\r\n */\r\nvar HierarchyData = (function () {\r\n function HierarchyData() {\r\n }\r\n return HierarchyData;\r\n}());\r\nexport { HierarchyData };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/MD5AnimParser.js","import * as tslib_1 from \"tslib\";\r\nimport { AttributesBuffer, Quaternion, Vector3D, URLLoaderDataFormat, ParserBase } from \"@awayjs/core\";\r\nimport { Shape, TriangleElements } from \"@awayjs/graphics\";\r\nimport { DisplayObjectContainer, Sprite } from \"@awayjs/scene\";\r\nimport { SkeletonAnimationSet, Skeleton, SkeletonJoint } from \"@awayjs/renderer\";\r\n// todo: create animation system, parse skeleton\r\n/**\r\n * MD5MeshParser provides a parser for the md5mesh data type, providing the graphics of the md5 format.\r\n *\r\n * todo: optimize\r\n */\r\nvar MD5MeshParser = (function (_super) {\r\n tslib_1.__extends(MD5MeshParser, _super);\r\n /**\r\n * Creates a new MD5MeshParser object.\r\n */\r\n function MD5MeshParser(additionalRotationAxis, additionalRotationRadians) {\r\n if (additionalRotationAxis === void 0) { additionalRotationAxis = null; }\r\n if (additionalRotationRadians === void 0) { additionalRotationRadians = 0; }\r\n var _this = _super.call(this, URLLoaderDataFormat.TEXT) || this;\r\n _this._parseIndex = 0;\r\n _this._line = 0;\r\n _this._charLineIndex = 0;\r\n _this._rotationQuat = new Quaternion();\r\n _this._rotationQuat.fromAxisAngle(Vector3D.X_AXIS, -Math.PI * .5);\r\n if (additionalRotationAxis) {\r\n var quat = new Quaternion();\r\n quat.fromAxisAngle(additionalRotationAxis, additionalRotationRadians);\r\n _this._rotationQuat.multiply(_this._rotationQuat, quat);\r\n }\r\n return _this;\r\n }\r\n /**\r\n * Indicates whether or not a given file extension is supported by the parser.\r\n * @param extension The file extension of a potential file to be parsed.\r\n * @return Whether or not the given file type is supported.\r\n */\r\n MD5MeshParser.supportsType = function (extension) {\r\n extension = extension.toLowerCase();\r\n return extension == \"md5sprite\";\r\n };\r\n /**\r\n * Tests whether a data block can be parsed by the parser.\r\n * @param data The data block to potentially be parsed.\r\n * @return Whether or not the given data is supported.\r\n */\r\n MD5MeshParser.supportsData = function (data) {\r\n return false;\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n MD5MeshParser.prototype._pProceedParsing = function () {\r\n var token;\r\n if (!this._startedParsing) {\r\n this._textData = this._pGetTextData();\r\n this._startedParsing = true;\r\n }\r\n while (this._pHasTime()) {\r\n token = this.getNextToken();\r\n switch (token) {\r\n case MD5MeshParser.COMMENT_TOKEN:\r\n this.ignoreLine();\r\n break;\r\n case MD5MeshParser.VERSION_TOKEN:\r\n this._version = this.getNextInt();\r\n if (this._version != 10)\r\n throw new Error(\"Unknown version number encountered!\");\r\n break;\r\n case MD5MeshParser.COMMAND_LINE_TOKEN:\r\n this.parseCMD();\r\n break;\r\n case MD5MeshParser.NUM_JOINTS_TOKEN:\r\n this._numJoints = this.getNextInt();\r\n this._bindPoses = new Array(this._numJoints);\r\n break;\r\n case MD5MeshParser.NUM_MESHES_TOKEN:\r\n this._numMeshes = this.getNextInt();\r\n break;\r\n case MD5MeshParser.JOINTS_TOKEN:\r\n this.parseJoints();\r\n break;\r\n case MD5MeshParser.MESH_TOKEN:\r\n this.parseMesh();\r\n break;\r\n default:\r\n if (!this._reachedEOF)\r\n this.sendUnknownKeywordError();\r\n }\r\n if (this._reachedEOF) {\r\n this.calculateMaxJointCount();\r\n this._animationSet = new SkeletonAnimationSet(this._maxJointCount);\r\n this._sprite = new Sprite();\r\n this._graphics = this._sprite.graphics;\r\n for (var i = 0; i < this._elementsData.length; ++i)\r\n this._graphics.addShape(new Shape(this.translateElements(this._elementsData[i].positionData, this._elementsData[i].weightData, this._elementsData[i].indices)));\r\n //_graphics.animation = _animation;\r\n //\t\t\t\t\t_sprite.animationController = _animationController;\r\n //add to the content property\r\n this._pContent.addChild(this._sprite);\r\n this._pFinalizeAsset(this._graphics);\r\n this._pFinalizeAsset(this._sprite);\r\n this._pFinalizeAsset(this._skeleton);\r\n this._pFinalizeAsset(this._animationSet);\r\n return ParserBase.PARSING_DONE;\r\n }\r\n }\r\n return ParserBase.MORE_TO_PARSE;\r\n };\r\n MD5MeshParser.prototype._pStartParsing = function (frameLimit) {\r\n //create a content object for Loaders\r\n this._pContent = new DisplayObjectContainer();\r\n _super.prototype._pStartParsing.call(this, frameLimit);\r\n };\r\n MD5MeshParser.prototype.calculateMaxJointCount = function () {\r\n this._maxJointCount = 0;\r\n var numElementsData = this._elementsData.length;\r\n for (var i = 0; i < numElementsData; ++i) {\r\n var elementsData = this._elementsData[i];\r\n var positionData = elementsData.positionData;\r\n var numVerts = positionData.length;\r\n for (var j = 0; j < numVerts; ++j) {\r\n var zeroWeights = this.countZeroWeightJoints(positionData[j], elementsData.weightData);\r\n var totalJoints = positionData[j].countWeight - zeroWeights;\r\n if (totalJoints > this._maxJointCount)\r\n this._maxJointCount = totalJoints;\r\n }\r\n }\r\n };\r\n MD5MeshParser.prototype.countZeroWeightJoints = function (position, weights) {\r\n var start = position.startWeight;\r\n var end = position.startWeight + position.countWeight;\r\n var count = 0;\r\n var weight;\r\n for (var i = start; i < end; ++i) {\r\n weight = weights[i].bias;\r\n if (weight == 0)\r\n ++count;\r\n }\r\n return count;\r\n };\r\n /**\r\n * Parses the skeleton's joints.\r\n */\r\n MD5MeshParser.prototype.parseJoints = function () {\r\n var ch;\r\n var joint;\r\n var pos;\r\n var quat;\r\n var i = 0;\r\n var token = this.getNextToken();\r\n if (token != \"{\")\r\n this.sendUnknownKeywordError();\r\n this._skeleton = new Skeleton();\r\n do {\r\n if (this._reachedEOF)\r\n this.sendEOFError();\r\n joint = new SkeletonJoint();\r\n joint.name = this.parseLiteralstring();\r\n joint.parentIndex = this.getNextInt();\r\n pos = this.parseVector3D();\r\n pos = this._rotationQuat.rotatePoint(pos);\r\n quat = this.parseQuaternion();\r\n // todo: check if this is correct, or maybe we want to actually store it as quats?\r\n this._bindPoses[i] = quat.toMatrix3D();\r\n this._bindPoses[i].appendTranslation(pos.x, pos.y, pos.z);\r\n var inv = this._bindPoses[i].clone();\r\n inv.invert();\r\n joint.inverseBindPose = inv._rawData;\r\n this._skeleton.joints[i++] = joint;\r\n ch = this.getNextChar();\r\n if (ch == \"/\") {\r\n this.putBack();\r\n ch = this.getNextToken();\r\n if (ch == MD5MeshParser.COMMENT_TOKEN)\r\n this.ignoreLine();\r\n ch = this.getNextChar();\r\n }\r\n if (ch != \"}\")\r\n this.putBack();\r\n } while (ch != \"}\");\r\n };\r\n /**\r\n * Puts back the last read character into the data stream.\r\n */\r\n MD5MeshParser.prototype.putBack = function () {\r\n this._parseIndex--;\r\n this._charLineIndex--;\r\n this._reachedEOF = this._parseIndex >= this._textData.length;\r\n };\r\n /**\r\n * Parses the mesh graphics.\r\n */\r\n MD5MeshParser.prototype.parseMesh = function () {\r\n var token = this.getNextToken();\r\n var ch;\r\n var positionData;\r\n var weights;\r\n var indices /*uint*/;\r\n if (token != \"{\")\r\n this.sendUnknownKeywordError();\r\n if (this._shaders == null)\r\n this._shaders = new Array();\r\n while (ch != \"}\") {\r\n ch = this.getNextToken();\r\n switch (ch) {\r\n case MD5MeshParser.COMMENT_TOKEN:\r\n this.ignoreLine();\r\n break;\r\n case MD5MeshParser.MESH_SHADER_TOKEN:\r\n this._shaders.push(this.parseLiteralstring());\r\n break;\r\n case MD5MeshParser.MESH_NUM_VERTS_TOKEN:\r\n positionData = new Array(this.getNextInt());\r\n break;\r\n case MD5MeshParser.MESH_NUM_TRIS_TOKEN:\r\n indices = new Array(this.getNextInt() * 3) /*uint*/;\r\n break;\r\n case MD5MeshParser.MESH_NUM_WEIGHTS_TOKEN:\r\n weights = new Array(this.getNextInt());\r\n break;\r\n case MD5MeshParser.MESH_VERT_TOKEN:\r\n this.parseVertex(positionData);\r\n break;\r\n case MD5MeshParser.MESH_TRI_TOKEN:\r\n this.parseTri(indices);\r\n break;\r\n case MD5MeshParser.MESH_WEIGHT_TOKEN:\r\n this.parseJoint(weights);\r\n break;\r\n }\r\n }\r\n if (this._elementsData == null)\r\n this._elementsData = new Array();\r\n var i = this._elementsData.length;\r\n this._elementsData[i] = new ElementsData();\r\n this._elementsData[i].positionData = positionData;\r\n this._elementsData[i].weightData = weights;\r\n this._elementsData[i].indices = indices;\r\n };\r\n /**\r\n * Converts the sprite data to a SkinnedSub instance.\r\n * @param positionData The sprite's positions.\r\n * @param weights The joint weights per position.\r\n * @param indices The indices for the faces.\r\n * @return A TriangleElements instance containing all elements data for the current sprite.\r\n */\r\n MD5MeshParser.prototype.translateElements = function (positionData, weights, indices /*uint*/) {\r\n var len = positionData.length;\r\n var v1 /*int*/, v2 /*int*/, v3 /*int*/;\r\n var position;\r\n var weight;\r\n var bindPose;\r\n var pos;\r\n var elements = new TriangleElements(new AttributesBuffer());\r\n var uvs = new Array(len * 2);\r\n var positions = new Array(len * 3);\r\n var jointIndices = new Array(len * this._maxJointCount);\r\n var jointWeights = new Array(len * this._maxJointCount);\r\n var l = 0;\r\n var nonZeroWeights /*int*/;\r\n for (var i = 0; i < len; ++i) {\r\n position = positionData[i];\r\n v1 = position.index * 3;\r\n v2 = v1 + 1;\r\n v3 = v1 + 2;\r\n positions[v1] = positions[v2] = positions[v3] = 0;\r\n nonZeroWeights = 0;\r\n for (var j = 0; j < position.countWeight; ++j) {\r\n weight = weights[position.startWeight + j];\r\n if (weight.bias > 0) {\r\n bindPose = this._bindPoses[weight.joint];\r\n pos = bindPose.transformVector(weight.pos);\r\n positions[v1] += pos.x * weight.bias;\r\n positions[v2] += pos.y * weight.bias;\r\n positions[v3] += pos.z * weight.bias;\r\n // indices need to be multiplied by 3 (amount of matrix registers)\r\n jointIndices[l] = weight.joint * 3;\r\n jointWeights[l++] = weight.bias;\r\n ++nonZeroWeights;\r\n }\r\n }\r\n for (j = nonZeroWeights; j < this._maxJointCount; ++j) {\r\n jointIndices[l] = 0;\r\n jointWeights[l++] = 0;\r\n }\r\n v1 = position.index << 1;\r\n uvs[v1++] = position.s;\r\n uvs[v1] = position.t;\r\n }\r\n elements.jointsPerVertex = this._maxJointCount;\r\n elements.setIndices(indices);\r\n elements.setPositions(positions);\r\n elements.setUVs(uvs);\r\n elements.setJointIndices(jointIndices);\r\n elements.setJointWeights(jointWeights);\r\n // cause explicit updates\r\n elements.setNormals(null);\r\n elements.setTangents(null);\r\n // turn auto updates off because they may be animated and set explicitly\r\n elements.autoDeriveTangents = false;\r\n elements.autoDeriveNormals = false;\r\n return elements;\r\n };\r\n /**\r\n * Retrieve the next triplet of position indices that form a face.\r\n * @param indices The index list in which to store the read data.\r\n */\r\n MD5MeshParser.prototype.parseTri = function (indices /*uint*/) {\r\n var index = this.getNextInt() * 3;\r\n indices[index] = this.getNextInt();\r\n indices[index + 1] = this.getNextInt();\r\n indices[index + 2] = this.getNextInt();\r\n };\r\n /**\r\n * Reads a new joint data set for a single joint.\r\n * @param weights the target list to contain the weight data.\r\n */\r\n MD5MeshParser.prototype.parseJoint = function (weights) {\r\n var weight = new JointData();\r\n weight.index = this.getNextInt();\r\n weight.joint = this.getNextInt();\r\n weight.bias = this.getNextNumber();\r\n weight.pos = this.parseVector3D();\r\n weights[weight.index] = weight;\r\n };\r\n /**\r\n * Reads the data for a single position.\r\n * @param positionData The list to contain the position data.\r\n */\r\n MD5MeshParser.prototype.parseVertex = function (positionData) {\r\n var position = new PositionData();\r\n position.index = this.getNextInt();\r\n this.parseUV(position);\r\n position.startWeight = this.getNextInt();\r\n position.countWeight = this.getNextInt();\r\n //\t\t\tif (position.countWeight > _maxJointCount) _maxJointCount = position.countWeight;\r\n positionData[position.index] = position;\r\n };\r\n /**\r\n * Reads the next uv coordinate.\r\n * @param positionData The positionData to contain the UV coordinates.\r\n */\r\n MD5MeshParser.prototype.parseUV = function (positionData) {\r\n var ch = this.getNextToken();\r\n if (ch != \"(\")\r\n this.sendParseError(\"(\");\r\n positionData.s = this.getNextNumber();\r\n positionData.t = this.getNextNumber();\r\n if (this.getNextToken() != \")\")\r\n this.sendParseError(\")\");\r\n };\r\n /**\r\n * Gets the next token in the data stream.\r\n */\r\n MD5MeshParser.prototype.getNextToken = function () {\r\n var ch;\r\n var token = \"\";\r\n while (!this._reachedEOF) {\r\n ch = this.getNextChar();\r\n if (ch == \" \" || ch == \"\\r\" || ch == \"\\n\" || ch == \"\\t\") {\r\n if (token != MD5MeshParser.COMMENT_TOKEN)\r\n this.skipWhiteSpace();\r\n if (token != \"\")\r\n return token;\r\n }\r\n else\r\n token += ch;\r\n if (token == MD5MeshParser.COMMENT_TOKEN)\r\n return token;\r\n }\r\n return token;\r\n };\r\n /**\r\n * Skips all whitespace in the data stream.\r\n */\r\n MD5MeshParser.prototype.skipWhiteSpace = function () {\r\n var ch;\r\n do\r\n ch = this.getNextChar();\r\n while (ch == \"\\n\" || ch == \" \" || ch == \"\\r\" || ch == \"\\t\");\r\n this.putBack();\r\n };\r\n /**\r\n * Skips to the next line.\r\n */\r\n MD5MeshParser.prototype.ignoreLine = function () {\r\n var ch;\r\n while (!this._reachedEOF && ch != \"\\n\")\r\n ch = this.getNextChar();\r\n };\r\n /**\r\n * Retrieves the next single character in the data stream.\r\n */\r\n MD5MeshParser.prototype.getNextChar = function () {\r\n var ch = this._textData.charAt(this._parseIndex++);\r\n if (ch == \"\\n\") {\r\n ++this._line;\r\n this._charLineIndex = 0;\r\n }\r\n else if (ch != \"\\r\")\r\n ++this._charLineIndex;\r\n if (this._parseIndex >= this._textData.length)\r\n this._reachedEOF = true;\r\n return ch;\r\n };\r\n /**\r\n * Retrieves the next integer in the data stream.\r\n */\r\n MD5MeshParser.prototype.getNextInt = function () {\r\n var i = parseInt(this.getNextToken());\r\n if (isNaN(i))\r\n this.sendParseError(\"int type\");\r\n return i;\r\n };\r\n /**\r\n * Retrieves the next floating point number in the data stream.\r\n */\r\n MD5MeshParser.prototype.getNextNumber = function () {\r\n var f = parseFloat(this.getNextToken());\r\n if (isNaN(f))\r\n this.sendParseError(\"float type\");\r\n return f;\r\n };\r\n /**\r\n * Retrieves the next 3d vector in the data stream.\r\n */\r\n MD5MeshParser.prototype.parseVector3D = function () {\r\n var vec = new Vector3D();\r\n var ch = this.getNextToken();\r\n if (ch != \"(\")\r\n this.sendParseError(\"(\");\r\n vec.x = -this.getNextNumber();\r\n vec.y = this.getNextNumber();\r\n vec.z = this.getNextNumber();\r\n if (this.getNextToken() != \")\")\r\n this.sendParseError(\")\");\r\n return vec;\r\n };\r\n /**\r\n * Retrieves the next quaternion in the data stream.\r\n */\r\n MD5MeshParser.prototype.parseQuaternion = function () {\r\n var quat = new Quaternion();\r\n var ch = this.getNextToken();\r\n if (ch != \"(\")\r\n this.sendParseError(\"(\");\r\n quat.x = this.getNextNumber();\r\n quat.y = -this.getNextNumber();\r\n quat.z = -this.getNextNumber();\r\n // quat supposed to be unit length\r\n var t = 1 - quat.x * quat.x - quat.y * quat.y - quat.z * quat.z;\r\n quat.w = t < 0 ? 0 : -Math.sqrt(t);\r\n if (this.getNextToken() != \")\")\r\n this.sendParseError(\")\");\r\n var rotQuat = new Quaternion();\r\n rotQuat.multiply(this._rotationQuat, quat);\r\n return rotQuat;\r\n };\r\n /**\r\n * Parses the command line data.\r\n */\r\n MD5MeshParser.prototype.parseCMD = function () {\r\n // just ignore the command line property\r\n this.parseLiteralstring();\r\n };\r\n /**\r\n * Retrieves the next literal string in the data stream. A literal string is a sequence of characters bounded\r\n * by double quotes.\r\n */\r\n MD5MeshParser.prototype.parseLiteralstring = function () {\r\n this.skipWhiteSpace();\r\n var ch = this.getNextChar();\r\n var str = \"\";\r\n if (ch != \"\\\"\")\r\n this.sendParseError(\"\\\"\");\r\n do {\r\n if (this._reachedEOF)\r\n this.sendEOFError();\r\n ch = this.getNextChar();\r\n if (ch != \"\\\"\")\r\n str += ch;\r\n } while (ch != \"\\\"\");\r\n return str;\r\n };\r\n /**\r\n * Throws an end-of-file error when a premature end of file was encountered.\r\n */\r\n MD5MeshParser.prototype.sendEOFError = function () {\r\n throw new Error(\"Unexpected end of file\");\r\n };\r\n /**\r\n * Throws an error when an unexpected token was encountered.\r\n * @param expected The token type that was actually expected.\r\n */\r\n MD5MeshParser.prototype.sendParseError = function (expected) {\r\n throw new Error(\"Unexpected token at line \" + (this._line + 1) + \", character \" + this._charLineIndex + \". \" + expected + \" expected, but \" + this._textData.charAt(this._parseIndex - 1) + \" encountered\");\r\n };\r\n /**\r\n * Throws an error when an unknown keyword was encountered.\r\n */\r\n MD5MeshParser.prototype.sendUnknownKeywordError = function () {\r\n throw new Error(\"Unknown keyword at line \" + (this._line + 1) + \", character \" + this._charLineIndex + \". \");\r\n };\r\n return MD5MeshParser;\r\n}(ParserBase));\r\nexport { MD5MeshParser };\r\nMD5MeshParser.VERSION_TOKEN = \"MD5Version\";\r\nMD5MeshParser.COMMAND_LINE_TOKEN = \"commandline\";\r\nMD5MeshParser.NUM_JOINTS_TOKEN = \"numJoints\";\r\nMD5MeshParser.NUM_MESHES_TOKEN = \"numMeshes\";\r\nMD5MeshParser.COMMENT_TOKEN = \"//\";\r\nMD5MeshParser.JOINTS_TOKEN = \"joints\";\r\nMD5MeshParser.MESH_TOKEN = \"mesh\";\r\nMD5MeshParser.MESH_SHADER_TOKEN = \"shader\";\r\nMD5MeshParser.MESH_NUM_VERTS_TOKEN = \"numverts\";\r\nMD5MeshParser.MESH_VERT_TOKEN = \"vert\";\r\nMD5MeshParser.MESH_NUM_TRIS_TOKEN = \"numtris\";\r\nMD5MeshParser.MESH_TRI_TOKEN = \"tri\";\r\nMD5MeshParser.MESH_NUM_WEIGHTS_TOKEN = \"numweights\";\r\nMD5MeshParser.MESH_WEIGHT_TOKEN = \"weight\";\r\nvar PositionData = (function () {\r\n function PositionData() {\r\n }\r\n return PositionData;\r\n}());\r\nexport { PositionData };\r\nvar JointData = (function () {\r\n function JointData() {\r\n }\r\n return JointData;\r\n}());\r\nexport { JointData };\r\nvar ElementsData = (function () {\r\n function ElementsData() {\r\n }\r\n return ElementsData;\r\n}());\r\nexport { ElementsData };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/MD5MeshParser.js","import * as tslib_1 from \"tslib\";\r\nimport { AttributesBuffer, URLLoaderDataFormat, URLRequest, ParserBase, ParserUtils } from \"@awayjs/core\";\r\nimport { Sampler2D, Shape, BitmapImage2D, TriangleElements, DefaultMaterialManager, Single2DTexture } from \"@awayjs/graphics\";\r\nimport { DisplayObjectContainer, Sprite } from \"@awayjs/scene\";\r\nimport { MethodMaterial, MethodMaterialMode, SpecularBasicMethod } from \"@awayjs/materials\";\r\n/**\r\n * OBJParser provides a parser for the OBJ data type.\r\n */\r\nvar OBJParser = (function (_super) {\r\n tslib_1.__extends(OBJParser, _super);\r\n /**\r\n * Creates a new OBJParser object.\r\n * @param uri The url or id of the data or file to be parsed.\r\n * @param extra The holder for extra contextual data that the parser might need.\r\n */\r\n function OBJParser(scale) {\r\n if (scale === void 0) { scale = 1; }\r\n var _this = _super.call(this, URLLoaderDataFormat.TEXT) || this;\r\n _this._mtlLibLoaded = true;\r\n _this._activeMaterialID = \"\";\r\n _this._scale = scale;\r\n return _this;\r\n }\r\n Object.defineProperty(OBJParser.prototype, \"scale\", {\r\n /**\r\n * Scaling factor applied directly to vertices data\r\n * @param value The scaling factor.\r\n */\r\n set: function (value) {\r\n this._scale = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * Indicates whether or not a given file extension is supported by the parser.\r\n * @param extension The file extension of a potential file to be parsed.\r\n * @return Whether or not the given file type is supported.\r\n */\r\n OBJParser.supportsType = function (extension) {\r\n extension = extension.toLowerCase();\r\n return extension == \"obj\";\r\n };\r\n /**\r\n * Tests whether a data block can be parsed by the parser.\r\n * @param data The data block to potentially be parsed.\r\n * @return Whether or not the given data is supported.\r\n */\r\n OBJParser.supportsData = function (data) {\r\n var content = ParserUtils.toString(data);\r\n var hasV = false;\r\n var hasF = false;\r\n if (content) {\r\n hasV = content.indexOf(\"\\nv \") != -1;\r\n hasF = content.indexOf(\"\\nf \") != -1;\r\n }\r\n return hasV && hasF;\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n OBJParser.prototype._iResolveDependency = function (resourceDependency) {\r\n if (resourceDependency.id == 'mtl') {\r\n var str = ParserUtils.toString(resourceDependency.data);\r\n this.parseMtl(str);\r\n }\r\n else {\r\n var asset;\r\n if (resourceDependency.assets.length != 1) {\r\n return;\r\n }\r\n asset = resourceDependency.assets[0];\r\n if (asset.isAsset(BitmapImage2D)) {\r\n var lm = new LoadedMaterial();\r\n lm.materialID = resourceDependency.id;\r\n lm.texture = new Single2DTexture(asset);\r\n this._materialLoaded.push(lm);\r\n if (this._sprites.length > 0) {\r\n this.applyMaterial(lm);\r\n }\r\n }\r\n }\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n OBJParser.prototype._iResolveDependencyFailure = function (resourceDependency) {\r\n if (resourceDependency.id == \"mtl\") {\r\n this._mtlLib = false;\r\n this._mtlLibLoaded = false;\r\n }\r\n else {\r\n var lm = new LoadedMaterial();\r\n lm.materialID = resourceDependency.id;\r\n this._materialLoaded.push(lm);\r\n }\r\n if (this._sprites.length > 0)\r\n this.applyMaterial(lm);\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n OBJParser.prototype._pProceedParsing = function () {\r\n var line;\r\n var creturn = String.fromCharCode(10);\r\n var trunk;\r\n if (!this._startedParsing) {\r\n this._textData = this._pGetTextData();\r\n // Merge linebreaks that are immediately preceeded by\r\n // the \"escape\" backward slash into single lines.\r\n this._textData = this._textData.replace(/\\\\[\\r\\n]+\\s*/gm, ' ');\r\n }\r\n if (this._textData.indexOf(creturn) == -1)\r\n creturn = String.fromCharCode(13);\r\n if (!this._startedParsing) {\r\n this._startedParsing = true;\r\n this._vertices = new Array();\r\n this._vertexNormals = new Array();\r\n this._materialIDs = new Array();\r\n this._materialLoaded = new Array();\r\n this._sprites = new Array();\r\n this._uvs = new Array();\r\n this._stringLength = this._textData.length;\r\n this._charIndex = this._textData.indexOf(creturn, 0);\r\n this._oldIndex = 0;\r\n this._objects = new Array();\r\n this._objectIndex = 0;\r\n }\r\n while (this._charIndex < this._stringLength && this._pHasTime()) {\r\n this._charIndex = this._textData.indexOf(creturn, this._oldIndex);\r\n if (this._charIndex == -1)\r\n this._charIndex = this._stringLength;\r\n line = this._textData.substring(this._oldIndex, this._charIndex);\r\n line = line.split('\\r').join(\"\");\r\n line = line.replace(\" \", \" \");\r\n trunk = line.split(\" \");\r\n this._oldIndex = this._charIndex + 1;\r\n this.parseLine(trunk);\r\n // If whatever was parsed on this line resulted in the\r\n // parsing being paused to retrieve dependencies, break\r\n // here and do not continue parsing until un-paused.\r\n if (this.parsingPaused) {\r\n return ParserBase.MORE_TO_PARSE;\r\n }\r\n }\r\n if (this._charIndex >= this._stringLength) {\r\n if (this._mtlLib && !this._mtlLibLoaded) {\r\n return ParserBase.MORE_TO_PARSE;\r\n }\r\n this.translate();\r\n this.applyMaterials();\r\n return ParserBase.PARSING_DONE;\r\n }\r\n return ParserBase.MORE_TO_PARSE;\r\n };\r\n OBJParser.prototype._pStartParsing = function (frameLimit) {\r\n //create a content object for Loaders\r\n this._pContent = new DisplayObjectContainer();\r\n _super.prototype._pStartParsing.call(this, frameLimit);\r\n };\r\n /**\r\n * Parses a single line in the OBJ file.\r\n */\r\n OBJParser.prototype.parseLine = function (trunk) {\r\n switch (trunk[0]) {\r\n case \"mtllib\":\r\n this._mtlLib = true;\r\n this._mtlLibLoaded = false;\r\n this.loadMtl(trunk[1]);\r\n break;\r\n case \"g\":\r\n this.createGroup(trunk);\r\n break;\r\n case \"o\":\r\n this.createObject(trunk);\r\n break;\r\n case \"usemtl\":\r\n if (this._mtlLib) {\r\n if (!trunk[1])\r\n trunk[1] = \"def000\";\r\n this._materialIDs.push(trunk[1]);\r\n this._activeMaterialID = trunk[1];\r\n if (this._currentGroup)\r\n this._currentGroup.materialID = this._activeMaterialID;\r\n }\r\n break;\r\n case \"v\":\r\n this.parseVertex(trunk);\r\n break;\r\n case \"vt\":\r\n this.parseUV(trunk);\r\n break;\r\n case \"vn\":\r\n this.parseVertexNormal(trunk);\r\n break;\r\n case \"f\":\r\n this.parseFace(trunk);\r\n }\r\n };\r\n /**\r\n * Converts the parsed data into an Away3D scenegraph structure\r\n */\r\n OBJParser.prototype.translate = function () {\r\n for (var objIndex = 0; objIndex < this._objects.length; ++objIndex) {\r\n var groups = this._objects[objIndex].groups;\r\n var numGroups = groups.length;\r\n var materialGroups;\r\n var numMaterialGroups;\r\n var graphics;\r\n var sprite;\r\n var m;\r\n var sm;\r\n var bmMaterial;\r\n for (var g = 0; g < numGroups; ++g) {\r\n bmMaterial = new MethodMaterial(DefaultMaterialManager.getDefaultImage2D());\r\n //check for multipass\r\n if (this.materialMode >= 2)\r\n bmMaterial.mode = MethodMaterialMode.MULTI_PASS;\r\n sprite = new Sprite(bmMaterial);\r\n graphics = sprite.graphics;\r\n materialGroups = groups[g].materialGroups;\r\n numMaterialGroups = materialGroups.length;\r\n for (m = 0; m < numMaterialGroups; ++m)\r\n this.translateMaterialGroup(materialGroups[m], graphics);\r\n if (graphics.count == 0)\r\n continue;\r\n // Finalize and force type-based name\r\n this._pFinalizeAsset(graphics); //, \"\");\r\n if (this._objects[objIndex].name) {\r\n // this is a full independent object ('o' tag in OBJ file)\r\n sprite.name = this._objects[objIndex].name;\r\n }\r\n else if (groups[g].name) {\r\n // this is a group so the sub groups contain the actual sprite object names ('g' tag in OBJ file)\r\n sprite.name = groups[g].name;\r\n }\r\n else {\r\n // No name stored. Use empty string which will force it\r\n // to be overridden by finalizeAsset() to type default.\r\n sprite.name = \"\";\r\n }\r\n this._sprites.push(sprite);\r\n if (groups[g].materialID != \"\")\r\n bmMaterial.name = groups[g].materialID + \"~\" + sprite.name;\r\n else\r\n bmMaterial.name = this._lastMtlID + \"~\" + sprite.name;\r\n if (sprite.graphics.count > 1) {\r\n for (sm = 1; sm < sprite.graphics.count; ++sm)\r\n sprite.graphics.getShapeAt(sm).material = bmMaterial;\r\n }\r\n //add to the content property\r\n this._pContent.addChild(sprite);\r\n this._pFinalizeAsset(sprite);\r\n }\r\n }\r\n };\r\n /**\r\n * Translates an obj's material group to a subgraphics.\r\n * @param materialGroup The material group data to convert.\r\n * @param graphics The Graphics to contain the converted Elements.\r\n */\r\n OBJParser.prototype.translateMaterialGroup = function (materialGroup, graphics) {\r\n var faces = materialGroup.faces;\r\n var face;\r\n var numFaces = faces.length;\r\n var numVerts;\r\n var elements;\r\n var vertices = new Array();\r\n var uvs = new Array();\r\n var normals = new Array();\r\n var indices = new Array();\r\n this._realIndices = [];\r\n this._vertexIndex = 0;\r\n var j;\r\n for (var i = 0; i < numFaces; ++i) {\r\n face = faces[i];\r\n numVerts = face.indexIds.length - 1;\r\n for (j = 1; j < numVerts; ++j) {\r\n this.translateVertexData(face, j, vertices, uvs, indices, normals);\r\n this.translateVertexData(face, 0, vertices, uvs, indices, normals);\r\n this.translateVertexData(face, j + 1, vertices, uvs, indices, normals);\r\n }\r\n }\r\n if (vertices.length > 0) {\r\n elements = new TriangleElements(new AttributesBuffer());\r\n elements.autoDeriveNormals = normals.length ? false : true;\r\n elements.setIndices(indices);\r\n elements.setPositions(vertices);\r\n elements.setNormals(normals);\r\n elements.setUVs(uvs);\r\n graphics.addShape(new Shape(elements));\r\n }\r\n };\r\n OBJParser.prototype.translateVertexData = function (face, vertexIndex, vertices, uvs, indices /*uint*/, normals) {\r\n var index;\r\n var vertex;\r\n var vertexNormal;\r\n var uv;\r\n if (!this._realIndices[face.indexIds[vertexIndex]]) {\r\n index = this._vertexIndex;\r\n this._realIndices[face.indexIds[vertexIndex]] = ++this._vertexIndex;\r\n vertex = this._vertices[face.vertexIndices[vertexIndex] - 1];\r\n vertices.push(vertex.x * this._scale, vertex.y * this._scale, vertex.z * this._scale);\r\n if (face.normalIndices.length > 0) {\r\n vertexNormal = this._vertexNormals[face.normalIndices[vertexIndex] - 1];\r\n normals.push(vertexNormal.x, vertexNormal.y, vertexNormal.z);\r\n }\r\n if (face.uvIndices.length > 0) {\r\n try {\r\n uv = this._uvs[face.uvIndices[vertexIndex] - 1];\r\n uvs.push(uv.u, uv.v);\r\n }\r\n catch (e) {\r\n switch (vertexIndex) {\r\n case 0:\r\n uvs.push(0, 1);\r\n break;\r\n case 1:\r\n uvs.push(.5, 0);\r\n break;\r\n case 2:\r\n uvs.push(1, 1);\r\n }\r\n }\r\n }\r\n }\r\n else {\r\n index = this._realIndices[face.indexIds[vertexIndex]] - 1;\r\n }\r\n indices.push(index);\r\n };\r\n /**\r\n * Creates a new object group.\r\n * @param trunk The data block containing the object tag and its parameters\r\n */\r\n OBJParser.prototype.createObject = function (trunk) {\r\n this._currentGroup = null;\r\n this._currentMaterialGroup = null;\r\n this._objects.push(this._currentObject = new ObjectGroup());\r\n if (trunk)\r\n this._currentObject.name = trunk[1];\r\n };\r\n /**\r\n * Creates a new group.\r\n * @param trunk The data block containing the group tag and its parameters\r\n */\r\n OBJParser.prototype.createGroup = function (trunk) {\r\n if (!this._currentObject)\r\n this.createObject(null);\r\n this._currentGroup = new Group();\r\n this._currentGroup.materialID = this._activeMaterialID;\r\n if (trunk)\r\n this._currentGroup.name = trunk[1];\r\n this._currentObject.groups.push(this._currentGroup);\r\n this.createMaterialGroup(null);\r\n };\r\n /**\r\n * Creates a new material group.\r\n * @param trunk The data block containing the material tag and its parameters\r\n */\r\n OBJParser.prototype.createMaterialGroup = function (trunk) {\r\n this._currentMaterialGroup = new MaterialGroup();\r\n if (trunk)\r\n this._currentMaterialGroup.url = trunk[1];\r\n this._currentGroup.materialGroups.push(this._currentMaterialGroup);\r\n };\r\n /**\r\n * Reads the next vertex coordinates.\r\n * @param trunk The data block containing the vertex tag and its parameters\r\n */\r\n OBJParser.prototype.parseVertex = function (trunk) {\r\n //for the very rare cases of other delimiters/charcodes seen in some obj files\r\n var v1, v2, v3;\r\n if (trunk.length > 4) {\r\n var nTrunk = [];\r\n var val;\r\n for (var i = 1; i < trunk.length; ++i) {\r\n val = parseFloat(trunk[i]);\r\n if (!isNaN(val))\r\n nTrunk.push(val);\r\n }\r\n v1 = nTrunk[0];\r\n v2 = nTrunk[1];\r\n v3 = -nTrunk[2];\r\n this._vertices.push(new Vertex(v1, v2, v3));\r\n }\r\n else {\r\n v1 = parseFloat(trunk[1]);\r\n v2 = parseFloat(trunk[2]);\r\n v3 = -parseFloat(trunk[3]);\r\n this._vertices.push(new Vertex(v1, v2, v3));\r\n }\r\n };\r\n /**\r\n * Reads the next uv coordinates.\r\n * @param trunk The data block containing the uv tag and its parameters\r\n */\r\n OBJParser.prototype.parseUV = function (trunk) {\r\n if (trunk.length > 3) {\r\n var nTrunk = [];\r\n var val;\r\n for (var i = 1; i < trunk.length; ++i) {\r\n val = parseFloat(trunk[i]);\r\n if (!isNaN(val))\r\n nTrunk.push(val);\r\n }\r\n this._uvs.push(new UV(nTrunk[0], 1 - nTrunk[1]));\r\n }\r\n else {\r\n this._uvs.push(new UV(parseFloat(trunk[1]), 1 - parseFloat(trunk[2])));\r\n }\r\n };\r\n /**\r\n * Reads the next vertex normal coordinates.\r\n * @param trunk The data block containing the vertex normal tag and its parameters\r\n */\r\n OBJParser.prototype.parseVertexNormal = function (trunk) {\r\n if (trunk.length > 4) {\r\n var nTrunk = [];\r\n var val;\r\n for (var i = 1; i < trunk.length; ++i) {\r\n val = parseFloat(trunk[i]);\r\n if (!isNaN(val))\r\n nTrunk.push(val);\r\n }\r\n this._vertexNormals.push(new Vertex(nTrunk[0], nTrunk[1], -nTrunk[2]));\r\n }\r\n else {\r\n this._vertexNormals.push(new Vertex(parseFloat(trunk[1]), parseFloat(trunk[2]), -parseFloat(trunk[3])));\r\n }\r\n };\r\n /**\r\n * Reads the next face's indices.\r\n * @param trunk The data block containing the face tag and its parameters\r\n */\r\n OBJParser.prototype.parseFace = function (trunk) {\r\n var len = trunk.length;\r\n var face = new FaceData();\r\n if (!this._currentGroup) {\r\n this.createGroup(null);\r\n }\r\n var indices;\r\n for (var i = 1; i < len; ++i) {\r\n if (trunk[i] == \"\") {\r\n continue;\r\n }\r\n indices = trunk[i].split(\"/\");\r\n face.vertexIndices.push(this.parseIndex(parseInt(indices[0]), this._vertices.length));\r\n if (indices[1] && String(indices[1]).length > 0)\r\n face.uvIndices.push(this.parseIndex(parseInt(indices[1]), this._uvs.length));\r\n if (indices[2] && String(indices[2]).length > 0)\r\n face.normalIndices.push(this.parseIndex(parseInt(indices[2]), this._vertexNormals.length));\r\n face.indexIds.push(trunk[i]);\r\n }\r\n this._currentMaterialGroup.faces.push(face);\r\n };\r\n /**\r\n * This is a hack around negative face coords\r\n */\r\n OBJParser.prototype.parseIndex = function (index, length) {\r\n if (index < 0)\r\n return index + length + 1;\r\n else\r\n return index;\r\n };\r\n OBJParser.prototype.parseMtl = function (data) {\r\n var materialDefinitions = data.split('newmtl');\r\n var lines;\r\n var trunk;\r\n var j;\r\n var basicSpecularMethod;\r\n var useSpecular;\r\n var useColor;\r\n var diffuseColor;\r\n var color;\r\n var specularColor;\r\n var specular;\r\n var alpha;\r\n var mapkd;\r\n for (var i = 0; i < materialDefinitions.length; ++i) {\r\n lines = (materialDefinitions[i].split('\\r')).join(\"\").split('\\n');\r\n //lines = (materialDefinitions[i].split('\\r') as Array).join(\"\").split('\\n');\r\n if (lines.length == 1)\r\n lines = materialDefinitions[i].split(String.fromCharCode(13));\r\n diffuseColor = color = specularColor = 0xFFFFFF;\r\n specular = 0;\r\n useSpecular = false;\r\n useColor = false;\r\n alpha = 1;\r\n mapkd = \"\";\r\n for (j = 0; j < lines.length; ++j) {\r\n lines[j] = lines[j].replace(/\\s+$/, \"\");\r\n if (lines[j].substring(0, 1) != \"#\" && (j == 0 || lines[j] != \"\")) {\r\n trunk = lines[j].split(\" \");\r\n if (String(trunk[0]).charCodeAt(0) == 9 || String(trunk[0]).charCodeAt(0) == 32)\r\n trunk[0] = trunk[0].substring(1, trunk[0].length);\r\n if (j == 0) {\r\n this._lastMtlID = trunk.join(\"\");\r\n this._lastMtlID = (this._lastMtlID == \"\") ? \"def000\" : this._lastMtlID;\r\n }\r\n else {\r\n switch (trunk[0]) {\r\n case \"Ka\":\r\n if (trunk[1] && !isNaN(Number(trunk[1])) && trunk[2] && !isNaN(Number(trunk[2])) && trunk[3] && !isNaN(Number(trunk[3])))\r\n color = trunk[1] * 255 << 16 | trunk[2] * 255 << 8 | trunk[3] * 255;\r\n break;\r\n case \"Ks\":\r\n if (trunk[1] && !isNaN(Number(trunk[1])) && trunk[2] && !isNaN(Number(trunk[2])) && trunk[3] && !isNaN(Number(trunk[3]))) {\r\n specularColor = trunk[1] * 255 << 16 | trunk[2] * 255 << 8 | trunk[3] * 255;\r\n useSpecular = true;\r\n }\r\n break;\r\n case \"Ns\":\r\n if (trunk[1] && !isNaN(Number(trunk[1])))\r\n specular = Number(trunk[1]) * 0.001;\r\n if (specular == 0)\r\n useSpecular = false;\r\n break;\r\n case \"Kd\":\r\n if (trunk[1] && !isNaN(Number(trunk[1])) && trunk[2] && !isNaN(Number(trunk[2])) && trunk[3] && !isNaN(Number(trunk[3]))) {\r\n diffuseColor = trunk[1] * 255 << 16 | trunk[2] * 255 << 8 | trunk[3] * 255;\r\n useColor = true;\r\n }\r\n break;\r\n case \"tr\":\r\n case \"d\":\r\n if (trunk[1] && !isNaN(Number(trunk[1])))\r\n alpha = Number(trunk[1]);\r\n break;\r\n case \"map_Kd\":\r\n mapkd = this.parseMapKdString(trunk);\r\n mapkd = mapkd.replace(/\\\\/g, \"/\");\r\n }\r\n }\r\n }\r\n }\r\n if (mapkd != \"\") {\r\n if (useSpecular) {\r\n basicSpecularMethod = new SpecularBasicMethod();\r\n basicSpecularMethod.color = specularColor;\r\n basicSpecularMethod.strength = specular;\r\n var specularData = new SpecularData();\r\n specularData.alpha = alpha;\r\n specularData.basicSpecularMethod = basicSpecularMethod;\r\n specularData.materialID = this._lastMtlID;\r\n if (!this._materialSpecularData)\r\n this._materialSpecularData = new Array();\r\n this._materialSpecularData.push(specularData);\r\n }\r\n this._pAddDependency(this._lastMtlID, new URLRequest(mapkd));\r\n }\r\n else if (useColor && !isNaN(color)) {\r\n var lm = new LoadedMaterial();\r\n lm.materialID = this._lastMtlID;\r\n if (alpha == 0)\r\n console.log(\"Warning: an alpha value of 0 was found in mtl color tag (Tr or d) ref:\" + this._lastMtlID + \", sprite(es) using it will be invisible!\");\r\n var cm = new MethodMaterial(color);\r\n if (this.materialMode < 2) {\r\n cm.alpha = alpha;\r\n }\r\n else {\r\n cm.mode = MethodMaterialMode.MULTI_PASS;\r\n }\r\n cm.diffuseMethod.color = diffuseColor;\r\n if (useSpecular) {\r\n cm.specularMethod.color = specularColor;\r\n cm.specularMethod.strength = specular;\r\n }\r\n lm.cm = cm;\r\n this._materialLoaded.push(lm);\r\n if (this._sprites.length > 0)\r\n this.applyMaterial(lm);\r\n }\r\n }\r\n this._mtlLibLoaded = true;\r\n };\r\n OBJParser.prototype.parseMapKdString = function (trunk) {\r\n var url = \"\";\r\n var i;\r\n var breakflag;\r\n for (i = 1; i < trunk.length;) {\r\n switch (trunk[i]) {\r\n case \"-blendu\":\r\n case \"-blendv\":\r\n case \"-cc\":\r\n case \"-clamp\":\r\n case \"-texres\":\r\n i += 2; //Skip ahead 1 attribute\r\n break;\r\n case \"-mm\":\r\n i += 3; //Skip ahead 2 attributes\r\n break;\r\n case \"-o\":\r\n case \"-s\":\r\n case \"-t\":\r\n i += 4; //Skip ahead 3 attributes\r\n continue;\r\n default:\r\n breakflag = true;\r\n break;\r\n }\r\n if (breakflag)\r\n break;\r\n }\r\n //Reconstruct URL/filename\r\n for (i; i < trunk.length; i++) {\r\n url += trunk[i];\r\n url += \" \";\r\n }\r\n //Remove the extraneous space and/or newline from the right side\r\n url = url.replace(/\\s+$/, \"\");\r\n return url;\r\n };\r\n OBJParser.prototype.loadMtl = function (mtlurl) {\r\n // Add raw-data dependency to queue and load dependencies now,\r\n // which will pause the parsing in the meantime.\r\n this._pAddDependency('mtl', new URLRequest(mtlurl), null, null, true);\r\n this._pPauseAndRetrieveDependencies(); //\r\n };\r\n OBJParser.prototype.applyMaterial = function (lm) {\r\n var decomposeID;\r\n var sprite;\r\n var tm;\r\n var j;\r\n var specularData;\r\n for (var i = 0; i < this._sprites.length; ++i) {\r\n sprite = this._sprites[i];\r\n decomposeID = sprite.material.name.split(\"~\");\r\n if (decomposeID[0] == lm.materialID) {\r\n if (lm.cm) {\r\n if (sprite.material)\r\n sprite.material = null;\r\n sprite.material = lm.cm;\r\n }\r\n else if (lm.texture) {\r\n tm = sprite.material;\r\n tm.ambientMethod.texture = lm.texture;\r\n tm.style.color = lm.color;\r\n tm.alpha = lm.alpha;\r\n tm.style.sampler = new Sampler2D(true);\r\n if (this.materialMode < 2)\r\n tm.alpha = lm.alpha;\r\n else\r\n tm.mode = MethodMaterialMode.MULTI_PASS;\r\n if (lm.specularMethod) {\r\n // By setting the specularMethod property to null before assigning\r\n // the actual method instance, we avoid having the properties of\r\n // the new method being overridden with the settings from the old\r\n // one, which is default behavior of the setter.\r\n tm.specularMethod = null;\r\n tm.specularMethod = lm.specularMethod;\r\n }\r\n else if (this._materialSpecularData) {\r\n for (j = 0; j < this._materialSpecularData.length; ++j) {\r\n specularData = this._materialSpecularData[j];\r\n if (specularData.materialID == lm.materialID) {\r\n tm.specularMethod = null; // Prevent property overwrite (see above)\r\n tm.specularMethod = specularData.basicSpecularMethod;\r\n tm.specularMethod.color = specularData.color;\r\n tm.specularMethod.strength = specularData.alpha;\r\n break;\r\n }\r\n }\r\n }\r\n }\r\n sprite.material.name = decomposeID[1] ? decomposeID[1] : decomposeID[0];\r\n this._sprites.splice(i, 1);\r\n --i;\r\n }\r\n }\r\n if (lm.cm || tm)\r\n this._pFinalizeAsset(lm.cm || tm);\r\n };\r\n OBJParser.prototype.applyMaterials = function () {\r\n if (this._materialLoaded.length == 0)\r\n return;\r\n for (var i = 0; i < this._materialLoaded.length; ++i)\r\n this.applyMaterial(this._materialLoaded[i]);\r\n };\r\n return OBJParser;\r\n}(ParserBase));\r\nexport { OBJParser };\r\nvar ObjectGroup = (function () {\r\n function ObjectGroup() {\r\n this.groups = new Array();\r\n }\r\n return ObjectGroup;\r\n}());\r\nexport { ObjectGroup };\r\nvar Group = (function () {\r\n function Group() {\r\n this.materialGroups = new Array();\r\n }\r\n return Group;\r\n}());\r\nexport { Group };\r\nvar MaterialGroup = (function () {\r\n function MaterialGroup() {\r\n this.faces = new Array();\r\n }\r\n return MaterialGroup;\r\n}());\r\nexport { MaterialGroup };\r\nvar SpecularData = (function () {\r\n function SpecularData() {\r\n this.color = 0xFFFFFF;\r\n this.alpha = 1;\r\n }\r\n return SpecularData;\r\n}());\r\nexport { SpecularData };\r\nvar LoadedMaterial = (function () {\r\n function LoadedMaterial() {\r\n this.color = 0xFFFFFF;\r\n this.alpha = 1;\r\n }\r\n return LoadedMaterial;\r\n}());\r\nexport { LoadedMaterial };\r\nvar FaceData = (function () {\r\n function FaceData() {\r\n this.vertexIndices = new Array();\r\n this.uvIndices = new Array();\r\n this.normalIndices = new Array();\r\n this.indexIds = new Array(); // used for real index lookups\r\n }\r\n return FaceData;\r\n}());\r\nexport { FaceData };\r\n/**\r\n* Texture coordinates value object.\r\n*/\r\nvar UV = (function () {\r\n /**\r\n * Creates a new UV object.\r\n *\r\n * @param u [optional] The horizontal coordinate of the texture value. Defaults to 0.\r\n * @param v [optional] The vertical coordinate of the texture value. Defaults to 0.\r\n */\r\n function UV(u, v) {\r\n if (u === void 0) { u = 0; }\r\n if (v === void 0) { v = 0; }\r\n this._u = u;\r\n this._v = v;\r\n }\r\n Object.defineProperty(UV.prototype, \"v\", {\r\n /**\r\n * Defines the vertical coordinate of the texture value.\r\n */\r\n get: function () {\r\n return this._v;\r\n },\r\n set: function (value) {\r\n this._v = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(UV.prototype, \"u\", {\r\n /**\r\n * Defines the horizontal coordinate of the texture value.\r\n */\r\n get: function () {\r\n return this._u;\r\n },\r\n set: function (value) {\r\n this._u = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * returns a new UV value Object\r\n */\r\n UV.prototype.clone = function () {\r\n return new UV(this._u, this._v);\r\n };\r\n /**\r\n * returns the value object as a string for trace/debug purpose\r\n */\r\n UV.prototype.toString = function () {\r\n return this._u + \",\" + this._v;\r\n };\r\n return UV;\r\n}());\r\nexport { UV };\r\nvar Vertex = (function () {\r\n /**\r\n * Creates a new Vertex value object.\r\n *\r\n * @param x [optional] The x value. Defaults to 0.\r\n * @param y [optional] The y value. Defaults to 0.\r\n * @param z [optional] The z value. Defaults to 0.\r\n * @param index [optional] The index value. Defaults is NaN.\r\n */\r\n function Vertex(x, y, z, index) {\r\n if (x === void 0) { x = 0; }\r\n if (y === void 0) { y = 0; }\r\n if (z === void 0) { z = 0; }\r\n if (index === void 0) { index = 0; }\r\n this._x = x;\r\n this._y = y;\r\n this._z = z;\r\n this._index = index;\r\n }\r\n Object.defineProperty(Vertex.prototype, \"index\", {\r\n get: function () {\r\n return this._index;\r\n },\r\n /**\r\n * To define/store the index of value object\r\n * @param ind The index\r\n */\r\n set: function (ind) {\r\n this._index = ind;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Vertex.prototype, \"x\", {\r\n /**\r\n * To define/store the x value of the value object\r\n * @param value The x value\r\n */\r\n get: function () {\r\n return this._x;\r\n },\r\n set: function (value) {\r\n this._x = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Vertex.prototype, \"y\", {\r\n /**\r\n * To define/store the y value of the value object\r\n * @param value The y value\r\n */\r\n get: function () {\r\n return this._y;\r\n },\r\n set: function (value) {\r\n this._y = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(Vertex.prototype, \"z\", {\r\n /**\r\n * To define/store the z value of the value object\r\n * @param value The z value\r\n */\r\n get: function () {\r\n return this._z;\r\n },\r\n set: function (value) {\r\n this._z = value;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n * returns a new Vertex value Object\r\n */\r\n Vertex.prototype.clone = function () {\r\n return new Vertex(this._x, this._y, this._z);\r\n };\r\n return Vertex;\r\n}());\r\nexport { Vertex };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/OBJParser.js","import { Loader } from \"@awayjs/core\";\r\nimport { AWDParser } from \"./AWDParser\";\r\nimport { Max3DSParser } from \"./Max3DSParser\";\r\nimport { MD2Parser } from \"./MD2Parser\";\r\nimport { OBJParser } from \"./OBJParser\";\r\nimport { FNTParser } from \"./FNTParser\";\r\n/**\r\n *\r\n */\r\nvar Parsers = (function () {\r\n function Parsers() {\r\n }\r\n /**\r\n * Short-hand function to enable all bundled parsers for auto-detection. In practice,\r\n * this is the same as invoking enableParsers(Parsers.ALL_BUNDLED) on any of the\r\n * loader classes SingleFileLoader, LoaderSession, AssetLibrary or Loader3D.\r\n *\r\n * See notes about file size in the documentation for the ALL_BUNDLED constant.\r\n *\r\n * @see away.parsers.Parsers.ALL_BUNDLED\r\n */\r\n Parsers.enableAllBundled = function () {\r\n Loader.enableParsers(Parsers.ALL_BUNDLED);\r\n };\r\n return Parsers;\r\n}());\r\nexport { Parsers };\r\n/**\r\n * A list of all parsers that come bundled with Away3D. Use this to quickly\r\n * enable support for all bundled parsers to the file format auto-detection\r\n * feature, using any of the enableParsers() methods on loaders, e.g.:\r\n *\r\n * AssetLibrary.enableParsers(Parsers.ALL_BUNDLED);\r\n *\r\n * Beware however that this requires all parser classes to be included in the\r\n * SWF file, which will add 50-100 kb to the file. When only a limited set of\r\n * file formats are used, SWF file size can be saved by adding the parsers\r\n * individually using AssetLibrary.enableParser()\r\n *\r\n * A third way is to specify a parser for each loaded file, thereby bypassing\r\n * the auto-detection mechanisms altogether, while at the same time allowing\r\n * any properties that are unique to that parser to be set for that load.\r\n *\r\n * The bundled parsers are:\r\n *\r\n * - \r\n *
- AC3D (.ac) \r\n *
- Away Data version 1 ASCII and version 2 binary (.awd). AWD1 BSP unsupported \r\n *
- 3DMax (.3ds) \r\n *
- DXF (.dxf) \r\n *
- Quake 2 MD2 models (.md2) \r\n *
- Doom 3 MD5 animation clips (.md5anim) \r\n *
- Doom 3 MD5 sprites (.md5sprite) \r\n *
- Wavefront OBJ (.obj) \r\n *
- Collada (.dae) \r\n *
- Images (.jpg, .png) \r\n *
MouseManager object.\r\n */\r\n function MouseManager() {\r\n var _this = this;\r\n this._viewLookup = new Array();\r\n this._containerLookup = new Array();\r\n this._nullVector = new Vector3D();\r\n this._queuedEvents = new Array();\r\n this._mouseUp = new MouseEvent(MouseEvent.MOUSE_UP);\r\n this._mouseClick = new MouseEvent(MouseEvent.CLICK);\r\n this._mouseOut = new MouseEvent(MouseEvent.MOUSE_OUT);\r\n this._mouseDown = new MouseEvent(MouseEvent.MOUSE_DOWN);\r\n this._mouseMove = new MouseEvent(MouseEvent.MOUSE_MOVE);\r\n this._mouseOver = new MouseEvent(MouseEvent.MOUSE_OVER);\r\n this._mouseWheel = new MouseEvent(MouseEvent.MOUSE_WHEEL);\r\n this._mouseDoubleClick = new MouseEvent(MouseEvent.DOUBLE_CLICK);\r\n this.onClickDelegate = function (event) { return _this.onClick(event); };\r\n this.onDoubleClickDelegate = function (event) { return _this.onDoubleClick(event); };\r\n this.onMouseDownDelegate = function (event) { return _this.onMouseDown(event); };\r\n this.onMouseMoveDelegate = function (event) { return _this.onMouseMove(event); };\r\n this.onMouseUpDelegate = function (event) { return _this.onMouseUp(event); };\r\n this.onMouseWheelDelegate = function (event) { return _this.onMouseWheel(event); };\r\n this.onMouseOverDelegate = function (event) { return _this.onMouseOver(event); };\r\n this.onMouseOutDelegate = function (event) { return _this.onMouseOut(event); };\r\n }\r\n MouseManager.prototype.registerContainer = function (container) {\r\n if (container && this._containerLookup.indexOf(container) == -1) {\r\n container.addEventListener(\"click\", this.onClickDelegate);\r\n container.addEventListener(\"dblclick\", this.onDoubleClickDelegate);\r\n container.addEventListener(\"touchstart\", this.onMouseDownDelegate);\r\n container.addEventListener(\"mousedown\", this.onMouseDownDelegate);\r\n container.addEventListener(\"touchmove\", this.onMouseMoveDelegate);\r\n container.addEventListener(\"mousemove\", this.onMouseMoveDelegate);\r\n container.addEventListener(\"mouseup\", this.onMouseUpDelegate);\r\n container.addEventListener(\"touchend\", this.onMouseUpDelegate);\r\n container.addEventListener(\"mousewheel\", this.onMouseWheelDelegate);\r\n container.addEventListener(\"mouseover\", this.onMouseOverDelegate);\r\n container.addEventListener(\"mouseout\", this.onMouseOutDelegate);\r\n this._containerLookup.push(container);\r\n }\r\n };\r\n MouseManager.prototype.unregisterContainer = function (container) {\r\n if (container && this._containerLookup.indexOf(container) != -1) {\r\n container.removeEventListener(\"click\", this.onClickDelegate);\r\n container.removeEventListener(\"dblclick\", this.onDoubleClickDelegate);\r\n container.removeEventListener(\"touchstart\", this.onMouseDownDelegate);\r\n container.removeEventListener(\"mousedown\", this.onMouseDownDelegate);\r\n container.removeEventListener(\"touchmove\", this.onMouseMoveDelegate);\r\n container.removeEventListener(\"mousemove\", this.onMouseMoveDelegate);\r\n container.removeEventListener(\"touchend\", this.onMouseUpDelegate);\r\n container.removeEventListener(\"mouseup\", this.onMouseUpDelegate);\r\n container.removeEventListener(\"mousewheel\", this.onMouseWheelDelegate);\r\n container.removeEventListener(\"mouseover\", this.onMouseOverDelegate);\r\n container.removeEventListener(\"mouseout\", this.onMouseOutDelegate);\r\n this._containerLookup.slice(this._containerLookup.indexOf(container), 1);\r\n }\r\n };\r\n MouseManager.getInstance = function () {\r\n if (this._instance)\r\n return this._instance;\r\n return (this._instance = new MouseManager());\r\n };\r\n MouseManager.prototype.fireMouseEvents = function (forceMouseMove) {\r\n // If colliding object has changed, queue over/out events.\r\n if (this._iCollision != this._previousCollidingObject) {\r\n if (this._previousCollidingObject)\r\n this.queueDispatch(this._mouseOut, this._mouseMoveEvent, this._previousCollidingObject);\r\n if (this._iCollision)\r\n this.queueDispatch(this._mouseOver, this._mouseMoveEvent);\r\n }\r\n // Fire mouse move events here if forceMouseMove is on.\r\n if (forceMouseMove && this._iCollision)\r\n this.queueDispatch(this._mouseMove, this._mouseMoveEvent);\r\n var event;\r\n var dispatcher;\r\n // Dispatch all queued events.\r\n var len = this._queuedEvents.length;\r\n for (var i = 0; i < len; ++i) {\r\n event = this._queuedEvents[i];\r\n dispatcher = event.entity;\r\n // bubble event up the heirarchy until the top level parent is reached\r\n while (dispatcher) {\r\n //console.log(\"dispatcher\", dispatcher, dispatcher.adapter.constructor.name);\r\n if (dispatcher._iIsMouseEnabled()) {\r\n dispatcher.dispatchEvent(event);\r\n }\r\n dispatcher = dispatcher.parent;\r\n }\r\n // not totally sure, but i think just calling it is easier and cheaper than any options for that\r\n // if nothing is queued, the function will return directly anyway\r\n FrameScriptManager.execute_queue();\r\n }\r\n this._queuedEvents.length = 0;\r\n this._previousCollidingObject = this._iCollision;\r\n this._iUpdateDirty = false;\r\n };\r\n //\t\tpublic addViewLayer(view:View)\r\n //\t\t{\r\n //\t\t\tvar stg:Stage = view.stage;\r\n //\r\n //\t\t\t// Add instance to mouse3dmanager to fire mouse events for multiple views\r\n //\t\t\tif (!view.stageGL.mouse3DManager)\r\n //\t\t\t\tview.stageGL.mouse3DManager = this;\r\n //\r\n //\t\t\tif (!hasKey(view))\r\n //\t\t\t\t_view3Ds[view] = 0;\r\n //\r\n //\t\t\t_childDepth = 0;\r\n //\t\t\ttraverseDisplayObjects(stg);\r\n //\t\t\t_viewCount = _childDepth;\r\n //\t\t}\r\n MouseManager.prototype.registerView = function (view) {\r\n if (view)\r\n this._viewLookup.push(view);\r\n };\r\n MouseManager.prototype.unregisterView = function (view) {\r\n if (view)\r\n this._viewLookup.slice(this._viewLookup.indexOf(view), 1);\r\n };\r\n MouseManager.prototype.addEventsForViewBinary = function (touchMessage, viewIdx) {\r\n if (viewIdx === void 0) { viewIdx = 0; }\r\n var newTouchEvent = {};\r\n newTouchEvent.clientX = null; // we get the x position from the active touch\r\n newTouchEvent.clientY = null; // we get the y position from the active touch\r\n newTouchEvent.touches = [];\r\n newTouchEvent.changedTouches = [];\r\n newTouchEvent.preventDefault = function () { };\r\n var messageView = new Float32Array(touchMessage);\r\n // transfer touches to event\r\n var i = 0;\r\n var cnt = 0;\r\n var touchCnt = 0;\r\n cnt++; //we temporary added 1 float to transfer fps from java to js. skip this\r\n var numTouches = messageView[cnt++];\r\n var touchtype = messageView[cnt++];\r\n var activeTouchID = messageView[cnt++];\r\n var x = 0;\r\n var y = 0;\r\n if ((touchtype != 1) && (touchtype != 6) && (touchtype != 12) && (touchtype != 262) && (touchtype != 518)) {\r\n // if this is not a UP command, we add all touches\r\n for (i = 0; i < numTouches; i++) {\r\n var newTouch = {};\r\n newTouch.identifier = messageView[cnt++];\r\n newTouch.clientX = messageView[cnt++];\r\n newTouch.clientY = messageView[cnt++];\r\n newTouchEvent.touches[i] = newTouch;\r\n }\r\n newTouchEvent.changedTouches[0] = newTouchEvent.touches[activeTouchID];\r\n x = newTouchEvent.changedTouches[0].clientX;\r\n y = newTouchEvent.changedTouches[0].clientY;\r\n }\r\n else {\r\n // if this is a UP command, we add all touches, except the active one\r\n if (numTouches == 1) {\r\n var newTouch = {};\r\n newTouch.identifier = messageView[cnt++];\r\n newTouch.clientX = messageView[cnt++];\r\n newTouch.clientY = messageView[cnt++];\r\n newTouchEvent.clientX = newTouch.clientX;\r\n newTouchEvent.clientY = newTouch.clientY;\r\n x = newTouchEvent.clientX;\r\n y = newTouchEvent.clientY;\r\n }\r\n else {\r\n for (i = 0; i < numTouches; i++) {\r\n var newTouch = {};\r\n newTouch.identifier = messageView[cnt++];\r\n newTouch.clientX = messageView[cnt++];\r\n newTouch.clientY = messageView[cnt++];\r\n if (i != activeTouchID) {\r\n newTouchEvent.touches[touchCnt] = newTouch;\r\n }\r\n else {\r\n newTouchEvent.clientX = newTouch.clientX;\r\n newTouchEvent.clientY = newTouch.clientY;\r\n x = newTouchEvent.clientX;\r\n y = newTouchEvent.clientY;\r\n }\r\n }\r\n }\r\n }\r\n //console.log(\"Touch ID:\"+touchtype+\" activeTouchID \"+activeTouchID+\" numTouches \"+numTouches+\" x\"+x+\" y\"+y);\r\n /*\r\n public static final int ACTION_DOWN = 0;\r\n public static final int ACTION_POINTER_1_DOWN = 5;\r\n public static final int ACTION_POINTER_DOWN = 5;\r\n public static final int ACTION_BUTTON_PRESS = 11;\r\n public static final int ACTION_POINTER_2_DOWN = 261;\r\n public static final int ACTION_POINTER_3_DOWN = 517;\r\n\r\n\r\n public static final int ACTION_UP = 1;\r\n public static final int ACTION_POINTER_1_UP = 6;\r\n public static final int ACTION_POINTER_UP = 6;\r\n public static final int ACTION_BUTTON_RELEASE = 12;\r\n public static final int ACTION_POINTER_2_UP = 262;\r\n public static final int ACTION_POINTER_3_UP = 518;\r\n\r\n public static final int ACTION_MOVE = 2;\r\n\r\n\r\n */\r\n if ((touchtype == 0) || (touchtype == 5) || (touchtype == 11) || (touchtype == 261) || (touchtype == 517)) {\r\n this.onMouseDown(newTouchEvent);\r\n }\r\n else if ((touchtype == 1) || (touchtype == 6) || (touchtype == 12) || (touchtype == 262) || (touchtype == 518)) {\r\n this.onMouseUp(newTouchEvent);\r\n }\r\n else if (touchtype == 2) {\r\n this.onMouseMove(newTouchEvent);\r\n }\r\n else {\r\n console.log(\"recieved unknown touch event-type: \" + touchtype);\r\n }\r\n };\r\n MouseManager.prototype.fireEventsForViewFromString = function (touchMessage, viewIdx) {\r\n if (viewIdx === void 0) { viewIdx = 0; }\r\n var newTouchEvent = {};\r\n newTouchEvent.clientX = null; // set the x position from the active touch\r\n newTouchEvent.clientY = null; // set the y position from the active touch\r\n newTouchEvent.preventDefault = function () { };\r\n var touchesFromMessage = touchMessage.split(\",\");\r\n // transfer touches to event\r\n var i = 0;\r\n var cnt = 0;\r\n var numTouches = parseInt(touchesFromMessage[cnt++]);\r\n var touchtype = parseInt(touchesFromMessage[cnt++]);\r\n var activeTouch = parseInt(touchesFromMessage[cnt++]);\r\n newTouchEvent.touches = [];\r\n newTouchEvent.changedTouches = [];\r\n if ((touchtype != 1) && (touchtype != 6)) {\r\n for (i = 0; i < numTouches; i++) {\r\n var newTouch = {};\r\n newTouch.identifier = touchesFromMessage[cnt++];\r\n newTouch.clientX = touchesFromMessage[cnt++];\r\n newTouch.clientY = touchesFromMessage[cnt++];\r\n newTouchEvent.touches[i] = newTouch;\r\n newTouchEvent.changedTouches[i] = newTouch;\r\n }\r\n ;\r\n newTouchEvent.changedTouches[i] = newTouchEvent.touches[activeTouch];\r\n }\r\n else {\r\n for (i = 0; i < numTouches; i++) {\r\n if (i != activeTouch) {\r\n var newTouch = {};\r\n newTouch.identifier = touchesFromMessage[cnt++];\r\n newTouch.clientX = touchesFromMessage[cnt++];\r\n newTouch.clientY = touchesFromMessage[cnt++];\r\n newTouchEvent.touches[i] = newTouch;\r\n newTouchEvent.changedTouches[i] = newTouch;\r\n }\r\n else {\r\n newTouchEvent.clientX = touchesFromMessage[cnt++];\r\n newTouchEvent.clientY = touchesFromMessage[cnt++];\r\n cnt++;\r\n }\r\n }\r\n ;\r\n }\r\n if (touchtype == 0) {\r\n this.onMouseDown(newTouchEvent);\r\n }\r\n else if (touchtype == 1) {\r\n this.onMouseUp(newTouchEvent);\r\n }\r\n else if (touchtype == 2) {\r\n this.onMouseMove(newTouchEvent);\r\n }\r\n else if (touchtype == 261) {\r\n this.onMouseDown(newTouchEvent);\r\n }\r\n else if (touchtype == 6) {\r\n this.onMouseUp(newTouchEvent);\r\n }\r\n };\r\n // ---------------------------------------------------------------------\r\n // Private.\r\n // ---------------------------------------------------------------------\r\n MouseManager.prototype.queueDispatch = function (event, sourceEvent, collision) {\r\n if (collision === void 0) { collision = null; }\r\n // 2D properties.\r\n if (sourceEvent) {\r\n event.delta = sourceEvent.wheelDelta;\r\n event.ctrlKey = sourceEvent.ctrlKey;\r\n event.altKey = sourceEvent.altKey;\r\n event.shiftKey = sourceEvent.shiftKey;\r\n event.screenX = (sourceEvent.clientX != null) ? sourceEvent.clientX : sourceEvent.changedTouches[0].clientX;\r\n event.screenY = (sourceEvent.clientY != null) ? sourceEvent.clientY : sourceEvent.changedTouches[0].clientY;\r\n }\r\n if (collision == null)\r\n collision = this._iCollision;\r\n // 3D properties.\r\n if (collision) {\r\n // Object.\r\n event.entity = collision.entity;\r\n event.renderable = collision.renderable;\r\n // UV.\r\n event.uv = collision.uv;\r\n // Position.\r\n event.position = collision.position ? collision.position.clone() : null;\r\n // Normal.\r\n event.normal = collision.normal ? collision.normal.clone() : null;\r\n // Face index.\r\n event.elementIndex = collision.elementIndex;\r\n }\r\n else {\r\n // Set all to null.\r\n event.uv = null;\r\n event.entity = null;\r\n event.position = this._nullVector;\r\n event.normal = this._nullVector;\r\n event.elementIndex = 0;\r\n }\r\n // Store event to be dispatched later.\r\n this._queuedEvents.push(event);\r\n };\r\n // ---------------------------------------------------------------------\r\n // Listeners.\r\n // ---------------------------------------------------------------------\r\n MouseManager.prototype.onMouseMove = function (event) {\r\n event.preventDefault();\r\n this.updateColliders(event);\r\n if (this._iCollision)\r\n this.queueDispatch(this._mouseMove, this._mouseMoveEvent = event);\r\n };\r\n MouseManager.prototype.onMouseOut = function (event) {\r\n this.updateColliders(event);\r\n if (this._iCollision)\r\n this.queueDispatch(this._mouseOut, event);\r\n };\r\n MouseManager.prototype.onMouseOver = function (event) {\r\n this.updateColliders(event);\r\n if (this._iCollision)\r\n this.queueDispatch(this._mouseOver, event);\r\n };\r\n MouseManager.prototype.onClick = function (event) {\r\n this.updateColliders(event);\r\n if (this._iCollision)\r\n this.queueDispatch(this._mouseClick, event);\r\n };\r\n MouseManager.prototype.onDoubleClick = function (event) {\r\n this.updateColliders(event);\r\n if (this._iCollision)\r\n this.queueDispatch(this._mouseDoubleClick, event);\r\n };\r\n MouseManager.prototype.onMouseDown = function (event) {\r\n event.preventDefault();\r\n this.updateColliders(event);\r\n if (this._iCollision)\r\n this.queueDispatch(this._mouseDown, event);\r\n };\r\n MouseManager.prototype.onMouseUp = function (event) {\r\n event.preventDefault();\r\n this.updateColliders(event);\r\n if (this._iCollision)\r\n this.queueDispatch(this._mouseUp, event);\r\n };\r\n MouseManager.prototype.onMouseWheel = function (event) {\r\n this.updateColliders(event);\r\n if (this._iCollision)\r\n this.queueDispatch(this._mouseWheel, event);\r\n };\r\n MouseManager.prototype.updateColliders = function (event) {\r\n var view;\r\n var mouseX = (event.clientX != null) ? event.clientX : event.changedTouches[0].clientX;\r\n var mouseY = (event.clientY != null) ? event.clientY : event.changedTouches[0].clientY;\r\n var len = this._viewLookup.length;\r\n for (var i = 0; i < len; i++) {\r\n view = this._viewLookup[i];\r\n view._pTouchPoints.length = 0;\r\n if (event.touches) {\r\n var touch;\r\n var len = event.touches.length;\r\n for (var i = 0; i < len; i++) {\r\n touch = event.touches[i];\r\n view._pTouchPoints.push(new TouchPoint(touch.clientX + view.x, touch.clientY + view.y, touch.identifier));\r\n }\r\n }\r\n if (this._iUpdateDirty)\r\n continue;\r\n if (mouseX < view.x || mouseX > view.x + view.width || mouseY < view.y || mouseY > view.y + view.height) {\r\n view._pMouseX = null;\r\n view._pMouseY = null;\r\n }\r\n else {\r\n view._pMouseX = mouseX + view.x;\r\n view._pMouseY = mouseY + view.y;\r\n view.updateCollider();\r\n if (view.layeredView && this._iCollision)\r\n break;\r\n }\r\n }\r\n this._iUpdateDirty = true;\r\n };\r\n return MouseManager;\r\n}());\r\nexport { MouseManager };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/managers/MouseManager.js","import * as tslib_1 from \"tslib\";\r\nimport { AbstractionBase } from \"@awayjs/core\";\r\nimport { DisplayObjectEvent, AxisAlignedBoundingBox, BoundingSphere, BoundsType, NullBounds } from \"@awayjs/scene\";\r\n/**\r\n * @class away.partition.EntityNode\r\n */\r\nvar DisplayObjectNode = (function (_super) {\r\n tslib_1.__extends(DisplayObjectNode, _super);\r\n function DisplayObjectNode(entity, pool) {\r\n var _this = _super.call(this, entity, pool) || this;\r\n _this.numEntities = 0;\r\n _this.isSceneGraphNode = false;\r\n _this._boundsDirty = true;\r\n _this._onInvalidatePartitionBoundsDelegate = function (event) { return _this._onInvalidatePartitionBounds(event); };\r\n _this._entity = entity;\r\n _this._entity.addEventListener(DisplayObjectEvent.INVALIDATE_PARTITION_BOUNDS, _this._onInvalidatePartitionBoundsDelegate);\r\n _this._boundsType = _this._entity.boundsType;\r\n return _this;\r\n }\r\n Object.defineProperty(DisplayObjectNode.prototype, \"debugVisible\", {\r\n get: function () {\r\n return this._entity.debugVisible;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n Object.defineProperty(DisplayObjectNode.prototype, \"bounds\", {\r\n /**\r\n * @internal\r\n */\r\n get: function () {\r\n if (this._boundsDirty)\r\n this._updateBounds();\r\n return this._bounds;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n /**\r\n *\r\n * @returns {boolean}\r\n */\r\n DisplayObjectNode.prototype.isCastingShadow = function () {\r\n return this._entity.castsShadows;\r\n };\r\n /**\r\n *\r\n * @returns {boolean}\r\n */\r\n DisplayObjectNode.prototype.isMask = function () {\r\n return this._entity.maskMode;\r\n };\r\n DisplayObjectNode.prototype.onClear = function (event) {\r\n _super.prototype.onClear.call(this, event);\r\n this._entity.removeEventListener(DisplayObjectEvent.INVALIDATE_PARTITION_BOUNDS, this._onInvalidatePartitionBoundsDelegate);\r\n this._entity = null;\r\n if (this._bounds)\r\n this._bounds.dispose();\r\n this._bounds = null;\r\n };\r\n DisplayObjectNode.prototype.onInvalidate = function (event) {\r\n _super.prototype.onInvalidate.call(this, event);\r\n if (this._boundsType != this._entity.boundsType) {\r\n this._boundsType = this._entity.boundsType;\r\n this._boundsDirty = true;\r\n }\r\n };\r\n /**\r\n *\r\n * @param planes\r\n * @param numPlanes\r\n * @returns {boolean}\r\n */\r\n DisplayObjectNode.prototype.isInFrustum = function (planes, numPlanes) {\r\n return true;\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n DisplayObjectNode.prototype.isIntersectingRay = function (rayPosition, rayDirection) {\r\n return true;\r\n };\r\n /**\r\n *\r\n * @returns {boolean}\r\n */\r\n DisplayObjectNode.prototype.isRenderable = function () {\r\n return true;\r\n };\r\n DisplayObjectNode.prototype.renderBounds = function (traverser) {\r\n traverser.applyEntity(this.bounds.boundsPrimitive);\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n DisplayObjectNode.prototype.acceptTraverser = function (traverser) {\r\n // do nothing here\r\n };\r\n DisplayObjectNode.prototype._onInvalidatePartitionBounds = function (event) {\r\n // do nothing here\r\n };\r\n DisplayObjectNode.prototype._updateBounds = function () {\r\n if (this._bounds)\r\n this._bounds.dispose();\r\n if (this._boundsType == BoundsType.AXIS_ALIGNED_BOX)\r\n this._bounds = new AxisAlignedBoundingBox(this._entity);\r\n else if (this._boundsType == BoundsType.SPHERE)\r\n this._bounds = new BoundingSphere(this._entity);\r\n else if (this._boundsType == BoundsType.NULL)\r\n this._bounds = new NullBounds();\r\n this._boundsDirty = false;\r\n };\r\n return DisplayObjectNode;\r\n}(AbstractionBase));\r\nexport { DisplayObjectNode };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/partition/DisplayObjectNode.js","import * as tslib_1 from \"tslib\";\r\nimport { DisplayObjectNode } from \"./DisplayObjectNode\";\r\n/**\r\n * Maintains scenegraph heirarchy when collecting nodes\r\n */\r\nvar SceneGraphNode = (function (_super) {\r\n tslib_1.__extends(SceneGraphNode, _super);\r\n function SceneGraphNode() {\r\n var _this = _super.apply(this, arguments) || this;\r\n _this.isSceneGraphNode = true;\r\n _this._numNodes = 0;\r\n _this._pChildNodes = new Array();\r\n _this._childDepths = new Array();\r\n _this._numMasks = 0;\r\n _this._childMasks = new Array();\r\n return _this;\r\n }\r\n /**\r\n *\r\n * @param traverser\r\n */\r\n SceneGraphNode.prototype.acceptTraverser = function (traverser) {\r\n //containers nodes are for ordering only, no need to check enterNode or debugVisible\r\n if (this.numEntities == 0)\r\n return;\r\n var i;\r\n for (i = this._numNodes - 1; i >= 0; i--)\r\n this._pChildNodes[i].acceptTraverser(traverser);\r\n for (i = this._numMasks - 1; i >= 0; i--)\r\n this._childMasks[i].acceptTraverser(traverser);\r\n };\r\n /**\r\n *\r\n * @param node\r\n * @internal\r\n */\r\n SceneGraphNode.prototype.iAddNode = function (node) {\r\n node.parent = this;\r\n if (node._entity.maskMode) {\r\n this._childMasks.push(node);\r\n this._numMasks++;\r\n }\r\n else {\r\n var depth = (this._entity != node._entity) ? node._entity._depthID : -16384;\r\n var len = this._childDepths.length;\r\n var index = len;\r\n while (index--)\r\n if (this._childDepths[index] < depth)\r\n break;\r\n index++;\r\n if (index < len) {\r\n this._pChildNodes.splice(index, 0, node);\r\n this._childDepths.splice(index, 0, depth);\r\n }\r\n else {\r\n this._pChildNodes.push(node);\r\n this._childDepths.push(depth);\r\n }\r\n this._numNodes++;\r\n }\r\n var numEntities = node.isSceneGraphNode ? node.numEntities : 1;\r\n node = this;\r\n do {\r\n node.numEntities += numEntities;\r\n } while ((node = node.parent) != null);\r\n };\r\n /**\r\n *\r\n * @param node\r\n * @internal\r\n */\r\n SceneGraphNode.prototype.iRemoveNode = function (node) {\r\n if (node._entity.maskMode) {\r\n this._childMasks.splice(this._childMasks.indexOf(node), 1);\r\n this._numMasks--;\r\n }\r\n else {\r\n var index = this._pChildNodes.indexOf(node);\r\n this._pChildNodes.splice(index, 1);\r\n this._childDepths.splice(index, 1);\r\n this._numNodes--;\r\n }\r\n var numEntities = node.numEntities;\r\n node = this;\r\n do {\r\n node.numEntities -= numEntities;\r\n } while ((node = node.parent) != null);\r\n };\r\n return SceneGraphNode;\r\n}(DisplayObjectNode));\r\nexport { SceneGraphNode };\r\nexport default SceneGraphNode;\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/partition/SceneGraphNode.js","/**\r\n * @class away.partition.Partition\r\n */\r\nvar PartitionBase = (function () {\r\n function PartitionBase(root) {\r\n this._abstractionPool = new Object();\r\n this._updateQueue = {};\r\n this._root = root;\r\n }\r\n Object.defineProperty(PartitionBase.prototype, \"root\", {\r\n get: function () {\r\n return this._root;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n PartitionBase.prototype.getAbstraction = function (entity) {\r\n return (this._abstractionPool[entity.id] || (this._abstractionPool[entity.id] = new PartitionBase._abstractionClassPool[entity.assetType](entity, this)));\r\n };\r\n /**\r\n *\r\n * @param image\r\n */\r\n PartitionBase.prototype.clearAbstraction = function (entity) {\r\n this._abstractionPool[entity.id] = null;\r\n };\r\n PartitionBase.prototype.traverse = function (traverser) {\r\n this.updateEntities();\r\n if (this._rootNode)\r\n this._rootNode.acceptTraverser(traverser);\r\n };\r\n PartitionBase.prototype.invalidateEntity = function (entity) {\r\n this._updateQueue[entity.id] = entity;\r\n };\r\n PartitionBase.prototype.updateEntity = function (entity) {\r\n entity._iInternalUpdate();\r\n if (entity.isEntity)\r\n this.updateNode(this.getAbstraction(entity));\r\n };\r\n PartitionBase.prototype.updateNode = function (node) {\r\n var targetNode = this.findParentForNode(node);\r\n if (node.parent != targetNode) {\r\n if (node.parent)\r\n node.parent.iRemoveNode(node);\r\n targetNode.iAddNode(node);\r\n }\r\n };\r\n PartitionBase.prototype.clearEntity = function (entity) {\r\n delete this._updateQueue[entity.id];\r\n if (entity.isEntity)\r\n this.clearNode(this.getAbstraction(entity));\r\n };\r\n PartitionBase.prototype.clearNode = function (node) {\r\n if (node.parent) {\r\n node.parent.iRemoveNode(node);\r\n node.parent = null;\r\n }\r\n };\r\n /**\r\n *\r\n * @param entity\r\n * @returns {away.partition.NodeBase}\r\n */\r\n PartitionBase.prototype.findParentForNode = function (node) {\r\n return this._rootNode;\r\n };\r\n PartitionBase.prototype.updateEntities = function () {\r\n var entity;\r\n //required for controllers with autoUpdate set to true and queued events\r\n for (var key in this._updateQueue)\r\n this.updateEntity(this._updateQueue[key]);\r\n //clear updateQueue\r\n this._updateQueue = {};\r\n };\r\n PartitionBase.prototype.dispose = function () {\r\n //TODO\r\n };\r\n /**\r\n *\r\n * @param imageObjectClass\r\n */\r\n PartitionBase.registerAbstraction = function (entityNodeClass, assetClass) {\r\n PartitionBase._abstractionClassPool[assetClass.assetType] = entityNodeClass;\r\n };\r\n return PartitionBase;\r\n}());\r\nexport { PartitionBase };\r\nPartitionBase._abstractionClassPool = new Object();\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/partition/PartitionBase.js","import * as tslib_1 from \"tslib\";\r\nimport { SceneGraphNode } from \"./SceneGraphNode\";\r\nimport { PartitionBase } from \"./PartitionBase\";\r\n/**\r\n * @class away.partition.Partition\r\n */\r\nvar SceneGraphPartition = (function (_super) {\r\n tslib_1.__extends(SceneGraphPartition, _super);\r\n function SceneGraphPartition(root) {\r\n var _this = _super.call(this, root) || this;\r\n _this._sceneGraphNodePool = new SceneGraphNodePool();\r\n return _this;\r\n }\r\n SceneGraphPartition.prototype.traverse = function (traverser) {\r\n _super.prototype.traverse.call(this, traverser);\r\n };\r\n /**\r\n *\r\n * @param entity\r\n * @returns {away.partition.NodeBase}\r\n */\r\n SceneGraphPartition.prototype.findParentForNode = function (node) {\r\n if (this._root == node._entity && node.isSceneGraphNode) {\r\n this._rootNode = node;\r\n return null;\r\n }\r\n if (!node.isSceneGraphNode && node._entity.isContainer)\r\n return this._sceneGraphNodePool.getAbstraction(node._entity);\r\n return this._sceneGraphNodePool.getAbstraction(node._entity.parent);\r\n };\r\n SceneGraphPartition.prototype.updateEntity = function (entity) {\r\n _super.prototype.updateEntity.call(this, entity);\r\n if (entity.isContainer)\r\n this.updateNode(this._sceneGraphNodePool.getAbstraction(entity));\r\n };\r\n SceneGraphPartition.prototype.clearEntity = function (entity) {\r\n _super.prototype.clearEntity.call(this, entity);\r\n if (entity.isContainer)\r\n this.clearNode(this._sceneGraphNodePool.getAbstraction(entity));\r\n };\r\n return SceneGraphPartition;\r\n}(PartitionBase));\r\nexport { SceneGraphPartition };\r\n/**\r\n * @class away.pool.SceneGraphNodePool\r\n */\r\nvar SceneGraphNodePool = (function () {\r\n function SceneGraphNodePool() {\r\n this._abstractionPool = new Object();\r\n }\r\n /**\r\n * //TODO\r\n *\r\n * @param entity\r\n * @returns EntityNode\r\n */\r\n SceneGraphNodePool.prototype.getAbstraction = function (entity) {\r\n return (this._abstractionPool[entity.id] || (this._abstractionPool[entity.id] = new SceneGraphNode(entity, this)));\r\n };\r\n /**\r\n * //TODO\r\n *\r\n * @param entity\r\n */\r\n SceneGraphNodePool.prototype.clearAbstraction = function (entity) {\r\n delete this._abstractionPool[entity.id];\r\n };\r\n return SceneGraphNodePool;\r\n}());\r\nexport { SceneGraphNodePool };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/partition/SceneGraphPartition.js","import * as tslib_1 from \"tslib\";\r\nimport { Vector3D } from \"@awayjs/core\";\r\nimport { TraverserBase } from \"@awayjs/graphics\";\r\n/**\r\n * Picks a 3d object from a view or scene by 3D raycast calculations.\r\n * Performs an initial coarse boundary calculation to return a subset of entities whose bounding volumes intersect with the specified ray,\r\n * then triggers an optional picking collider on individual renderable objects to further determine the precise values of the picking ray collision.\r\n *\r\n * @class away.pick.RaycastPicker\r\n */\r\nvar RaycastPicker = (function (_super) {\r\n tslib_1.__extends(RaycastPicker, _super);\r\n /**\r\n * Creates a new RaycastPicker object.\r\n *\r\n * @param findClosestCollision Determines whether the picker searches for the closest bounds collision along the ray,\r\n * or simply returns the first collision encountered. Defaults to false.\r\n */\r\n function RaycastPicker(findClosestCollision) {\r\n if (findClosestCollision === void 0) { findClosestCollision = false; }\r\n var _this = _super.call(this) || this;\r\n _this._entities = new Array();\r\n /**\r\n * @inheritDoc\r\n */\r\n _this.onlyMouseEnabled = true;\r\n _this._findClosestCollision = findClosestCollision;\r\n return _this;\r\n }\r\n /**\r\n * Returns true if the current node is at least partly in the frustum. If so, the partition node knows to pass on the traverser to its children.\r\n *\r\n * @param node The Partition3DNode object to frustum-test.\r\n */\r\n RaycastPicker.prototype.enterNode = function (node) {\r\n return node.isIntersectingRay(this._rayPosition, this._rayDirection) && !node.isMask();\r\n };\r\n /**\r\n * @inheritDoc\r\n */\r\n RaycastPicker.prototype.getCollision = function (rayPosition, rayDirection, view) {\r\n this._rayPosition = rayPosition;\r\n this._rayDirection = rayDirection;\r\n // collect entities to test\r\n view.traversePartitions(this);\r\n //early out if no collisions detected\r\n if (!this._entities.length)\r\n return null;\r\n //console.log(\"entities: \", this._entities)\r\n var collision = this.getPickingCollision(view);\r\n //discard entities\r\n this._entities.length = 0;\r\n return collision;\r\n };\r\n //\t\tpublic getEntityCollision(position:Vector3D, direction:Vector3D, entities:ArrayfillColor parameter, every pixel in\r\n * the bitmap is set to that color.\r\n *\r\n * By default, the bitmap is created as transparent, unless you pass\r\n * the value false for the transparent parameter. After you\r\n * create an opaque bitmap, you cannot change it to a transparent bitmap.\r\n * Every pixel in an opaque bitmap uses only 24 bits of color channel\r\n * information. If you define the bitmap as transparent, every pixel uses 32\r\n * bits of color channel information, including an alpha transparency\r\n * channel.
true\r\n * (transparent). To create a fully transparent bitmap,\r\n * set the value of the transparent\r\n * parameter to true and the value of the\r\n * fillColor parameter to 0x00000000(or to\r\n * 0). Setting the transparent property to\r\n * false can result in minor improvements\r\n * in rendering performance.\r\n * @param fillColor A 32-bit ARGB color value that you use to fill the\r\n * bitmap image area. The default value is\r\n * 0xFFFFFFFF(solid white).\r\n */\r\n function ViewImage2D(width, height, transparent, fillColor, powerOfTwo, stage) {\r\n if (transparent === void 0) { transparent = true; }\r\n if (fillColor === void 0) { fillColor = 0xffffffff; }\r\n if (powerOfTwo === void 0) { powerOfTwo = true; }\r\n if (stage === void 0) { stage = null; }\r\n var _this = _super.call(this, width, height, transparent, fillColor, powerOfTwo) || this;\r\n _this._fillColor = fillColor;\r\n _this._stage = stage;\r\n return _this;\r\n }\r\n Object.defineProperty(ViewImage2D.prototype, \"assetType\", {\r\n /**\r\n *\r\n * @returns {string}\r\n */\r\n get: function () {\r\n return ViewImage2D.assetType;\r\n },\r\n enumerable: true,\r\n configurable: true\r\n });\r\n ViewImage2D.prototype.createView = function () {\r\n //create the view\r\n this._view = new View(new DefaultRenderer(this._stage));\r\n this._view.disableMouseEvents = true;\r\n this._view.width = this._rect.width;\r\n this._view.height = this._rect.height;\r\n this._fillColor = this._fillColor;\r\n this._view.backgroundAlpha = this._transparent ? (this._fillColor & 0xff000000) >>> 24 : 1;\r\n this._view.backgroundColor = this._fillColor & 0xffffff;\r\n this._view.renderer.renderableSorter = null; //new RenderableSort2D();\r\n //create the projection\r\n var projection = new PerspectiveProjection();\r\n projection.coordinateSystem = CoordinateSystem.RIGHT_HANDED;\r\n projection.originX = 0;\r\n projection.originY = 0;\r\n projection.preserveFocalLength = true;\r\n projection.setViewRect(0, 0, this._rect.width, this._rect.height);\r\n projection.setStageRect(0, 0, this._rect.width, this._rect.height);\r\n this._view.camera.projection = projection;\r\n };\r\n /**\r\n * Frees memory that is used to store the BitmapImage2D object.\r\n *\r\n * When the dispose() method is called on an image, the width\r\n * and height of the image are set to 0. All subsequent calls to methods or\r\n * properties of this BitmapImage2D instance fail, and an exception is thrown.\r\n *
BitmapImage2D.dispose() releases the memory occupied by the\r\n * actual bitmap data, immediately(a bitmap can consume up to 64 MB of\r\n * memory). After using BitmapImage2D.dispose(), the BitmapImage2D\r\n * object is no longer usable and an exception may be thrown if\r\n * you call functions on the BitmapImage2D object. However,\r\n * BitmapImage2D.dispose() does not garbage collect the BitmapImage2D\r\n * object(approximately 128 bytes); the memory occupied by the actual\r\n * BitmapImage2D object is released at the time the BitmapImage2D object is\r\n * collected by the garbage collector.
RaycastPicker picking object.\r\n *\r\n * @see away.base.DisplayObject#pickingCollider\r\n * @see away.pick.RaycastPicker\r\n *\r\n * @class away.pick.JSPickingCollider\r\n */\r\nvar JSPickingCollider = (function () {\r\n /**\r\n * Creates a new JSPickingCollider object.\r\n *\r\n * @param findClosestCollision Determines whether the picking collider searches for the closest collision along the ray. Defaults to false.\r\n */\r\n function JSPickingCollider(findClosestCollision) {\r\n if (findClosestCollision === void 0) { findClosestCollision = false; }\r\n this._findClosestCollision = findClosestCollision;\r\n }\r\n /**\r\n * Tests a Billboard object for a collision with the picking ray.\r\n *\r\n * @param billboard The billboard instance to be tested.\r\n * @param pickingCollision The collision object used to store the collision results\r\n * @param findClosest\r\n */\r\n JSPickingCollider.prototype.testBillboardCollision = function (billboard, material, pickingCollision) {\r\n pickingCollision.renderable = null;\r\n //if (this._testGraphicCollision(TriangleElements object for a collision with the picking ray.\r\n *\r\n * @param triangleElements\r\n * @param material\r\n * @param pickingCollision\r\n * @returns {boolean}\r\n */\r\n JSPickingCollider.prototype.testTriangleCollision = function (triangleElements, material, pickingCollision, count, offset) {\r\n if (offset === void 0) { offset = 0; }\r\n var rayPosition = pickingCollision.rayPosition;\r\n var rayDirection = pickingCollision.rayDirection;\r\n var t;\r\n var i0, i1, i2;\r\n var rx, ry, rz;\r\n var nx, ny, nz;\r\n var cx, cy, cz;\r\n var coeff, u, v, w;\r\n var p0x, p0y, p0z;\r\n var p1x, p1y, p1z;\r\n var p2x, p2y, p2z;\r\n var s0x, s0y, s0z;\r\n var s1x, s1y, s1z;\r\n var nl, nDotV, D, disToPlane;\r\n var Q1Q2, Q1Q1, Q2Q2, RQ1, RQ2;\r\n var collisionTriangleIndex = -1;\r\n var bothSides = material.bothSides;\r\n var positions = triangleElements.positions.get(count, offset);\r\n var posDim = triangleElements.positions.dimensions;\r\n var posStride = triangleElements.positions.stride;\r\n var indices;\r\n if (triangleElements.indices) {\r\n indices = triangleElements.indices.get(triangleElements.numElements);\r\n count = indices.length;\r\n }\r\n for (var index = 0; index < count; index += 3) {\r\n // evaluate triangle indices\r\n if (indices) {\r\n i0 = indices[index] * posStride;\r\n i1 = indices[index + 1] * posStride;\r\n i2 = indices[index + 2] * posStride;\r\n }\r\n else {\r\n i0 = index * posStride;\r\n i1 = (index + 1) * posStride;\r\n i2 = (index + 2) * posStride;\r\n }\r\n // evaluate triangle positions\r\n p0x = positions[i0];\r\n p1x = positions[i1];\r\n p2x = positions[i2];\r\n s0x = p1x - p0x; // s0 = p1 - p0\r\n s1x = p2x - p0x; // s1 = p2 - p0\r\n p0y = positions[i0 + 1];\r\n p1y = positions[i1 + 1];\r\n p2y = positions[i2 + 1];\r\n s0y = p1y - p0y;\r\n s1y = p2y - p0y;\r\n if (posDim == 3) {\r\n p0z = positions[i0 + 2];\r\n p1z = positions[i1 + 2];\r\n p2z = positions[i2 + 2];\r\n s0z = p1z - p0z;\r\n s1z = p2z - p0z;\r\n // evaluate sides and triangle normal\r\n nx = s0y * s1z - s0z * s1y; // n = s0 x s1\r\n ny = s0z * s1x - s0x * s1z;\r\n nz = s0x * s1y - s0y * s1x;\r\n nl = 1 / Math.sqrt(nx * nx + ny * ny + nz * nz); // normalize n\r\n nx *= nl;\r\n ny *= nl;\r\n nz *= nl;\r\n }\r\n else {\r\n nx = 0;\r\n ny = 0;\r\n nz = 1;\r\n }\r\n // -- plane intersection test --\r\n nDotV = nx * rayDirection.x + ny * +rayDirection.y + nz * rayDirection.z; // rayDirection . normal\r\n if ((!bothSides && nDotV < 0.0) || (bothSides && nDotV != 0.0)) {\r\n // find collision t\r\n D = -(nx * p0x + ny * p0y + nz * p0z);\r\n disToPlane = -(nx * rayPosition.x + ny * rayPosition.y + nz * rayPosition.z + D);\r\n t = disToPlane / nDotV;\r\n // find collision point\r\n cx = rayPosition.x + t * rayDirection.x;\r\n cy = rayPosition.y + t * rayDirection.y;\r\n cz = rayPosition.z + t * rayDirection.z;\r\n // collision point inside triangle? ( using barycentric coordinates )\r\n Q1Q2 = s0x * s1x + s0y * s1y + s0z * s1z;\r\n Q1Q1 = s0x * s0x + s0y * s0y + s0z * s0z;\r\n Q2Q2 = s1x * s1x + s1y * s1y + s1z * s1z;\r\n rx = cx - p0x;\r\n ry = cy - p0y;\r\n rz = cz - p0z;\r\n RQ1 = rx * s0x + ry * s0y + rz * s0z;\r\n RQ2 = rx * s1x + ry * s1y + rz * s1z;\r\n coeff = 1 / (Q1Q1 * Q2Q2 - Q1Q2 * Q1Q2);\r\n v = coeff * (Q2Q2 * RQ1 - Q1Q2 * RQ2);\r\n w = coeff * (-Q1Q2 * RQ1 + Q1Q1 * RQ2);\r\n if (v < 0)\r\n continue;\r\n if (w < 0)\r\n continue;\r\n u = 1 - v - w;\r\n if (!(u < 0) && t > 0 && t < pickingCollision.rayEntryDistance) {\r\n collisionTriangleIndex = index / 3;\r\n pickingCollision.rayEntryDistance = t;\r\n pickingCollision.position = new Vector3D(cx, cy, cz);\r\n pickingCollision.normal = new Vector3D(nx, ny, nz);\r\n if (triangleElements.uvs) {\r\n var uvs = triangleElements.uvs.get(triangleElements.numVertices);\r\n var uvStride = triangleElements.uvs.stride;\r\n var uIndex = indices[index] * uvStride;\r\n var uv0 = new Vector3D(uvs[uIndex], uvs[uIndex + 1]);\r\n uIndex = indices[index + 1] * uvStride;\r\n var uv1 = new Vector3D(uvs[uIndex], uvs[uIndex + 1]);\r\n uIndex = indices[index + 2] * uvStride;\r\n var uv2 = new Vector3D(uvs[uIndex], uvs[uIndex + 1]);\r\n pickingCollision.uv = new Point(u * uv0.x + v * uv1.x + w * uv2.x, u * uv0.y + v * uv1.y + w * uv2.y);\r\n }\r\n pickingCollision.elementIndex = collisionTriangleIndex;\r\n // if not looking for best hit, first found will do...\r\n if (!this._findClosestCollision)\r\n return true;\r\n }\r\n }\r\n }\r\n if (collisionTriangleIndex >= 0)\r\n return true;\r\n return false;\r\n };\r\n //\r\n ///**\r\n // * Tests a CurveElements object for a collision with the picking ray.\r\n // *\r\n // * @param triangleElements\r\n // * @param material\r\n // * @param pickingCollision\r\n // * @returns {boolean}\r\n // */\r\n //public testCurveCollision(curveElements:CurveElements, material:MaterialBase, pickingCollision:PickingCollision, shortestCollisionDistance:number):boolean\r\n //{\r\n //\tvar rayPosition:Vector3D = pickingCollision.localRayPosition;\r\n //\tvar rayDirection:Vector3D = pickingCollision.localRayDirection;\r\n //\r\n //\t//project ray onto x/y plane to generate useful test points from mouse coordinates\r\n //\t//this will only work while all points lie on the x/y plane\r\n //\tvar plane:Vector3D = new Vector3D(0,0,-1,0);\r\n //\r\n //\tvar result:Vector3D = new Vector3D();\r\n //\tvar distance:number = plane.x * rayPosition.x + plane.y * rayPosition.y + plane.z * rayPosition.z + plane.w;//distance(position);\r\n //\tresult.x = rayPosition.x - ( plane.x*distance);\r\n //\tresult.y = rayPosition.y - ( plane.y*distance);\r\n //\tresult.z = rayPosition.z - ( plane.z*distance);\r\n //\tvar normal:Vector3D = new Vector3D(plane.x,plane.y,plane.z);\r\n //\tvar t:number = -(rayPosition.dotProduct(normal))/(rayDirection.dotProduct(normal));\r\n //\trayDirection.scaleBy(t);\r\n //\tvar p:Vector3D = rayPosition.add(rayDirection);\r\n //\r\n //\tvar indices:Uint16Array = curveElements.indices.get(curveElements.numElements);\r\n //\tvar collisionCurveIndex:number = -1;\r\n //\tvar bothSides:boolean = material.bothSides;\r\n //\r\n //\r\n //\tvar positions:Float32Array = curveElements.positions.get(curveElements.numVertices);\r\n //\tvar posDim:number = curveElements.positions.dimensions;\r\n //\tvar curves:Float32Array = curveElements.curves.get(curveElements.numVertices);\r\n //\tvar curveDim:number = curveElements.curves.dimensions;\r\n //\tvar uvs:ArrayBufferView = curveElements.uvs.get(curveElements.numVertices);\r\n //\tvar uvDim:number = curveElements.uvs.dimensions;\r\n //\tvar numIndices:number = indices.length;\r\n //\r\n //\r\n //\tfor(var index:number = 0; index < numIndices; index+=3)\r\n //\t{\r\n //\t\tvar id0:number = indices[index];\r\n //\t\tvar id1:number = indices[index + 1] * posDim;\r\n //\t\tvar id2:number = indices[index + 2] * posDim;\r\n //\r\n //\t\tvar ax:number = positions[id0 * posDim];\r\n //\t\tvar ay:number = positions[id0 * posDim + 1];\r\n //\t\tvar bx:number = positions[id1];\r\n //\t\tvar by:number = positions[id1 + 1];\r\n //\t\tvar cx:number = positions[id2];\r\n //\t\tvar cy:number = positions[id2 + 1];\r\n //\r\n //\t\tvar curvex:number = curves[id0 * curveDim];\r\n //\t\tvar az:number = positions[id0 * posDim + 2];\r\n //\r\n //\t\t//console.log(ax, ay, bx, by, cx, cy);\r\n //\r\n //\t\t//from a to p\r\n //\t\tvar dx:number = ax - p.x;\r\n //\t\tvar dy:number = ay - p.y;\r\n //\r\n //\t\t//edge normal (a-b)\r\n //\t\tvar nx:number = by - ay;\r\n //\t\tvar ny:number = -(bx - ax);\r\n //\r\n //\t\t//console.log(ax,ay,bx,by,cx,cy);\r\n //\r\n //\t\tvar dot:number = (dx * nx) + (dy * ny);\r\n //\t\t//console.log(\"dot a\",dot);\r\n //\t\tif (dot > 0)\r\n //\t\t\tcontinue;\r\n //\r\n //\t\tdx = bx - p.x;\r\n //\t\tdy = by - p.y;\r\n //\t\tnx = cy - by;\r\n //\t\tny = -(cx - bx);\r\n //\r\n //\t\tdot = (dx * nx) + (dy * ny);\r\n //\t\t//console.log(\"dot b\",dot);\r\n //\t\tif (dot > 0)\r\n //\t\t\tcontinue;\r\n //\r\n //\t\tdx = cx - p.x;\r\n //\t\tdy = cy - p.y;\r\n //\t\tnx = ay - cy;\r\n //\t\tny = -(ax - cx);\r\n //\r\n //\t\tdot = (dx * nx) + (dy * ny);\r\n //\t\t//console.log(\"dot c\",dot);\r\n //\t\tif (dot > 0)\r\n //\t\t\tcontinue;\r\n //\r\n //\t\t//check if not solid\r\n //\t\tif (curvex != 2) {\r\n //\r\n //\t\t\tvar v0x:number = bx - ax;\r\n //\t\t\tvar v0y:number = by - ay;\r\n //\t\t\tvar v1x:number = cx - ax;\r\n //\t\t\tvar v1y:number = cy - ay;\r\n //\t\t\tvar v2x:number = p.x - ax;\r\n //\t\t\tvar v2y:number = p.y - ay;\r\n //\r\n //\t\t\tvar den:number = v0x * v1y - v1x * v0y;\r\n //\t\t\tvar v:number = (v2x * v1y - v1x * v2y) / den;\r\n //\t\t\tvar w:number = (v0x * v2y - v2x * v0y) / den;\r\n //\t\t\tvar u:number = 1 - v - w;\r\n //\r\n //\t\t\tvar uu:number = 0.5 * v + w;// (0 * u) + (0.5 * v) + (1 * w);// (lerp(0, 0.5, v) + lerp(0.5, 1, w) + lerp(1, 0, u)) / 1.5;\r\n //\t\t\tvar vv:number = w;// (0 * u) + (0 * v) + (1 * w);// (lerp(0, 1, w) + lerp(1, 0, u)) / 1;\r\n //\r\n //\t\t\tvar d:number = uu * uu - vv;\r\n //\r\n //\t\t\tif ((d > 0 && az == -1) || (d < 0 && az == 1))\r\n //\t\t\t\tcontinue;\r\n //\t\t}\r\n //\t\t//TODO optimize away this pointless check as the distance is always the same\r\n //\t\t//also this stuff should only be calculated right before the return and not for each hit\r\n //\t\tif (distance < shortestCollisionDistance) {\r\n //\t\t\tshortestCollisionDistance = distance;\r\n //\t\t\tcollisionCurveIndex = index/3;\r\n //\t\t\tpickingCollision.rayEntryDistance = distance;\r\n //\t\t\tpickingCollision.localPosition = p;\r\n //\t\t\tpickingCollision.localNormal = new Vector3D(0, 0, 1);\r\n //\t\t\tpickingCollision.uv = this._getCollisionUV(indices, uvs, index, v, w, u, uvDim);\r\n //\t\t\tpickingCollision.index = index;\r\n //\t\t\t//\t\t\t\t\t\tpickingCollision.elementIndex = this.pGetSpriteGraphicIndex(renderable);\r\n //\r\n //\t\t\t// if not looking for best hit, first found will do...\r\n //\t\t\tif (!this._findClosestCollision)\r\n //\t\t\t\treturn true;\r\n //\t\t}\r\n //\t}\r\n //\r\n //\tif (collisionCurveIndex >= 0)\r\n //\t\treturn true;\r\n //\r\n //\treturn false;\r\n //}\r\n /**\r\n * Tests a LineElements object for a collision with the picking ray.\r\n *\r\n * @param triangleElements\r\n * @param material\r\n * @param pickingCollision\r\n * @returns {boolean}\r\n */\r\n JSPickingCollider.prototype.testLineCollision = function (lineElements, material, pickingCollision, count, offset) {\r\n if (offset === void 0) { offset = 0; }\r\n return false;\r\n };\r\n return JSPickingCollider;\r\n}());\r\nexport { JSPickingCollider };\r\n\n\n\n// WEBPACK FOOTER //\n// ../dist/lib/pick/JSPickingCollider.js","module.exports = require('./src/tess2');\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./node_modules/tess2/index.js\n// module id = 18\n// module chunks = 9","/*\n** SGI FREE SOFTWARE LICENSE B (Version 2.0, Sept. 18, 2008) \n** Copyright (C) [dates of first publication] Silicon Graphics, Inc.\n** All Rights Reserved.\n**\n** Permission is hereby granted, free of charge, to any person obtaining a copy\n** of this software and associated documentation files (the \"Software\"), to deal\n** in the Software without restriction, including without limitation the rights\n** to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies\n** of the Software, and to permit persons to whom the Software is furnished to do so,\n** subject to the following conditions:\n** \n** The above copyright notice including the dates of first publication and either this\n** permission notice or a reference to http://oss.sgi.com/projects/FreeB/ shall be\n** included in all copies or substantial portions of the Software. \n**\n** THE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED,\n** INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A\n** PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL SILICON GRAPHICS, INC.\n** BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,\n** TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE\n** OR OTHER DEALINGS IN THE SOFTWARE.\n** \n** Except as contained in this notice, the name of Silicon Graphics, Inc. shall not\n** be used in advertising or otherwise to promote the sale, use or other dealings in\n** this Software without prior written authorization from Silicon Graphics, Inc.\n*/\n/*\n** Author: Mikko Mononen, Aug 2013.\n** The code is based on GLU libtess by Eric Veach, July 1994\n*/\n\n\t\"use strict\";\n\n\t/* Public API */\n\n\tvar Tess2 = {};\n\n\tmodule.exports = Tess2;\n\t\n\tTess2.WINDING_ODD = 0;\n\tTess2.WINDING_NONZERO = 1;\n\tTess2.WINDING_POSITIVE = 2;\n\tTess2.WINDING_NEGATIVE = 3;\n\tTess2.WINDING_ABS_GEQ_TWO = 4;\n\n\tTess2.POLYGONS = 0;\n\tTess2.CONNECTED_POLYGONS = 1;\n\tTess2.BOUNDARY_CONTOURS = 2;\n\n\tTess2.tesselate = function(opts) {\n\t\tvar debug = opts.debug || false;\n\t\tvar tess = new Tesselator();\n\t\tfor (var i = 0; i < opts.contours.length; i++) {\n\t\t\ttess.addContour(opts.vertexSize || 2, opts.contours[i]);\n\t\t}\n\t\ttess.tesselate(opts.windingRule || Tess2.WINDING_ODD,\n\t\t\t\t\t opts.elementType || Tess2.POLYGONS,\n\t\t\t\t\t opts.polySize || 3,\n\t\t\t\t\t opts.vertexSize || 2,\n\t\t\t\t\t opts.normal || [0,0,1]);\n\t\treturn {\n\t\t\tvertices: tess.vertices,\n\t\t\tvertexIndices: tess.vertexIndices,\n\t\t\tvertexCount: tess.vertexCount,\n\t\t\telements: tess.elements,\n\t\t\telementCount: tess.elementCount,\n\t\t\tmesh: debug ? tess.mesh : undefined\n\t\t};\n\t};\n\n\t/* Internal */\n\n\tvar assert = function(cond) {\n\t\tif (!cond) {\n\t\t\tthrow \"Assertion Failed!\";\n\t\t}\n\t}\n\n\t/* The mesh structure is similar in spirit, notation, and operations\n\t* to the \"quad-edge\" structure (see L. Guibas and J. Stolfi, Primitives\n\t* for the manipulation of general subdivisions and the computation of\n\t* Voronoi diagrams, ACM Transactions on Graphics, 4(2):74-123, April 1985).\n\t* For a simplified description, see the course notes for CS348a,\n\t* \"Mathematical Foundations of Computer Graphics\", available at the\n\t* Stanford bookstore (and taught during the fall quarter).\n\t* The implementation also borrows a tiny subset of the graph-based approach\n\t* use in Mantyla's Geometric Work Bench (see M. Mantyla, An Introduction\n\t* to Sold Modeling, Computer Science Press, Rockville, Maryland, 1988).\n\t*\n\t* The fundamental data structure is the \"half-edge\". Two half-edges\n\t* go together to make an edge, but they point in opposite directions.\n\t* Each half-edge has a pointer to its mate (the \"symmetric\" half-edge Sym),\n\t* its origin vertex (Org), the face on its left side (Lface), and the\n\t* adjacent half-edges in the CCW direction around the origin vertex\n\t* (Onext) and around the left face (Lnext). There is also a \"next\"\n\t* pointer for the global edge list (see below).\n\t*\n\t* The notation used for mesh navigation:\n\t* Sym = the mate of a half-edge (same edge, but opposite direction)\n\t* Onext = edge CCW around origin vertex (keep same origin)\n\t* Dnext = edge CCW around destination vertex (keep same dest)\n\t* Lnext = edge CCW around left face (dest becomes new origin)\n\t* Rnext = edge CCW around right face (origin becomes new dest)\n\t*\n\t* \"prev\" means to substitute CW for CCW in the definitions above.\n\t*\n\t* The mesh keeps global lists of all vertices, faces, and edges,\n\t* stored as doubly-linked circular lists with a dummy header node.\n\t* The mesh stores pointers to these dummy headers (vHead, fHead, eHead).\n\t*\n\t* The circular edge list is special; since half-edges always occur\n\t* in pairs (e and e->Sym), each half-edge stores a pointer in only\n\t* one direction. Starting at eHead and following the e->next pointers\n\t* will visit each *edge* once (ie. e or e->Sym, but not both).\n\t* e->Sym stores a pointer in the opposite direction, thus it is\n\t* always true that e->Sym->next->Sym->next == e.\n\t*\n\t* Each vertex has a pointer to next and previous vertices in the\n\t* circular list, and a pointer to a half-edge with this vertex as\n\t* the origin (NULL if this is the dummy header). There is also a\n\t* field \"data\" for client data.\n\t*\n\t* Each face has a pointer to the next and previous faces in the\n\t* circular list, and a pointer to a half-edge with this face as\n\t* the left face (NULL if this is the dummy header). There is also\n\t* a field \"data\" for client data.\n\t*\n\t* Note that what we call a \"face\" is really a loop; faces may consist\n\t* of more than one loop (ie. not simply connected), but there is no\n\t* record of this in the data structure. The mesh may consist of\n\t* several disconnected regions, so it may not be possible to visit\n\t* the entire mesh by starting at a half-edge and traversing the edge\n\t* structure.\n\t*\n\t* The mesh does NOT support isolated vertices; a vertex is deleted along\n\t* with its last edge. Similarly when two faces are merged, one of the\n\t* faces is deleted (see tessMeshDelete below). For mesh operations,\n\t* all face (loop) and vertex pointers must not be NULL. However, once\n\t* mesh manipulation is finished, TESSmeshZapFace can be used to delete\n\t* faces of the mesh, one at a time. All external faces can be \"zapped\"\n\t* before the mesh is returned to the client; then a NULL face indicates\n\t* a region which is not part of the output polygon.\n\t*/\n\n\tfunction TESSvertex() {\n\t\tthis.next = null;\t/* next vertex (never NULL) */\n\t\tthis.prev = null;\t/* previous vertex (never NULL) */\n\t\tthis.anEdge = null;\t/* a half-edge with this origin */\n\n\t\t/* Internal data (keep hidden) */\n\t\tthis.coords = [0,0,0];\t/* vertex location in 3D */\n\t\tthis.s = 0.0;\n\t\tthis.t = 0.0;\t\t\t/* projection onto the sweep plane */\n\t\tthis.pqHandle = 0;\t\t/* to allow deletion from priority queue */\n\t\tthis.n = 0;\t\t\t\t/* to allow identify unique vertices */\n\t\tthis.idx = 0;\t\t\t/* to allow map result to original verts */\n\t} \n\n\tfunction TESSface() {\n\t\tthis.next = null;\t\t/* next face (never NULL) */\n\t\tthis.prev = null;\t\t/* previous face (never NULL) */\n\t\tthis.anEdge = null;\t\t/* a half edge with this left face */\n\n\t\t/* Internal data (keep hidden) */\n\t\tthis.trail = null;\t\t/* \"stack\" for conversion to strips */\n\t\tthis.n = 0;\t\t\t\t/* to allow identiy unique faces */\n\t\tthis.marked = false;\t/* flag for conversion to strips */\n\t\tthis.inside = false;\t/* this face is in the polygon interior */\n\t};\n\n\tfunction TESShalfEdge(side) {\n\t\tthis.next = null;\t\t/* doubly-linked list (prev==Sym->next) */\n\t\tthis.Sym = null;\t\t/* same edge, opposite direction */\n\t\tthis.Onext = null;\t\t/* next edge CCW around origin */\n\t\tthis.Lnext = null;\t\t/* next edge CCW around left face */\n\t\tthis.Org = null;\t\t/* origin vertex (Overtex too long) */\n\t\tthis.Lface = null;\t\t/* left face */\n\n\t\t/* Internal data (keep hidden) */\n\t\tthis.activeRegion = null;\t/* a region with this upper edge (sweep.c) */\n\t\tthis.winding = 0;\t\t\t/* change in winding number when crossing\n\t\t\t\t\t\t\t\t\t from the right face to the left face */\n\t\tthis.side = side;\n\t};\n\n\tTESShalfEdge.prototype = {\n\t\tget Rface() { return this.Sym.Lface; },\n\t\tset Rface(v) { this.Sym.Lface = v; },\n\t\tget Dst() { return this.Sym.Org; },\n\t\tset Dst(v) { this.Sym.Org = v; },\n\t\tget Oprev() { return this.Sym.Lnext; },\n\t\tset Oprev(v) { this.Sym.Lnext = v; },\n\t\tget Lprev() { return this.Onext.Sym; },\n\t\tset Lprev(v) { this.Onext.Sym = v; },\n\t\tget Dprev() { return this.Lnext.Sym; },\n\t\tset Dprev(v) { this.Lnext.Sym = v; },\n\t\tget Rprev() { return this.Sym.Onext; },\n\t\tset Rprev(v) { this.Sym.Onext = v; },\n\t\tget Dnext() { return /*this.Rprev*/this.Sym.Onext.Sym; }, /* 3 pointers */\n\t\tset Dnext(v) { /*this.Rprev*/this.Sym.Onext.Sym = v; }, /* 3 pointers */\n\t\tget Rnext() { return /*this.Oprev*/this.Sym.Lnext.Sym; }, /* 3 pointers */\n\t\tset Rnext(v) { /*this.Oprev*/this.Sym.Lnext.Sym = v; }, /* 3 pointers */\n\t};\n\n\n\n\tfunction TESSmesh() {\n\t\tvar v = new TESSvertex();\n\t\tvar f = new TESSface();\n\t\tvar e = new TESShalfEdge(0);\n\t\tvar eSym = new TESShalfEdge(1);\n\n\t\tv.next = v.prev = v;\n\t\tv.anEdge = null;\n\n\t\tf.next = f.prev = f;\n\t\tf.anEdge = null;\n\t\tf.trail = null;\n\t\tf.marked = false;\n\t\tf.inside = false;\n\n\t\te.next = e;\n\t\te.Sym = eSym;\n\t\te.Onext = null;\n\t\te.Lnext = null;\n\t\te.Org = null;\n\t\te.Lface = null;\n\t\te.winding = 0;\n\t\te.activeRegion = null;\n\n\t\teSym.next = eSym;\n\t\teSym.Sym = e;\n\t\teSym.Onext = null;\n\t\teSym.Lnext = null;\n\t\teSym.Org = null;\n\t\teSym.Lface = null;\n\t\teSym.winding = 0;\n\t\teSym.activeRegion = null;\n\n\t\tthis.vHead = v;\t\t/* dummy header for vertex list */\n\t\tthis.fHead = f;\t\t/* dummy header for face list */\n\t\tthis.eHead = e;\t\t/* dummy header for edge list */\n\t\tthis.eHeadSym = eSym;\t/* and its symmetric counterpart */\n\t};\n\n\t/* The mesh operations below have three motivations: completeness,\n\t* convenience, and efficiency. The basic mesh operations are MakeEdge,\n\t* Splice, and Delete. All the other edge operations can be implemented\n\t* in terms of these. The other operations are provided for convenience\n\t* and/or efficiency.\n\t*\n\t* When a face is split or a vertex is added, they are inserted into the\n\t* global list *before* the existing vertex or face (ie. e->Org or e->Lface).\n\t* This makes it easier to process all vertices or faces in the global lists\n\t* without worrying about processing the same data twice. As a convenience,\n\t* when a face is split, the \"inside\" flag is copied from the old face.\n\t* Other internal data (v->data, v->activeRegion, f->data, f->marked,\n\t* f->trail, e->winding) is set to zero.\n\t*\n\t* ********************** Basic Edge Operations **************************\n\t*\n\t* tessMeshMakeEdge( mesh ) creates one edge, two vertices, and a loop.\n\t* The loop (face) consists of the two new half-edges.\n\t*\n\t* tessMeshSplice( eOrg, eDst ) is the basic operation for changing the\n\t* mesh connectivity and topology. It changes the mesh so that\n\t* eOrg->Onext <- OLD( eDst->Onext )\n\t* eDst->Onext <- OLD( eOrg->Onext )\n\t* where OLD(...) means the value before the meshSplice operation.\n\t*\n\t* This can have two effects on the vertex structure:\n\t* - if eOrg->Org != eDst->Org, the two vertices are merged together\n\t* - if eOrg->Org == eDst->Org, the origin is split into two vertices\n\t* In both cases, eDst->Org is changed and eOrg->Org is untouched.\n\t*\n\t* Similarly (and independently) for the face structure,\n\t* - if eOrg->Lface == eDst->Lface, one loop is split into two\n\t* - if eOrg->Lface != eDst->Lface, two distinct loops are joined into one\n\t* In both cases, eDst->Lface is changed and eOrg->Lface is unaffected.\n\t*\n\t* tessMeshDelete( eDel ) removes the edge eDel. There are several cases:\n\t* if (eDel->Lface != eDel->Rface), we join two loops into one; the loop\n\t* eDel->Lface is deleted. Otherwise, we are splitting one loop into two;\n\t* the newly created loop will contain eDel->Dst. If the deletion of eDel\n\t* would create isolated vertices, those are deleted as well.\n\t*\n\t* ********************** Other Edge Operations **************************\n\t*\n\t* tessMeshAddEdgeVertex( eOrg ) creates a new edge eNew such that\n\t* eNew == eOrg->Lnext, and eNew->Dst is a newly created vertex.\n\t* eOrg and eNew will have the same left face.\n\t*\n\t* tessMeshSplitEdge( eOrg ) splits eOrg into two edges eOrg and eNew,\n\t* such that eNew == eOrg->Lnext. The new vertex is eOrg->Dst == eNew->Org.\n\t* eOrg and eNew will have the same left face.\n\t*\n\t* tessMeshConnect( eOrg, eDst ) creates a new edge from eOrg->Dst\n\t* to eDst->Org, and returns the corresponding half-edge eNew.\n\t* If eOrg->Lface == eDst->Lface, this splits one loop into two,\n\t* and the newly created loop is eNew->Lface. Otherwise, two disjoint\n\t* loops are merged into one, and the loop eDst->Lface is destroyed.\n\t*\n\t* ************************ Other Operations *****************************\n\t*\n\t* tessMeshNewMesh() creates a new mesh with no edges, no vertices,\n\t* and no loops (what we usually call a \"face\").\n\t*\n\t* tessMeshUnion( mesh1, mesh2 ) forms the union of all structures in\n\t* both meshes, and returns the new mesh (the old meshes are destroyed).\n\t*\n\t* tessMeshDeleteMesh( mesh ) will free all storage for any valid mesh.\n\t*\n\t* tessMeshZapFace( fZap ) destroys a face and removes it from the\n\t* global face list. All edges of fZap will have a NULL pointer as their\n\t* left face. Any edges which also have a NULL pointer as their right face\n\t* are deleted entirely (along with any isolated vertices this produces).\n\t* An entire mesh can be deleted by zapping its faces, one at a time,\n\t* in any order. Zapped faces cannot be used in further mesh operations!\n\t*\n\t* tessMeshCheckMesh( mesh ) checks a mesh for self-consistency.\n\t*/\n\n\tTESSmesh.prototype = {\n\n\t\t/* MakeEdge creates a new pair of half-edges which form their own loop.\n\t\t* No vertex or face structures are allocated, but these must be assigned\n\t\t* before the current edge operation is completed.\n\t\t*/\n\t\t//static TESShalfEdge *MakeEdge( TESSmesh* mesh, TESShalfEdge *eNext )\n\t\tmakeEdge_: function(eNext) {\n\t\t\tvar e = new TESShalfEdge(0);\n\t\t\tvar eSym = new TESShalfEdge(1);\n\n\t\t\t/* Make sure eNext points to the first edge of the edge pair */\n\t\t\tif( eNext.Sym.side < eNext.side ) { eNext = eNext.Sym; }\n\n\t\t\t/* Insert in circular doubly-linked list before eNext.\n\t\t\t* Note that the prev pointer is stored in Sym->next.\n\t\t\t*/\n\t\t\tvar ePrev = eNext.Sym.next;\n\t\t\teSym.next = ePrev;\n\t\t\tePrev.Sym.next = e;\n\t\t\te.next = eNext;\n\t\t\teNext.Sym.next = eSym;\n\n\t\t\te.Sym = eSym;\n\t\t\te.Onext = e;\n\t\t\te.Lnext = eSym;\n\t\t\te.Org = null;\n\t\t\te.Lface = null;\n\t\t\te.winding = 0;\n\t\t\te.activeRegion = null;\n\n\t\t\teSym.Sym = e;\n\t\t\teSym.Onext = eSym;\n\t\t\teSym.Lnext = e;\n\t\t\teSym.Org = null;\n\t\t\teSym.Lface = null;\n\t\t\teSym.winding = 0;\n\t\t\teSym.activeRegion = null;\n\n\t\t\treturn e;\n\t\t},\n\n\t\t/* Splice( a, b ) is best described by the Guibas/Stolfi paper or the\n\t\t* CS348a notes (see mesh.h). Basically it modifies the mesh so that\n\t\t* a->Onext and b->Onext are exchanged. This can have various effects\n\t\t* depending on whether a and b belong to different face or vertex rings.\n\t\t* For more explanation see tessMeshSplice() below.\n\t\t*/\n\t\t// static void Splice( TESShalfEdge *a, TESShalfEdge *b )\n\t\tsplice_: function(a, b) {\n\t\t\tvar aOnext = a.Onext;\n\t\t\tvar bOnext = b.Onext;\n\t\t\taOnext.Sym.Lnext = b;\n\t\t\tbOnext.Sym.Lnext = a;\n\t\t\ta.Onext = bOnext;\n\t\t\tb.Onext = aOnext;\n\t\t},\n\n\t\t/* MakeVertex( newVertex, eOrig, vNext ) attaches a new vertex and makes it the\n\t\t* origin of all edges in the vertex loop to which eOrig belongs. \"vNext\" gives\n\t\t* a place to insert the new vertex in the global vertex list. We insert\n\t\t* the new vertex *before* vNext so that algorithms which walk the vertex\n\t\t* list will not see the newly created vertices.\n\t\t*/\n\t\t//static void MakeVertex( TESSvertex *newVertex, TESShalfEdge *eOrig, TESSvertex *vNext )\n\t\tmakeVertex_: function(newVertex, eOrig, vNext) {\n\t\t\tvar vNew = newVertex;\n\t\t\tassert(vNew !== null);\n\n\t\t\t/* insert in circular doubly-linked list before vNext */\n\t\t\tvar vPrev = vNext.prev;\n\t\t\tvNew.prev = vPrev;\n\t\t\tvPrev.next = vNew;\n\t\t\tvNew.next = vNext;\n\t\t\tvNext.prev = vNew;\n\n\t\t\tvNew.anEdge = eOrig;\n\t\t\t/* leave coords, s, t undefined */\n\n\t\t\t/* fix other edges on this vertex loop */\n\t\t\tvar e = eOrig;\n\t\t\tdo {\n\t\t\t\te.Org = vNew;\n\t\t\t\te = e.Onext;\n\t\t\t} while(e !== eOrig);\n\t\t},\n\n\t\t/* MakeFace( newFace, eOrig, fNext ) attaches a new face and makes it the left\n\t\t* face of all edges in the face loop to which eOrig belongs. \"fNext\" gives\n\t\t* a place to insert the new face in the global face list. We insert\n\t\t* the new face *before* fNext so that algorithms which walk the face\n\t\t* list will not see the newly created faces.\n\t\t*/\n\t\t// static void MakeFace( TESSface *newFace, TESShalfEdge *eOrig, TESSface *fNext )\n\t\tmakeFace_: function(newFace, eOrig, fNext) {\n\t\t\tvar fNew = newFace;\n\t\t\tassert(fNew !== null); \n\n\t\t\t/* insert in circular doubly-linked list before fNext */\n\t\t\tvar fPrev = fNext.prev;\n\t\t\tfNew.prev = fPrev;\n\t\t\tfPrev.next = fNew;\n\t\t\tfNew.next = fNext;\n\t\t\tfNext.prev = fNew;\n\n\t\t\tfNew.anEdge = eOrig;\n\t\t\tfNew.trail = null;\n\t\t\tfNew.marked = false;\n\n\t\t\t/* The new face is marked \"inside\" if the old one was. This is a\n\t\t\t* convenience for the common case where a face has been split in two.\n\t\t\t*/\n\t\t\tfNew.inside = fNext.inside;\n\n\t\t\t/* fix other edges on this face loop */\n\t\t\tvar e = eOrig;\n\t\t\tdo {\n\t\t\t\te.Lface = fNew;\n\t\t\t\te = e.Lnext;\n\t\t\t} while(e !== eOrig);\n\t\t},\n\n\t\t/* KillEdge( eDel ) destroys an edge (the half-edges eDel and eDel->Sym),\n\t\t* and removes from the global edge list.\n\t\t*/\n\t\t//static void KillEdge( TESSmesh *mesh, TESShalfEdge *eDel )\n\t\tkillEdge_: function(eDel) {\n\t\t\t/* Half-edges are allocated in pairs, see EdgePair above */\n\t\t\tif( eDel.Sym.side < eDel.side ) { eDel = eDel.Sym; }\n\n\t\t\t/* delete from circular doubly-linked list */\n\t\t\tvar eNext = eDel.next;\n\t\t\tvar ePrev = eDel.Sym.next;\n\t\t\teNext.Sym.next = ePrev;\n\t\t\tePrev.Sym.next = eNext;\n\t\t},\n\n\n\t\t/* KillVertex( vDel ) destroys a vertex and removes it from the global\n\t\t* vertex list. It updates the vertex loop to point to a given new vertex.\n\t\t*/\n\t\t//static void KillVertex( TESSmesh *mesh, TESSvertex *vDel, TESSvertex *newOrg )\n\t\tkillVertex_: function(vDel, newOrg) {\n\t\t\tvar eStart = vDel.anEdge;\n\t\t\t/* change the origin of all affected edges */\n\t\t\tvar e = eStart;\n\t\t\tdo {\n\t\t\t\te.Org = newOrg;\n\t\t\t\te = e.Onext;\n\t\t\t} while(e !== eStart);\n\n\t\t\t/* delete from circular doubly-linked list */\n\t\t\tvar vPrev = vDel.prev;\n\t\t\tvar vNext = vDel.next;\n\t\t\tvNext.prev = vPrev;\n\t\t\tvPrev.next = vNext;\n\t\t},\n\n\t\t/* KillFace( fDel ) destroys a face and removes it from the global face\n\t\t* list. It updates the face loop to point to a given new face.\n\t\t*/\n\t\t//static void KillFace( TESSmesh *mesh, TESSface *fDel, TESSface *newLface )\n\t\tkillFace_: function(fDel, newLface) {\n\t\t\tvar eStart = fDel.anEdge;\n\n\t\t\t/* change the left face of all affected edges */\n\t\t\tvar e = eStart;\n\t\t\tdo {\n\t\t\t\te.Lface = newLface;\n\t\t\t\te = e.Lnext;\n\t\t\t} while(e !== eStart);\n\n\t\t\t/* delete from circular doubly-linked list */\n\t\t\tvar fPrev = fDel.prev;\n\t\t\tvar fNext = fDel.next;\n\t\t\tfNext.prev = fPrev;\n\t\t\tfPrev.next = fNext;\n\t\t},\n\n\t\t/****************** Basic Edge Operations **********************/\n\n\t\t/* tessMeshMakeEdge creates one edge, two vertices, and a loop (face).\n\t\t* The loop consists of the two new half-edges.\n\t\t*/\n\t\t//TESShalfEdge *tessMeshMakeEdge( TESSmesh *mesh )\n\t\tmakeEdge: function() {\n\t\t\tvar newVertex1 = new TESSvertex();\n\t\t\tvar newVertex2 = new TESSvertex();\n\t\t\tvar newFace = new TESSface();\n\t\t\tvar e = this.makeEdge_( this.eHead);\n\t\t\tthis.makeVertex_( newVertex1, e, this.vHead );\n\t\t\tthis.makeVertex_( newVertex2, e.Sym, this.vHead );\n\t\t\tthis.makeFace_( newFace, e, this.fHead );\n\t\t\treturn e;\n\t\t},\n\n\t\t/* tessMeshSplice( eOrg, eDst ) is the basic operation for changing the\n\t\t* mesh connectivity and topology. It changes the mesh so that\n\t\t*\teOrg->Onext <- OLD( eDst->Onext )\n\t\t*\teDst->Onext <- OLD( eOrg->Onext )\n\t\t* where OLD(...) means the value before the meshSplice operation.\n\t\t*\n\t\t* This can have two effects on the vertex structure:\n\t\t* - if eOrg->Org != eDst->Org, the two vertices are merged together\n\t\t* - if eOrg->Org == eDst->Org, the origin is split into two vertices\n\t\t* In both cases, eDst->Org is changed and eOrg->Org is untouched.\n\t\t*\n\t\t* Similarly (and independently) for the face structure,\n\t\t* - if eOrg->Lface == eDst->Lface, one loop is split into two\n\t\t* - if eOrg->Lface != eDst->Lface, two distinct loops are joined into one\n\t\t* In both cases, eDst->Lface is changed and eOrg->Lface is unaffected.\n\t\t*\n\t\t* Some special cases:\n\t\t* If eDst == eOrg, the operation has no effect.\n\t\t* If eDst == eOrg->Lnext, the new face will have a single edge.\n\t\t* If eDst == eOrg->Lprev, the old face will have a single edge.\n\t\t* If eDst == eOrg->Onext, the new vertex will have a single edge.\n\t\t* If eDst == eOrg->Oprev, the old vertex will have a single edge.\n\t\t*/\n\t\t//int tessMeshSplice( TESSmesh* mesh, TESShalfEdge *eOrg, TESShalfEdge *eDst )\n\t\tsplice: function(eOrg, eDst) {\n\t\t\tvar joiningLoops = false;\n\t\t\tvar joiningVertices = false;\n\n\t\t\tif( eOrg === eDst ) return;\n\n\t\t\tif( eDst.Org !== eOrg.Org ) {\n\t\t\t\t/* We are merging two disjoint vertices -- destroy eDst->Org */\n\t\t\t\tjoiningVertices = true;\n\t\t\t\tthis.killVertex_( eDst.Org, eOrg.Org );\n\t\t\t}\n\t\t\tif( eDst.Lface !== eOrg.Lface ) {\n\t\t\t\t/* We are connecting two disjoint loops -- destroy eDst->Lface */\n\t\t\t\tjoiningLoops = true;\n\t\t\t\tthis.killFace_( eDst.Lface, eOrg.Lface );\n\t\t\t}\n\n\t\t\t/* Change the edge structure */\n\t\t\tthis.splice_( eDst, eOrg );\n\n\t\t\tif( ! joiningVertices ) {\n\t\t\t\tvar newVertex = new TESSvertex();\n\n\t\t\t\t/* We split one vertex into two -- the new vertex is eDst->Org.\n\t\t\t\t* Make sure the old vertex points to a valid half-edge.\n\t\t\t\t*/\n\t\t\t\tthis.makeVertex_( newVertex, eDst, eOrg.Org );\n\t\t\t\teOrg.Org.anEdge = eOrg;\n\t\t\t}\n\t\t\tif( ! joiningLoops ) {\n\t\t\t\tvar newFace = new TESSface(); \n\n\t\t\t\t/* We split one loop into two -- the new loop is eDst->Lface.\n\t\t\t\t* Make sure the old face points to a valid half-edge.\n\t\t\t\t*/\n\t\t\t\tthis.makeFace_( newFace, eDst, eOrg.Lface );\n\t\t\t\teOrg.Lface.anEdge = eOrg;\n\t\t\t}\n\t\t},\n\n\t\t/* tessMeshDelete( eDel ) removes the edge eDel. There are several cases:\n\t\t* if (eDel->Lface != eDel->Rface), we join two loops into one; the loop\n\t\t* eDel->Lface is deleted. Otherwise, we are splitting one loop into two;\n\t\t* the newly created loop will contain eDel->Dst. If the deletion of eDel\n\t\t* would create isolated vertices, those are deleted as well.\n\t\t*\n\t\t* This function could be implemented as two calls to tessMeshSplice\n\t\t* plus a few calls to memFree, but this would allocate and delete\n\t\t* unnecessary vertices and faces.\n\t\t*/\n\t\t//int tessMeshDelete( TESSmesh *mesh, TESShalfEdge *eDel )\n\t\tdelete: function(eDel) {\n\t\t\tvar eDelSym = eDel.Sym;\n\t\t\tvar joiningLoops = false;\n\n\t\t\t/* First step: disconnect the origin vertex eDel->Org. We make all\n\t\t\t* changes to get a consistent mesh in this \"intermediate\" state.\n\t\t\t*/\n\t\t\tif( eDel.Lface !== eDel.Rface ) {\n\t\t\t\t/* We are joining two loops into one -- remove the left face */\n\t\t\t\tjoiningLoops = true;\n\t\t\t\tthis.killFace_( eDel.Lface, eDel.Rface );\n\t\t\t}\n\n\t\t\tif( eDel.Onext === eDel ) {\n\t\t\t\tthis.killVertex_( eDel.Org, null );\n\t\t\t} else {\n\t\t\t\t/* Make sure that eDel->Org and eDel->Rface point to valid half-edges */\n\t\t\t\teDel.Rface.anEdge = eDel.Oprev;\n\t\t\t\teDel.Org.anEdge = eDel.Onext;\n\n\t\t\t\tthis.splice_( eDel, eDel.Oprev );\n\t\t\t\tif( ! joiningLoops ) {\n\t\t\t\t\tvar newFace = new TESSface();\n\n\t\t\t\t\t/* We are splitting one loop into two -- create a new loop for eDel. */\n\t\t\t\t\tthis.makeFace_( newFace, eDel, eDel.Lface );\n\t\t\t\t}\n\t\t\t}\n\n\t\t\t/* Claim: the mesh is now in a consistent state, except that eDel->Org\n\t\t\t* may have been deleted. Now we disconnect eDel->Dst.\n\t\t\t*/\n\t\t\tif( eDelSym.Onext === eDelSym ) {\n\t\t\t\tthis.killVertex_( eDelSym.Org, null );\n\t\t\t\tthis.killFace_( eDelSym.Lface, null );\n\t\t\t} else {\n\t\t\t\t/* Make sure that eDel->Dst and eDel->Lface point to valid half-edges */\n\t\t\t\teDel.Lface.anEdge = eDelSym.Oprev;\n\t\t\t\teDelSym.Org.anEdge = eDelSym.Onext;\n\t\t\t\tthis.splice_( eDelSym, eDelSym.Oprev );\n\t\t\t}\n\n\t\t\t/* Any isolated vertices or faces have already been freed. */\n\t\t\tthis.killEdge_( eDel );\n\t\t},\n\n\t\t/******************** Other Edge Operations **********************/\n\n\t\t/* All these routines can be implemented with the basic edge\n\t\t* operations above. They are provided for convenience and efficiency.\n\t\t*/\n\n\n\t\t/* tessMeshAddEdgeVertex( eOrg ) creates a new edge eNew such that\n\t\t* eNew == eOrg->Lnext, and eNew->Dst is a newly created vertex.\n\t\t* eOrg and eNew will have the same left face.\n\t\t*/\n\t\t// TESShalfEdge *tessMeshAddEdgeVertex( TESSmesh *mesh, TESShalfEdge *eOrg );\n\t\taddEdgeVertex: function(eOrg) {\n\t\t\tvar eNew = this.makeEdge_( eOrg );\n\t\t\tvar eNewSym = eNew.Sym;\n\n\t\t\t/* Connect the new edge appropriately */\n\t\t\tthis.splice_( eNew, eOrg.Lnext );\n\n\t\t\t/* Set the vertex and face information */\n\t\t\teNew.Org = eOrg.Dst;\n\n\t\t\tvar newVertex = new TESSvertex();\n\t\t\tthis.makeVertex_( newVertex, eNewSym, eNew.Org );\n\n\t\t\teNew.Lface = eNewSym.Lface = eOrg.Lface;\n\n\t\t\treturn eNew;\n\t\t},\n\n\n\t\t/* tessMeshSplitEdge( eOrg ) splits eOrg into two edges eOrg and eNew,\n\t\t* such that eNew == eOrg->Lnext. The new vertex is eOrg->Dst == eNew->Org.\n\t\t* eOrg and eNew will have the same left face.\n\t\t*/\n\t\t// TESShalfEdge *tessMeshSplitEdge( TESSmesh *mesh, TESShalfEdge *eOrg );\n\t\tsplitEdge: function(eOrg, eDst) {\n\t\t\tvar tempHalfEdge = this.addEdgeVertex( eOrg );\n\t\t\tvar eNew = tempHalfEdge.Sym;\n\n\t\t\t/* Disconnect eOrg from eOrg->Dst and connect it to eNew->Org */\n\t\t\tthis.splice_( eOrg.Sym, eOrg.Sym.Oprev );\n\t\t\tthis.splice_( eOrg.Sym, eNew );\n\n\t\t\t/* Set the vertex and face information */\n\t\t\teOrg.Dst = eNew.Org;\n\t\t\teNew.Dst.anEdge = eNew.Sym;\t/* may have pointed to eOrg->Sym */\n\t\t\teNew.Rface = eOrg.Rface;\n\t\t\teNew.winding = eOrg.winding;\t/* copy old winding information */\n\t\t\teNew.Sym.winding = eOrg.Sym.winding;\n\n\t\t\treturn eNew;\n\t\t},\n\n\n\t\t/* tessMeshConnect( eOrg, eDst ) creates a new edge from eOrg->Dst\n\t\t* to eDst->Org, and returns the corresponding half-edge eNew.\n\t\t* If eOrg->Lface == eDst->Lface, this splits one loop into two,\n\t\t* and the newly created loop is eNew->Lface. Otherwise, two disjoint\n\t\t* loops are merged into one, and the loop eDst->Lface is destroyed.\n\t\t*\n\t\t* If (eOrg == eDst), the new face will have only two edges.\n\t\t* If (eOrg->Lnext == eDst), the old face is reduced to a single edge.\n\t\t* If (eOrg->Lnext->Lnext == eDst), the old face is reduced to two edges.\n\t\t*/\n\n\t\t// TESShalfEdge *tessMeshConnect( TESSmesh *mesh, TESShalfEdge *eOrg, TESShalfEdge *eDst );\n\t\tconnect: function(eOrg, eDst) {\n\t\t\tvar joiningLoops = false; \n\t\t\tvar eNew = this.makeEdge_( eOrg );\n\t\t\tvar eNewSym = eNew.Sym;\n\n\t\t\tif( eDst.Lface !== eOrg.Lface ) {\n\t\t\t\t/* We are connecting two disjoint loops -- destroy eDst->Lface */\n\t\t\t\tjoiningLoops = true;\n\t\t\t\tthis.killFace_( eDst.Lface, eOrg.Lface );\n\t\t\t}\n\n\t\t\t/* Connect the new edge appropriately */\n\t\t\tthis.splice_( eNew, eOrg.Lnext );\n\t\t\tthis.splice_( eNewSym, eDst );\n\n\t\t\t/* Set the vertex and face information */\n\t\t\teNew.Org = eOrg.Dst;\n\t\t\teNewSym.Org = eDst.Org;\n\t\t\teNew.Lface = eNewSym.Lface = eOrg.Lface;\n\n\t\t\t/* Make sure the old face points to a valid half-edge */\n\t\t\teOrg.Lface.anEdge = eNewSym;\n\n\t\t\tif( ! joiningLoops ) {\n\t\t\t\tvar newFace = new TESSface();\n\t\t\t\t/* We split one loop into two -- the new loop is eNew->Lface */\n\t\t\t\tthis.makeFace_( newFace, eNew, eOrg.Lface );\n\t\t\t}\n\t\t\treturn eNew;\n\t\t},\n\n\t\t/* tessMeshZapFace( fZap ) destroys a face and removes it from the\n\t\t* global face list. All edges of fZap will have a NULL pointer as their\n\t\t* left face. Any edges which also have a NULL pointer as their right face\n\t\t* are deleted entirely (along with any isolated vertices this produces).\n\t\t* An entire mesh can be deleted by zapping its faces, one at a time,\n\t\t* in any order. Zapped faces cannot be used in further mesh operations!\n\t\t*/\n\t\tzapFace: function( fZap )\n\t\t{\n\t\t\tvar eStart = fZap.anEdge;\n\t\t\tvar e, eNext, eSym;\n\t\t\tvar fPrev, fNext;\n\n\t\t\t/* walk around face, deleting edges whose right face is also NULL */\n\t\t\teNext = eStart.Lnext;\n\t\t\tdo {\n\t\t\t\te = eNext;\n\t\t\t\teNext = e.Lnext;\n\n\t\t\t\te.Lface = null;\n\t\t\t\tif( e.Rface === null ) {\n\t\t\t\t\t/* delete the edge -- see TESSmeshDelete above */\n\n\t\t\t\t\tif( e.Onext === e ) {\n\t\t\t\t\t\tthis.killVertex_( e.Org, null );\n\t\t\t\t\t} else {\n\t\t\t\t\t\t/* Make sure that e->Org points to a valid half-edge */\n\t\t\t\t\t\te.Org.anEdge = e.Onext;\n\t\t\t\t\t\tthis.splice_( e, e.Oprev );\n\t\t\t\t\t}\n\t\t\t\t\teSym = e.Sym;\n\t\t\t\t\tif( eSym.Onext === eSym ) {\n\t\t\t\t\t\tthis.killVertex_( eSym.Org, null );\n\t\t\t\t\t} else {\n\t\t\t\t\t\t/* Make sure that eSym->Org points to a valid half-edge */\n\t\t\t\t\t\teSym.Org.anEdge = eSym.Onext;\n\t\t\t\t\t\tthis.splice_( eSym, eSym.Oprev );\n\t\t\t\t\t}\n\t\t\t\t\tthis.killEdge_( e );\n\t\t\t\t}\n\t\t\t} while( e != eStart );\n\n\t\t\t/* delete from circular doubly-linked list */\n\t\t\tfPrev = fZap.prev;\n\t\t\tfNext = fZap.next;\n\t\t\tfNext.prev = fPrev;\n\t\t\tfPrev.next = fNext;\n\t\t},\n\n\t\tcountFaceVerts_: function(f) {\n\t\t\tvar eCur = f.anEdge;\n\t\t\tvar n = 0;\n\t\t\tdo\n\t\t\t{\n\t\t\t\tn++;\n\t\t\t\teCur = eCur.Lnext;\n\t\t\t}\n\t\t\twhile (eCur !== f.anEdge);\n\t\t\treturn n;\n\t\t},\n\n\t\t//int tessMeshMergeConvexFaces( TESSmesh *mesh, int maxVertsPerFace )\n\t\tmergeConvexFaces: function(maxVertsPerFace) {\n\t\t\tvar f;\n\t\t\tvar eCur, eNext, eSym;\n\t\t\tvar vStart;\n\t\t\tvar curNv, symNv;\n\n\t\t\tfor( f = this.fHead.next; f !== this.fHead; f = f.next )\n\t\t\t{\n\t\t\t\t// Skip faces which are outside the result.\n\t\t\t\tif( !f.inside )\n\t\t\t\t\tcontinue;\n\n\t\t\t\teCur = f.anEdge;\n\t\t\t\tvStart = eCur.Org;\n\t\t\t\t\t\n\t\t\t\twhile (true)\n\t\t\t\t{\n\t\t\t\t\teNext = eCur.Lnext;\n\t\t\t\t\teSym = eCur.Sym;\n\n\t\t\t\t\t// Try to merge if the neighbour face is valid.\n\t\t\t\t\tif( eSym && eSym.Lface && eSym.Lface.inside )\n\t\t\t\t\t{\n\t\t\t\t\t\t// Try to merge the neighbour faces if the resulting polygons\n\t\t\t\t\t\t// does not exceed maximum number of vertices.\n\t\t\t\t\t\tcurNv = this.countFaceVerts_( f );\n\t\t\t\t\t\tsymNv = this.countFaceVerts_( eSym.Lface );\n\t\t\t\t\t\tif( (curNv+symNv-2) <= maxVertsPerFace )\n\t\t\t\t\t\t{\n\t\t\t\t\t\t\t// Merge if the resulting poly is convex.\n\t\t\t\t\t\t\tif( Geom.vertCCW( eCur.Lprev.Org, eCur.Org, eSym.Lnext.Lnext.Org ) &&\n\t\t\t\t\t\t\t\tGeom.vertCCW( eSym.Lprev.Org, eSym.Org, eCur.Lnext.Lnext.Org ) )\n\t\t\t\t\t\t\t{\n\t\t\t\t\t\t\t\teNext = eSym.Lnext;\n\t\t\t\t\t\t\t\tthis.delete( eSym );\n\t\t\t\t\t\t\t\teCur = null;\n\t\t\t\t\t\t\t\teSym = null;\n\t\t\t\t\t\t\t}\n\t\t\t\t\t\t}\n\t\t\t\t\t}\n\t\t\t\t\t\n\t\t\t\t\tif( eCur && eCur.Lnext.Org === vStart )\n\t\t\t\t\t\tbreak;\n\t\t\t\t\t\t\n\t\t\t\t\t// Continue to next edge.\n\t\t\t\t\teCur = eNext;\n\t\t\t\t}\n\t\t\t}\n\t\t\t\n\t\t\treturn true;\n\t\t},\n\n\t\t/* tessMeshCheckMesh( mesh ) checks a mesh for self-consistency.\n\t\t*/\n\t\tcheck: function() {\n\t\t\tvar fHead = this.fHead;\n\t\t\tvar vHead = this.vHead;\n\t\t\tvar eHead = this.eHead;\n\t\t\tvar f, fPrev, v, vPrev, e, ePrev;\n\n\t\t\tfPrev = fHead;\n\t\t\tfor( fPrev = fHead ; (f = fPrev.next) !== fHead; fPrev = f) {\n\t\t\t\tassert( f.prev === fPrev );\n\t\t\t\te = f.anEdge;\n\t\t\t\tdo {\n\t\t\t\t\tassert( e.Sym !== e );\n\t\t\t\t\tassert( e.Sym.Sym === e );\n\t\t\t\t\tassert( e.Lnext.Onext.Sym === e );\n\t\t\t\t\tassert( e.Onext.Sym.Lnext === e );\n\t\t\t\t\tassert( e.Lface === f );\n\t\t\t\t\te = e.Lnext;\n\t\t\t\t} while( e !== f.anEdge );\n\t\t\t}\n\t\t\tassert( f.prev === fPrev && f.anEdge === null );\n\n\t\t\tvPrev = vHead;\n\t\t\tfor( vPrev = vHead ; (v = vPrev.next) !== vHead; vPrev = v) {\n\t\t\t\tassert( v.prev === vPrev );\n\t\t\t\te = v.anEdge;\n\t\t\t\tdo {\n\t\t\t\t\tassert( e.Sym !== e );\n\t\t\t\t\tassert( e.Sym.Sym === e );\n\t\t\t\t\tassert( e.Lnext.Onext.Sym === e );\n\t\t\t\t\tassert( e.Onext.Sym.Lnext === e );\n\t\t\t\t\tassert( e.Org === v );\n\t\t\t\t\te = e.Onext;\n\t\t\t\t} while( e !== v.anEdge );\n\t\t\t}\n\t\t\tassert( v.prev === vPrev && v.anEdge === null );\n\n\t\t\tePrev = eHead;\n\t\t\tfor( ePrev = eHead ; (e = ePrev.next) !== eHead; ePrev = e) {\n\t\t\t\tassert( e.Sym.next === ePrev.Sym );\n\t\t\t\tassert( e.Sym !== e );\n\t\t\t\tassert( e.Sym.Sym === e );\n\t\t\t\tassert( e.Org !== null );\n\t\t\t\tassert( e.Dst !== null );\n\t\t\t\tassert( e.Lnext.Onext.Sym === e );\n\t\t\t\tassert( e.Onext.Sym.Lnext === e );\n\t\t\t}\n\t\t\tassert( e.Sym.next === ePrev.Sym\n\t\t\t\t&& e.Sym === this.eHeadSym\n\t\t\t\t&& e.Sym.Sym === e\n\t\t\t\t&& e.Org === null && e.Dst === null\n\t\t\t\t&& e.Lface === null && e.Rface === null );\n\t\t}\n\n\t};\n\n\tvar Geom = {};\n\n\tGeom.vertEq = function(u,v) {\n\t\treturn (u.s === v.s && u.t === v.t);\n\t};\n\n\t/* Returns TRUE if u is lexicographically <= v. */\n\tGeom.vertLeq = function(u,v) {\n\t\treturn ((u.s < v.s) || (u.s === v.s && u.t <= v.t));\n\t};\n\n\t/* Versions of VertLeq, EdgeSign, EdgeEval with s and t transposed. */\n\tGeom.transLeq = function(u,v) {\n\t\treturn ((u.t < v.t) || (u.t === v.t && u.s <= v.s));\n\t};\n\n\tGeom.edgeGoesLeft = function(e) {\n\t\treturn Geom.vertLeq( e.Dst, e.Org );\n\t};\n\n\tGeom.edgeGoesRight = function(e) {\n\t\treturn Geom.vertLeq( e.Org, e.Dst );\n\t};\n\n\tGeom.vertL1dist = function(u,v) {\n\t\treturn (Math.abs(u.s - v.s) + Math.abs(u.t - v.t));\n\t};\n\n\t//TESSreal tesedgeEval( TESSvertex *u, TESSvertex *v, TESSvertex *w )\n\tGeom.edgeEval = function( u, v, w ) {\n\t\t/* Given three vertices u,v,w such that VertLeq(u,v) && VertLeq(v,w),\n\t\t* evaluates the t-coord of the edge uw at the s-coord of the vertex v.\n\t\t* Returns v->t - (uw)(v->s), ie. the signed distance from uw to v.\n\t\t* If uw is vertical (and thus passes thru v), the result is zero.\n\t\t*\n\t\t* The calculation is extremely accurate and stable, even when v\n\t\t* is very close to u or w. In particular if we set v->t = 0 and\n\t\t* let r be the negated result (this evaluates (uw)(v->s)), then\n\t\t* r is guaranteed to satisfy MIN(u->t,w->t) <= r <= MAX(u->t,w->t).\n\t\t*/\n\t\tassert( Geom.vertLeq( u, v ) && Geom.vertLeq( v, w ));\n\n\t\tvar gapL = v.s - u.s;\n\t\tvar gapR = w.s - v.s;\n\n\t\tif( gapL + gapR > 0.0 ) {\n\t\t\tif( gapL < gapR ) {\n\t\t\t\treturn (v.t - u.t) + (u.t - w.t) * (gapL / (gapL + gapR));\n\t\t\t} else {\n\t\t\t\treturn (v.t - w.t) + (w.t - u.t) * (gapR / (gapL + gapR));\n\t\t\t}\n\t\t}\n\t\t/* vertical line */\n\t\treturn 0.0;\n\t};\n\n\t//TESSreal tesedgeSign( TESSvertex *u, TESSvertex *v, TESSvertex *w )\n\tGeom.edgeSign = function( u, v, w ) {\n\t\t/* Returns a number whose sign matches EdgeEval(u,v,w) but which\n\t\t* is cheaper to evaluate. Returns > 0, == 0 , or < 0\n\t\t* as v is above, on, or below the edge uw.\n\t\t*/\n\t\tassert( Geom.vertLeq( u, v ) && Geom.vertLeq( v, w ));\n\n\t\tvar gapL = v.s - u.s;\n\t\tvar gapR = w.s - v.s;\n\n\t\tif( gapL + gapR > 0.0 ) {\n\t\t\treturn (v.t - w.t) * gapL + (v.t - u.t) * gapR;\n\t\t}\n\t\t/* vertical line */\n\t\treturn 0.0;\n\t};\n\n\n\t/***********************************************************************\n\t* Define versions of EdgeSign, EdgeEval with s and t transposed.\n\t*/\n\n\t//TESSreal testransEval( TESSvertex *u, TESSvertex *v, TESSvertex *w )\n\tGeom.transEval = function( u, v, w ) {\n\t\t/* Given three vertices u,v,w such that TransLeq(u,v) && TransLeq(v,w),\n\t\t* evaluates the t-coord of the edge uw at the s-coord of the vertex v.\n\t\t* Returns v->s - (uw)(v->t), ie. the signed distance from uw to v.\n\t\t* If uw is vertical (and thus passes thru v), the result is zero.\n\t\t*\n\t\t* The calculation is extremely accurate and stable, even when v\n\t\t* is very close to u or w. In particular if we set v->s = 0 and\n\t\t* let r be the negated result (this evaluates (uw)(v->t)), then\n\t\t* r is guaranteed to satisfy MIN(u->s,w->s) <= r <= MAX(u->s,w->s).\n\t\t*/\n\t\tassert( Geom.transLeq( u, v ) && Geom.transLeq( v, w ));\n\n\t\tvar gapL = v.t - u.t;\n\t\tvar gapR = w.t - v.t;\n\n\t\tif( gapL + gapR > 0.0 ) {\n\t\t\tif( gapL < gapR ) {\n\t\t\t\treturn (v.s - u.s) + (u.s - w.s) * (gapL / (gapL + gapR));\n\t\t\t} else {\n\t\t\t\treturn (v.s - w.s) + (w.s - u.s) * (gapR / (gapL + gapR));\n\t\t\t}\n\t\t}\n\t\t/* vertical line */\n\t\treturn 0.0;\n\t};\n\n\t//TESSreal testransSign( TESSvertex *u, TESSvertex *v, TESSvertex *w )\n\tGeom.transSign = function( u, v, w ) {\n\t\t/* Returns a number whose sign matches TransEval(u,v,w) but which\n\t\t* is cheaper to evaluate. Returns > 0, == 0 , or < 0\n\t\t* as v is above, on, or below the edge uw.\n\t\t*/\n\t\tassert( Geom.transLeq( u, v ) && Geom.transLeq( v, w ));\n\n\t\tvar gapL = v.t - u.t;\n\t\tvar gapR = w.t - v.t;\n\n\t\tif( gapL + gapR > 0.0 ) {\n\t\t\treturn (v.s - w.s) * gapL + (v.s - u.s) * gapR;\n\t\t}\n\t\t/* vertical line */\n\t\treturn 0.0;\n\t};\n\n\n\t//int tesvertCCW( TESSvertex *u, TESSvertex *v, TESSvertex *w )\n\tGeom.vertCCW = function( u, v, w ) {\n\t\t/* For almost-degenerate situations, the results are not reliable.\n\t\t* Unless the floating-point arithmetic can be performed without\n\t\t* rounding errors, *any* implementation will give incorrect results\n\t\t* on some degenerate inputs, so the client must have some way to\n\t\t* handle this situation.\n\t\t*/\n\t\treturn (u.s*(v.t - w.t) + v.s*(w.t - u.t) + w.s*(u.t - v.t)) >= 0.0;\n\t};\n\n\t/* Given parameters a,x,b,y returns the value (b*x+a*y)/(a+b),\n\t* or (x+y)/2 if a==b==0. It requires that a,b >= 0, and enforces\n\t* this in the rare case that one argument is slightly negative.\n\t* The implementation is extremely stable numerically.\n\t* In particular it guarantees that the result r satisfies\n\t* MIN(x,y) <= r <= MAX(x,y), and the results are very accurate\n\t* even when a and b differ greatly in magnitude.\n\t*/\n\tGeom.interpolate = function(a,x,b,y) {\n\t\treturn (a = (a < 0) ? 0 : a, b = (b < 0) ? 0 : b, ((a <= b) ? ((b == 0) ? ((x+y) / 2) : (x + (y-x) * (a/(a+b)))) : (y + (x-y) * (b/(a+b)))));\n\t};\n\n\t/*\n\t#ifndef FOR_TRITE_TEST_PROGRAM\n\t#define Interpolate(a,x,b,y)\tRealInterpolate(a,x,b,y)\n\t#else\n\n\t// Claim: the ONLY property the sweep algorithm relies on is that\n\t// MIN(x,y) <= r <= MAX(x,y). This is a nasty way to test that.\n\t#include